A	alt
	head	a
	or	a
	syl	A
	pron	<A>
	pos	n.
a's	infl
	head	a
	syl	a's
	pos	n.
	mod	pl.
A's	infl
	head	a
	or	As
	syl	A's
	pos	n.
	mod	pl.
As	infl
	head	a
	or	A's
	syl	As.
	pos	n.
	mod	pl.
a	1.
	or	A
	syl	a
	pron	<A>
	pos	n.
	def	the first letter and first vowel of the modern English alphabet.
a	2.
	or	A
	syl	a
	pron	<A>
	pos	n.
	def	any of several speech sounds represented by this letter, in English as in or
a	3.
	or	A
	syl	a
	pron	<A>
	pos	n.
	def	Also called: {alpha}. the first in a series, esp. the highest grade or mark, as in an examination.
from A to Z	4.
	head	a
	syl	from A to Z.
	def	from start to finish; from beginning to end.
an	infl
	head	a
	syl	{an
	pos	determiner.
a	H1.1.
	syl	a
	pron	<*>, <emphatic> <A>
	pos	determiner.
	usage	%1)}
	def	used preceding a singular countable noun, if the noun is not previously specified or known.
	exam	1	a dog;
	exam	2	a terrible disappointment.
a	H1.2.
	syl	a
	pron	<*>, <emphatic> <A>
	pos	determiner.
	usage	%1)}
	def	used preceding a proper noun to indicate that a person or thing has some of the qualities of the one named.
	exam	1	a Romeo;
	exam	2	a Shylock.
a	H1.3.
	syl	a
	pron	<*>, <emphatic> <A>
	pos	determiner.
	usage	%1)}
	def	used preceding a noun or determiner of quantity.
	exam	1	a cupful;
	exam	2	a dozen eggs;
	exam	3	a great many;
	exam	4	to read a lot.
a	H1.4.
	syl	a
	pron	<*>, <emphatic> <A>
	pos	determiner.
	usage	%1)}
	def	used preceding a noun indicating a concrete or abstract thing capable of being divided.
	exam	1	half a loaf;
	exam	2	a quarter of a minute.
a	H1.5.
	syl	a
	pron	<*>, <emphatic> <A>
	pos	determiner.
	usage	%1)}; preceded by once, twice, several times, etc.
	def	each or every; per.
	exam	1	once a day;
	exam	2	fifty pence a pound.
a	H1.6.
	syl	a
	pron	<*>, <emphatic> <A>
	pos	determiner.
	usage	%1)}
	def	a certain; one.
	exam	1	to change policy at a stroke;
	exam	2	a Mr. Jones called.
a	H1.7.
	syl	a
	pron	<*>, <emphatic> <A>
	pos	determiner.
	usage	%1)}; preceded by not
	def	any at all.
	exam	1	not a hope.
a	H2.0.
	syl	a
	pron	<*>
	pos	vb.
	def	an informal or dialect word for {have}.
	exam	1	they'd a said if they'd known.
a	H3.0.
	syl	a
	pron	<*>
	pos	prep.
	usage	usually linked to the preceding noun
	def	an informal form of {of}.
	exam	1	sorta sad;
	exam	2	a kinda waste.
a	H4.1.
	syl	a
	qual	symbol for:
	def	acceleration.
a	H4.2.
	syl	a
	qual	symbol for:
	def	atto-.
A	1.a.
	syl	A
	qual	symbol for:
	def	a note having a frequency of 440 hertz ({A above middle C}) or this value multiplied or divided by any power of 2; the sixth note of the scale of C major.
A	1.b.
	syl	A
	qual	symbol for:
	def	a key, string, or pipe producing this note.
A	1.c.
	syl	A
	qual	symbol for:
	def	the major or minor key having this note as its tonic.
A	2.
	syl	A
	qual	symbol for:
	def	a human blood type of the ABO group, containing the A antigen.
A	3.
	syl	A
	qual	symbol for:
	usage	in Britain
	def	a major arterial road.
	exam	1	the A3 runs from London to Portsmouth.
A	4.a.
	syl	A
	qual	symbol for:
	def	a film certified for viewing by anyone, but which contains material that some parents may not wish their children to see.
A	4.b.
	syl	A
	qual	symbol for:
	usage	as modifier
	exam	1	an A film.
A	5.
	syl	A
	qual	symbol for:
	def	mass number.
A	6.
	syl	A
	qual	symbol for:; Cards.
	def	ace.
A	7.
	syl	A
	qual	symbol for:
	def	argon (now superseded by {Ar) }.
A	8.
	syl	A
	qual	symbol for:
	def	ampere(s).
A	9.
	syl	A
	qual	symbol for:
	def	Also: {at}. ampere-turn.
A	10.
	syl	A
	qual	symbol for:
	def	absolute (temperature).
A	11.
	syl	A
	qual	symbol for:
	usage	in circuit diagrams
	def	ammeter.
A	12.
	syl	A
	qual	symbol for:
	def	area.
A	13.
	syl	A
	qual	symbol for:
	usage	in combination
	def	atomic.
	exam	1	an A-bomb;
	exam	2	an A-plant.
A	14.
	syl	A
	qual	symbol for:
	usage	international car registration for
	def	Austria.
A	0.
	syl	*%A
	qual	symbol for
	def	angstrom unit.
a	1.
	syl	a.
	qual	abbrev. for:
	def	acre(s) or acreage.
a	2.
	syl	a.
	qual	abbrev. for:
	def	alto.
a	3.
	syl	a.
	qual	abbrev. for:
	def	amateur.
a	4.
	syl	a.
	qual	abbrev. for:
	def	answer.
a	5.
	syl	a.
	qual	abbrev. for:
	def	are(s) (metric measure of land).
A	1.
	syl	A.
	qual	abbrev. for:
	def	acre(s) or acreage.
A	2.
	syl	A.
	qual	abbrev. for:
	def	America(n).
A	3.
	syl	A.
	qual	abbrev. for:
	def	answer.
aa	infl
	head	a'
	or	aw
	syl	aa
	pron	<c:>
	pos	adj.
aw	infl
	head	a'
	or	aa
	syl	aw
	pron	<c:>
	pos	adj.
a'	0.
	syl	a'
	pron	<c:>
	pos	adj.
	qual	Scot.
	def	variant of {all}.
a-	ety	from Greek a-, an- not, without
a-	H2.1.
	syl	a-
	pos	prefix.
	def	on; in; towards.
	exam	1	afoot;
	exam	2	abed;
	exam	3	aground;
	exam	4	aback.
a-	H2.2.
	syl	a-
	pos	prefix.
	qual	Literary or archaic. (used before a present participle
	def	in the act or process of.
	exam	1	come a-running;
	exam	2	go a-hunting.
a-	H2.3.
	syl	a-
	pos	prefix.
	def	in the condition or state of.
	exam	1	afloat;
	exam	2	alive;
	exam	3	asleep.
A-	infl
	head	A
	or	A-one
	syl	A-1
	pron	<1A1w^n>
	pos	adj.
A-one	infl
	head	A
	or	A-
	syl	A-one
	pron	<1A1w^n>
	pos	adj.
A	1.
	syl	A1
	pron	<1A1w^n>
	pos	adj.
	def	in good health; physically fit.
A	2.
	syl	A1
	pron	<1A1w^n>
	pos	adj.
	qual	Informal.
	def	first class; excellent.
A	3.
	syl	A1
	pron	<1A1w^n>
	pos	adj.
	usage	of a vessel
	def	with hull and equipment in first-class condition.
A	0.a.
	syl	A4
	pos	n.
	def	a standard paper size, 297#M210 mm.
A	0.b.
	syl	A4
	pos	as; adj.
	def	.
	exam	1	an A4 book.
A	0.a.
	syl	A5
	pos	n.
	def	a standard paper size (half A4), 210#M148 mm.
A	0.b.
	syl	A5
	pos	as; adj.
	exam	1	A5 notepaper.
aa	ety	Hawaiian
aa	0.
	syl	a:a
	pron	<1a:a:>
	pos	n.
	def	a volcanic rock consisting of angular blocks of lava with a very rough surface.
AA	1.
	syl	AA
	qual	abbrev. for:
	def	Alcoholics Anonymous.
AA	2.
	syl	AA
	qual	abbrev. for:
	def	anti-aircraft.
AA	3.
	syl	AA
	qual	abbrev. for:
	usage	in Britain
	def	Automobile Association. {~}
AA	4.
	syl	AA
	qual	abbrev. for:
	usage	in Britain
	def	a film that may not be publicly shown to a child under fourteen.
AAA	1.
	syl	A.A.A.
	qual	abbrev. for:; Brit.
	def	Amateur Athletic Association.
AAA	2.
	syl	A.A.A.
	qual	abbrev. for:; U.S.
	def	Automobile Association of America.
Aachen	0.
	syl	Aa:chen
	pron	<1a:k*n>, German <1a:$xN>
	pos	n.
	def	a city and spa in West Germany, in North Rhine-Westphalia: the northern capital of Charlemagne's empire. Pop.: 241362 (1974 est.). French name: {Aix-la-Chapelle}.
Alborg	alt
	head	Aalborg
	or	Aalborg
	syl	*%Al+borg
	pron	Danish <1clbcr>
	pos	n.
Aalborg	0.
	or	Alborg
	syl	Aal+borg
	pron	Danish <1clbcr>
	pos	n.
	def	a city and port in Denmark, in N Jutland. Pop.: 154582 (1974 est.).
Aalesund	0.
	syl	Aa:le+sund
	pron	Norwegian <1o:l*2sun>
	pos	n.
	def	a variant spelling of {*%Alesund}.
aalii	ety	Hawaiian
aalii	0.
	syl	aa:li:i
	pron	<a:1lEE>
	pos	n.
	def	a bushy sapindaceous shrub, of Australia, Hawaii, Africa, and tropical America, having small greenish flowers and sticky foliage.
Aalst	0.
	syl	Aalst
	pron	<a:lst>
	pos	n.
	def	the Flemish name for {Alost}.
Alvar	infl
	head	Aalto
	syl	Al:var
	pron	<1alvar>
	pos	n.
Aalto	0.
	syl	Aal:to
	pron	Finnish <1a:ltc>
	pos	n.
	def	1898-1976, Finnish architect and furniture designer, noted particularly for his public and industrial buildings, in which wood is much used. He invented bent plywood furniture (1932).
AAM	0.
	syl	AAM
	qual	abbrev. for
	def	air-to-air missile.
A  M	1.
	syl	A ?& M
	qual	abbrev. for:
	def	Agricultural and Mechanical.
A  M	2.
	syl	A ?& M
	qual	abbrev. for:
	def	Ancient and Modern (hymn book).
A  R	0.
	syl	A ?& R
	qual	abbrev. for
	def	artists and repertoire.
Aarau	0.
	syl	Aar:au
	pron	German <1a:rau>
	pos	n.
	def	a town in N Switzerland, capital of Aargau canton: capital of the Helvetic Republic from 1798 to 1803. Pop.: 16881 (1970).
aardvark	ety	C19: from obsolete Afrikaans, from aarde earth+ varken pig
aardvark	0.
	syl	aard+vark
	pron	<1a:d2va:k>
	pos	n.
	def	a nocturnal mammal, the sole member of its family and order It inhabits the grasslands of Africa, has long ears and snout, and feeds on termites. Also called: {ant bear}.
aardwolf	ety	C19: from Afrikaans, from aarde earth+ wolf wolf
aardwolves	infl
	head	aardwolf
	syl	aard+wolves.
	pos	n.
	mod	pl.
aardwolf	0.
	syl	aard+wolf
	pron	<1a:d2wulf>
	pos	n.
	def	a nocturnal mammal, that inhabits the plains of southern Africa and feeds on termites and insect larvae: family (hyenas), order (carnivores).
Aargau	0.
	syl	Aar+gau
	pron	German <1a:rgau>
	pos	n.
	def	a canton in N Switzerland. Capital: Aarau. Pop.: 433284 (1970). Area: 1404 sq. km (542 sq. miles). French name: {Argovie}.
Arhus	alt
	head	Aarhus
	or	Aarhus
	syl	*%Ar+hus
	pron	Danish <1crhu:s>
	pos	n.
Aarhus	0.
	or	Arhus
	syl	Aar+hus
	pron	Danish <1crhu:s>
	pos	n.
	def	a city and port in Denmark, in E Jutland. Pop.: 187342 (1970).
Aaron	0.
	syl	Aa:ron
	pron	<1e*r*n>
	pos	n.
	qual	Old Testament.
	def	the first high priest of the Israelites, brother of Moses (Exodus 4:14).
Aaronic	1.
	syl	Aa:ron+ic
	pron	<e*1ronik>
	pos	adj.
	def	of or relating to Aaron, his family, or the priestly dynasty initiated by him.
Aaronic	2.
	syl	Aa:ron+ic
	pron	<e*1ronik>
	pos	adj.
	def	of or relating to the Israelite high priesthood.
Aaronic	3.
	syl	Aa:ron+ic
	pron	<e*1ronik>
	pos	adj.
	def	of or relating to the priesthood in general.
Aaronic	4.
	syl	Aa:ron+ic
	pron	<e*1ronik>
	pos	adj.
	qual	Mormon Church.
	def	denoting or relating to the second order of the Mormon priesthood.
Aaron's beard	0.
	syl	Aa:ron's beard
	pos	n.
	def	another name for { {rose of Sharon} (sense 1).
Aaron's rod	1.
	syl	Aa:ron's rod
	pos	n.
	def	the rod used by Aaron in performing a variety of miracles in Egypt. It later blossomed and produced almonds (Numbers 17).
Aaron's rod	2.
	syl	Aa:ron's rod
	pos	n.
	def	a widespread Eurasian scrophulari?!aceous plant, having woolly leaves and tall erect spikes of yellow flowers.
A'asia	0.
	syl	A'asia
	qual	abbrev. for
	def	Australasia.
AB	0.
	syl	AB
	def	a human blood type of the ABO group, containing both the A antigen and the B antigen.
AB	1.
	syl	A.B.
	qual	abbrev. for:
	def	Also: {a.b}. able-bodied seaman.
AB	2.
	syl	A.B.
	qual	abbrev. for:
	usage	in the U.S.
	def	Bachelor of Arts.
Ab	ety	from Hebrew, from Akkadian abu 
Av	alt
	head	Ab
	or	Ab
	syl	Av
	pron	<@v>
	pos	n.
Ab	0.
	or	Av
	syl	Ab
	pron	<@b>
	pos	n.
	def	the eleventh month of the civil year and the fifth of the ecclesiastical year in the Jewish calendar, falling approximately in July and August.
ab-	ety	from Latin ab away from
ab-	H1.0.
	syl	ab-
	pos	prefix.
	def	away from; off; outside of; opposite to.
	exam	1	abnormal;
	exam	2	abaxial;
	exam	3	aboral.
ab-	ety	abstracted from #7absolute 
ab-	H2.0.
	syl	ab-
	pos	prefix.
	def	denoting a cgs unit of measurement in the electromagnetic system.
	exam	1	abvolt.
aba	ety	from Arabic
aba	1.
	syl	ab:a
	pron	<1@b*>
	pos	n.
	def	a type of cloth from Syria, made of goat hair or camel hair.
aba	2.
	syl	ab:a
	pron	<1@b*>
	pos	n.
	def	a sleeveless outer garment of such cloth.
ABA	1.
	syl	A.B.A.
	qual	abbrev. for:
	usage	in Britain
	def	Amateur Boxing Associa?!tion.
ABA	2.
	syl	A.B.A.
	qual	abbrev. for:
	def	American Booksellers Associa?!tion.
abac	ety	C20: from French, from Latin #7abacus 
abac	0.
	syl	a:bac
	pron	<2Ab@k>
	pos	n.
	def	another name for {nomogram}.
abaca	ety	via Spanish from Tagalog abak*'a 
abaca	1.
	syl	ab:a+ca
	pron	<1@b*k*>
	pos	n.
	def	a Philippine plant, related to the banana: family Its leafstalks are the source of Manila hemp.
abaca	2.
	syl	ab:a+ca
	pron	<1@b*k*>
	pos	n.
	def	another name for {Manila hemp}.
aback	ety	Old English on b@ac to the back
aback	1.a.
	syl	a:back
	pron	<*1b@k>
	pos	adv.
	def	startled or disconcerted.
aback	1.b.
	syl	a:back
	pron	<*1b@k>
	pos	adv.
	usage	Nautical. of a vessel or sail
	def	having the wind against the forward side so as to prevent forward motion.
aback	2.
	syl	a:back
	pron	<*1b@k>
	pos	adv.
	qual	Rare.
	def	towards the back; backwards.
abactinal	0.
	syl	ab+ac+ti+nal
	pron	<@b1@ktinL>
	pos	adj.
	usage	Zoology. of organisms showing radial symmetry
	def	situated away from or opposite to the mouth; aboral.
abactinally	sub
	head	abactinal
	syl	ab+1ac+ti+nal+ly
	pos	adv.
abacus	ety	C16: from Latin, from Greek abax board covered with sand for tracing calculations, from Hebrew *_abh*_aq dust
abaci	infl
	head	abacus
	or	abacuses
	syl	ab:a+ci
	pron	<-2sI>
	pos	n.
	mod	pl.
abacuses	infl
	head	abacus
	or	abaci
	syl	ab:a+cus:es.
	pos	n.
	mod	pl.
abacus	1.
	syl	ab:a+cus
	pron	<1@b*k*s>
	pos	n.
	def	a counting device that consists of a frame holding rods on which a specific number of beads are free to move. Each rod designates a given denomination, such as units, tens, hundreds, etc., in the decimal system, and each bead represents a digit or a specific number of digits.
abacus	2.
	syl	ab:a+cus
	pron	<1@b*k*s>
	pos	n.
	qual	Architect.
	def	the flat upper part of the capital of a column.
Abadan	0.
	syl	Ab:a+dan
	pron	<2@b*1da:n>
	pos	n.
	def	a port in SW Iran, on an island in the Shatt-al-Arab delta. Pop.: 312000 (1973 est.).
Abaddon	ety	Hebrew: literally, destruction
Abaddon	1.
	syl	A:bad+don
	pron	<*1b@dN>
	pos	n.
	def	the Devil (Revelation 9:11).
Abaddon	2.
	syl	A:bad+don
	pron	<*1b@dN>
	pos	n.
	usage	in rabbinical literature
	def	a part of Gehenna; Hell.
abaft	ety	C13: on baft; baft from Old English be@aftan, from be by+ @aftan behind
abaft	1.
	syl	a:baft
	pron	<*1ba:ft>
	pos	adv. adj.
	qual	Nautical.
	usage	postpositive
	def	closer to the stern than to another place on a vessel.
	exam	1	with the wind abaft.
abaft	2.
	syl	a:baft
	pron	<*1ba:ft>
	pos	prep.
	qual	Nautical.
	def	behind; aft of.
	exam	1	abaft the mast.
Abakan	0.
	syl	A:ba+kan
	pron	Russian <aba1kan>
	pos	n.
	def	a city in the S Soviet Union, capital of the Khakass AR, at the confluence of the Yenisei and Abakan Rivers. Pop.: 116000 (1975 est.).
abalone	ety	C19: from American Spanish abul*'on; origin unknown
abalone	0.
	syl	ab:a+lo+ne
	pron	<2@b*1l*uni>
	pos	n.
	def	any of various edible marine gastropod molluscs of the genus having an ear-shaped shell that is perforated with a row of respiratory holes. The shells are used for ornament or decoration. Also called: {ear shell}. See also {ormer}.
abamp	0.
	syl	ab+amp
	pron	<1@b2@mp>
	pos	n.
	def	short for {abampere}.
abampere	0.
	syl	ab+am+pere
	pron	<@b1ampe*>
	pos	n.
	def	the cgs unit of current in the electromagnetic system; the constant current that, when flowing through two parallel straight infinitely long conductors 1 centimetre apart, will produce a force between them of 2 dynes per centimetre: equivalent to 10 amperes. Abbrev.: {abamp}.
abandon	ety	C14: abandounen (vb.), from Old French, from a bandon under one's control, in one's power, from a at, to+ bandon control, power
abandon	1.
	syl	a:ban+don
	pron	<*1b@nd*n>
	pos	vb.
	mod	tr.
	def	to forsake completely; desert; leave behind.
	exam	1	to abandon a baby;
	exam	2	drivers had to abandon their cars.
abandon	2.
	syl	a:ban+don
	pron	<*1b@nd*n>
	pos	vb.
	mod	tr.
	def	to give up completely.
	exam	1	to abandon a habit;
	exam	2	to abandon hope.
abandon	3.
	syl	a:ban+don
	pron	<*1b@nd*n>
	pos	vb.
	mod	tr.
	def	to yield control of or concern in; relinquish.
	exam	1	to abandon office.
abandon	4.
	syl	a:ban+don
	pron	<*1b@nd*n>
	pos	vb.
	mod	tr.
	def	to give up (something begun) before completion.
	exam	1	to abandon a job;
	exam	2	the game was abandoned.
abandon	5.
	syl	a:ban+don
	pron	<*1b@nd*n>
	pos	vb.
	mod	tr.
	def	to surrender (oneself) to emotion without restraint.
abandon	6.
	syl	a:ban+don
	pron	<*1b@nd*n>
	pos	vb.
	mod	tr.
	def	to give (insured property that has suffered partial loss or damage) to the insurers in order that a claim for a total loss may be made. {~}
abandon	7.
	syl	a:ban+don
	pron	<*1b@nd*n>
	pos	vb.
	mod	tr.
	def	freedom from inhibitions, restraint, concern, or worry.
	exam	1	she danced with abandon.
abandonment	sub
	head	abandon
	syl	a:1ban+don+ment
	pos	n.
abandoned	1.
	syl	a:ban+doned
	pron	<*1b@nd*nd>
	pos	adj.
	def	deserted.
	exam	1	an abandoned windmill.
abandoned	2.
	syl	a:ban+doned
	pron	<*1b@nd*nd>
	pos	adj.
	def	forsaken.
	exam	1	an abandoned child.
abandoned	3.
	syl	a:ban+doned
	pron	<*1b@nd*nd>
	pos	adj.
	def	unrestrained; uninhibited.
abandonee	0.
	syl	a:ban+don:ee
	pron	<*2b@nd*1nE>
	pos	n.
	qual	Law.
	def	a person to whom something is formally relinquished, esp. an insurer having the right to salvage a wreck.
a bas	0.
	syl	*`a bas
	pron	French. <a 1ba>
	def	down with&!
abase	ety	C15: abessen, from Old French abaissier to make low. See #7base %2
abase	1.
	syl	a:base
	pron	<*1bAs>
	pos	vb.
	mod	tr.
	def	to humble or belittle (oneself, etc.).
abase	2.
	syl	a:base
	pron	<*1bAs>
	pos	vb.
	mod	tr.
	def	to lower or reduce, as in rank or estimation.
abasement	sub
	head	abase
	syl	a:1base+ment
	pos	n.
abash	ety	C14: via Norman French from Old French esbair to be astonished, from es- out+ bair to gape, yawn
abash	0.
	syl	a:bash
	pron	<*1b@S>
	pos	vb.
	mod	tr.
	usage	usually passive
	def	to cause to feel ill at ease, embarrassed, or confused; make ashamed.
abashedly	sub
	head	abash
	syl	a:bash+ed+ly
	pron	<*1b@Sidli>
	pos	adv.
abashment	sub
	head	abash
	syl	a:1bash+ment
	pos	n.
abate	ety	C14: from Old French abatre to beat down, fell
abate	1.
	syl	a:bate
	pron	<*1bAt>
	pos	vb.
	def	to make or become less in amount, intensity, degree, etc..
	exam	1	the storm has abated.
abate	2.a.
	syl	a:bate
	pron	<*1bAt>
	pos	vb.
	def	to remove, suppress, or terminate (a nuisance).
abate	2.b.
	syl	a:bate
	pron	<*1bAt>
	pos	vb.
	def	to suspend or extinguish (a claim or action).
abate	2.c.
	syl	a:bate
	pron	<*1bAt>
	pos	vb.
	def	to annul (a writ).
abate	3.
	syl	a:bate
	pron	<*1bAt>
	pos	vb.
	mod	intr.
	usage	Law. of a writ, legal action, etc.
	def	to become null and void.
abate	4.
	syl	a:bate
	pron	<*1bAt>
	pos	vb.
	mod	tr.
	def	to subtract or deduct, as part of a price.
abatement	1.
	syl	a:bate+ment
	pron	<*1bAtm*nt>
	pos	n.
	def	diminution or alleviation; decrease.
abatement	2.
	syl	a:bate+ment
	pron	<*1bAtm*nt>
	pos	n.
	def	suppression or termination.
	exam	1	the abatement of a nuisance.
abatement	3.
	syl	a:bate+ment
	pron	<*1bAtm*nt>
	pos	n.
	def	the amount by which something is reduced, such as the cost of an article.
abatement	4.
	syl	a:bate+ment
	pron	<*1bAtm*nt>
	pos	n.
	qual	Property law.
	def	a decrease in the payment to legatees when the assets of the estate are insufficient to meet all payments in full.
abatement	5.
	syl	a:bate+ment
	pron	<*1bAtm*nt>
	pos	n.
	usage	Property law. formerly
	def	a wrongful entry on land by a stranger who takes possession after the death of the owner and before the heir has entered into possession.
abatis	ety	C18: from French, from abattre to fell
abattis	alt
	head	abatis
	or	abatis
	syl	ab+at+tis
	pron	<1@b*tis>, <1@b*tE>
	pos	n.
abatis	0.
	or	abattis
	syl	ab:a+tis
	pron	<1@b*tis>, <1@b*tE>
	pos	n.
	qual	Fortifications.
	def	a rampart of felled trees placed with their branches outwards.
abator	0.
	syl	a:ba+tor
	pron	<*1bAt*>
	pos	n.
	qual	Law.
	def	a person who effects an abatement.
A battery	0.
	syl	A bat+ter:y
	pos	n.
	qual	U.S.
	def	a low-voltage battery for supplying power to heat the cathode of a thermionic valve. Compare {B battery, C battery}.
abattoir	ety	C19: French, from abattre to fell
abattoir	0.
	syl	ab+at+toir
	pron	<1@b*2twa:>
	pos	n.
	def	another name for {slaughterhouse}.
abaxial	0.
	syl	ab+ax+i:al
	pron	<@b1@ksi*l>
	pos	adj.
	def	facing away from the axis, as the surface of a leaf. Compare {adaxial}.
Abba	ety	from Aramaic
Abba	1.
	syl	Ab:ba
	pron	<1@b*>
	pos	n.
	qual	New Testament.
	def	father (used of God).
Abba	2.
	syl	Ab:ba
	pron	<1@b*>
	pos	n.
	def	a title given to bishops and patriarchs in the Syrian, Coptic, and Ethiopian Churches.
abbacy	ety	C15: from Church Latin abb*_atia, from abb*_at- #7abbot 
abbacies	infl
	head	abbacy
	syl	ab+ba+cies.
	pos	n.
	mod	pl.
abbacy	0.
	syl	ab+ba+cy
	pron	<1@b*si>
	pos	n.
	def	the office, term of office, or jurisdiction of an abbot or abbess.
Abbasid	0.a.
	syl	Ab:bas:id
	pron	<1@b*2sid>, <*1b@sid>
	pos	n.
	def	any caliph of the dynasty that ruled the Muslim empire from Baghdad (750-1258) and claimed descent from Abbas, uncle of Mohammed.
Abbasid	0.b.
	syl	Ab:bas:id
	pron	<1@b*2sid>, <*1b@sid>
	pos	n.
	usage	as modifier
	exam	1	the Abbasid dynasty.
abbatial	ety	C17: from Church Latin abb*_ati*_alis, from abb*_at- #7abbot ; see -#7al %1
abbatial	0.
	syl	ab+ba+tial
	pron	<*1bAS*l>
	pos	adj.
	def	of or relating to an abbot, abbess, or abbey.
abb'e	1.
	syl	ab:b*'e
	pron	<1@bA>, French <a1bA>
	pos	n.
	def	a French abbot.
abb'e	2.
	syl	ab:b*'e
	pron	<1@bA>, French <a1bA>
	pos	n.
	def	a title used in addressing any other French cleric, such as a priest.
abbess	ety	C13: from Old French, from Church Latin abb*_atissa 
abbess	0.
	syl	ab+bess
	pron	<1@bis>
	pos	n.
	def	the female superior of a convent.
Abbevillian	ety	C20: after Abbeville, France, where the stone tools were discovered
Abbevillian	1.
	syl	Abbe+vill+i:an
	pron	<@b1vili*n>, <-j*n>
	pos	n.
	qual	Archaeol.
	def	the period represented by Lower Palaeolithic European sites containing the earliest hand axes, dating from the Mindel glaciation. See also {Acheulian}.
Abbevillian	2.
	syl	Abbe+vill+i:an
	pron	<@b1vili*n>, <-j*n>
	pos	adj.
	qual	Archaeol.
	def	of or relating to this period.
abbey	ety	C13: via Old French abeie from Church Latin abb*_atia #7abbacy 
abbey	1.
	syl	ab+bey
	pron	<1@bi>
	pos	n.
	def	a building inhabited by a community of monks or nuns governed by an abbot or abbess.
abbey	2.
	syl	ab+bey
	pron	<1@bi>
	pos	n.
	def	a church built in conjunction with such a building.
abbey	3.
	syl	ab+bey
	pron	<1@bi>
	pos	n.
	def	such a community of monks or nuns.
Abbey Theatre	0.
	syl	Ab+bey The:a+tre
	pos	n.
	def	an influential theatre in Dublin (opened 1904): associated with it were Synge, Yeats, Lady Gregory, and O'Casey. It was closed by fire in 1951 and reopened in 1966.
abbot	ety	Old English abbod, from Church Latin abb*_at- (stem of abbas) , ultimately from Aramaic abb*_a A#7bba 
abbot	0.
	syl	ab+bot
	pron	<1@b*t>
	pos	n.
	def	the superior of an abbey of monks.
abbotship	sub
	head	abbot
	or	abbotcy
	syl	ab+bot+2ship
	pos	n.
abbotcy	sub
	head	abbot
	or	abbotship
	syl	ab+bot+cy
	pos	n.
abbr	alt
	head	abbrev
	or	abbrev
	syl	abbr.
abbrev	0.
	or	abbr
	syl	abbrev.
	qual	abbrev. for
	def	abbreviation.
abbreviate	ety	C15: from the past participle of Late Latin abbrevi*_are, from Latin brevis brief
abbreviate	1.
	syl	ab+bre+vi+ate
	pron	<*1brEvi2At>
	pos	vb.
	mod	tr.
	def	to shorten (a word or phrase) by contraction or omission of some letters or words.
abbreviate	2.
	syl	ab+bre+vi+ate
	pron	<*1brEvi2At>
	pos	vb.
	mod	tr.
	def	to shorten (a speech or piece of writing) by omitting sections, paraphrasing, etc.
abbreviate	3.
	syl	ab+bre+vi+ate
	pron	<*1brEvi2At>
	pos	vb.
	mod	tr.
	def	to cut short; curtail.
abbreviator	sub
	head	abbreviate
	syl	ab+1bre+vi:2a+tor
	pos	n.
abbreviation	1.
	syl	ab+bre+vi:a+tion
	pron	<*2brEvi1AS*n>
	pos	n.
	def	a shortened or contracted form of a word or phrase used in place of the whole.
abbreviation	2.
	syl	ab+bre+vi:a+tion
	pron	<*2brEvi1AS*n>
	pos	n.
	def	the process or result of abbreviating.
ABC	H1.1.
	syl	ABC
	pos	n.
	mod	often; pl.
	qual	U.S.
	usage	in
	def	the alphabet.
ABC	H1.2.
	syl	ABC
	pos	n.
	mod	pl.
	qual	U.S.
	usage	in
	def	the rudiments of a subject.
ABC	H1.3.
	syl	ABC
	pos	n.
	def	an alphabetical guide to a subject.
ABC	H2.1.
	syl	ABC
	qual	abbrev. for:
	usage	of weapons or warfare
	def	atomic, biological, and chemical.
ABC	H2.2.
	syl	ABC
	qual	abbrev. for:
	def	Australian Broadcasting Commission.
ABC	H2.3.
	syl	ABC
	qual	abbrev. for:
	def	American Broadcasting Company.
abcoulomb	0.
	syl	ab+cou+lomb
	pron	<@b1ku:lom>
	pos	n.
	def	the cgs unit of electric charge in the electromagnetic system; the charge per second passing any cross section of a conductor through which a steady current of 1 abampere is flowing: equivalent to 10 coulombs.
Abd-el-Krim	0.
	syl	Abd-el-Krim
	pron	<2@bdel1krim>
	pos	n.
	def	1882-1963, Moroccan chief who led revolts against Spain and France, surrendered before their combined forces in 1926, but later formed the North African independence movement.
Abdias	0.
	syl	Ab:di:as
	pron	<@b1dI*s>
	pos	n.
	qual	Bible.
	def	the Douay form of {Obadiah}.
abdicate	ety	C16: from the past participle of Latin abdic*_are to proclaim away, disclaim
abdicate	0.
	syl	ab+di+cate
	pron	<1@bdi2kAt>
	pos	vb.
	def	to renounce (a throne, power, responsibility, rights, etc.), esp. formally.
abdicable	sub
	head	abdicate
	syl	ab+di+ca:ble
	pron	<1@bdik*bL>
	pos	adj.
abdication	sub
	head	abdicate
	syl	ab+di+1ca+tion
	pos	n.
abdicative	sub
	head	abdicate
	syl	ab+dic:a+tive
	pron	<@b1dik*tiv>
	pos	adj.
abdicator	sub
	head	abdicate
	syl	ab+di+2ca+tor
	pos	n.
abdomen	ety	C16: from Latin; origin obscure
abdomen	1.
	syl	ab+do+men
	pron	<1@bd*m*n>, <@b1d*u->
	pos	n.
	def	the region of the body of a vertebrate that contains the viscera other than the heart and lungs. In mammals it is separated from the thorax by the diaphragm.
abdomen	2.
	syl	ab+do+men
	pron	<1@bd*m*n>, <@b1d*u->
	pos	n.
	def	the front or surface of this region; belly.
abdomen	3.
	syl	ab+do+men
	pron	<1@bd*m*n>, <@b1d*u->
	pos	n.
	usage	in arthropods
	def	the posterior part of the body behind the thorax, consisting of up to ten similar segments.
abdominal	sub
	head	abdomen
	syl	ab+dom:i+nal
	pron	<@b1dominL>
	pos	adj.
abdominally	sub
	head	abdomen
	syl	ab+1dom:i+nal+ly
	pos	adv.
abdominous	0.
	syl	ab+dom:i+nous
	pron	<@b1domin*s>
	pos	adj.
	qual	Rare.
	def	having a large belly.
abducens nerve	ety	see #7abducent 
abducens nerve	0.
	syl	ab+du+cens nerve
	pron	<@b1dju:s*nz>
	pos	n.
	def	either of the sixth pair of cranial nerves, which supply the lateral rectus muscle of the eye.
abducent	ety	C18: from Latin abd*_ucent-, abd*_ucens leading away, from abd*_ucere, from ab- away+ d*_ucere to lead, carry
abducent	0.
	syl	ab+du+cent
	pron	<@b1dju:sNt>
	pos	adj.
	usage	of a muscle
	def	abducting.
abduct	ety	C19: from the past participle of Latin abd*_ucere to lead away
abduct	1.
	syl	ab+duct
	pron	<@b1d^kt>
	pos	vb.
	mod	tr.
	def	to remove (a person) by force or cunning; kidnap.
abduct	2.
	syl	ab+duct
	pron	<@b1d^kt>
	pos	vb.
	mod	tr.
	usage	of certain muscles
	def	to pull away (a leg, arm, etc.) from the median axis of the body. Compare {adduct}.
abduction	sub
	head	abduct
	syl	ab+1duc+tion
	pos	n.
Abdul-Hamid II	0.
	syl	Ab:dul-Ha:mid II
	pron	<1@bdul> <1h@mid>
	pos	n.
	def	1842-1918, sultan of Turkey (1876-1909), deposed by the Young Turks, noted for his brutal suppression of the Armenian revolt (1894-96).
abeam	ety	C19: {#7a -%2}#7+beam
abeam	0.
	syl	a:beam
	pron	<*1bEm>
	pos	adv. adj.
	usage	postpositive
	def	at right angles to the length and directly opposite the centre of a vessel or aircraft.
abecedarian	ety	C17: from Late Latin abecedarius, from the letters a, b, c, d 
abecedarian	1.
	syl	a:be:ce+dar+i:an
	pron	<2AbEsE1de*ri*n>
	pos	n.
	def	a person who is learning the alphabet or the rudiments of a subject. {~}
abecedarian	2.
	syl	a:be:ce+dar+i:an
	pron	<2AbEsE1de*ri*n>
	pos	n.
	def	alphabetically arranged.
abed	0.
	syl	a:bed
	pron	<*1bed>
	pos	adv.
	qual	Archaic.
	def	in bed.
Abednego	0.
	syl	A:bed:ne:go
	pron	<*1bedni2g*u>
	pos	n.
	qual	Old Testament.
	def	one of Daniel's three companions who, together with Shadrach and Meshach, was miraculously saved from destruction in Nebuchadnezzar's fiery furnace (Daniel 3:12-30).
Abel	0.
	syl	A:bel
	pron	<1AbL>
	pos	n.
	def	the second son of Adam and Eve, a shepherd, murdered by his brother Cain (Genesis 4:1-8).
Peter	infl
	head	Abelard
	syl	Pe:ter.
	pos	n.
Abelard	0.
	syl	Ab:e:lard
	pron	<1@b*2la:d>
	pos	n.
	def	French name 1079-1142, French scholastic philosopher and theologian whose works include and (1121). His love for Heloise is recorded in their correspondence.
abele	ety	C16: from Dutch abeel, ultimately related to Latin albus white
abele	0.
	syl	a:bele
	pron	<*1bEl>, <1AbL>
	pos	n.
	def	another name for {white poplar}.
Abelian group	ety	C19: named after Niels Henrik Abel (1802-29), Norwegian mathematician
Abelian group	0.
	syl	A:be:li:an group
	pron	<*1bEli*n>
	pos	n.
	def	a mathematical group that is commutative: if and are members of an Abelian group then = .
abelmosk	ety	New Latin, from Arabic abu'l misk father of musk
abelmosk	0.
	syl	a:bel+mosk
	pron	<1AbL2mosk>
	pos	n.
	def	a tropical bushy malvaceous plant, cultivated for its yellow-and-crimson flowers and for its musk-scented seeds, which yield an oil used in perfumery. Also called: {musk mallow}.
Abeokuta	0.
	syl	Ab+e:o+ku+ta
	pron	<2@bi*u1ku:t*>
	pos	n.
	def	a town in W Nigeria, capital of Ogun state. Pop.: 253000 (1975 est.).
Aberdare	0.
	syl	Ab+er+dare
	pron	<2@b*1de*>
	pos	n.
	def	a mining town in South Wales, in N Mid Glamorgan. Pop.: 37760 (1971).
Aberdeen	H1.1.
	syl	Ab+er+deen
	pron	<2@b*1dEn>
	pos	n.
	def	a city in NE Scotland, administrative centre of Grampian region on the North Sea: centre for processing North Sea oil and gas; university (1494). Pop.: 209831 (1976 est.).
Aberdeen	H1.2.
	syl	Ab+er+deen
	pron	<2@b*1dEn>
	pos	n.
	usage	until 1975
	def	a county of NE Scotland, now part of Grampian region. &- {Ab+er+do+ni@.an} (@!@ab$$?!#!d$$$un$I$$n)
George Hamilton-Gordon	infl
	head	Aberdeen
	syl	George Ham:il:ton-Gor:don
	pos	n.
Aberdeen	H2.0.
	syl	Ab:er:deen
	pron	<2@b*1dEn>
	pos	n.
	def	4th Earl of. 1784-1860, British statesman. He was foreign secretary under Wellington (1828) and Peel (1841-46); became prime minister of a coalition ministry in 1852 but was compelled to resign after mismanagement of the Crimean War (1855).
Aberdeen Angus	0.
	syl	Ab+er+deen An+gus
	pos	n.
	def	a black hornless breed of beef cattle originating in Scotland.
abernethy	ety	C19: perhaps named after Dr. John Abernethy (1764-1831), English surgeon interested in diet
abernethy	0.
	syl	ab+er+neth:y
	pron	<2@b*1neTi>
	pos	n.
	def	a crisp unleavened biscuit.
aberrant	ety	rare before C19: from the present participle of Latin aberr*_are to wander away
aberrant	1.
	syl	ab+er+rant
	pron	<@1ber*nt>
	pos	adj.
	def	deviating from the normal or usual type, as certain animals from the group in which they are classified.
aberrant	2.
	syl	ab+er+rant
	pron	<@1ber*nt>
	pos	adj.
	def	behaving in an abnormal or untypical way.
aberrant	3.
	syl	ab+er+rant
	pron	<@1ber*nt>
	pos	adj.
	def	deviating from truth, morality, etc.
aberrance	sub
	head	aberrant
	or	aberrancy
	syl	ab+1er+rance
	pos	n.
aberrancy	sub
	head	aberrant
	or	aberrance
	syl	ab+1er+ran+cy
	pos	n.
aberration	1.
	syl	ab+er+ra+tion
	pron	<2@b*1rAS*n>
	pos	n.
	def	deviation from what is normal, expected, or usual.
aberration	2.
	syl	ab+er+ra+tion
	pron	<2@b*1rAS*n>
	pos	n.
	def	departure from truth, morality, etc.
aberration	3.
	syl	ab+er+ra+tion
	pron	<2@b*1rAS*n>
	pos	n.
	def	a lapse in control of one's mental faculties.
aberration	4.
	syl	ab+er+ra+tion
	pron	<2@b*1rAS*n>
	pos	n.
	qual	Optics.
	def	a defect in a lens or mirror that causes the formation of either a distorted image (see {spherical aberration}) or one with coloured fringes (see {chromatic aberration) }.
aberration	5.
	syl	ab+er+ra+tion
	pron	<2@b*1rAS*n>
	pos	n.
	qual	Astronomy.
	def	the apparent displacement of a celestial body due to the motion of the observer with the earth.
Aberystwyth	0.
	syl	Ab+er+yst+wyth
	pron	<2@b*1ristwiT>
	pos	n.
	def	a resort and university town in Wales, on Cardigan Bay. Pop.: 10680 (1971).
abet	ety	C14: from Old French abeter to lure on, entice, from beter to bait
abets	infl
	head	abet
	syl	a:bets
	pos	vb.
	mod	tr.
abetting	infl
	head	abet
	syl	a:bet+ting
	pos	vb.
	mod	tr.
abetted	infl
	head	abet
	syl	a:bet+ted.
	pos	vb.
	mod	tr.
abet	0.
	syl	a:bet
	pron	<*1bet>
	pos	vb.
	mod	tr.
	def	to assist or encourage, esp. in crime or wrongdoing.
abetment	sub
	head	abet
	or	abettal
	syl	a:1bet+ment
	pos	n.
abettal	sub
	head	abet
	or	abetment
	syl	a:1bet+tal
	pos	n.
abettor	sub
	head	abet
	or	abetter
	syl	a:1bet+tor
	pos	n.
abetter	sub
	head	abet
	or	abettor
	syl	a:1bet+ter
	pos	n.
abeyance	ety	C16-17: from Anglo-French, from Old French abeance expectation, literally a gaping after, a reaching towards
abeyance	1.
	syl	a:bey+ance
	pron	<*1bA*ns>
	pos	n.
	usage	usually preceded by in or into
	def	a state of being suspended or put aside temporarily.
abeyance	2.
	syl	a:bey+ance
	pron	<*1bA*ns>
	pos	n.
	qual	Law.
	usage	usually preceded by in
	def	an indeterminate state of ownership, as when the person entitled to an estate has not been ascertained.
abeyant	sub
	head	abeyance
	syl	a:1bey+ant
	pos	adj.
abfarad	0.
	syl	ab+far+ad
	pron	<@b1f@r@d>, <-*d>
	pos	n.
	def	the cgs unit of capacitance in the electromagnetic system; the capacitance of a capacitor having a charge of 1 abcoulomb and a potential difference of 1 abvolt between its conductors: equivalent to 10%9 farads.
abhenries	infl
	head	abhenry
	syl	ab+hen+ries.
	pos	n.
	mod	pl.
abhenry	0.
	syl	ab+hen+ry
	pron	<@b1henri>
	pos	n.
	def	the cgs unit of inductance in the electromagnetic system; the inductance that results when a rate of change of current of 1 abampere per second generates an induced emf of 1 abvolt: equivalent to 10%-%9 henry.
abhor	ety	C15: from Latin abhorr*_ere to shudder at, shrink from, from ab- away from+ horr*_ere to bristle, shudder
abhors	infl
	head	abhor
	syl	ab+hors
	pos	vb.
	mod	tr.
abhorring	infl
	head	abhor
	syl	ab+hor+ring
	pos	vb.
	mod	tr.
abhorred	infl
	head	abhor
	syl	ab+horred.
	pos	vb.
	mod	tr.
abhor	0.
	syl	ab+hor
	pron	<*b1hc:>
	pos	vb.
	mod	tr.
	def	to detest vehemently; find repugnant; reject.
abhorrer	sub
	head	abhor
	syl	ab+1hor+rer
	pos	n.
abhorrence	1.
	syl	ab+hor+rence
	pron	<*b1hor*ns>
	pos	n.
	def	a feeling of extreme loathing or aversion.
abhorrence	2.
	syl	ab+hor+rence
	pron	<*b1hor*ns>
	pos	n.
	def	a person or thing that is loathsome.
abhorrent	1.
	syl	ab+hor+rent
	pron	<*b1hor*nt>
	pos	adj.
	def	repugnant; loathsome.
abhorrent	2.
	syl	ab+hor+rent
	pron	<*b1hor*nt>
	pos	adj.
	usage	when postpositive, foll. by of
	def	feeling extreme aversion or loathing (for).
	exam	1	abhorrent of vulgarity.
abhorrent	3.
	syl	ab+hor+rent
	pron	<*b1hor*nt>
	pos	adj.
	usage	usually postpositive and foll. by to
	def	conflicting (with).
	exam	1	abhorrent to common sense.
abhorrently	sub
	head	abhorrent
	syl	ab+1hor+rent+ly
	pos	adv.
Abib	ety	Hebrew *_abh*_ibh ear of grain, hence the month when grain was fresh
Abib	0.
	syl	A:bib
	pron	Hebrew <a1bEb>
	pos	n.
	qual	Judaism.
	def	the month of Nisan in the ancient Hebrew calendar (Exodus 13:4).
abide	ety	Old English *_ab*_idan, from a- (intensive)+ b*_idan to wait, bide
abides	infl
	head	abide
	syl	a:bides
	pos	vb.
abiding	infl
	head	abide
	syl	a:bid+ing
	pos	vb.
abode	infl
	head	abide
	or	abided
	syl	a:bode
	pos	vb.
abided	infl
	head	abide
	or	abode
	syl	a:bid+ed.
	pos	vb.
abide	1.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	mod	tr.
	def	to tolerate; put up with.
abide	2.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	mod	tr.
	def	to accept or submit to; suffer.
	exam	1	to abide the court's decision.
abide	3.a.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	def	to comply (with).
	exam	1	to abide by the decision.
abide	3.b.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	def	to remain faithful (to).
	exam	1	to abide by your promise.
abide	4.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	mod	intr.
	def	to remain or continue.
abide	5.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	mod	intr.
	qual	Archaic.
	def	to dwell.
abide	6.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to await in expectation.
abide	7.
	syl	a:bide
	pron	<*1bId>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to withstand or sustain; endure.
	exam	1	to abide the onslaught.
abidance	sub
	head	abide
	syl	a:1bid+ance
	pos	n.
abider	sub
	head	abide
	syl	a:1bid+er
	pos	n.
abiding	0.
	syl	a:bid+ing
	pron	<*1bIdiG>
	pos	adj.
	def	permanent; enduring.
	exam	1	an abiding belief.
abidingly	sub
	head	abiding
	syl	a:1bid+ing+ly
	pos	adv.
Abidjan	0.
	syl	A:bid+jan
	pron	<2@bi1Ja:n>, French <abid1Z?~a>
	pos	n.
	def	the capital of the Ivory Coast: a port on the Gulf of Guinea. Pop.: 282000 (1964 est.).
abietic acid	ety	C19 abietic, from Latin abi*_et-, from abi*_es silver fir (the acid originally being extracted from the resin)
abietic acid	0.
	syl	ab:i+et+ic ac:id
	pron	<2@bi1etik>
	pos	n.
	def	a yellowish powder occurring naturally as a constituent of rosin and used in lacquers, var?!nishes, and soap. Formula: C\1\9H\2\9COOH; melting pt.: 173?%C.
abigail	ety	C17: after the name of a lady's maid in Beaumont and Fletcher's play, The Scornful Lady (1610)
abigail	0.
	syl	ab:i+gail
	pron	<1@bi2gAl>
	pos	n.
	qual	Archaic.
	usage	sometimes cap.
	def	a lady's maid.
Abigail	0.
	syl	Ab:i+gail
	pron	<1@bi2gAl>
	pos	n.
	qual	Old Testament.
	def	the woman who brought provisions to David and his followers and subsequently became his wife (I Samuel 25:1-42).
Abilene	0.
	syl	Ab:i+lene
	pron	<1@b*2lEn>
	pos	n.
	def	a city in central Texas. Pop.: 89653 (1970).
ability	ety	C14: from Old French from Latin habilit*_as aptitude, handiness, from habilis #7able 
abilities	infl
	head	ability
	syl	a:bil+i:ties.
	pos	n.
	mod	pl.
ability	1.
	syl	a:bil+i:ty
	pron	<*1biliti>
	pos	n.
	def	possession of the qualities required to do something; necessary skill, competence, or power.
	exam	1	the ability to cope with a problem.
ability	2.
	syl	a:bil+i:ty
	pron	<*1biliti>
	pos	n.
	def	considerable proficiency; natural capability.
	exam	1	a man of ability.
ability	3.
	syl	a:bil+i:ty
	pron	<*1biliti>
	pos	n.
	mod	pl.
	def	special talents.
Abingdon	0.
	syl	Ab+ing+don
	pron	<1@biGd*n>
	pos	n.
	def	a market town in S England, in Oxfordshire. Pop.: 18596 (1971).
ab initio	0.
	syl	ab in:i+ti:o
	pron	Latin. <@b> <i1niSi2*u>
	def	from the start.
abiogenesis	ety	C19: New Latin, from {#7a -%1}#7+bio -#7+genesis 
abiogenesis	0.
	syl	a:bi:o+gen+e:sis
	pron	<2AbI*u1Jenisis>
	pos	n.
	def	the hypothetical process by which living organisms arise from inanimate matter: formerly thought to explain the origin of microorganisms. Also called: {spontaneous generation, autogenesis}. Compare {biogenesis}.
abiogenetic	sub
	head	abiogenesis
	syl	a:bi:o+ge:1net+ic
	pos	adj.
abiogenist	sub
	head	abiogenesis
	syl	a:bi:og+e:nist
	pron	<2AbI1oJinist>
	pos	n.
abiosis	ety	C20: from {#7a -%1}#7+ Greek bi*_osis a way of living &- a@.bi@.ot+ic (#!e$Iba$I@!$At$Ik) adj.
abiosis	0.
	syl	a:bi:o+sis
	pron	<2AbI1*usis>
	pos	n.
	def	absence of life.
abirritant	1.
	syl	ab+ir+ri+tant
	pron	<@b1irit*nt>
	pos	adj.
	def	relieving irritation.
abirritant	2.
	syl	ab+ir+ri+tant
	pron	<@b1irit*nt>
	pos	n.
	def	any drug or agent that relieves irritation.
abirritate	0.
	syl	ab+ir+ri+tate
	pron	<@b1iri2tAt>
	pos	vb.
	mod	tr.
	qual	Med.
	def	to soothe or relieve irritation.
abject	ety	C14 (in the sense: rejected, cast out): from Latin abjectus thrown or cast away, from abjicere, from ab- away+ jacere to throw
abject	1.
	syl	ab+ject
	pron	<1@bJekt>
	pos	adj.
	def	utterly wretched or hopeless.
abject	2.
	syl	ab+ject
	pron	<1@bJekt>
	pos	adj.
	def	miserable; forlorn; dejected.
abject	3.
	syl	ab+ject
	pron	<1@bJekt>
	pos	adj.
	def	indicating humiliation; submissive.
	exam	1	an abject apology.
abject	4.
	syl	ab+ject
	pron	<1@bJekt>
	pos	adj.
	def	contemptible; despicable; servile.
	exam	1	an abject liar.
abjection	sub
	head	abject
	syl	ab+1jec+tion
	pos	n.
abjectly	sub
	head	abject
	syl	ab+ject+ly
	pos	adv.
abjure	ety	C15: from Old French abjurer or Latin abjur*_are to deny on oath
abjure	1.
	syl	ab+jure
	pron	<*b1Ju*>
	pos	vb.
	mod	tr.
	def	to renounce or retract, esp. formally, solemnly, or under oath.
abjure	2.
	syl	ab+jure
	pron	<*b1Ju*>
	pos	vb.
	mod	tr.
	def	to abstain from or reject.
abjuration	sub
	head	abjure
	syl	ab+ju+1ra+tion
	pos	n.
abjurer	sub
	head	abjure
	syl	ab+1jur+er
	pos	n.
Abkhaz	infl
	syl	Ab+khaz
	pos	n.
	mod	pl.
Abkhaz	1.
	syl	Ab+khaz
	pron	<@b1ka:z>
	pos	n.
	def	a member of a Georgian people living east of the Black Sea.
Abkhaz	2.
	syl	Ab+khaz
	pron	<@b1ka:z>
	pos	n.
	def	the language of this people, belonging to the North Caucasian family.
Abkhaz Autonomous Soviet Socialist Republic	0.
	syl	Ab+khaz Au:ton:o+mous So+vi+et So+cial+ist Re+pub+lic
	pos	n.
	def	an administrative division of the S Soviet Union, in the NW Georgian SSR between the Black Sea and the Caucasus Mountains: a subtropical region, with mountains rising over 3900 m (13000 ft.). Capital: Sukhumi. Pop.: 486959 (1970). Area: 8600 sq. km (3320 sq. miles). Also called: {Ab+kha+zi@.a} (@ab#!k$a$:z$I$$).
abl	0.
	syl	abl.
	qual	abbrev. for
	def	ablative.
ablactation	1.
	syl	ab+lac+ta+tion
	pron	<2@bl@k1tAS*n>
	pos	n.
	def	the weaning of an infant.
ablactation	2.
	syl	ab+lac+ta+tion
	pron	<2@bl@k1tAS*n>
	pos	n.
	def	the cessation of milk secretion in the breasts.
ablate	ety	C20: back formation from #7ablation 
ablate	0.
	syl	ab+late
	pron	<@b1lAt>
	pos	vb.
	mod	tr.
	def	to remove by ablation.
ablation	ety	C15: from Late Latin ablati*_on-, from Latin auferre to carry away, remove
ablation	1.
	syl	ab+la+tion
	pron	<@b1lAS*n>
	pos	n.
	def	the surgical removal of an organ, structure, or part.
ablation	2.
	syl	ab+la+tion
	pron	<@b1lAS*n>
	pos	n.
	def	the melting or wearing away of an ex?!pendable part, such as the heat shield of a space re-entry vehicle on passing through the earth's atmosphere.
ablation	3.
	syl	ab+la+tion
	pron	<@b1lAS*n>
	pos	n.
	def	the wearing away of a rock or glacier.
ablative	1.
	syl	ab+la+tive
	pron	<1@bl*tiv>
	pos	adj.
	qual	Grammar.
	usage	in certain inflected languages such as Latin
	def	denoting a case of nouns, pronouns, and adjectives indicating the agent in passive sentences or the instrument, manner, or place of the action described by the verb.
ablative	2.a.
	syl	ab+la+tive
	pron	<1@bl*tiv>
	pos	n.
	qual	Grammar.
	def	the ablative case.
ablative	2.b.
	syl	ab+la+tive
	pron	<1@bl*tiv>
	pos	n.
	qual	Grammar.
	def	a word or speech element in the ablative case.
ablative absolute	0.
	syl	ab+la+tive ab+so+lute
	pos	n.
	def	an absolute construction in Latin grammar in which a head noun and a modifier in the ablative case function as a sentence modifier; for example, @6the enemy having been beaten@9.
ablator	ety	C20: from #7ablation 
ablator	0.
	syl	ab+la+tor
	pron	<@b1lAt*>
	pos	n.
	def	the heat shield of a space vehicle, which melts or wears away during re-entry into the earth's atmosphere.
ablaut	ety	German, coined 1819 by Jakob Grimm from ab off+ Laut sound
ablaut	0.
	syl	ab+laut
	pron	<1@blaut>, German <1aplaut>
	pos	n.
	qual	Linguistics.
	def	vowel gradation, esp. in Indo-European languages. See { {gradation} (sense 5)}.
ablaze	1.
	syl	a:blaze
	pron	<*1blAz>
	pos	adj. postpositive; adv.
	def	on fire; burning.
ablaze	2.
	syl	a:blaze
	pron	<*1blAz>
	pos	adj. postpositive; adv.
	def	brightly illuminated.
ablaze	3.
	syl	a:blaze
	pron	<*1blAz>
	pos	adj. postpositive; adv.
	def	emotionally aroused.
able	ety	C14: ultimately from Latin habilis easy to hold, manageable, apt, from hab*_ere to have, hold+ -ilis -#7ile 
able	1.
	syl	a:ble
	pron	<1AbL>
	pos	adj.
	usage	postpositive
	def	having the necessary power, resources, skill, time, opportunity, etc., to do something.
	exam	1	able to swim.
able	2.
	syl	a:ble
	pron	<1AbL>
	pos	adj.
	def	capable; competent; talented.
	exam	1	an able teacher.
able	3.
	syl	a:ble
	pron	<1AbL>
	pos	adj.
	qual	Law.
	def	qualified, competent, or authorized to do some specific act.
-able	ety	via Old French from Latin -*_abilis, -*_ibilis, forms of -bilis, adjectival suffix
-able	0.
	syl	-a:ble
	exam	1	suffix forming adjectives.
-able	1.
	syl	-a:ble
	def	capable of, suitable for, or deserving of (being acted upon as indicated).
	exam	1	enjoyable;
	exam	2	pitiable;
	exam	3	readable;
	exam	4	separable;
	exam	5	washable.
-able	2.
	syl	-a:ble
	def	inclined to; given to; able to; causing.
	exam	1	comfortable;
	exam	2	reasonable;
	exam	3	variable.
-ably	sub
	head	-able
	syl	-a:bly
-ability	sub
	head	-able
	syl	-a:bil:i:ty
able-bodied	0.
	syl	a:ble-bod:ied
	pos	adj.
	def	physically strong and healthy; robust.
able-bodied seaman	0.
	syl	a:ble-bod:ied sea+man
	pos	n.
	def	an ordinary seaman, esp. one in the merchant navy, who has been trained in certain skills. Also: {able seaman}. Abbrev.: {A.B., a.b}.
able rating	0.
	syl	a:ble rat+ing
	pos	n.
	usage	esp. in the Royal Navy
	def	a rating who is qualified to perform certain duties of seamanship.
abloom	0.
	syl	a:bloom
	pron	<*1blu:m>
	pos	adj.
	usage	postpositive
	def	in flower; blooming.
ablution	ety	C14: ultimately from Latin abl*_uere to wash away
ablution	1.
	syl	ab+lu+tion
	pron	<*1blu:S*n>
	pos	n.
	def	the ritual washing of a priest's hands or of sacred vessels.
ablution	2.
	syl	ab+lu+tion
	pron	<*1blu:S*n>
	pos	n.
	mod	often; pl.
	def	the act of washing (esp. in the phrase {perform one's ablutions) }.
ablution	3.
	syl	ab+lu+tion
	pron	<*1blu:S*n>
	pos	n.
	mod	pl.
	qual	Military informal.
	def	latrines.
ablutionary	sub
	head	ablution
	syl	ab+1lu+tion+ar:y
	pos	adj.
ably	0.
	syl	a:bly
	pron	<1Abli>
	pos	adv.
	def	in a competent or skilful manner.
ABM	0.
	syl	ABM
	qual	abbrev. for
	def	antiballistic missile.
abnegate	ety	C17: from Latin abneg*_are to deny
abnegate	0.
	syl	ab+ne+gate
	pron	<1@bni2gAt>
	pos	vb.
	mod	tr.
	def	to deny to oneself; renounce (privileges, pleasure, etc.).
abnegation	sub
	head	abnegate
	syl	ab+ne+1ga+tion
	pos	n.
abnegator	sub
	head	abnegate
	syl	ab+ne+2ga+tor
	pos	n.
Abney level	ety	C20: named after W. de W. Abney, died 1920, English scientist
Abney level	0.
	syl	Ab:ney lev+el
	pron	<1@bni>
	pos	n.
	def	a surveying instrument consisting of a spirit level and a sighting tube, used to measure the angle of inclination of a line from the observer to another point.
abnormal	ety	C19: {#7ab -%1}#7+normal, replacing earlier anormal from Medieval Latin anormalus, a blend of Late Latin an*_omalus #7anomalous+ Latin abnormis departing from a rule &- ab+#!nor+mal+ly adv.
abnormal	1.
	syl	ab+nor+mal
	pron	<@b1nc:m*l>
	pos	adj.
	def	not normal; deviating from the usual or typical; extraordinary.
abnormal	2.
	syl	ab+nor+mal
	pron	<@b1nc:m*l>
	pos	adj.
	qual	Informal.
	def	odd in behaviour or appearance; strange.
abnormalities	infl
	head	abnormality
	syl	ab+nor+mal+i:ties.
	pos	n.
	mod	pl.
abnormality	1.
	syl	ab+nor+mal+i:ty
	pron	<2@bnc:1m@liti>
	pos	n.
	def	an abnormal feature, event, etc.
abnormality	2.
	syl	ab+nor+mal+i:ty
	pron	<2@bnc:1m@liti>
	pos	n.
	def	a physical malformation; deformity.
abnormality	3.
	syl	ab+nor+mal+i:ty
	pron	<2@bnc:1m@liti>
	pos	n.
	def	deviation from the typical or usual; irregularity.
abnormal psychology	0.
	syl	ab+nor+mal psy+chol+o:gy
	pos	n.
	def	the study of behaviour patterns that diverge widely from generally accepted norms, esp. those of a pathological nature.
Abos	infl
	head	Abo
	syl	Ab:os.
	pos	n.
	mod	pl.
Abo	0.a.
	syl	Ab:o
	pron	<1@b*u>
	pos	n.
	qual	Austral. informal, often derogatory.
	usage	sometimes not cap.
	def	short for {Aborigine}.
Abo	0.b.
	syl	Ab:o
	pron	<1@b*u>
	pos	n.
	qual	Austral. informal, often derogatory.
	usage	sometimes not cap.; as modifier
	exam	1	an Abo reserve.
Abo	0.
	syl	*%A:bo
	pron	<1o:bu:>
	pos	n.
	def	the Swedish name for {Turku}.
ABO system	0.
	syl	ABO sys+tem
	pos	n.
	def	a system for classifying human blood on the basis of the presence or absence of two antigens in the red cells: there are four such blood types (A, B, AB, and O).
aboard	1.
	syl	a:board
	pron	<*1bc:d>
	pos	adv. adj. postpositive; prep.
	def	on, in, onto, or into (a ship, train, aircraft, etc.).
aboard	2.
	syl	a:board
	pron	<*1bc:d>
	pos	adv. adj. postpositive; prep.
	qual	Nautical.
	def	alongside (a vessel).
all aboard	3.
	head	aboard
	syl	all aboard&!
	pos	interj.
	def	a warning to passengers to board a vehicle, ship, etc.
abode	ety	C17: n. formed from #7abide 
abode	H1.0.
	syl	a:bode
	pron	<*1b*ud>
	pos	n.
	def	a place in which one lives; one's home.
abode	H2.0.
	syl	a:bode
	pron	<*1b*ud>
	pos	vb.
	def	a past tense and past participle of {abide}.
abohm	0.
	syl	ab+ohm
	pron	<@b1*um>, <1@b2*um>
	pos	n.
	def	the cgs unit of resistance in the electromagnetic system: equivalent to 10%-%9 ohm.
aboideau	ety	Canadian French
aboiteau	alt
	head	aboideau
	or	aboideau
	syl	a:boi+teau
	pron	<1@b*2t*u>
	pos	n.
aboideaus	infl
	head	aboideau
	or	aboiteaus
	syl	a:boi+deaus
	pron	<-2d*uz>
	pos	n.
	mod	pl.
aboideaux	infl
	head	aboideau
	or	aboiteaux
	syl	a:boi+deaux
	pron	<-2d*uz>
	pos	n.
	mod	pl.
aboiteaus	infl
	head	aboideau
	or	aboideaus
	syl	a:boi+teaus
	pron	<-2t*uz>
	pos	n.
	mod	pl.
aboiteaux	infl
	head	aboideau
	or	aboideaux
	syl	a:boi+teaux
	pron	<-2t*uz>
	pos	n.
	mod	pl.
aboideau	1.
	or	aboiteau
	syl	a:boi+deau
	pron	<1@b*2d*u>
	pos	n.
	usage	in the Canadian Maritimes
	def	a dyke with a sluice gate that allows flood water to drain off while keeping the sea water out.
aboideau	2.
	or	aboiteau
	syl	a:boi+deau
	pron	<1@b*2d*u>
	pos	n.
	usage	in the Canadian Maritimes
	def	a sluice gate in a dyke.
abolish	ety	C15: from Old French aboliss- (lengthened stem of abolir) , ultimately from Latin abol*_ere to destroy
abolish	0.
	syl	a:bol+ish
	pron	<*1boliS>
	pos	vb.
	mod	tr.
	def	to do away with (laws, regulations, customs, etc.); put an end to.
abolishable	sub
	head	abolish
	syl	a:1bol+ish+a:ble
	pos	adj.
abolisher	sub
	head	abolish
	syl	a:1bol+ish+er
	pos	n.
abolishment	sub
	head	abolish
	syl	a:1bol+ish+ment
	pos	n.
abolition	ety	C16: from Latin abolitio, from abol*_ere to destroy
abolition	1.
	syl	ab:o+li+tion
	pron	<2@b*1liS*n>
	pos	n.
	def	the act of abolishing or the state of being abolished; annulment.
abolition	2.
	syl	ab:o+li+tion
	pron	<2@b*1liS*n>
	pos	n.
	usage	often cap.; in British territories
	def	the ending of the slave trade (1807) or the ending of slavery (1833): accomplished after a long campaign led by William Wilberforce.
abolition	3.
	syl	ab:o+li+tion
	pron	<2@b*1liS*n>
	pos	n.
	usage	often cap.; in the U.S.
	def	the emancipation of the slaves, accomplished by the Emancipation Proclamation issued in 1863 and ratified in 1865.
abolitionary	sub
	head	abolition
	syl	ab:o+1li+tion+ar:y
	pos	adj.
abolitionism	sub
	head	abolition
	syl	ab:o+1li+tion+ism
	pos	n.
abolitionist	sub
	head	abolition
	syl	ab:o+1li+tion+ist
	pos	n. adj.
abomasum	ety	C18: New Latin, from {#7ab -%1}#7+ om*_asum bullock's tripe
abomasum	0.
	syl	ab:o+ma+sum
	pron	<2@b*1mAs*m>
	pos	n.
	def	the fourth and last compartment of the stomach of ruminants, which receives and digests food from the psalterium and passes it on to the small intestine.
A-bomb	0.
	syl	A-bomb
	pos	n.
	def	short for {atom bomb}.
abominable	ety	C14: from Latin ab*_omin*_abilis, from ab*_omin*_ar*_i to #7abominate 
abominable	1.
	syl	a:bom:i+na:ble
	pron	<*1bomin*bL>
	pos	adj.
	def	offensive; loathsome; detestable.
abominable	2.
	syl	a:bom:i+na:ble
	pron	<*1bomin*bL>
	pos	adj.
	qual	Informal.
	def	very bad, unpleasant, or inferior.
	exam	1	abominable weather;
	exam	2	abominable workmanship.
abominably	sub
	head	abominable
	syl	a:1bom:i+na:bly
	pos	adv.
abominable snowman	ety	a translation of Tibetan metohkangmi, from metoh foul+ kangmi snowman
abominable snowman	0.
	syl	a:bom:i+na:ble snow+man
	pos	n.
	def	a large legendary manlike or apelike creature, alleged to inhabit the Himalayan Mountains. Also called: {yeti}.
abominate	ety	C17: from the past participle of Latin ab*_omin*_ar*_i to regard as an ill omen, from ab- away from+ *_omin-, from #7omen 
abominate	0.
	syl	a:bom:i+nate
	pron	<*1bomi2nAt>
	pos	vb.
	mod	tr.
	def	to dislike intensely; loathe; detest.
abominator	sub
	head	abominate
	syl	a:1bom:i+2na+tor
	pos	n.
abomination	1.
	syl	a:bom:i+na+tion
	pron	<*2bomi1nAS*n>
	pos	n.
	def	a person or thing that is disgusting or loathsome.
abomination	2.
	syl	a:bom:i+na+tion
	pron	<*2bomi1nAS*n>
	pos	n.
	def	an action that is vicious, vile, etc.
abomination	3.
	syl	a:bom:i+na+tion
	pron	<*2bomi1nAS*n>
	pos	n.
	def	intense loathing or disgust.
abondance	0.
	syl	a:bon+dance
	pron	French <ab?~c1d*~a:s>
	pos	n.
	qual	Cards.
	def	a variant spelling of { {abundance} (sense 6)}.
a bon march'e	0.
	syl	*`a bon mar+ch*'e
	pron	French. <a b?~c mar1SA>
	pos	adv.
	def	at a bargain price.
aboral	0.
	syl	ab+o:ral
	pron	<@b1c:r*l>
	pos	adj.
	qual	Zoology.
	def	away from or opposite the mouth.
aboriginal	0.
	syl	ab:o+rig:i+nal
	pron	<2@b*1riJinL>
	pos	adj.
	def	existing in a place from the earliest known period; indigenous; autochthonous.
aboriginally	sub
	head	aboriginal
	syl	ab:o+1rig:i+nal+ly
	pos	adv.
Aboriginal	1.
	syl	Ab:o+rig:i+nal
	pron	<2@b*1riJinL>
	pos	adj.
	def	of, relating to, or characteristic of the Aborigines of Australia.
Aboriginal	2.
	syl	Ab:o+rig:i+nal
	pron	<2@b*1riJinL>
	pos	n.
	def	another word for an Australian {Aborigine}.
aborigine	ety	C16: back formation from aborigines, from Latin: inhabitants of Latium in pre-Roman times, probably represent?!ing some tribal name but associated in folk etymology with ab origine from the beginning
aborigine	0.
	syl	ab:o+rig:i+ne
	pron	<2@b*1riJini>
	pos	n.
	def	an original inhabitant of a country or region who has been there from the earliest known times.
Aborigine	1.
	syl	Ab:o+rig:i+ne
	pron	<2@b*1riJini>
	pos	n.
	def	Also called: {native Australian}, (Austral.) {native}, (Austral.) {Black}. a member of a dark-skinned hunting and gathering people who were living in Australia when European settlers arrived. Often shortened to {Abo}.
Aborigine	2.
	syl	Ab:o+rig:i+ne
	pron	<2@b*1riJini>
	pos	n.
	def	any of the languages of this people. See also { {Australian} (sense 3)}.
aborning	ety	C20: from #7a -%2#7+ borning, from #7born 
aborning	0.
	syl	a:born+ing
	pron	<*1bc:niG>
	pos	adv.
	qual	U.S.
	def	while being born, developed, or realized (esp. in the phrase {die aborning}) .
abort	ety	C16: from Latin abort*_are, from the past participle of abor*_ir*_i to miscarry, from ab- wrongly, badly+ or*_ir*_i to appear, arise, be born
abort	1.
	syl	a:bort
	pron	<*1bc:t>
	pos	vb.
	def	to terminate or cause to terminate pregnancy before the fetus is viable.
abort	2.
	syl	a:bort
	pron	<*1bc:t>
	pos	vb.
	mod	intr.
	def	to fail to come to completion; go wrong.
abort	3.
	syl	a:bort
	pron	<*1bc:t>
	pos	vb.
	mod	tr.
	def	to interrupt the development of.
abort	4.
	syl	a:bort
	pron	<*1bc:t>
	pos	vb.
	mod	intr.
	def	to give birth to a dead or nonviable fetus.
abort	5.
	syl	a:bort
	pron	<*1bc:t>
	pos	vb.
	usage	of a space flight, military operation, etc.
	def	to fail or terminate prematurely.
abort	6.
	syl	a:bort
	pron	<*1bc:t>
	pos	vb.
	mod	intr.
	usage	of an organism or part of an organism
	def	to fail to develop into the mature form.
aborticide	1.
	syl	a:bor+ti+cide
	pron	<*1bc:ti2sId>
	pos	n.
	def	the destruction of a fetus; feticide.
aborticide	2.
	syl	a:bor+ti+cide
	pron	<*1bc:ti2sId>
	pos	n.
	def	a drug or agent that kills a fetus.
abortifacient	1.
	syl	a:bor+ti+fa+cient
	pron	<*2bc:ti1fAS*nt>
	pos	adj.
	def	causing abortion.
abortifacient	2.
	syl	a:bor+ti+fa+cient
	pron	<*2bc:ti1fAS*nt>
	pos	n.
	def	a drug or agent that causes abortion.
abortion	1.
	syl	a:bor+tion
	pron	<*1bc:S*n>
	pos	n.
	def	an operation or other procedure to terminate pregnancy before the fetus is viable.
abortion	2.
	syl	a:bor+tion
	pron	<*1bc:S*n>
	pos	n.
	def	the premature termination of pregnancy by spontaneous or induced expulsion of a nonviable fetus from the uterus.
abortion	3.
	syl	a:bor+tion
	pron	<*1bc:S*n>
	pos	n.
	def	the products of abortion; an aborted fetus.
abortion	4.
	syl	a:bor+tion
	pron	<*1bc:S*n>
	pos	n.
	def	the arrest of development of an organ.
abortion	5.
	syl	a:bor+tion
	pron	<*1bc:S*n>
	pos	n.
	def	a failure to develop to completion or maturity.
	exam	1	the project proved an abortion.
abortion	6.
	syl	a:bor+tion
	pron	<*1bc:S*n>
	pos	n.
	def	a person or thing that is de?!formed.
abortional	sub
	head	abortion
	syl	a:1bor+tion+al
	pos	adj.
abortionist	0.
	syl	a:bor+tion+ist
	pron	<*1bc:S*nist>
	pos	n.
	def	a person who performs abortions, esp. illegally.
abortive	1.
	syl	a:bor+tive
	pron	<*1bc:tiv>
	pos	adj.
	def	failing to achieve a purpose; fruitless.
abortive	2.
	syl	a:bor+tive
	pron	<*1bc:tiv>
	pos	adj.
	usage	of organisms
	def	imperfectly developed; rudimentary.
abortive	3.
	syl	a:bor+tive
	pron	<*1bc:tiv>
	pos	adj.
	def	causing abortion; abortifacient.
Abukir Bay	alt
	head	Aboukir Bay
	or	Aboukir Bay
	syl	A:bu+kir Bay
	pron	<2@bu:1ki*>
	pos	n.
Aboukir Bay	0.
	or	Abukir Bay
	syl	A:bou+kir Bay
	pron	<2@bu:1ki*>
	pos	n.
	def	a bay on the N coast of Egypt, where the Nile enters the Mediterranean: site of the Battle of the Nile (1798), in which Nelson defeated the French fleet. Arabic name: {Abu Q*^ir}.
aboulia	0.
	syl	a:bou+li:a
	pron	<*1bu:li*>, <-1bju:->
	pos	n.
	def	a variant spelling of {abulia}.
abound	ety	C14: via Old French from Latin abund*_are to overflow, from und*_are to flow, from unda wave
abound	1.
	syl	a:bound
	pron	<*1baund>
	pos	vb.
	mod	intr.
	def	to exist or occur in abundance; be plentiful.
	exam	1	a swamp in which snakes abound.
abound	2.
	syl	a:bound
	pron	<*1baund>
	pos	vb.
	mod	intr.
	usage	foll. by with or in
	def	to be plentifully supplied (with); teem (with).
	exam	1	the gardens abound with flowers;
	exam	2	the fields abound in corn.
about	ety	Old English ab*_utan, onb*_utan on the outside of, around, from #7on+ b*_utan outside
about	1.
	syl	a:bout
	pron	<*1baut>
	pos	prep.
	def	relating to; concerning; on the subject of.
about	2.
	syl	a:bout
	pron	<*1baut>
	pos	prep.
	def	near or close to.
about	3.
	syl	a:bout
	pron	<*1baut>
	pos	prep.
	def	carried on.
	exam	1	I haven't any money about me.
about	4.
	syl	a:bout
	pron	<*1baut>
	pos	prep.
	def	on every side of; all the way around.
about	5.
	syl	a:bout
	pron	<*1baut>
	pos	prep.
	def	active in or engaged in.
	exam	1	she is about her business.
about	6.
	syl	a:bout
	pron	<*1baut>
	pos	prep.
	usage	foll. by an infinitive
	def	ready to or intending to: often used to form an immediate future verb.
	exam	1	he was about to jump.
about	7.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	def	approximately; near in number, time, degree, etc..
	exam	1	about 50 years old.
about	8.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	def	nearby.
about	9.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	def	here and there; from place to place; in no particular direction.
	exam	1	walk about to keep warm.
about	10.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	def	all around; on every side.
about	11.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	def	in or to the opposite direction.
	exam	1	he turned about and came back.
about	12.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	def	in rotation or revolution.
	exam	1	turn and turn about.
about	13.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	def	used in informal phrases to indicate understatement.
	exam	1	I've had just about enough of your insults;
	exam	2	it's about time you stopped.
about	14.
	syl	a:bout
	pron	<*1baut>
	pos	adv.
	qual	Archaic.
	def	in circumference; around.
about	15.
	syl	a:bout
	pron	<*1baut>
	pos	adj.
	usage	predicative
	def	active; astir after sleep.
	exam	1	up and about.
about-ships	infl
	head	about-ship
	syl	a:bout-ships
	pos	vb.
	mod	intr.
about-shipping	infl
	head	about-ship
	syl	a:bout-ship:ping
	pos	vb.
	mod	intr.
about-shipped	infl
	head	about-ship
	syl	a:bout-shipped.
	pos	vb.
	mod	intr.
about-ship	0.
	syl	a:bout-ship
	pos	vb.
	mod	intr.
	qual	Nautical.
	def	to manoeuvre a vessel onto a new tack.
about face	alt
	head	about turn
	or	about turn
	syl	a:bout face
	pos	interj.
	qual	U.S.
about turn	1.
	or	about face
	syl	a:bout turn
	pos	interj.
	def	a military command to a formation of men to reverse the direction in which they are facing.
about-turn	infl
	head	about turn
	or	about-face
	syl	a:bout-turn
	pos	n.
about-face	infl
	head	about turn
	or	about-turn
	syl	a:bout-face.
	pos	n.
	qual	U.S.
about turn	2.
	or	about face
	syl	a:bout turn
	pos	n.
	def	a complete change or reversal, as of opinion, attitude, direction, etc.
about-turn	infl
	head	about turn
	or	about-face
	syl	a:bout-turn
	pos	vb.
about-face	infl
	head	about turn
	or	about-turn
	syl	a:bout-face.
	pos	vb.
	qual	U.S.
about turn	3.
	or	about face
	syl	a:bout turn
	pos	vb.
	mod	intr.
	def	to perform an about-turn.
above	ety	Old English abufan, from a- on+ bufan above
above	1.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	on top of or higher than; over.
	exam	1	the sky above the earth.
above	2.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	greater than in quantity or degree.
	exam	1	above average in weight.
above	3.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	superior to or prior to.
	exam	1	to place honour above wealth.
above	4.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	too honourable or high-minded for.
	exam	1	above petty gossiping.
above	5.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	too respected for; beyond.
	exam	1	above suspicion;
	exam	2	above reproach.
above	6.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	too difficult to be understood by.
	exam	1	the talk was above me.
above	7.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	louder or higher than (other noise).
	exam	1	I heard her call above the radio.
above	8.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	in preference to.
	exam	1	I love you above all others.
above	9.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	north of.
	exam	1	which town lies just above London??
above	10.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	upstream from.
above all	11.
	head	above
	syl	above all.
	def	most of all or most important.
above and beyond	12.
	head	above
	syl	above and beyond.
	def	in addition to.
above oneself	13.
	head	above
	syl	above oneself.
	def	presumptuous or conceited. {~}
above	14.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	in or to a higher place.
	exam	1	the sky above.
above	15.a.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	in a previous place (in something written).
above	15.b.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	usage	in combination
	exam	1	the above-mentioned clause.
above	16.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	higher in rank or position.
above	17.
	syl	a:bove
	pron	<*1b^v>
	pos	prep.
	def	in or concerned with heaven.
	exam	1	seek the things that are above.
the above	18.
	head	above
	syl	the above.
	def	something that is above or previously mentioned.
above	19.
	syl	a:bove
	pron	<*1b^v>
	pos	adj.
	def	mentioned or appearing in a previous place (in something written).
(aboveboard	infl
	head	above board
	syl	(aboveboard
	pos	adj.
above board	0.
	syl	a:bove board
	pos	adj.
	usage	when prenominal)
	def	, in the open; without dishonesty, concealment, or fraud.
ab ovo	ety	literally: from the egg
ab ovo	0.
	syl	ab o:vo
	pron	Latin. <@b> <1*uv*u>
	def	from the beginning.
abp	alt
	head	Abp
	or	Abp
	syl	abp.
Abp	0.
	or	abp
	syl	Abp.
	qual	abbrev. for
	def	archbishop.
abr	1.
	syl	abr.
	qual	abbrev. for:
	def	abridged.
abr	2.
	syl	abr.
	qual	abbrev. for:
	def	abridgment.
abracadabra	ety	C17: from Latin: magical word used in certain Gnostic writings, perhaps related to Greek Abrasax, a Gnostic deity
abracadabra	1.
	syl	ab+ra+ca+dab+ra
	pron	<2@br*k*1d@br*>
	pos	interj.
	def	a spoken formula, used esp. by conjurors.
abracadabra	2.
	syl	ab+ra+ca+dab+ra
	pron	<2@br*k*1d@br*>
	pos	n.
	def	a word used in incantations, etc., considered to possess magic powers.
abracadabra	3.
	syl	ab+ra+ca+dab+ra
	pron	<2@br*k*1d@br*>
	pos	n.
	def	gibberish; nonsense.
abrade	ety	C17: from Latin abr*_adere to scrape away, from #7ab -#7+ r*_adere to scrape
abrade	0.
	syl	a:brade
	pron	<*1brAd>
	pos	vb.
	mod	tr.
	def	to scrape away or wear down by friction; erode.
abradant	sub
	head	abrade
	syl	a:1bra+dant
	pos	n.
abrader	sub
	head	abrade
	syl	a:1brad+er
	pos	n.
Abraham	1.
	syl	A:bra:ham
	pron	<1Abr*2h@m>, <-h*m>
	pos	n.
	qual	Old Testament.
	def	the first of the patriarchs, the father of Isaac and the founder of the Hebrew people (Genesis 11-25).
Abraham's bosom	2.
	head	Abraham
	syl	Abraham's bosom.
	def	the place where the just repose after death (Luke 16:22).
abranchiate	ety	C19: #7a -%1#7+branchiate 
abranchial	alt
	head	abranchiate
	or	abranchiate
	syl	a:bran+chi:al
	pos	adj.
abranchiate	0.
	or	abranchial
	syl	a:bran+chi+ate
	pron	<*1br@Gkiit>, <-2At>
	pos	adj.
	qual	Zool?!ogy.
	def	having no gills.
abrasion	ety	C17: from Medieval Latin abr*_asi*_on-, from the past participle of Latin abr*_adere to #7abrade 
abrasion	1.
	syl	a:bra+sion
	pron	<*1brAZ*n>
	pos	n.
	def	the process of scraping or wearing down by friction.
abrasion	2.
	syl	a:bra+sion
	pron	<*1brAZ*n>
	pos	n.
	def	a scraped area or spot; graze.
abrasion	3.
	syl	a:bra+sion
	pron	<*1brAZ*n>
	pos	n.
	qual	Geography.
	def	the effect of mechanical erosion of rock, esp. a river bed, by rock fragments scratching and scraping it; wearing down. Compare { {attrition} (sense 3)}, {corrasion}.
abrasive	1.
	syl	a:bra+sive
	pron	<*1brAsiv>
	pos	n.
	def	a substance or material such as sandpaper, pumice, or emery, used for cleaning, grinding, smoothing, or polishing.
abrasive	2.
	syl	a:bra+sive
	pron	<*1brAsiv>
	pos	adj.
	def	causing abrasion; grating; rough.
abrasive	3.
	syl	a:bra+sive
	pron	<*1brAsiv>
	pos	adj.
	def	irritating in manner or personality; causing tension or annoyance.
abraxas	ety	from Greek: invented word
abraxas	0.
	syl	a:brax+as
	pron	<*1br@ks*s>
	pos	n.
	def	an ancient charm composed of Greek letters: originally believed to have magical powers and inscribed on amulets, etc., but from the second century #7a.d. personified by Gnostics as a deity, the source of divine emanations.
abreact	0.
	syl	ab+re+act
	pron	<2@bri1@kt>
	pos	vb.
	mod	tr.
	qual	Psychoanal.
	def	to alleviate (emotional tension) through abreaction.
abreaction	0.
	syl	ab+re+ac+tion
	pron	<2@bri1@kS*n>
	pos	n.
	qual	Psychoanal.
	def	the release and expression of emotional tension associated with repressed ideas by bringing those ideas into consciousness.
abreast	1.
	syl	a:breast
	pron	<*1brest>
	pos	adj.
	usage	postpositive
	def	alongside each other and facing in the same direction.
abreast	2.
	syl	a:breast
	pron	<*1brest>
	pos	adj.
	usage	postpositive; foll. by of or with
	def	up to date (with); fully conversant (with).
abri	ety	French, from Latin apricum an open place
abri	0.
	syl	a:bri
	pron	<@1bri>
	pos	n.
	def	a shelter or place of refuge, esp. in wartime.
abridge	ety	C14: via Old French abregier from Late Latin abbrevi*_are to shorten
abridge	1.
	syl	a:bridge
	pron	<*1briJ>
	pos	vb.
	mod	tr.
	def	to reduce the length of (a written work) by condensing or rewriting.
abridge	2.
	syl	a:bridge
	pron	<*1briJ>
	pos	vb.
	mod	tr.
	def	to curtail; diminish.
abridge	3.
	syl	a:bridge
	pron	<*1briJ>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to deprive of (privileges, rights, etc.).
abridgable	sub
	head	abridge
	or	abridgeable
	syl	a:1bridg+a:ble
	pos	adj.
abridgeable	sub
	head	abridge
	or	abridgable
	syl	a:1bridge+a:ble
	pos	adj.
abridger	sub
	head	abridge
	syl	a:1bridg+er
	pos	n.
abridgement	alt
	head	abridgment
	or	abridgment
	syl	a:bridge+ment
	pron	<*1briJm*nt>
	pos	n.
abridgment	1.
	or	abridgement
	syl	a:bridg+ment
	pron	<*1briJm*nt>
	pos	n.
	def	a short?!ened version of a written work.
abridgment	2.
	or	abridgement
	syl	a:bridg+ment
	pron	<*1briJm*nt>
	pos	n.
	def	the act of abridging or state of being abridged.
abroach	ety	C14: from Old French abrochier from a - to+ brochier to #7broach 
abroach	0.
	syl	a:broach
	pron	<*1br*uC>
	pos	adj.
	usage	postpositive; of a cask, barrel, etc.
	def	tapped; broached.
abroad	ety	C13: from #7a -%2#7+broad 
abroad	1.
	syl	a:broad
	pron	<*1brc:d>
	pos	adv.
	def	to or in a foreign country or countries.
abroad	2.
	syl	a:broad
	pron	<*1brc:d>
	pos	adj.
	usage	postpositive; of news, rumours, etc.
	def	in general circulation; current.
abroad	3.
	syl	a:broad
	pron	<*1brc:d>
	pos	adj.
	usage	postpositive
	def	out in the open.
abroad	4.
	syl	a:broad
	pron	<*1brc:d>
	pos	adj.
	usage	postpositive
	def	over a wide area.
abroad	5.
	syl	a:broad
	pron	<*1brc:d>
	pos	adj.
	qual	Archaic.
	usage	postpositive
	def	in error.
abrogate	ety	C16: from Latin abrog*_atus repealed, from #7ab -%1#7+ rog*_are to propose (a law)
abrogate	0.
	syl	ab+ro+gate
	pron	<1@br*u2gAt>
	pos	vb.
	mod	tr.
	def	to cancel or revoke formally or officially; repeal; annul.
abrogation	sub
	head	abrogate
	syl	ab+ro+1ga+tion
	pos	n.
abrogator	sub
	head	abrogate
	syl	ab+ro+2ga+tor
	pos	n.
abrupt	ety	C16: from Latin abruptus broken off, from #7ab -%1#7+ rumpere to break
abrupt	1.
	syl	ab+rupt
	pron	<*1br^pt>
	pos	adj.
	def	sudden; unexpected.
abrupt	2.
	syl	ab+rupt
	pron	<*1br^pt>
	pos	adj.
	def	brusque or brief in speech, manner, etc.; curt.
abrupt	3.
	syl	ab+rupt
	pron	<*1br^pt>
	pos	adj.
	usage	of a style of writing or speaking
	def	making sharp transitions from one subject to another; disconnected.
abrupt	4.
	syl	ab+rupt
	pron	<*1br^pt>
	pos	adj.
	def	precipitous; steep.
abrupt	5.
	syl	ab+rupt
	pron	<*1br^pt>
	pos	adj.
	qual	Botany.
	def	shaped as though a part has been cut off; truncate.
abrupt	6.
	syl	ab+rupt
	pron	<*1br^pt>
	pos	adj.
	usage	Geology. of strata
	def	cropping out suddenly.
abruptly	sub
	head	abrupt
	syl	ab+1rupt+ly
	pos	adv.
abruptness	sub
	head	abrupt
	syl	ab+1rupt+ness
	pos	n.
abruption	ety	C17: from Latin abruptio ; see #7abrupt 
abruption	0.
	syl	ab+rup+tion
	pron	<*1br^pS*n>
	pos	n.
	def	a breaking off of a part or parts from a mass.
Abruzzi	0.
	syl	A:bruz+zi
	pron	Italian <a1bruttsi>
	pos	n.
	def	a region of S central Italy, between the Apennines and the Adriatic: separated from the former administrative region {Abruzzi e Molise} in 1965. Capital: Aquila. Pop.: 1163334 (1971). Area: 10794 sq. km (4210 sq. miles).
Absalom	0.
	syl	Ab:sa:lom
	pron	<1@bs*l*m>
	pos	n.
	qual	Old Testament.
	def	the third son of David, who rebelled against his father and was eventually killed by Joab (II Samuel 15-18).
abscess	ety	C16: from Latin abscessus a going away, a throwing off of bad humours, hence an abscess, from absc*_edere to go away
abscess	1.
	syl	ab+scess
	pron	<1@bses>, <-sis>
	pos	n.
	def	a localized collection of pus formed as the product of inflammation and often caused by bacteria.
abscess	2.
	syl	ab+scess
	pron	<1@bses>, <-sis>
	pos	vb.
	mod	intr.
	def	to form such a collection of pus.
abscessed	sub
	head	abscess
	syl	ab+scessed
	pos	adj.
abscise	ety	C17: from Latin abscisus , from absc*_idere to cut off
abscise	0.
	syl	ab+scise
	pron	<@b1sIz>
	pos	vb.
	def	to separate by abscission.
abscissa	ety	C17: New Latin, originally linea abscissa a cut-off line
abscissas	infl
	head	abscissa
	or	abscissae
	syl	ab+scis+sas
	pron	<-1sisE>
	pos	n.
	mod	pl.
abscissae	infl
	head	abscissa
	or	abscissas
	syl	ab+scis+sae
	pron	<-1sisE>
	pos	n.
	mod	pl.
abscissa	0.
	syl	ab+scis+sa
	pron	<@b1sis*>
	pos	n.
	def	the horizontal or -coordinate of a point in a two-dimensional system of Cartesian coordinates. It is the distance from the -axis measured parallel to the -axis. Compare { {ordinate} (sense 1)}.
abscission	ety	C17: from Latin abscissi*_on-, from #7ab -%1#7+ scissi*_o a cleaving
abscission	1.
	syl	ab+scis+sion
	pron	<@b1siZ*n>, <-1siS->
	pos	n.
	def	the separation of leaves, branches, flowers, and bark from plants by the formation of an abscission layer.
abscission	2.
	syl	ab+scis+sion
	pron	<@b1siZ*n>, <-1siS->
	pos	n.
	def	the act of cutting off.
abscission layer	0.
	syl	ab+scis+sion lay+er
	pos	n.
	def	a layer of parenchyma cells, bounded on both sides by cork, that is formed at the base of fruit, flower, and leaf stems and under bark before abscission. As the parenchyma disintegrates the organ becomes separated from the plant.
abscond	ety	C16: from Latin abscondere to hide, put away, from abs- #7ab -%1#7+ condere to stow
abscond	0.
	syl	ab+scond
	pron	<*b1skond>
	pos	vb.
	mod	intr.
	def	to run away secretly, esp. to avoid prosecution or arrest after stealing something.
absconder	sub
	head	abscond
	syl	ab+1scond+er
	pos	n.
abseil	ety	C20: from German abseilen to descend by a rope, from ab- down+ Seil rope
abseil	1.
	syl	ab+seil
	pron	<1@bsIl>
	pos	vb.
	mod	intr.
	qual	Mountaineering.
	def	to descend a steep slope or vertical drop by a rope secured from above and coiled around one's body or through karabiners attached to one's body in order to control the speed of descent.
abseil	2.
	syl	ab+seil
	pron	<1@bsIl>
	pos	vb.
	mod	intr.
	def	to descend by rope from a helicopter.
abseil	3.
	syl	ab+seil
	pron	<1@bsIl>
	pos	n.
	mod	intr.
	def	an instance or the technique of abseiling. {~} Also called: {rappel}.
absence	ety	C14: via Old French from Latin absentia, from abs*_ens a being away
absence	1.
	syl	ab+sence
	pron	<1@bs*ns>
	pos	n.
	def	the state of being away.
absence	2.
	syl	ab+sence
	pron	<1@bs*ns>
	pos	n.
	def	the time during which a person or thing is away.
absence	3.
	syl	ab+sence
	pron	<1@bs*ns>
	pos	n.
	def	the fact of being without something; lack.
absent	ety	C14: from Latin absent-, stem of abs*_ens, present participle of abesse to be away
absent	1.
	syl	ab+sent
	pron	<1@bs*nt>
	pos	adj.
	def	away or not present.
absent	2.
	syl	ab+sent
	pron	<1@bs*nt>
	pos	adj.
	def	lacking; missing.
absent	3.
	syl	ab+sent
	pron	<1@bs*nt>
	pos	adj.
	def	inattentive; absent-minded.
absent	4.
	syl	ab+sent
	pron	<@b1sent>
	pos	vb.
	mod	tr.
	def	to remove (oneself) or keep away.
absenter	sub
	head	absent
	syl	ab+1sent+er
	pos	n.
absentee	0.a.
	syl	ab+sen+tee
	pron	<2@bs*n1tE>
	pos	n.
	def	a person who is absent.
absentee	0.b.
	syl	ab+sen+tee
	pron	<2@bs*n1tE>
	pos	n.
	usage	as modifier
	exam	1	an absentee voter.
absenteeism	0.
	syl	ab+sen+tee+ism
	pron	<2@bs*n1tEiz*m>
	pos	n.
	def	persistent absence from work, school, etc.
absentee landlord	0.
	syl	ab+sen+tee land+lord
	pos	n.
	def	a landlord who does not live in or near a property from which he draws an income.
absente reo	ety	Latin: literally: the defendant being absent
absente reo	0.
	syl	ab+sen+te re:o
	pron	<@b1senti> <1rE*u>
	qual	Law.
	def	in the absence of the defendant.
absently	0.
	syl	ab+sent+ly
	pron	<1@bs*ntli>
	pos	adv.
	def	in an absent-minded or preoccupied manner; inattentively.
absent-minded	0.
	syl	ab:sent-mind:ed
	pos	adj.
	def	preoccupied; forgetful; inattentive.
absent-mindedly	sub
	head	absent-minded
	syl	ab:sent-1mind:ed+ly
	pos	adv.
absent-mindedness	sub
	head	absent-minded
	syl	ab:sent-1mind:ed+ness
	pos	n.
absent without leave	0.
	syl	ab+sent with+out leave
	qual	Military.
	def	the full form of {A.W.O.L}.
absinthe	ety	C15: via French and Latin from Greek apsinthion wormwood
absinth	alt
	head	absinthe
	or	absinthe
	syl	ab+sinth
	pron	<1@bsinT>
	pos	n.
absinthe	1.
	or	absinth
	syl	ab+sinthe
	pron	<1@bsinT>
	pos	n.
	def	a potent green alcoholic drink, technically a gin, originally having high wormwood content.
absinthe	2.
	or	absinth
	syl	ab+sinthe
	pron	<1@bsinT>
	pos	n.
	def	another name for {wormwood} (the plant).
absinthism	0.
	syl	ab+sinth+ism
	pron	<1@bsin2Tiz*m>
	pos	n.
	qual	Pathol.
	def	a diseased condition resulting from excessive drinking of absinthe.
absit omen	ety	literally: may the (evil) omen be absent
absit omen	0.
	syl	ab+sit o:men
	pron	Latin. <1@bsit> <1*umen>
	def	may the presentiment not become real or take place.
absolute	ety	C14: from Latin absol*_utus unconditional, freed from, from absolvere. See #7absolve 
absolute	1.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	complete; perfect.
absolute	2.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	free from limitations, restrictions, or exceptions; unqualified.
	exam	1	an absolute choice.
absolute	3.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	having unlimited authority; despotic.
	exam	1	an absolute ruler.
absolute	4.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	undoubted; certain.
	exam	1	the absolute truth.
absolute	5.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	not depend?!ent on, conditioned by, or relative to anything else; independ?!ent.
	exam	1	an absolute term in logic;
	exam	2	the absolute value of a quantity in physics.
absolute	6.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	pure; unmixed.
	exam	1	absolute alcohol.
absolute	7.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	of a grammatical construction
	def	syntactically independent of the main clause, as for example the construction in the sentence
absolute	8.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	Grammar. of a transitive verb
	def	used without a direct object, as the verb in the sentence
absolute	9.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	Grammar. of an adjective
	def	used as a noun, as for instance and in the sentence
absolute	10.a.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	postpositive; of a pressure measurement
	def	not relative to atmospheric pressure.
	exam	1	the pressure was 5 bar absolute.
absolute	10.b.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	denoting absolute or thermo?!dynamic temperature.
absolute	11.a.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	def	Also: {{numerical} (sense 4b.)}. (of a value) having a magnitude but no sign.
absolute	11.b.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	of a constant
	def	never changing in value.
absolute	11.c.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	of an inequality
	def	un?!conditional.
absolute	11.d.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	of a term
	def	not containing a variable.
absolute	12.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	Law. of a court order or decree
	def	coming into effect immediately and not liable to be modified; final. See {decree absolute}.
absolute	13.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	adj.
	usage	Law. of a title to property, etc.
	def	not subject to any encumbrance or condition.
absolute	14.
	syl	ab+so+lute
	pron	<1@bs*2lu:t>
	pos	n.
	def	something that is absolute.
Absolute	1.a.
	syl	Ab+so+lute
	pron	<1@bs*2lu:t>
	pos	n.
	usage	sometimes not cap.
	def	the ultimate basis of reality.
Absolute	1.b.
	syl	Ab+so+lute
	pron	<1@bs*2lu:t>
	pos	n.
	usage	sometimes not cap.
	def	that which is totally un?!conditioned, unrestricted, pure, perfect, or complete.
Absolute	2.
	syl	Ab+so+lute
	pron	<1@bs*2lu:t>
	pos	n.
	usage	sometimes not cap.; in the philosophy of Hegel
	def	that towards which all things evolve dialectically.
absolute alcohol	0.
	syl	ab+so+lute al+co+hol
	pos	n.
	def	a liquid containing at least 99 per cent of pure ethanol by weight.
absolute ceiling	0.
	syl	ab+so+lute ceil+ing
	pos	n.
	def	the maximum height above sea level, usually measured in feet or metres, at which an aircraft can maintain horizontal flight. Compare {service ceiling}.
absolute humidity	0.
	syl	ab+so+lute hu+mid+i:ty
	pos	n.
	def	the humidity of the atmosphere expressed as the number of grams of water contained in 1 cubic metre of air. Compare {relative humidity}.
absolutely	1.
	syl	ab+so+lute+ly
	pron	<2@bs*1lu:tli>
	pos	adv.
	def	in an absolute manner, esp. completely or perfectly.
absolutely	2.
	syl	ab+so+lute+ly
	pron	<2@bs*1lu:tli>
	pos	adv.
	usage	sentence substitute
	def	yes; certainly; unquestionably.
absolute magnitude	0.
	syl	ab+so+lute mag+ni+tude
	pos	n.
	def	the magnitude a given star would have if it were situated at a distance of 10 parsecs (32.6 light years) from the earth.
absolute majority	0.
	syl	ab+so+lute ma+jor+i:ty
	pos	n.
	def	a majority of over 50 per cent, such as the total number of votes or seats obtained by a party that beats the combined opposition. Compare {relative majority}.
absolute monarchy	0.
	syl	ab+so+lute mon+ar+chy
	pos	n.
	def	a monarchy without constitutional limits. Compare {constitutional monarchy}.
absolute music	0.
	syl	ab+so+lute mu+sic
	pos	n.
	def	music that is not designed to depict or evoke any scene or event. Compare {programme music}.
absolute pitch	1.
	syl	ab+so+lute pitch
	pos	n.
	def	the ability to identify or to reproduce the pitch of a note.
absolute pitch	2.
	syl	ab+so+lute pitch
	pos	n.
	def	the exact pitch of a note determined by vibration per second. {~} Also called (not in technical usage): {perfect pitch}. Compare {relative pitch}.
absolute temperature	0.
	syl	ab+so+lute tem+per:a+ture
	pos	n.
	def	another name for {thermodynamic temperature}.
absolute unit	1.
	syl	ab+so+lute u:nit
	pos	n.
	def	a unit of measurement forming part of the electromagnetic cgs system, such as an abampere or abcoulomb.
absolute unit	2.
	syl	ab+so+lute u:nit
	pos	n.
	def	a unit of measurement forming part of a system of units that includes a unit of force defined so that it is independent of the acceleration of free fall.
absolute value	1.
	syl	ab+so+lute val:ue
	pos	n.
	def	the magnitude of a real number or quantity regardless of its sign. The absolute value of - is written #800002 -
absolute value	2.
	syl	ab+so+lute val:ue
	pos	n.
	def	Also called: {modulus}. the positive square root of the sum of the squares of the real and imaginary parts of a complex number: #800004 4+3 =+$/#800006 (4%2+3%2) =5.
absolute viscosity	0.
	syl	ab+so+lute vis+cos+i:ty
	pos	n.
	def	a full name for {viscosity}, used to distinguish it from kinematic viscosity and specific viscosity.
absolute zero	0.
	syl	ab+so+lute ze:ro
	pos	n.
	def	the lowest temperature theoretically attainable, at which the particles constituting matter would be at rest; the zero of thermodynamic temperature; zero on the International Practical Scale of Temperature: equivalent to -273.15?%C or -459.67?%F.
absolution	ety	C12: from Latin absol*_uti*_on- acquittal, forgiveness of sins, from absolvere to #7absolve 
absolution	1.
	syl	ab+so+lu+tion
	pron	<2@bs*1lu:S*n>
	pos	n.
	def	the act of absolving or the state of being absolved; release from guilt, obligation, or punishment.
absolution	2.a.
	syl	ab+so+lu+tion
	pron	<2@bs*1lu:S*n>
	pos	n.
	def	a formal remission of sin pronounced by a priest in the sacrament of penance.
absolution	2.b.
	syl	ab+so+lu+tion
	pron	<2@bs*1lu:S*n>
	pos	n.
	def	the prescribed form of words granting such a remission.
absolutory	sub
	head	absolution
	syl	ab+sol:u+to:ry
	pron	<@b1soljut*ri>, <-tri>
	pos	adj.
absolutism	1.
	syl	ab+so+lut+ism
	pron	<1@bs*lu:2tiz*m>
	pos	n.
	def	the principle or practice of a political system in which unrestricted power is vested in a monarch, dictator, etc.; despotism.
absolutism	2.
	syl	ab+so+lut+ism
	pron	<1@bs*lu:2tiz*m>
	pos	n.
	qual	Philosophy.
	def	the doctrine of the existence of an absolute or nonrelative being.
absolutism	3.
	syl	ab+so+lut+ism
	pron	<1@bs*lu:2tiz*m>
	pos	n.
	qual	Theol.
	def	an uncompromising form of the doctrine of predestination.
absolve	ety	C15: from Latin absolvere to free from, from #7ab -%1#7+ solvere to make loose
absolve	1.
	syl	ab+solve
	pron	<*b1zolv>
	pos	vb.
	mod	tr.
	usage	usually foll. by from
	def	to release from blame, sin, punishment, obligation, or responsibility.
absolve	2.
	syl	ab+solve
	pron	<*b1zolv>
	pos	vb.
	mod	tr.
	def	to pronounce not guilty; acquit; pardon.
absolvable	sub
	head	absolve
	syl	ab+1solv+a:ble
	pos	adj.
absolver	sub
	head	absolve
	syl	ab+1solv+er
	pos	n.
absonant	ety	C16: Medieval Latin, from Latin #7ab -%1#7+ sonant-, from son*_ans sounding. Compare #7consonant 
absonant	0.
	syl	ab+so+nant
	pron	<1@bs*n*nt>
	pos	adj.
	qual	Archaic.
	def	discordant or inharmoni?!ous.
absorb	ety	C15: via Old French from Latin absorb*_ere to suck, swallow, from {#7ab -%1}#7+ sorb*_ere to suck
absorb	1.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	def	to soak or suck up (liquids).
absorb	2.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	def	to engage or occupy (the interest, attention, or time) of (someone); engross.
absorb	3.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	def	to receive or take in (the energy of an impact).
absorb	4.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	qual	Physics.
	def	to take in all or part of incident radiated energy and retain it without reflection or transmission.
absorb	5.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	def	to take in or assimilate; incorporate.
absorb	6.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	def	to accept and find a market for (goods, etc.).
absorb	7.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	def	to pay for as part of a commercial transaction.
	exam	1	the distributor absorbed the cost of transport.
absorb	8.
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	qual	Chem.
	def	to undergo or cause to undergo a process in which one substance, usually a liquid or gas, permeates into or is dissolved by a liquid or solid.
	exam	1	porous solids absorb water;
	exam	2	hydrochloric acid absorbs carbon dioxide.
absorb	xref
	syl	ab+sorb
	pron	<*b1sc:b>, <-1zc:b>
	pos	vb.
	mod	tr.
	def	Compare {{adsorb}}.
absorbability	sub
	head	absorb
	syl	ab+2sorb+a:1bil+i:ty
	pos	n.
absorbable	sub
	head	absorb
	syl	ab+1sorb+a:ble
	pos	adj.
absorbance	0.a.
	syl	ab+sorb+ance
	pron	<*b1sc:b*ns>, <-1zc:->
	pos	n.
	qual	Physics.
	def	the logarithm to base ten of internal transmittance.
absorbance	0.b.
	syl	ab+sorb+ance
	pron	<*b1sc:b*ns>, <-1zc:->
	pos	n.
	qual	Physics.
	def	another term for {transmission density}.
absorbed	0.
	syl	ab+sorbed
	pron	<*b1sc:bd>, <-1zc:bd>
	pos	adj.
	def	engrossed; deeply interested.
absorbedly	sub
	head	absorbed
	syl	ab+sorb+ed+ly
	pron	<*b1sc:bidli>, <-1zc:->
	pos	adv.
absorbefacient	1.
	syl	ab+sor+be+fa+cient
	pron	<*b2sc:bi1fAS*nt>, <-2zc:->
	pos	n.
	qual	Med.
	def	a medicine or other agent that promotes absorption.
absorbefacient	2.
	syl	ab+sor+be+fa+cient
	pron	<*b2sc:bi1fAS*nt>, <-2zc:->
	pos	adj.
	qual	Med.
	def	causing or promoting absorption.
absorbent	1.
	syl	ab+sorb+ent
	pron	<*b1sc:b*nt>, <-1zc:->
	pos	adj.
	def	able to absorb.
absorbent	2.
	syl	ab+sorb+ent
	pron	<*b1sc:b*nt>, <-1zc:->
	pos	n.
	def	a substance that absorbs.
absorbency	sub
	head	absorbent
	syl	ab+1sorb+en+cy
	pos	n.
absorbent cotton	0.
	syl	ab+sorb+ent cot+ton
	pos	n.
	def	the usual U.S. term for { {cotton wool} (sense 1)}.
absorber	1.
	syl	ab+sorb+er
	pron	<*b1sc:b*>, <-1zc:->
	pos	n.
	def	a person or thing that absorbs.
absorber	2.
	syl	ab+sorb+er
	pron	<*b1sc:b*>, <-1zc:->
	pos	n.
	qual	Physics.
	def	a material, esp. in a nuclear reactor, that absorbs radiation or causes it to lose energy.
absorbing	0.
	syl	ab+sorb+ing
	pron	<*b1sc:biG>, <-1zc:b->
	pos	adj.
	def	occupying one's interest or attention; engrossing; gripping.
absorbingly	sub
	head	absorbing
	syl	ab+1sorb+ing+ly
	pos	adv.
absorptance	ety	C20: #7absorption+ -#7ance
absorption factor	alt
	head	absorptance
	or	absorptance
	syl	ab+sorp+tion fac+tor
	pos	n.
absorptance	0.
	or	absorption factor
	syl	ab+sorp+tance
	pron	<*b1sc:pt*ns>, <-1zc:p->
	pos	n.
	qual	Physics.
	def	a measure of the ability of an object or surface to absorb radiation, equal to the ratio of the absorbed flux to the incident flux. For a plate of material the ratio of the flux absorbed between the entry and exit surfaces to the flux leaving the entry surface is the {internal absorptance}. Symbol: #Ga Compare {reflectance, transmittance}.
absorption	ety	C16: from Latin absorpti*_on-, from ab?!sorb*_ere to #7absorb 
absorption	1.
	syl	ab+sorp+tion
	pron	<*b1sc:pS*n>, <-1zc:p->
	pos	n.
	def	the process of absorbing or the state of being absorbed.
absorption	2.a.
	syl	ab+sorp+tion
	pron	<*b1sc:pS*n>, <-1zc:p->
	pos	n.
	def	normal assimilation by the tissues of the products of digestion.
absorption	2.b.
	syl	ab+sorp+tion
	pron	<*b1sc:pS*n>, <-1zc:p->
	pos	n.
	def	the process of taking up various gases, fluids, drugs, etc., through the mucous membranes or skin.
absorptive	sub
	head	absorption
	syl	ab+1sorp+tive
	pos	adj.
absorption spectrum	0.
	syl	ab+sorp+tion spec+trum
	pos	n.
	def	the characteristic pattern of dark lines or bands that occurs when electromagnetic radiation is passed through an absorbing medium into a spectroscope. The same pattern occurs as coloured lines or bands in the emission spectrum of that medium.
absorptivity	0.
	syl	ab+sorp+tiv+i:ty
	pron	<2@bsc:p1tiviti>, <-zc:p->
	pos	n.
	qual	Physics.
	def	a measure of the ability of a material to absorb radiation, equal to the internal absorptance of a homogeneous plate of the material under conditions in which the path of the radiation has unit length and the boundaries of the plate have no influence.
absquatulate	ety	C19: humorous formation as if from Latin
absquatulate	0.
	syl	ab+squat:u+late
	pron	<@b1skwotju2lAt>
	pos	vb.
	mod	intr.
	def	to leave; decamp.
abstain	ety	C14: via Old French from Latin abstin*_ere, from abs- #7ab -%1#7+ ten*_ere to hold, keep
abstain	1.
	syl	ab+stain
	pron	<*b1stAn>
	pos	vb.
	mod	intr.
	usage	usually foll. by from
	def	to choose to refrain.
	exam	1	he abstained from alcohol.
abstain	2.
	syl	ab+stain
	pron	<*b1stAn>
	pos	vb.
	mod	intr.
	usage	usually foll. by from
	def	to refrain from voting, esp. in a committee, legislature, etc.
abstainer	sub
	head	abstain
	syl	ab+1stain+er
	pos	n.
abstemious	ety	C17: from Latin abst*_emius, from abs- #7ab -%1#7+ t*_em-, from t*_em*_etum intoxicating drink
abstemious	0.
	syl	ab+ste+mi+ous
	pron	<*b1stEmi*s>
	pos	adj.
	def	moderate or sparing, esp. in the consumption of alcohol or food; temperate.
abstemiously	sub
	head	abstemious
	syl	ab+1ste+mi+ous+ly
	pos	adv.
abstention	ety	C16: from Late Latin abstenti*_on-, from Latin abstin*_ere. See #7abstain 
abstention	1.
	syl	ab+sten+tion
	pron	<*b1stenS*n>
	pos	n.
	def	a voluntary decision not to act; the act of refraining or abstaining.
abstention	2.
	syl	ab+sten+tion
	pron	<*b1stenS*n>
	pos	n.
	def	the act of withholding one's vote.
abstentious	sub
	head	abstention
	syl	ab+1sten+tious
	pos	adj.
abstergent	ety	C17: from Latin abstergent-, abst*_ergens wiping off, from abs- away, off+ terg*_ere to wipe
abstergent	0.
	syl	ab+ster+gent
	pron	<*b1stR:J*nt>
	pos	adj.
	def	cleansing or scouring.
abstinence	ety	C13: via Old French from Latin abstinentia, from abstin*_ere to #7abstain 
abstinence	1.
	syl	ab+sti+nence
	pron	<1@bstin*ns>
	pos	n.
	def	the act or practice of refraining from some action or from the use of something, esp. alcohol.
abstinence	2.
	syl	ab+sti+nence
	pron	<1@bstin*ns>
	pos	n.
	qual	Chiefly R.C. Church.
	def	the practice of refraining from specific kinds of food or drink, esp. from meat, as an act of penance.
abstract	ety	C14 (in the sense: extracted): from Latin abstractus drawn off, removed from (something specific), from abs- #7ab -%1#7+ trahere to draw
abstract	1.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	adj.
	def	having no reference to material objects or specific examples; not concrete.
abstract	2.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	adj.
	def	not applied or practical; theoretical.
abstract	3.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	adj.
	def	hard to understand; recondite; abstruse.
abstract	4.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	adj.
	qual	Fine arts.
	def	characterized by geometric, formalized, or otherwise nonrepresentational qualities.
abstract	5.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	n.
	def	a condensed version of a piece of writing, speech, etc.; summary.
abstract	6.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	n.
	def	an abstract term or idea.
abstract	7.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	n.
	def	an abstract painting, sculpture, etc.
in the abstract	8.
	head	abstract
	syl	in the abstract.
	def	without reference to specific circumstances or practical experience.
abstract	9.
	syl	ab+stract
	pron	<@b1str@kt>
	pos	vb.
	mod	tr.
	def	to think of (a quality or concept) generally without reference to a specific example; regard theoretically.
abstract	10.
	syl	ab+stract
	pron	<1@bstr@kt>
	pos	vb.
	mod	also; intr.
	def	to summarize or epitomize.
abstract	11.
	syl	ab+stract
	pron	<@b1str@kt>
	pos	vb.
	mod	tr.
	def	to remove or extract.
abstract	12.
	syl	ab+stract
	pron	<@b1str@kt>
	pos	vb.
	mod	tr.
	qual	Euphemistic.
	def	to steal.
abstracted	1.
	syl	ab+stract+ed
	pron	<@b1str@ktid>
	pos	adj.
	def	lost in thought; preoccu?!pied.
abstracted	2.
	syl	ab+stract+ed
	pron	<@b1str@ktid>
	pos	adj.
	def	taken out or separated; extracted.
abstractedly	sub
	head	abstracted
	syl	ab+1stract+ed+ly
	pos	adv.
abstractedness	sub
	head	abstracted
	syl	ab+1stract+ed+ness
	pos	n.
abstract expressionism	0.
	syl	ab+stract ex+pres+sion+ism
	pos	n.
	def	a school of painting in New York in the 1940s that combined the spontaneity of expressionism with abstract forms in unpremeditated, apparently random, compositions. See also {action painting, tachisme}.
abstraction	1.
	syl	ab+strac+tion
	pron	<@b1str@kS*n>
	pos	n.
	def	absence of mind; preoccupa?!tion.
abstraction	2.
	syl	ab+strac+tion
	pron	<@b1str@kS*n>
	pos	n.
	def	the process of formulating generalized ideas or concepts by extracting common qualities from specific examples.
abstraction	3.
	syl	ab+strac+tion
	pron	<@b1str@kS*n>
	pos	n.
	def	an idea or concept formulated in this way.
	exam	1	good and evil are abstractions.
abstraction	4.
	syl	ab+strac+tion
	pron	<@b1str@kS*n>
	pos	n.
	def	an abstract painting, sculpture, etc.
abstraction	5.
	syl	ab+strac+tion
	pron	<@b1str@kS*n>
	pos	n.
	def	the act of withdrawing or removing.
abstractive	sub
	head	abstraction
	syl	ab+1strac+tive
	pos	adj.
abstractively	sub
	head	abstraction
	syl	ab+1strac+tive+ly
	pos	adv.
abstractionism	0.
	syl	ab+strac+tion+ism
	pron	<@b1str@kS*2niz*m>
	pos	n.
	def	the theory and practice of the abstract, esp. of abstract art. &- {ab+#!strac+tion+ist}
abstract noun	0.
	syl	ab+stract noun
	pos	n.
	def	a noun that refers to an abstract concept. Compare {concrete noun}.
abstract of title	0.
	syl	ab+stract of ti+tle
	pos	n.
	qual	Property law.
	def	a summary of the ownership of land, showing the original grant, conveyances, and any incumbrances.
abstriction	ety	C17: from Latin #7ab -%1#7+ strictio a binding, from stringere to bind
abstriction	0.
	syl	ab+stric+tion
	pron	<@b1strikS*n>
	pos	n.
	def	the separation and release of a mature spore from a sporophore by the formation of a septum. This process occurs in some fungi.
abstruse	ety	C16: from Latin abstr*_usus thrust away, concealed, from abs- #7ab -%1#7+ tr*_udere to thrust
abstruse	0.
	syl	ab+struse
	pron	<*b1stru:s>
	pos	adj.
	def	not easy to understand; recondite; esoteric.
abstrusely	sub
	head	abstruse
	syl	ab+1struse+ly
	pos	adv.
abstruseness	sub
	head	abstruse
	syl	ab+1struse+ness
	pos	n.
absurd	ety	C16: via French from Latin absurdus dissonant,@T senseless,@T from@T #7ab -%1@T (intensive)+ surdus@T dull-sounding, indistinct
absurd	1.
	syl	ab+surd
	pron	<*b1sR:d>
	pos	adj.
	def	at variance with reason; incongruous; ridiculous.
absurd	2.
	syl	ab+surd
	pron	<*b1sR:d>
	pos	adj.
	def	ludicrous.
absurdity	sub
	head	absurd
	or	absurdness
	syl	ab+1surd+i:ty
	pos	n.
absurdness	sub
	head	absurd
	or	absurdity
	syl	ab+1surd+ness
	pos	n.
absurdly	sub
	head	absurd
	syl	ab+1surd+ly
	pos	adv.
Abu-Bakr	alt
	head	Abu-Bekr
	or	Abu-Bekr
	syl	A:bu-Bakr
	pron	<*2bu:1b@k*>
	pos	n.
Abu-Bekr	0.
	or	Abu-Bakr
	syl	A:bu-Bekr
	pron	<*2bu:1bek*>
	pos	n.
	def	573-634 #7a.d., father-in-law of Mohammed; the first caliph of Islam.
Abu Dhabi	0.
	syl	Ab:u Dha+bi
	pron	<1@bu:> <1da:bi>
	pos	n.
	def	a sheikdom of SE Arabia, on the S coast of the Persian Gulf: the chief sheikdom and capital of the United Arab Emirates, consisting principally of the port of Abu Dhabi and a desert hinterland; contains major oilfields. Pop.: 65000 (1972 est.). Area: about 10360 sq. km (4000 sq. miles).
Abukir	0.
	syl	A:bu+kir
	pron	<2@bu:1ki*>
	pos	n.
	def	a variant spelling of {Aboukir}.
abulia	ety	C19: New Latin, from Greek aboulia lack of resolution, from #7a -%1#7+ boul*_e will
aboulia	alt
	head	abulia
	or	abulia
	syl	a:bou+li:a
	pron	<*1bu:li*>, <-1bju:->
	pos	n.
abulia	0.
	or	aboulia
	syl	a:bu+li:a
	pron	<*1bu:li*>, <-1bju:->
	pos	n.
	qual	Psychiatry.
	def	a loss of will power.
abulic	sub
	head	abulia
	syl	a:1bu+lic
	pos	adj.
abundance	ety	C14: via Old French from Latin abundantia, from abund*_are to #7abound 
abundance	1.
	syl	a:bun+dance
	pron	<*1b^nd*ns>
	pos	n.
	def	a copious supply; great amount.
abundance	2.
	syl	a:bun+dance
	pron	<*1b^nd*ns>
	pos	n.
	def	fullness or benevolence.
	exam	1	from the abundance of my heart.
abundance	3.
	syl	a:bun+dance
	pron	<*1b^nd*ns>
	pos	n.
	def	degree of plentifulness.
abundance	4.
	syl	a:bun+dance
	pron	<*1b^nd*ns>
	pos	n.
	qual	Chem.
	def	the extent to which an element occurs in the earth's crust or some other specified environment: expressed in parts per million or as a percent?!age.
abundance	5.
	syl	a:bun+dance
	pron	<*1b^nd*ns>
	pos	n.
	qual	Physics.
	def	the ratio of the number of atoms of a specific isotope in a mixture of isotopes of an element to the total number of atoms present: often expressed as a percentage.
	exam	1	the abundance of neon-22 in natural neon is 8.82 per cent.
abundance	6.
	syl	a:bun+dance
	pron	<*1b^nd*ns>
	pos	n.
	def	Also: {abondance}. a call in solo whist undertaking to make nine tricks.
abundance	7.
	syl	a:bun+dance
	pron	<*1b^nd*ns>
	pos	n.
	def	affluence.
abundant	ety	C14: from Latin abundant-, present participle of abund*_are to #7abound 
abundant	1.
	syl	a:bun+dant
	pron	<*1b^nd*nt>
	pos	adj.
	def	existing in plentiful supply.
abundant	2.
	syl	a:bun+dant
	pron	<*1b^nd*nt>
	pos	adj.
	usage	postpositive; foll. by in
	def	having a plentiful supply (of).
abundant	3.
	syl	a:bun+dant
	pron	<*1b^nd*nt>
	pos	adj.
	usage	of a chemical element or mineral
	def	occurring to an extent specified in relation to other elements or minerals in the earth's crust or some other specified environment.
abundant	4.
	syl	a:bun+dant
	pron	<*1b^nd*nt>
	pos	adj.
	usage	of an isotope
	def	occurring to an extent specified in relation to other isotopes in a mixture of isotopes.
abundantly	sub
	head	abundant
	syl	a:1bun+dant+ly
	pos	adv.
ab urbe condita	0.
	syl	ab ur:be con+di+ta
	pron	Latin. <@b> <1R:bi> <1kondit*>
	def	the full form of {A.U.C}.
abuse	ety	C14 (vb.): via Old French from Latin ab*_usus, past participle of ab*_ut*_i to misuse, from #7ab -%1#7+ *_ut*_i to #7use 
abuse	1.
	syl	a:buse
	pron	<*1bju:z>
	pos	vb.
	mod	tr.
	def	to use incorrectly or improperly; misuse.
abuse	2.
	syl	a:buse
	pron	<*1bju:z>
	pos	vb.
	mod	tr.
	def	to maltreat.
abuse	3.
	syl	a:buse
	pron	<*1bju:z>
	pos	vb.
	mod	tr.
	def	to speak insultingly or cruelly to; revile.
abuse	4.
	syl	a:buse
	pron	<*1bju:z>
	pos	vb.
	mod	tr.
	usage	reflexive
	def	to masturbate.
abuse	5.
	syl	a:buse
	pron	<*1bju:s>
	pos	n.
	mod	tr.
	def	improp?!er, incorrect, or excessive use; misuse.
abuse	6.
	syl	a:buse
	pron	<*1bju:s>
	pos	n.
	mod	tr.
	def	maltreatment of a person; injury.
abuse	7.
	syl	a:buse
	pron	<*1bju:s>
	pos	n.
	mod	tr.
	def	insulting, contemptuous, or coarse speech.
abuse	8.
	syl	a:buse
	pron	<*1bju:s>
	pos	n.
	mod	tr.
	def	an evil, unjust, or corrupt practice.
abuse	9.
	syl	a:buse
	pron	<*1bju:s>
	pos	n.
	mod	tr.
	qual	Archaic.
	def	a deception.
abuser	sub
	head	abuse
	syl	a:1bus+er
	pos	n.
Abu Simbel	0.
	syl	Ab:u Sim+bel
	pron	<2@bu:> <1simbL>
	pos	n.
	def	a former village in S Egypt: site of two temples of Rameses II, which were moved to higher ground (1966-67) before the area behind the Aswan High Dam was flooded. Also called: {Ipsambul}.
abusive	1.
	syl	a:bu+sive
	pron	<*1bju:siv>
	pos	adj.
	def	characterized by insulting or coarse language.
abusive	2.
	syl	a:bu+sive
	pron	<*1bju:siv>
	pos	adj.
	def	characterized by maltreatment.
abusive	3.
	syl	a:bu+sive
	pron	<*1bju:siv>
	pos	adj.
	def	incorrectly used; corrupt.
abusively	sub
	head	abusive
	syl	a:1bu+sive+ly
	pos	adv.
abusiveness	sub
	head	abusive
	syl	a:1bu+sive+ness
	pos	n.
abut	ety	C15: from Old French abouter to join at the ends, border on; influenced by abuter to touch at an end, buttress
abuts	infl
	head	abut
	syl	a:buts
	pos	vb.
abutting	infl
	head	abut
	syl	a:but+ting
	pos	vb.
abutted	infl
	head	abut
	syl	a:but+ted.
	pos	vb.
abut	0.
	syl	a:but
	pron	<*1b^t>
	pos	vb.
	usage	usually foll. by on, upon, or against
	def	to adjoin, touch, or border on (something) at one end.
abuttal	sub
	head	abut
	syl	a:1but+tal
	pos	n.
abutilon	ety	C18: New Latin from Arabic
abutilon	0.
	syl	a:bu+ti+lon
	pron	<*1bju:til*n>
	pos	n.
	def	any shrub or herbaceous plant of the malvaceous genus such as the flowering maple, that have showy white, yellow, or red flowers.
abuttal	alt
	head	abutment
	or	abutment
	syl	a:but+tal
	pos	n.
abutment	1.
	or	abuttal
	syl	a:but+ment
	pron	<*1b^tm*nt>
	pos	n.
	def	the state or process of abutting.
abutment	2.a.
	or	abuttal
	syl	a:but+ment
	pron	<*1b^tm*nt>
	pos	n.
	def	something that abuts.
abutment	2.b.
	or	abuttal
	syl	a:but+ment
	pron	<*1b^tm*nt>
	pos	n.
	def	the thing on which something abuts.
abutment	2.c.
	or	abuttal
	syl	a:but+ment
	pron	<*1b^tm*nt>
	pos	n.
	def	the point of junction between them.
abutment	3.
	or	abuttal
	syl	a:but+ment
	pron	<*1b^tm*nt>
	pos	n.
	qual	Architect., civil engineering.
	def	a construction that takes the thrust of an arch or vault or supports the end of a bridge.
abuttals	0.
	syl	a:but+tals
	pron	<*1b^tLz>
	pos	n.
	mod	pl.
	qual	Property law.
	def	the boundaries of a plot of land where it abuts against other property.
abutter	0.
	syl	a:but+ter
	pron	<*1b^t*>
	pos	n.
	qual	Property law.
	def	the owner of adjoining property.
abuzz	0.
	syl	a:buzz
	pron	<*1b^z>
	pos	adj.
	usage	postpositive
	def	humming, as with conversa?!tion, activity, etc.; buzzing.
abvolt	0.
	syl	ab+volt
	pron	<1@b2v*ult>
	pos	n.
	def	the cgs unit of potential difference in the electromagnetic system; the potential difference between two points when work of 1 erg must be done to transfer 1 abcoulomb of charge from one point to the other: equivalent to 10%#-%8 volt.
abwatt	0.
	syl	ab+watt
	pron	<1@b2wot>
	pos	n.
	def	the cgs unit of power in the electro?!magnetic system, equal to the power dissipated when a current of 1 abampere flows across a potential difference of 1 abvolt: equivalent to 10%#-%7 watt.
aby	ety	Old English *_abycgan to pay for, atone for, from bycgan to buy
abye	alt
	head	aby
	or	aby
	syl	a:bye
	pron	<*1bI>
	pos	vb.
	mod	tr.
abys	infl
	head	aby
	or	abyes
	syl	a:bys
	pos	vb.
	mod	tr.
abyes	infl
	head	aby
	or	abys
	syl	a:byes
	pos	vb.
	mod	tr.
abying	infl
	head	aby
	syl	a:by+ing
	pos	vb.
	mod	tr.
abought	infl
	head	aby
	syl	a:bought.
	pos	vb.
	mod	tr.
aby	0.
	or	abye
	syl	a:by
	pron	<*1bI>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to pay the penalty for; redeem.
Abydos	1.
	syl	A:by+dos
	pron	<*1bId*s>
	pos	n.
	def	an ancient town in central Egypt: site of many temples and tombs.
Abydos	2.
	syl	A:by+dos
	pron	<*1bId*s>
	pos	n.
	def	an ancient Greek colony on the Asiatic side of the Dardanelles (Hellespont): scene of the legend of Hero and Leander.
abysm	ety	C13: via Old French from Medieval Latin abysmus #7abyss 
abysm	0.
	syl	a:bysm
	pron	<*1biz*m>
	pos	n.
	def	an archaic word for {abyss}.
abysmal	1.
	syl	a:bys+mal
	pron	<*1bizm*l>
	pos	adj.
	def	immeasurable; very great.
	exam	1	abysmal stupidity.
abysmal	2.
	syl	a:bys+mal
	pron	<*1bizm*l>
	pos	adj.
	qual	Informal.
	def	extremely bad.
	exam	1	an abysmal film.
abysmally	sub
	head	abysmal
	syl	a:1bys+mal+ly
	pos	adv.
abyss	ety	C16: via Late Latin from Greek abussos bottomless (as in the phrase abussos limn*_e bottomless lake), from #7a -%1#7+ bussos depth
abyss	1.
	syl	a:byss
	pron	<*1bis>
	pos	n.
	def	a very deep or unfathomable gorge or chasm.
abyss	2.
	syl	a:byss
	pron	<*1bis>
	pos	n.
	def	anything that appears to be endless or immeasurably deep, such as time, despair, or shame.
abyss	3.
	syl	a:byss
	pron	<*1bis>
	pos	n.
	def	hell or the infernal regions conceived of as a bottomless pit.
abyssal	1.
	syl	a:bys+sal
	pron	<*1bis*l>
	pos	adj.
	def	at or belonging to the depths or floor of the ocean.
abyssal	2.
	syl	a:bys+sal
	pron	<*1bis*l>
	pos	adj.
	qual	Geology.
	def	another word for {plutonic}.
Abyssinia	0.
	syl	Ab+ys+sin:i:a
	pron	<2@bi1sini*>
	pos	n.
	def	a former name for {Ethiopia}.
Abyssinian	sub
	head	Abyssinia
	syl	Ab+ys+1sin+i:an
	pos	adj. n.
Abyssinian cat	0.
	syl	Ab+ys+sin+i:an cat
	pos	n.
	def	a variety of cat with a long body and a short brown coat with black or dark brown markings.
Ac	0.
	syl	Ac
	usage	the chemical symbol for
	def	actinium.
ac	ety	Latin: before meals
ac	0.
	syl	a.c.
	usage	abbrev. for in prescriptions
	def	ante cibum.
AC	0.
	syl	AC
	qual	abbrev. for
	def	alternating current. Compare {DC}.
AC	ety	Latin: before Christ
AC	1.
	syl	A.C.
	qual	abbrev. for:
	def	ante Christum.
AC	2.
	syl	A.C.
	qual	abbrev. for:
	def	Air Corps.
AC	3.
	syl	A.C.
	qual	abbrev. for:
	def	athletic club.
ac	1.
	syl	a/c
	qual	Book-keeping. abbrev. for:
	def	account.
ac	2.
	syl	a/c
	qual	Book-keeping. abbrev. for:
	def	account current.
acacia	ety	C16: from Latin, from Greek akakia, perhaps related to ak*_e point
acacia	1.
	syl	a:ca+cia
	pron	<*1kAS*>
	pos	n.
	def	any shrub or tree of the tropical and subtropical mimosaceous genus having compound or reduced leaves and small yellow or white flowers. See also {wattle} (sense 4).
false acacia	2.
	head	acacia
	syl	false acacia.
	def	another name for { {locust} (senses 2, 3)}.
gum acacia	3.
	head	acacia
	syl	gum acacia.
	def	another name for {gum arabic}.
academe	ety	C16: first used by Shakespeare in Love's Labour's Lost (1588); see #7academy 
academe	1.
	syl	ac:a+deme
	pron	<1@k*2dEm>
	pos	n.
	qual	Literary.
	def	any place of learning, such as a college or university.
the grove(s) of Academe	2.
	head	academe
	syl	the grove(s) of Academe.
	qual	Literary.
	def	the academic world.
academia	0.
	syl	ac:a+dem:i:a
	pron	<2@k*1dEmi*>
	pos	n.
	def	the academic world.
academic	1.
	syl	ac:a+dem+ic
	pron	<2@k*1demik>
	pos	adj.
	def	belonging or relating to a place of learning, esp. a college, university, or academy.
academic	2.
	syl	ac:a+dem+ic
	pron	<2@k*1demik>
	pos	adj.
	def	of purely theoretical or speculative interest.
	exam	1	an academic argument.
academic	3.
	syl	ac:a+dem+ic
	pron	<2@k*1demik>
	pos	adj.
	def	excessively concerned with intellectual matters and lacking experience of practical affairs.
academic	4.
	syl	ac:a+dem+ic
	pron	<2@k*1demik>
	pos	adj.
	def	conforming to set rules and traditions; conventional.
	exam	1	an academic painter.
academic	5.
	syl	ac:a+dem+ic
	pron	<2@k*1demik>
	pos	adj.
	qual	Chiefly U.S.
	def	relating to studies such as languages, philosophy, and pure science, rather than technical or professional studies.
academic	6.
	syl	ac:a+dem+ic
	pron	<2@k*1demik>
	pos	n.
	def	a member of a college or university. &- {@!ac@.a+#!dem+i@.cal+ly}
academicals	0.
	syl	ac:a+dem+i:cals
	pron	<2@k*1demikLz>
	pos	n.
	mod	pl.
	def	another term for {academ?!ic dress}.
academic dress	0.
	syl	ac:a+dem+ic dress
	pos	n.
	def	formal dress, usually comprising cap, gown, and hood, worn by university staff and students.
academician	0.
	syl	a:cad+e:mi+cian
	pron	<*2k@d*1miS*n>, <2@k*d*->
	pos	n.
	def	a member of an Academy (sense 2).
academism	alt
	head	academicism
	or	academicism
	syl	a:cad+e:mism
	pron	<*1k@d*?!2miz*m>
	pos	n.
academicism	0.
	or	academism
	syl	ac:a+dem:i+cism
	pron	<2@k*1demi2siz*m>
	pos	n.
	def	adherence to rules and traditions in art, literature, etc.; conventionalism.
academy	ety	C16: via Latin from Greek akad*_emeia name of the grove where Plato taught, named after the legendary hero Akad*_emos 
academies	infl
	head	academy
	syl	a:cad+e:mies.
	pos	n.
	mod	pl.
academy	1.
	syl	a:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	def	an institution or society for the advancement of literature, art, or science.
academy	2.
	syl	a:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	def	a school for training in a particular skill or profession.
	exam	1	a military acad?!emy.
academy	3.
	syl	a:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	def	a secondary school, esp. a private one.
academy	4.
	syl	a:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	usage	in Scotland
	def	a fee-paying secondary day school.
the	infl
	head	Academy
	syl	the.
	pos	n.
Academy	1.a.
	syl	A:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	def	the grove or garden near Athens where Plato taught in the late 4th century #7b.c.
Academy	1.b.
	syl	A:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	def	the school of philosophy founded by Plato.
Academy	1.c.
	syl	A:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	def	the members of this school and their successors.
Academy	2.
	syl	A:cad+e:my
	pron	<*1k@d*mi>
	pos	n.
	def	short for the {French Academy, Royal Academy}, etc.
Acadia	1.a.
	syl	A:ca+di:a
	pron	<*1kAdi*>
	pos	n.
	def	the Maritime Provinces of Canada.
Acadia	1.b.
	syl	A:ca+di:a
	pron	<*1kAdi*>
	pos	n.
	def	the French-speaking areas of these provinces.
Acadia	2.
	syl	A:ca+di:a
	pron	<*1kAdi*>
	pos	n.
	usage	formerly
	def	a French colony in the present-day Maritime Provinces: ceded to Britain in 1713.
Acadia	xref
	syl	A:ca+di:a
	pron	<*1kAdi*>
	pos	n.
	def	French name: {A@.ca+die} (aka#!di).
Acadian	1.
	syl	A:ca+di:an
	pron	<*1kAdi*n>
	pos	adj.
	def	denoting or relating to Acadia or its inhabitants.
Acadian	2.
	syl	A:ca+di:an
	pron	<*1kAdi*n>
	pos	n.
	def	any of the early French settlers in Nova Scotia, many of whom were deported to Louisiana in the 18th century. See also {Cajun}.
acajou	ety	C18: via French from Portuguese acaj*'u, from Tupi
acajou	1.
	syl	ac:a+jou
	pron	<1@k*2Zu:>
	pos	n.
	def	a type of mahogany used by cabinet-makers in France.
acajou	2.
	syl	ac:a+jou
	pron	<1@k*2Zu:>
	pos	n.
	def	a less common name for {cashew}.
acaleph	ety	C18: from New Latin, from Greek akal*_eph*_e a sting
acaleph	0.
	syl	ac:a+leph
	pron	<1@k*2lef>
	pos	n.
	qual	Obsolete.
	def	any of the coelenterates of the former taxonomic group which included the jellyfishes.
acanthaceous	1.
	syl	ac+an+tha+ceous
	pron	<2@k*n1TAS*s>
	pos	adj.
	def	of or relating to the a mainly tropical and subtropical family of flowering plants that includes the acanthus.
acanthaceous	2.
	syl	ac+an+tha+ceous
	pron	<2@k*n1TAS*s>
	pos	adj.
	def	having spiny or prickly outgrowths.
acanthine	1.
	syl	a:can+thine
	pron	<*1k@nTIn>, <-TEn>
	pos	adj.
	def	of or resembling an acanthus.
acanthine	2.
	syl	a:can+thine
	pron	<*1k@nTIn>, <-TEn>
	pos	adj.
	def	decorated with acanthus leaves.
acantho-	ety	New Latin from Greek akanthos thorn plant, from akantha thorn
acanthocephalan	1.
	syl	a:can+tho+ceph:a+lan
	pron	<*2k@nT*u1sef*l*n>
	pos	n.
	def	any of the parasitic wormlike invertebrates of the phylum the adults of which have a spiny proboscis and live in the intestines of vertebrates.
acanthocephalan	2.
	syl	a:can+tho+ceph:a+lan
	pron	<*2k@nT*u1sef*l*n>
	pos	adj.
	def	of, relating to, or belonging to the
acanthoid	0.
	syl	a:can+thoid
	pron	<*1k@nTcid>
	pos	adj.
	def	resembling a spine; spiny.
acanthopterygian	ety	C19: from New Latin Acanthopterygii, from #7acantho -#7+ Greek pter*'ugion fin
acanthopterygian	1.
	syl	ac+an+thop+ter+yg+i:an
	pron	<2@k*n2Topt*1riJi*n>
	pos	adj.
	def	of, relat?!ing to, or belonging to the a large group of teleost fishes having spiny fin rays. The group includes most saltwater bony fishes.
acanthopterygian	2.
	syl	ac+an+thop+ter+yg+i:an
	pron	<2@k*n2Topt*1riJi*n>
	pos	n.
	def	any fish belonging to the
acanthopterygian	xref
	syl	ac+an+thop+ter+yg+i:an
	pron	<2@k*n2Topt*1riJi*n>
	pos	adj.
	def	Compare {malacopterygian}.
acanthous	0.
	syl	a:can+thous
	pron	<*1k@nT*s>
	pos	adj.
	def	another term for {spinous}.
acanthus	ety	C17: New Latin, from Greek akanthos, from akantha thorn, spine
acanthuses	infl
	head	acanthus
	or	acanthi
	syl	a:can+thus:es
	pron	<-TI>
	pos	n.
	mod	pl.
acanthi	infl
	head	acanthus
	or	acanthuses
	syl	a:can+thi
	pron	<-TI>
	pos	n.
	mod	pl.
acanthus	1.
	syl	a:can+thus
	pron	<*1k@nT*s>
	pos	n.
	def	any shrub or herbaceous plant of the genus native to the Mediterranean region but widely cultivated as ornamental plants, having large spiny leaves and spikes of white or purplish flowers: family See also {bear's-breech}.
acanthus	2.
	syl	a:can+thus
	pron	<*1k@nT*s>
	pos	n.
	def	a carved ornament based on the leaves of the acanthus plant, esp. as used on the capital of a Corinthian column.
a cappella	ety	Italian: literally, according to (the style of the) chapel
a cappella	0.
	syl	a cap+pel+la
	pron	<a:> <k*1pel*>
	pos	adj. adv.
	qual	Music.
	def	without instrumental accompaniment.
Acapulco	0.
	syl	A:ca+pul+co
	pron	<2@k*1pulk*u>, Spanish <2aka1pulko>
	pos	n.
	def	a port and resort in SW Mexico, in Guerrero state. Pop.: 352673 (1975 est.). Official name: {A@.ca+pul+co de Ju*'a+rez} $de #!$xwares).
acariasis	ety	C19: New Latin. See #7acarus, -#7iasis 
acariasis	0.
	syl	ac:a+ri:a+sis
	pron	<2@k*1rI*sis>
	pos	n.
	def	infestation of the hair follicles and skin with acarids, esp. mites.
acarid	ety	C19: from #7acarus 
acaridan	alt
	head	acarid
	or	acarid
	syl	a:car:i+dan
	pron	<*1k@ridN>
	pos	n.
acarid	1.
	or	acaridan
	syl	ac:a+rid
	pron	<1@k*rid>
	pos	n.
	def	any of the small arachnids of the order (or which includes the ticks and mites.
acarid	2.
	or	acaridan
	syl	ac:a+rid
	pron	<1@k*rid>
	pos	adj.
	def	of or relating to the order
acaroid	ety	C19: see #7acarus, -#7oid 
acaroid	0.
	syl	ac:a+roid
	pron	<1@k*2rcid>
	pos	adj.
	def	resembling a mite or tick.
acaroid gum	ety	C19 acaroid, of uncertain origin (apparently not related to #7acarus) 
acaresin	alt
	head	acaroid gum
	or	acaroid gum
	syl	ac:a+res+in
	pos	n.
acaroid gum	0.
	or	acaresin
	syl	ac:a+roid gum
	pos	n.
	def	a red alcohol-soluble resin that exudes from various species of grass tree, esp. and is used in varnishes, for coating paper, etc. Also called: {gum accroides}.
acarology	0.
	syl	ac:a+rol+o:gy
	pron	<2@k*1rol*Ji>
	pos	n.
	def	the study of mites and ticks.
acarpelous	alt
	head	acarpellous
	or	acarpellous
	syl	a:car+pel+ous
	pron	<A1ka:p*l*s>
	pos	adj.
	qual	U.S.
acarpellous	0.
	or	acarpelous
	syl	a:car+pel+lous
	pron	<A1ka:p*l*s>
	pos	adj.
	usage	of flowers
	def	having no carpels.
acarpous	ety	from Greek akarpos, from #7a -%1#7+ karpos fruit
acarpous	0.
	syl	a:car+pous
	pron	<A1ka:p*s>
	pos	adj.
	usage	of plants
	def	producing no fruit.
acarus	ety	C17: New Latin, from Greek akari a small thing, a mite
acari	infl
	head	acarus
	syl	ac:a+ri
	pron	<-2rI>
	pos	n.
	mod	pl.
acarus	0.
	syl	ac:a+rus
	pron	<1@k*r*s>
	pos	n.
	def	any of the free-living mites of the widely distributed genus several of which, esp. are serious pests of stored flour, grain, etc.
ACAS	0.
	syl	ACAS
	pron	<1Ak@s>
	pos	n.
	usage	in Britain; acronym for
	def	Advisory Conciliation and Arbitration Service.
acatalectic	ety	C16: via Late Latin from Greek akatal*_ektikos. See #7a -%1#7, catalectic 
acatalectic	1.
	syl	a:cat:a+lec+tic
	pron	<@2k@t*1lektik>
	pos	adj.
	qual	Prosody.
	def	having the necessary number of feet or syllables, esp. having a complete final foot.
acatalectic	2.
	syl	a:cat:a+lec+tic
	pron	<@2k@t*1lektik>
	pos	n.
	qual	Prosody.
	def	a verse having the full number of syllables.
acaudate	alt
	head	acaudal
	or	acaudal
	syl	a:cau+date
	pos	adj.
acaudal	0.
	or	acaudate
	syl	a:cau+dal
	pron	<A1kc:dL>
	pos	adj.
	qual	Zoology.
	def	having no tail.
acaulescent	0.
	syl	a:cau+les+cent
	pron	<2@kc:1lesNt>
	pos	adj.
	def	having no visible stem or a very short one.
acc	1.
	syl	acc.
	qual	abbrev. for:; Commerce.
	def	acceptance.
acc	2.
	syl	acc.
	qual	abbrev. for:
	def	accompa?!nied.
acc	3.
	syl	acc.
	qual	abbrev. for:
	def	according.
acc	4.
	syl	acc.
	qual	abbrev. for:; Book-keeping.
	def	account.
acc	5.
	syl	acc.
	qual	abbrev. for:; Grammar.
	def	accusative.
Accad	0.
	syl	Ac+cad
	pron	<1@k@d>
	pos	n.
	def	a variant spelling of {Akkad}.
accede	ety	C15: from Latin acc*_edere to approach, agree, from ad- to+ c*_edere to go, yield
accede	1.
	syl	ac+cede
	pron	<@k1sEd>
	pos	vb.
	mod	intr.
	usage	usually foll. by to
	def	to assent or give one's consent; agree.
accede	2.
	syl	ac+cede
	pron	<@k1sEd>
	pos	vb.
	mod	intr.
	usage	usually foll. by to
	def	to enter upon or attain (to an office, right, etc.).
	exam	1	the prince acceded to the throne.
accede	3.
	syl	ac+cede
	pron	<@k1sEd>
	pos	vb.
	mod	intr.
	qual	International law.
	usage	usually foll. by to
	def	to become a party (to an agreement between nations, etc.), as by signing a treaty.
accedence	sub
	head	accede
	syl	ac+1ced+ence
	pos	n.
acceder	sub
	head	accede
	syl	ac+1ced+er
	pos	n.
accel	0.
	syl	accel.
	qual	abbrev. for
	def	accelerando.
accelerando	ety	Italian
	infl
	head	accelerando
	syl	~
	pos	adj. adv.
	qual	Music.
accelerando	1.
	syl	ac+cel+er+an+do
	pron	<@k2sel*1r@nd*u>
	pos	adj. adv.
	def	be?!coming faster. {~} {+dos}.
accelerando	2.
	syl	ac+cel+er+an+do
	pron	<@k2sel*1r@nd*u>
	pos	adj. adv.
	def	an increase in speed.
accelerant	ety	C20: from Latin from acceler*_ans, present participle of acceler*_are to go faster
accelerant	0.
	syl	ac+cel+er+ant
	pron	<@k1sel*r*nt>
	pos	n.
	qual	Chem.
	def	another name for { {accelerator} (sense 3)}.
accelerate	ety	C16: from Latin acceler*_atus, from acceler*_are to go faster, from ad- (intensive)+ celer*_are to hasten, from celer swift
accelerate	1.
	syl	ac+cel+er+ate
	pron	<@k1sel*2rAt>
	pos	vb.
	def	to go, occur, or cause to go or occur more quickly; speed up.
accelerate	2.
	syl	ac+cel+er+ate
	pron	<@k1sel*2rAt>
	pos	vb.
	mod	tr.
	def	to cause to happen sooner than expected.
accelerate	3.
	syl	ac+cel+er+ate
	pron	<@k1sel*2rAt>
	pos	vb.
	mod	tr.
	def	to increase the velocity of (a body, reaction, etc.); cause acceleration.
accelerable	sub
	head	accelerate
	syl	ac+1cel+er+a:ble
	pos	adj.
accelerative	sub
	head	accelerate
	or	acceleratory
	syl	ac+1cel+er:a+tive
	pos	adj.
acceleratory	sub
	head	accelerate
	or	accelerative
	syl	ac+1cel+er:a+to:ry
	pos	adj.
acceleration	1.
	syl	ac+cel+er:a+tion
	pron	<@k2sel*1rAS*n>
	pos	n.
	def	the act of accelerating or the state of being accelerated.
acceleration	2.
	syl	ac+cel+er:a+tion
	pron	<@k2sel*1rAS*n>
	pos	n.
	def	the rate of increase of speed or the rate of change of velocity. Symbol.
	exam	1	a
acceleration of free fall	0.
	syl	ac+cel+er:a+tion of free fall
	pos	n.
	def	the acceleration of a body falling freely in a vacuum in the earth's gravitational field: the standard value is 9.80665 metres per second per second or 32.174 feet per second per second. Symbol.
	exam	1	g
accelerator	1.
	syl	ac+cel+er:a+tor
	pron	<@k1sel*2rAt*>
	pos	n.
	def	a device for increasing speed, esp. a pedal for controlling the fuel intake in a motor vehicle; throttle.
accelerator	2.
	syl	ac+cel+er:a+tor
	pron	<@k1sel*2rAt*>
	pos	n.
	def	Also called (not in technical usage): {atom smasher}. a machine for increasing the kinetic energy of subatomic particles or atomic nuclei and focusing them on a target.
accelerator	3.
	syl	ac+cel+er:a+tor
	pron	<@k1sel*2rAt*>
	pos	n.
	qual	Chem.
	def	a substance that increases the speed of a chemical reaction, esp. one that increases the rate of vulcanization of rubber or the rate of development in photography; catalyst.
accelerometer	0.
	syl	ac+cel+er+om+e:ter
	pron	<@k2sel*1romit*>
	pos	n.
	def	an instrument for measuring acceleration, esp. of an aircraft or rocket.
accent	ety	C14: via Old French from Latin ac?!centus, from ad- to+ cantus chant, song. The Latin is a rendering of Greek pros*_oidia a song sung to music, the tone of a syllable
accent	1.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	the relative prominence of a spoken or sung syllable, esp. with regard to stress or pitch. Compare { {pitch} %1 (sense 26)}, { {stress} (sense 2)}.
accent	2.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	a mark (such as #! , @! , *' , or *` ) used in writing to indicate the stress or prominence of a syllable. Such a mark may also be used to indicate that a written syllable is to be pronounced, esp. when such pronunciation is not usual, as in
accent	3.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	any of various marks or symbols conventionally used in writing certain languages to indicate the quality of a vowel, or for some other purpose, such as differentiation of homographs. See { {acute} (sense 9)}, { {grave} %2 (sense 5)}, { {circumflex}}.
accent	4.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	usage	in some languages, such as Chinese
	def	any of the tones that have phonemic value in distinguishing one word from another. Compare { {tone} (sense 7)}.
accent	5.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	rhythmical stress in verse or prose.
accent	6.a.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	stress placed on certain notes in a piece of music, indicated by a symbol printed over the note concerned.
accent	6.b.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	the rhythmical pulse of a piece or passage, usually represented as the stress on the first beat of each bar. See also {syncopation}.
accent	7.a.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	a superscript symbol used to distinguish between variables represented by the same letter, as in @'#800008 , a @"#800009 .
accent	7.b.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	a superscript symbol indicating the first or a higher derivative of a variable, as in @'#800010 , the second derivative.
accent	8.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	either of two superscript symbols indicating a specific unit, such as feet (@'#800011) , inches (@"#800012) , minutes of arc (@'#800013) , or seconds of arc (@"#800014) .
accent	9.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	the characteristic mode of pronunciation of a person or group, esp. one that betrays social or geographical origin.
accent	10.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	a distinctive characteristic of anything, such as taste, pattern, style, etc.
accent	11.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	particular attention or emphasis.
	exam	1	an accent on learning.
accent	12.
	syl	ac+cent
	pron	<1@ks*nt>
	pos	n.
	def	a strongly contrasting detail.
	exam	1	a blue rug with red accents.
accent	13.
	syl	ac+cent
	pron	<@k1sent>
	pos	vb.
	mod	tr.
	def	to mark with an accent in writing, speech, music, etc.
accent	14.
	syl	ac+cent
	pron	<@k1sent>
	pos	vb.
	mod	tr.
	def	to lay particular emphasis or stress on.
accentor	0.
	syl	ac+cen+tor
	pron	<@k1sent*>
	pos	n.
	def	any small sparrow-like songbirds of the genus family which inhabit mainly mountainous regions of Europe and Asia. See also {hedge sparrow}.
accentual	1.
	syl	ac+cen+tu:al
	pron	<@k1senCu*l>
	pos	adj.
	def	of, relating to, or having accents; rhythmical.
accentual	2.
	syl	ac+cen+tu:al
	pron	<@k1senCu*l>
	pos	adj.
	qual	Prosody.
	def	of or relating to verse based on the number of stresses in a line rather than on the number of syllables. Compare {quantitative}.
accentually	sub
	head	accentual
	syl	ac+1cen+tu+al+ly
	pos	adv.
accentuate	0.
	syl	ac+cen+tu+ate
	pron	<@k1senCu2At>
	pos	vb.
	mod	tr.
	def	to stress or emphasize.
accentuation	sub
	head	accentuate
	syl	ac+2cen+tu:1a+tion
	pos	n.
accept	ety	C14: from Latin accept*_are, from ad- to+ capere to take
accept	1.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to take or receive (something offered).
accept	2.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to give an affirmative reply to.
	exam	1	to accept an invitation.
accept	3.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to take on the responsibilities, duties, etc., of.
	exam	1	he accepted office.
accept	4.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to tolerate or accommodate oneself to.
accept	5.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to consider as true or believe in (a philosophy, theory, etc.).
	exam	1	I cannot accept your argument.
accept	6.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	usage	may take a clause as object
	def	be willing to grant or believe.
	exam	1	you must accept that he lied.
accept	7.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to receive with approval or admit, as into a community, group, etc.
accept	8.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	qual	Commerce.
	def	to agree to pay (a bill, draft, shipping document, etc.), esp. by signing.
accept	9.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to receive as adequate, satisfactory, or valid.
accept	10.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	def	to receive, take, or hold (something applied, inserted, etc.).
accept	11.
	syl	ac+cept
	pron	<*k1sept>
	pos	vb.
	mod	mainly; tr.
	qual	Archaic. (intr.
	def	some?!times foll. by to take or receive an offer, invitation, etc.
accepter	sub
	head	accept
	syl	ac+1cept+er
	pos	n.
acceptable	1.
	syl	ac+cept+a:ble
	pron	<*k1sept*bL>
	pos	adj.
	def	satisfactory; adequate.
acceptable	2.
	syl	ac+cept+a:ble
	pron	<*k1sept*bL>
	pos	adj.
	def	pleasing; welcome.
acceptable	3.
	syl	ac+cept+a:ble
	pron	<*k1sept*bL>
	pos	adj.
	def	tolerable.
acceptability	sub
	head	acceptable
	or	acceptableness
	syl	ac+2cept+a:1bil+i:ty
	pos	n.
acceptableness	sub
	head	acceptable
	or	acceptability
	syl	ac+1cept+a:ble+ness
	pos	n.
acceptably	sub
	head	acceptable
	syl	ac+1cept+a:bly
	pos	adv.
acceptance	1.
	syl	ac+cept+ance
	pron	<*k1sept*ns>
	pos	n.
	def	the act of accepting or the state of being accepted or acceptable.
acceptance	2.
	syl	ac+cept+ance
	pron	<*k1sept*ns>
	pos	n.
	def	favourable reception; approval.
acceptance	3.
	syl	ac+cept+ance
	pron	<*k1sept*ns>
	pos	n.
	usage	often foll. by of
	def	belief (in) or assent (to).
acceptance	4.a.
	syl	ac+cept+ance
	pron	<*k1sept*ns>
	pos	n.
	def	a formal agreement by a debtor to pay a draft, bill, etc.
acceptance	4.b.
	syl	ac+cept+ance
	pron	<*k1sept*ns>
	pos	n.
	def	the document so accepted. Compare {bank acceptance, trade acceptance}.
acceptance	5.
	syl	ac+cept+ance
	pron	<*k1sept*ns>
	pos	n.
	qual	Contract law.
	def	words or conduct by which a person signifies his assent to the terms and conditions of an offer or agreement.
acceptant	0.
	syl	ac+cept+ant
	pron	<*k1sept*nt>
	pos	adj.
	def	receiving willingly; receptive.
acceptation	0.
	syl	ac+cep+ta+tion
	pron	<2@ksep1tAS*n>
	pos	n.
	def	the accepted meaning, as of a word, phrase, etc.
accepted	0.
	syl	ac+cept+ed
	pron	<*k1septid>
	pos	adj.
	def	commonly approved or recognized; customary; established.
acceptedly	sub
	head	accepted
	syl	ac+1cept+ed+ly
	pos	adv.
acceptor	1.
	syl	ac+cep+tor
	pron	<*k1sept*>
	pos	n.
	qual	Commerce.
	def	the person or organization on which a draft or bill of exchange is drawn after liability has been accepted, usually by signature.
acceptor	2.
	syl	ac+cep+tor
	pron	<*k1sept*>
	pos	n.
	def	Also called: {acceptor impurity}. an impurity, such as gallium, added to a semiconductor material to increase its p-type conductivity by increasing the number of holes in the semi?!conductor. Compare {{donor} (sense 5)}.
acceptor	3.
	syl	ac+cep+tor
	pron	<*k1sept*>
	pos	n.
	qual	Chem.
	def	the atom or group that does not supply electrons in a semipolar bond.
acceptor	4.
	syl	ac+cep+tor
	pron	<*k1sept*>
	pos	n.
	qual	Electronics.
	def	a circuit tuned to accept a particular frequency.
access	ety	C14: from Old French or from Latin accessus an approach, from acc*_edere to #7accede 
access	1.
	syl	ac+cess
	pron	<1@kses>
	pos	n.
	def	the act of approaching or entering.
access	2.
	syl	ac+cess
	pron	<1@kses>
	pos	n.
	def	the state or condition of being approachable or easy to enter.
access	3.
	syl	ac+cess
	pron	<1@kses>
	pos	n.
	def	the right or privilege to approach, reach, enter, or make use of something.
access	4.
	syl	ac+cess
	pron	<1@kses>
	pos	n.
	def	a way or means of approach or entry.
access	5.
	syl	ac+cess
	pron	<1@kses>
	pos	n.
	usage	modifier
	def	: designating programmes made by the general public as distinguished from those made by professional broadcasters.
	exam	1	access television.
access	6.
	syl	ac+cess
	pron	<1@kses>
	pos	n.
	def	a sudden outburst or attack, as of rage or disease.
access	7.a.
	syl	ac+cess
	pron	<1@kses>
	pos	vb.
	def	to obtain or retrieve (information) from a storage device.
access	7.b.
	syl	ac+cess
	pron	<1@kses>
	pos	vb.
	def	to place (information) in a storage device. See also {direct access, sequential access}.
accessaries	infl
	head	accessary
	syl	ac+ces+sa+ries.
	pos	n.
	mod	pl.
accessary	0.
	syl	ac+ces+sa+ry
	pron	<*k1ses*ri>
	pos	n.
	qual	Law.
	def	a less common spelling of {accessory}.
accessarily	sub
	head	accessary
	syl	ac+1ces+sa+ri+ly
	pos	adv.
accessariness	sub
	head	accessary
	syl	ac+1ces+sa+ri+ness
	pos	n.
accessible	1.
	syl	ac+ces+si:ble
	pron	<*k1ses*bL>
	pos	adj.
	def	easy to approach, enter, or use.
accessible to	2.
	head	accessible
	syl	accessible to.
	def	likely to be affected by; open to; susceptible to.
accessible	3.
	syl	ac+ces+si:ble
	pron	<*k1ses*bL>
	pos	adj.
	def	obtainable; available.
accessibility	sub
	head	accessible
	syl	ac+2ces+si:1bil+i:ty
	pos	n.
accessibly	sub
	head	accessible
	syl	ac+1ces+si:bly
	pos	adv.
accession	1.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	def	the act of entering upon or attaining to an office, right, condition, etc.
accession	2.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	def	an increase due to an addition.
accession	3.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	def	an addition, as to a collection.
accession	4.a.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	def	an addition to land or property by natural increase or improvement.
accession	4.b.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	def	the owner's right to the increased value of such land.
accession	5.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	qual	International law.
	def	the formal acceptance of a convention or treaty.
accession	6.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	def	agreement; consent.
accession	7.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	n.
	def	a less common word for { {access} (sense 1)}.
accession	8.
	syl	ac+ces+sion
	pron	<*k1seS*n>
	pos	vb.
	mod	tr.
	def	to make a record of (additions to a collection).
accessional	sub
	head	accession
	syl	ac+1ces+sion+al
	pos	adj.
accession number	0.
	syl	ac+ces+sion num+ber
	pos	n.
	qual	Library science.
	def	the number given to record a new addition to a collection.
accessories	infl
	head	accessory
	syl	ac+ces+so+ries.
	pos	n.
	mod	pl.
accessory	1.
	syl	ac+ces+so+ry
	pron	<*k1ses*ri>
	pos	n.
	def	a supplementary part or object, as of a car, appliance, etc.
accessory	2.
	syl	ac+ces+so+ry
	pron	<*k1ses*ri>
	pos	n.
	mod	often; pl.
	def	a small accompanying item of dress, esp. of women's dress.
accessory	3.
	syl	ac+ces+so+ry
	pron	<*k1ses*ri>
	pos	n.
	usage	formerly
	def	a person involved in a crime although absent during its commission, either a person who incites or encourages or otherwise assists the planning of a crime ({accessory before the fact}) or a person who knowingly conceals, comforts, or assists after the commission of a crime ({accessory after the fact}) .
accessory	4.
	syl	ac+ces+so+ry
	pron	<*k1ses*ri>
	pos	adj.
	def	supplementary; additional; subordinate.
accessory	5.
	syl	ac+ces+so+ry
	pron	<*k1ses*ri>
	pos	adj.
	def	assisting in or having knowledge of an act, esp. a crime.
accessorial	sub
	head	accessory
	syl	ac+ces+so+ri:al
	pron	<2@kse1sc:ri*l>
	pos	adj.
accessorily	sub
	head	accessory
	syl	ac+1ces+so+ri+ly
	pos	adv.
accessoriness	sub
	head	accessory
	syl	ac+1ces+so+ri+ness
	pos	n.
accessory fruit	0.
	syl	ac+ces+so+ry fruit
	pos	n.
	def	another name for {pseudocarp}.
accessory nerve	0.
	syl	ac+ces+so+ry nerve
	pos	n.
	def	either one of the eleventh pair of cranial nerves, which supply the muscles of the head, shoulders, larynx, and pharynx and the viscera of the abdomen and thorax.
access road	0.
	syl	ac+cess road
	pos	n.
	def	a road providing a means of entry into a region or of approach to another road, esp. a motorway.
access time	0.
	syl	ac+cess time
	pos	n.
	qual	Computer technol.
	def	the time required to retrieve a piece of stored information.
acciaccatura	ety	C18: literally: a crushing sound
acciaccaturas	infl
	head	acciaccatura
	or	acciaccature
	syl	ac+ciac+ca+tu+ras
	pron	<-rA>, <-rE>
	pos	n.
	mod	pl.
acciaccature	infl
	head	acciaccatura
	or	acciaccaturas
	syl	ac+ciac+ca+tu+re
	pron	<-rA>, <-rE>
	pos	n.
	mod	pl.
acciaccatura	1.
	syl	ac+ciac+ca+tu+ra
	pron	<a:2Ca:ka:1tu*r*>
	pos	n.
	def	a small grace note melodically adjacent to a principal note and played simultaneously with or immediately before it.
acciaccatura	2.
	syl	ac+ciac+ca+tu+ra
	pron	<a:2Ca:ka:1tu*r*>
	pos	n.
	usage	in modern music
	def	a very short appoggiatura.
accidence	ety	C15: from Latin accidentia accidental matters, hence inflections of words, from accidere to happen. See #7accident 
accidence	0.
	syl	ac+ci+dence
	pron	<1@ksid*ns>
	pos	n.
	def	inflectional morphology; the part of grammar concerned with changes in the form of words by internal modification or by affixation, for the expression of tense, person, case, number, etc.
accident	ety	C14: via Old French from Latin accident- chance, happening, from the present participle of accidere to befall, happen, from ad- to+ cadere to fall
accident	1.
	syl	ac+ci+dent
	pron	<1@ksid*nt>
	pos	n.
	def	an unforeseen event or one without an apparent cause.
accident	2.
	syl	ac+ci+dent
	pron	<1@ksid*nt>
	pos	n.
	def	anything that occurs unintentionally or by chance; chance; fortune.
	exam	1	I met him by accident.
accident	3.
	syl	ac+ci+dent
	pron	<1@ksid*nt>
	pos	n.
	def	a misfortune or mishap, esp. one causing injury or death.
accident	4.
	syl	ac+ci+dent
	pron	<1@ksid*nt>
	pos	n.
	def	a material quality that is not an essential part of something (as opposed to .
accident	5.
	syl	ac+ci+dent
	pron	<1@ksid*nt>
	pos	n.
	def	Also called: {adjunct}. a nonessential attribute or characteristic of something.
accident	6.
	syl	ac+ci+dent
	pron	<1@ksid*nt>
	pos	n.
	qual	Geology.
	def	a surface irregularity in a natural formation, esp. in a rock formation or a river system.
accident	7.
	syl	ac+ci+dent
	pron	<1@ksid*nt>
	pos	n.
	qual	Archaic.
	def	an inflected form of a word.
accidental	1.
	syl	ac+ci+den+tal
	pron	<2@ksi1dentL>
	pos	adj.
	def	occurring by chance, unexpectedly, or unintentionally.
accidental	2.
	syl	ac+ci+den+tal
	pron	<2@ksi1dentL>
	pos	adj.
	def	nonessential; incidental.
accidental	3.
	syl	ac+ci+den+tal
	pron	<2@ksi1dentL>
	pos	adj.
	qual	Music.
	def	denoting sharps, flats, or naturals that are not in the key signature of a piece.
accidental	4.
	syl	ac+ci+den+tal
	pron	<2@ksi1dentL>
	pos	n.
	def	an incidental, nonessential, or supplementary circumstance, factor, or attribute.
accidental	5.
	syl	ac+ci+den+tal
	pron	<2@ksi1dentL>
	pos	n.
	qual	Music.
	def	a symbol denoting that the following note is a sharp, flat, or natural that is not a part of the key signature.
accidentally	sub
	head	accidental
	syl	ac+ci+1den+tal+ly
	pos	adv.
accident insurance	0.
	syl	ac+ci+dent in+sur+ance
	pos	n.
	def	insurance providing compensation for accidental injury or death.
accident-prone	0.
	syl	ac+ci:dent-prone
	pos	adj.
	def	liable to become involved in accidents.
accidie	ety	in use C13 to C16 and revived C19: via Late Latin from Greek ak*_edia, from #7a -%1#7+ k*_edos care
acedia	alt
	head	accidie
	or	accidie
	syl	a:ce:di:a
	pos	n.
accidie	0.
	or	acedia
	syl	ac+ci+die
	pron	<1@ksidi>
	pos	n.
	def	spiritual sloth; apathy; indifference.
accipiter	ety	C19: New Latin, from Latin: hawk
accipiter	0.
	syl	ac+cip:i+ter
	pron	<@k1sipit*>
	pos	n.
	def	any hawk of the genus typically having short rounded wings and a long tail.
accipitrine	1.
	syl	ac+cip:i+trine
	pron	<@k1sipi2trIn>, <-trin>
	pos	adj.
	def	Also: {ac+cip@.i+tral} (@ak#!s$Ip$Itr$$l). of, relating to, or resembling a hawk; rapacious.
accipitrine	2.
	syl	ac+cip:i+trine
	pron	<@k1sipi2trIn>, <-trin>
	pos	adj.
	def	of, relating to, or belonging to the subfamily which includes the hawks.
acclaim	ety	C17: from Latin accl*_am*_are to shout at, shout applause, from ad- to+ clam*_are to shout
acclaim	1.
	syl	ac+claim
	pron	<*1klAm>
	pos	vb.
	mod	tr.
	def	to acknowledge publicly the excellence of (a person, act, etc.).
acclaim	2.
	syl	ac+claim
	pron	<*1klAm>
	pos	vb.
	def	to salute with cheering, clapping, etc.; applaud.
acclaim	3.
	syl	ac+claim
	pron	<*1klAm>
	pos	vb.
	mod	tr.
	def	to acknowledge publicly that (a person) has (some position, quality, etc.).
	exam	1	they acclaimed him king.
acclaim	4.
	syl	ac+claim
	pron	<*1klAm>
	pos	n.
	def	an enthusiastic shout of welcome, approval, etc.
acclaimer	sub
	head	acclaim
	syl	ac+1claim+er
	pos	n.
acclamation	1.
	syl	ac+cla+ma+tion
	pron	<2@kl*1mAS*n>
	pos	n.
	def	an enthusiastic reception or exhibition of welcome, approval, etc.
acclamation	2.
	syl	ac+cla+ma+tion
	pron	<2@kl*1mAS*n>
	pos	n.
	def	an expression of approval by a meeting or gathering through shouts or applause.
acclamation	3.a.
	syl	ac+cla+ma+tion
	pron	<2@kl*1mAS*n>
	pos	n.
	def	by an overwhelming majority without a ballot.
acclamation	3.b.
	syl	ac+cla+ma+tion
	pron	<2@kl*1mAS*n>
	pos	n.
	usage	Canadian. of an election or electoral victory
	def	without opposition.
	exam	1	he won by acclamation.
acclamatory	sub
	head	acclamation
	syl	ac+clam:a+to:ry
	pron	<*1kl@m*t*ri>, <-tri>
	pos	adj.
acclimatise	infl
	head	acclimatize
	or	acclimate
	syl	ac+cli+ma+tise
	pron	<*1klIm*2tIz>
	pos	vb.
acclimate	infl
	head	acclimatize
	or	acclimatise
	syl	ac+cli+mate
	pron	<*1klImit>, <1@kli2mAt>
	pos	vb.
acclimatize	0.
	syl	ac+cli+ma+tize
	pron	<*1klIm*2tIz>
	pos	vb.
	def	to adapt or become accustomed to a new climate or environment.
acclimatizable	sub
	head	acclimatize
	syl	ac+1cli+ma+2tiz+a:ble
	pos	adj.
acclimatisable	sub
	head	acclimatize
	or	acclimatable
	syl	ac+1cli+ma+2tis+a:ble
	pos	adj.
acclimatable	sub
	head	acclimatize
	or	acclimatisable
	syl	ac+1cli+mat+a:ble
	pos	adj.
acclimatization	sub
	head	acclimatize
	syl	ac+2cli+ma+ti+1za+tion
	pos	n.
acclimatisation	sub
	head	acclimatize
	or	acclimation
	syl	ac+2cli+ma+ti+1sa+tion
	pos	n.
acclimation	sub
	head	acclimatize
	or	acclimatisation
	syl	ac+cli+1ma+tion
	pos	n.
acclimatizer	sub
	head	acclimatize
	or	acclimatiser
	syl	ac+1cli+ma+2tiz+er
	pos	n.
acclimatiser	sub
	head	acclimatize
	or	acclimatizer
	syl	ac+1cli+ma+2tis+er
	pos	n.
acclivity	ety	C17: from Latin accl*_ivit*_as, from accl*_ivis sloping up, steep
acclivities	infl
	head	acclivity
	syl	ac+cliv+i:ties.
	pos	n.
	mod	pl.
acclivity	0.
	syl	ac+cliv+i:ty
	pron	<*1kliviti>
	pos	n.
	def	an upward slope, esp. of the ground. Compare {declivity}.
acclivitous	sub
	head	acclivity
	or	acclivous
	syl	ac+1cliv:i+tous
	pron	<*1klIv*s>
	pos	adj.
acclivous	sub
	head	acclivity
	or	acclivitous
	syl	ac+cli+vous
	pron	<*1klIv*s>
	pos	adj.
accolade	ety	C17: via French and Italian from Vulgar Latin accoll*_are (unattested) to hug; related to Latin collum neck
accolade	1.
	syl	ac+co+lade
	pron	<1@k*2lAd>, <2@k*1lAd>
	pos	n.
	def	strong praise or approval; acclaim.
accolade	2.
	syl	ac+co+lade
	pron	<1@k*2lAd>, <2@k*1lAd>
	pos	n.
	def	an award or honour.
accolade	3.
	syl	ac+co+lade
	pron	<1@k*2lAd>, <2@k*1lAd>
	pos	n.
	def	the ceremonial gesture used to confer knighthood, originally an embrace, now a touch on the shoulder with a sword.
accolade	4.
	syl	ac+co+lade
	pron	<1@k*2lAd>, <2@k*1lAd>
	pos	n.
	def	a rare word for { {brace} (sense 7)}.
accolade	5.
	syl	ac+co+lade
	pron	<1@k*2lAd>, <2@k*1lAd>
	pos	n.
	qual	Architect.
	def	a curved ornamental moulding, esp. one having the shape of an ogee arch.
accommodate	ety	C16: from Latin accommod*_are to make fit, from ad- to+ commodus having the proper measure
accommodate	1.
	syl	ac+com+mo+date
	pron	<*1kom*2dAt>
	pos	vb.
	mod	tr.
	def	to supply or provide, esp. with lodging or board and lodging.
accommodate	2.
	syl	ac+com+mo+date
	pron	<*1kom*2dAt>
	pos	vb.
	mod	tr.
	def	to oblige or do a favour for.
accommodate	3.
	syl	ac+com+mo+date
	pron	<*1kom*2dAt>
	pos	vb.
	def	to adjust or become adjusted; adapt.
accommodate	4.
	syl	ac+com+mo+date
	pron	<*1kom*2dAt>
	pos	vb.
	mod	tr.
	def	to bring into harmony; reconcile.
accommodate	5.
	syl	ac+com+mo+date
	pron	<*1kom*2dAt>
	pos	vb.
	mod	tr.
	def	to allow room for; contain.
accommodate	6.
	syl	ac+com+mo+date
	pron	<*1kom*2dAt>
	pos	vb.
	mod	tr.
	def	to lend money to.
accommodative	sub
	head	accommodate
	syl	ac+1com+mo+2da+tive
	pos	adj.
accommodating	0.
	syl	ac+com+mo+dat+ing
	pron	<*1kom*2dAtiG>
	pos	adj.
	def	willing to help; kind; obliging.
accommodatingly	sub
	head	accommodating
	syl	ac+1com+mo+2dat+ing+ly
	pos	adv.
accommodation	1.
	syl	ac+com+mo+da+tion
	pron	<*2kom*1dAS*n>
	pos	n.
	def	adjustment, as of differences or to new circumstances; adaptation, settlement, or reconciliation.
accommodation	2.
	syl	ac+com+mo+da+tion
	pron	<*2kom*1dAS*n>
	pos	n.
	def	lodging or board and lodging.
accommodation	3.
	syl	ac+com+mo+da+tion
	pron	<*2kom*1dAS*n>
	pos	n.
	def	something fulfilling a need, want, etc.; convenience or facility.
accommodation	4.
	syl	ac+com+mo+da+tion
	pron	<*2kom*1dAS*n>
	pos	n.
	qual	Physiol.
	def	the automatic or voluntary adjustment of the thickness of the lens of the eye for far or near vision.
accommodation	5.
	syl	ac+com+mo+da+tion
	pron	<*2kom*1dAS*n>
	pos	n.
	def	willingness to help or oblige.
accommodation	6.
	syl	ac+com+mo+da+tion
	pron	<*2kom*1dAS*n>
	pos	n.
	qual	Commerce.
	def	a loan, usually made as an act of favour by a bank before formal credit arrangements are agreed.
accommodation address	0.
	syl	ac+com+mo+da+tion ad+dress
	pos	n.
	def	an address on letters, etc., to a person or business that does not wish or is not able to receive post at a permanent or actual address.
accommodation bill	0.
	syl	ac+com+mo+da+tion bill
	pos	n.
	qual	Commerce.
	def	a bill of exchange cosigned by a guarantor: designed to strengthen the acceptor's credit.
accommodation ladder	0.
	syl	ac+com+mo+da+tion lad+der
	pos	n.
	qual	Nautical.
	def	a flight of stairs or a ladder for lowering over the side of a ship for access to and from a small boat, pier, etc.
accompaniment	1.
	syl	ac+com+pa+ni+ment
	pron	<*1k^mp*nim*nt>, <*1k^mpni->
	pos	n.
	def	some?!thing that accompanies or is served or used with something else.
accompaniment	2.
	syl	ac+com+pa+ni+ment
	pron	<*1k^mp*nim*nt>, <*1k^mpni->
	pos	n.
	def	something inessential or subsidiary that is added, as for ornament or symmetry.
accompaniment	3.
	syl	ac+com+pa+ni+ment
	pron	<*1k^mp*nim*nt>, <*1k^mpni->
	pos	n.
	qual	Music.
	def	a subordinate part for an instrument, voices, or an orchestra.
accompanyist	alt
	head	accompanist
	or	accompanist
	syl	ac+com+pa+ny+ist
	pron	<*1k^mp*nEist>
	pos	n.
	qual	U.S. (sometimes
accompanist	0.
	or	accompanyist
	syl	ac+com+pa+nist
	pron	<*1k^mp*nist>, <*1k^mpnist>
	pos	n.
	def	a person who supplies a musical accompaniment.
accompany	ety	C15: from Old French accompaignier, from compaing #7companion 
accompanies	infl
	head	accompany
	syl	ac+com+pa+nies
	pos	vb.
accompanying	infl
	head	accompany
	syl	ac+com+pa+ny+ing
	pos	vb.
accompanied	infl
	head	accompany
	syl	ac+com+pa+nied.
	pos	vb.
accompany	1.
	syl	ac+com+pa+ny
	pron	<*1k^mp*ni>, <*1k^mpni>
	pos	vb.
	mod	tr.
	def	to go along with, so as to be in company with or escort.
accompany	2.
	syl	ac+com+pa+ny
	pron	<*1k^mp*ni>, <*1k^mpni>
	pos	vb.
	mod	tr.
	usage	foll. by with
	def	to supplement.
	exam	1	he accompanied his tirade with gestures.
accompany	3.
	syl	ac+com+pa+ny
	pron	<*1k^mp*ni>, <*1k^mpni>
	pos	vb.
	mod	tr.
	def	to occur, coexist, or be associated with.
accompany	4.
	syl	ac+com+pa+ny
	pron	<*1k^mp*ni>, <*1k^mpni>
	pos	vb.
	def	to provide a musical accompaniment for (a soloist, etc.).
accompanier	sub
	head	accompany
	syl	ac+1com+pa+ni+er
	pos	n.
accomplice	ety	C15: from a complice, interpreted as one word. See #7complice 
accomplice	0.
	syl	ac+com+plice
	pron	<*1komplis>, <*1k^m->
	pos	n.
	def	a person who has helped another in committing a crime.
accomplish	ety	C14: from Old French acomplir to complete, ultimately from Latin compl*_ere to fill up. See #7complete 
accomplish	1.
	syl	ac+com+plish
	pron	<*1kompliS>, <*1k^m->
	pos	vb.
	mod	tr.
	def	to manage to do; achieve.
accomplish	2.
	syl	ac+com+plish
	pron	<*1kompliS>, <*1k^m->
	pos	vb.
	mod	tr.
	def	to conclude successfully; complete.
accomplishable	sub
	head	accomplish
	syl	ac+1com+plish+a:ble
	pos	adj.
accomplisher	sub
	head	accomplish
	syl	ac+1com+plish+er
	pos	n.
accomplished	1.
	syl	ac+com+plished
	pron	<*1kompliSt>, <*1k^m->
	pos	adj.
	def	successfully completed; achieved.
accomplished	2.
	syl	ac+com+plished
	pron	<*1kompliSt>, <*1k^m->
	pos	adj.
	def	expert; proficient.
accomplishment	1.
	syl	ac+com+plish+ment
	pron	<*1kompliSm*nt>, <*1k^m->
	pos	n.
	def	the act of carrying out or achieving.
accomplishment	2.
	syl	ac+com+plish+ment
	pron	<*1kompliSm*nt>, <*1k^m->
	pos	n.
	def	something achieved or successfully completed.
accomplishment	3.
	syl	ac+com+plish+ment
	pron	<*1kompliSm*nt>, <*1k^m->
	pos	n.
	mod	often; pl.
	def	skill or talent.
accomplishment	4.
	syl	ac+com+plish+ment
	pron	<*1kompliSm*nt>, <*1k^m->
	pos	n.
	mod	often; pl.
	def	social grace, style, and poise.
accord	ety	C12: via Old French from Latin ad- to+ cord-, stem of cor heart
accord	1.
	syl	ac+cord
	pron	<*1kc:d>
	pos	n.
	def	agreement; conformity; accordance (esp. in the phrase {in accord with}) .
accord	2.
	syl	ac+cord
	pron	<*1kc:d>
	pos	n.
	def	consent or concurrence of opinion.
with one accord	3.
	head	accord
	syl	with one accord.
	def	unanimously.
accord	4.
	syl	ac+cord
	pron	<*1kc:d>
	pos	n.
	def	pleasing relationship between sounds, colours, etc.; harmony.
accord	5.
	syl	ac+cord
	pron	<*1kc:d>
	pos	n.
	def	a settlement of differences, as between nations; compromise.
of one's own accord	6.
	head	accord
	syl	of one's own accord.
	def	voluntarily.
accord	7.
	syl	ac+cord
	pron	<*1kc:d>
	pos	vb.
	def	to be or cause to be in harmony or agreement.
accord	8.
	syl	ac+cord
	pron	<*1kc:d>
	pos	vb.
	mod	tr.
	def	to grant; bestow.
accordable	sub
	head	accord
	syl	ac+1cord+a:ble
	pos	adj.
accorder	sub
	head	accord
	syl	ac1cord+er
	pos	n.
accordance	1.
	syl	ac+cord+ance
	pron	<*1kc:d*ns>
	pos	n.
	def	conformity; agreement; accord (esp. in the phrase {in accordance with}) .
accordance	2.
	syl	ac+cord+ance
	pron	<*1kc:d*ns>
	pos	n.
	def	the act of granting; bestowal.
	exam	1	accordance of rights.
accordant	0.
	syl	ac+cord+ant
	pron	<*1kc:dNt>
	pos	adj.
	usage	usually postpositive and foll. by with
	def	in conformity or harmony.
accordantly	sub
	head	accordant
	syl	ac+1cord+ant+ly
	pos	adv.
according	1.
	syl	ac+cord+ing
	pron	<*1kc:diG>
	pos	adj.
	usage	foll. by to
	def	in proportion; in relation.
according	2.
	syl	ac+cord+ing
	pron	<*1kc:diG>
	pos	adj.
	usage	foll. by to
	def	on the report (of); as stated (by).
according	3.
	syl	ac+cord+ing
	pron	<*1kc:diG>
	pos	adj.
	usage	foll. by to
	def	in conformity (with); in accordance (with).
according	4.
	syl	ac+cord+ing
	pron	<*1kc:diG>
	pos	adj.
	usage	foll. by as
	def	depending (on whether).
according	5.
	syl	ac+cord+ing
	pron	<*1kc:diG>
	pos	adj.
	qual	Not standard.
	def	dependent on.
	exam	1	it's all according where you want to go.
accordingly	1.
	syl	ac+cord+ing+ly
	pron	<*1kc:diGli>
	pos	adv.
	def	in an appropriate manner; suitably.
accordingly	2.
	syl	ac+cord+ing+ly
	pron	<*1kc:diGli>
	pos	adv.
	usage	sentence connector
	def	consequently.
accordion	ety	C19: from German Akkordion, from Akkord harmony, chord
accordion	1.
	syl	ac+cor+di+on
	pron	<*1kc:di*n>
	pos	n.
	def	a portable box-shaped instrument of the reed organ family, consisting of metallic reeds that are made to vibrate by air from a set of bellows controlled by the player's hands. Notes are produced by means of studlike keys.
accordion	2.
	syl	ac+cor+di+on
	pron	<*1kc:di*n>
	pos	n.
	def	short for {piano accordion}.
accordionist	sub
	head	accordion
	syl	ac+1cor+di+on+ist
	pos	n.
accordion pleats	0.
	syl	ac+cor+di+on pleats
	pos	n.
	mod	pl.
	def	tiny knife pleats.
accost	ety	C16: from Late Latin accost*_are to place side by side, from Latin costa side, rib
accost	1.
	syl	ac+cost
	pron	<*1kost>
	pos	vb.
	mod	tr.
	def	to approach, stop, and speak to (a person), as to ask a question, confront with a crime, solicit sexually, etc.
accost	2.
	syl	ac+cost
	pron	<*1kost>
	pos	n.
	qual	Rare.
	def	a greeting.
accostable	sub
	head	accost
	syl	ac+1cost+a:ble
	pos	adj.
accouchement	ety	C19: from accoucher to put to bed, to give birth. See #7couch 
accouchement	0.
	syl	ac+couche+ment
	pron	French. <akuS1m?~a>, English <*1ku:Sm*nt>
	pos	n.
	def	childbirth or the period of confinement.
accoucheur	ety	literally: one who is present at the bedside
accoucheuse	alt
	head	accoucheur
	or	accoucheur
	syl	ac+cou+cheuse
	pron	<aku1S@o:z>
	pos	n.
	mod	fem.
accoucheur	0.
	or	accoucheuse
	syl	ac+cou+cheur
	pron	French. <aku1S@o:r>
	pos	n.
	def	an obstetrician or midwife.
account	ety	C13: from Old French acont, from conter, compter to #7count %1
account	1.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	a verbal or written report, description, or narration of some occurrence, event, etc.
account	2.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	an explanation of conduct, esp. one made to someone in authority.
account	3.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	ground; basis; consideration (often in the phrases {on this (that, every, no}, {account, on account of) }.
account	4.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	importance, consequence, or value.
	exam	1	of little account.
account	5.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	assessment; judgment.
account	6.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	profit or advantage.
	exam	1	to turn an idea to account.
account	7.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	part or behalf (only in the phrase {on one's} {someone's account) }.
account	8.a.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	a business relationship between a bank, department store, stockbroker, etc., and a depositor, customer, or client permitting the latter certain banking or credit services.
account	8.b.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	the sum of money deposited at a bank.
account	8.c.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	the amount of credit available to the holder of an account.
account	8.d.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	a record of these.
account	9.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	a statement of monetary transactions with the resulting balance.
account	10.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	usage	on the London Stock Exchange
	def	the period, ordinarily of a fortnight's duration, in which transactions take place and at the end of which settlements are made.
account	11.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	qual	Book-keeping.
	def	a chronological list of debits and credits relating to a specified asset, liability, expense, or income of a business and forming part of the ledger.
account	12.a.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	a regular client or customer, esp. a firm that purchases commodities on credit.
account	12.b.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	an area of business assigned to another.
	exam	1	they transferred their publicity account to a new agent.
account	13.a.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	to insist on explanation.
account	13.b.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	to rebuke; reprimand.
account	13.c.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	to hold responsible.
account	15.a.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	on credit.
account	15.b.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	Also: {to account}. as partial payment.
on account of	16.
	head	account
	syl	on account of.
	pos	prep.
	def	because of; by reason of.
take account of	17.
	head	account
	or	take into account
	syl	take account of
	def	to take into consideration; allow for.
account	18.a.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	to pay or receive a balance due.
account	18.b.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	to get revenge on (someone).
account	19.
	syl	ac+count
	pron	<*1kaunt>
	pos	n.
	def	See {bank account} or {credit account}.
account	20.
	syl	ac+count
	pron	<*1kaunt>
	pos	vb.
	mod	tr.
	def	to consider or reckon.
	exam	1	he accounts himself poor.
accountable	1.
	syl	ac+count+a:ble
	pron	<*1kaunt*bL>
	pos	adj.
	def	responsible to someone or for some action; answerable.
accountable	2.
	syl	ac+count+a:ble
	pron	<*1kaunt*bL>
	pos	adj.
	def	able to be explained.
accountability	sub
	head	accountable
	syl	ac+2count+a:1bil+i:ty
	pos	n.
accountably	sub
	head	accountable
	syl	ac+1count+a:bly
	pos	adv.
accountancy	0.
	syl	ac+count+an+cy
	pron	<*1kaunt*nsi>
	pos	n.
	def	the profession or business of an accountant.
accountant	0.
	syl	ac+count+ant
	pron	<*1kaunt*nt>
	pos	n.
	def	a person concerned with the maintenance and audit of business accounts and the preparation of consultant reports in tax and finance.
account day	0.
	syl	ac+count day
	pos	n.
	usage	on the London Stock Exchange
	def	the day on which deliveries and payments relating to transactions made during the preceding account are made.
account for	1.
	syl	ac+count for
	pos	vb. prep.
	mod	intr.
	def	to give reasons for (an event, act, etc.).
account for	2.
	syl	ac+count for
	pos	vb. prep.
	mod	intr.
	def	to make or provide a reckoning of (expenditure, payments, etc.).
account for	3.
	syl	ac+count for
	pos	vb. prep.
	mod	intr.
	def	to be responsible for destroying, killing, or putting (people, aircraft, etc.) out of action.
accounting	0.
	syl	ac+count+ing
	pron	<*1kauntiG>
	pos	n.
	def	the skill or practice of maintaining and auditing accounts and preparing reports on the assets, liabilities, etc., of a business.
account payable	0.
	syl	ac+count pay+a:ble
	pos	n.
	qual	Accounting, U.S.
	def	a current liability account showing amounts payable by a firm to suppliers for purchases of materials, stocks, or services on credit.
account receivable	0.
	syl	ac+count re+ceiv+a:ble
	pos	n.
	qual	Accounting, U.S.
	def	a current asset account showing amounts payable to a firm by customers who have made purchases of goods and services on credit.
accouplement	ety	C15: French, from accoupler, from Latin copul*_are to #7couple 
accouplement	0.
	syl	ac+cou+ple+ment
	pron	<*1k^pLm*nt>
	pos	n.
	def	a timber joist or beam that serves as a tie or support.
accoutre	ety	C16: from Old French accoustrer to equip with clothing, ultimately related to Latin consuere to sew together
accouter	alt
	head	accoutre
	or	accoutre
	syl	ac+cou+ter
	pron	<*1ku:t*>
	pos	vb.
	mod	tr.
	qual	U.S.
accoutre	0.
	or	accouter
	syl	ac+cou+tre
	pron	<*1ku:t*>
	pos	vb.
	mod	tr.
	usage	usually passive
	def	to provide with military equipment.
accouterment	alt
	head	accoutrement
	or	accoutrement
	syl	ac+cou+terment
	pron	<*1ku:tr*m*nt>
	pos	n.
	qual	U.S.
accoutrement	1.
	or	accouterment
	syl	ac+cou+trement
	pron	<*1ku:tr*m*nt>
	pos	n.
	def	equipment worn by soldiers in addition to their clothing and weapons.
accoutrement	2.
	or	accouterment
	syl	ac+cou+trement
	pron	<*1ku:tr*m*nt>
	pos	n.
	mod	usually; pl.
	def	clothing, equipment, etc.; trappings.
	exam	1	the accoutrements of war.
Accra	0.
	syl	Ac+cra
	pron	<*1kra:>
	pos	n.
	def	the capital of Ghana, a port on the Gulf of Guinea: built on the site of three 17th-century trading fortresses founded by the English, Dutch, and Danish. Pop.: 564194 (1970).
accredit	ety	C17: from French accr*'editer, from the phrase mettre *`a cr*'edit to put to #7credit 
accredit	1.
	syl	ac+cred+it
	pron	<*1kredit>
	pos	vb.
	mod	tr.
	def	to ascribe or attribute.
accredit	2.
	syl	ac+cred+it
	pron	<*1kredit>
	pos	vb.
	mod	tr.
	def	to give official recognition to; sanction; authorize.
accredit	3.
	syl	ac+cred+it
	pron	<*1kredit>
	pos	vb.
	mod	tr.
	def	to certify or guarantee as meeting required standards.
accredit	4.a.
	syl	ac+cred+it
	pron	<*1kredit>
	pos	vb.
	mod	tr.
	def	to furnish or send (an envoy, etc.) with official credentials.
accredit	4.b.
	syl	ac+cred+it
	pron	<*1kredit>
	pos	vb.
	mod	tr.
	def	to appoint (someone) as an envoy, etc.
accredit	5.
	syl	ac+cred+it
	pron	<*1kredit>
	pos	vb.
	mod	tr.
	def	to believe.
accreditation	sub
	head	accredit
	syl	ac+2cred:i+1ta+tion
	pos	n.
accrescent	ety	C18: from Latin accr*_escere to continue to grow, from cr*_escere to grow
accrescent	0.
	syl	ac+cres+cent
	pron	<@1kresNt>
	pos	adj.
	usage	Botany. of a calyx or other part
	def	continuing to grow after flowering.
accrete	ety	C18: back formation from #7accretion 
accrete	1.
	syl	ac+crete
	pron	<*1krEt>
	pos	vb.
	def	to grow or cause to grow together; be or become fused.
accrete	2.
	syl	ac+crete
	pron	<*1krEt>
	pos	vb.
	mod	tr.
	def	to make or become bigger, as by addition.
accrete	3.
	syl	ac+crete
	pron	<*1krEt>
	pos	adj.
	usage	of plant organs
	def	grown together.
accretion	ety	C17: from Latin accreti*_o increase, from accr*_escere. See #7accrue 
accretion	1.
	syl	ac+cre+tion
	pron	<*1krES*n>
	pos	n.
	def	any gradual increase in size, as through growth or external addition.
accretion	2.
	syl	ac+cre+tion
	pron	<*1krES*n>
	pos	n.
	def	something added, esp. extraneously, to cause growth or an increase in size.
accretion	3.
	syl	ac+cre+tion
	pron	<*1krES*n>
	pos	n.
	def	the growing together of normally separate plant or animal parts.
accretion	4.a.
	syl	ac+cre+tion
	pron	<*1krES*n>
	pos	n.
	def	abnormal union or growing together of parts; adhesion.
accretion	4.b.
	syl	ac+cre+tion
	pron	<*1krES*n>
	pos	n.
	def	a mass of foreign matter collected in a cavity.
accretion	5.
	syl	ac+cre+tion
	pron	<*1krES*n>
	pos	n.
	qual	Law.
	def	an increase in the share of a beneficiary in an estate, as when a co-beneficiary fails to take his share.
accretive	sub
	head	accretion
	or	accretionary
	syl	ac+1cre+tive
	pos	adj.
accretionary	sub
	head	accretion
	or	accretive
	syl	ac+1cre+tion+ar:y
	pos	adj.
Accrington	0.
	syl	Ac+cring+ton
	pron	<1@kriGt*n>
	pos	n.
	def	a town in NW England, in SE Lancashire. Pop.: 36838 (1971).
accrue	ety	C15: from Old French accreue growth, ultimately from Latin accr*_escere to increase, from ad- to, in addition+ cr*_escere to grow
accrues	infl
	head	accrue
	syl	ac+crues
	pos	vb.
	mod	intr.
accruing	infl
	head	accrue
	syl	ac+cru+ing
	pos	vb.
	mod	intr.
accrued	infl
	head	accrue
	syl	ac+crued.
	pos	vb.
	mod	intr.
accrue	1.
	syl	ac+crue
	pron	<*1kru:>
	pos	vb.
	mod	intr.
	def	to increase by growth or addition, esp. (of capital) to increase by periodic addition of interest.
accrue	2.
	syl	ac+crue
	pron	<*1kru:>
	pos	vb.
	mod	intr.
	usage	often foll. by to
	def	to fall naturally (to); come into the possession (of); result (for).
accrue	3.
	syl	ac+crue
	pron	<*1kru:>
	pos	vb.
	mod	intr.
	usage	Law. of a right or demand
	def	to become capable of being enforced.
accrument	sub
	head	accrue
	or	accrual
	syl	ac+1cru+ment
	pos	n.
accrual	sub
	head	accrue
	or	accrument
	syl	ac+1cru+al
	pos	n.
acct	0.
	syl	acct.
	qual	Book-keeping. abbrev. for
	def	account.
acculturate	ety	C20: from #7ad -+#7culture +-#7ate %1 &- ac+@!cul+tur@.#!a+tion n.
acculturate	0.
	syl	ac+cul+tur+ate
	pron	<*1k^lC*2rAt>
	pos	vb.
	mod	tr.
	usage	of a cultural or social group
	def	to assimilate the cultural traits of another group.
accumbent	ety	C18: from Latin accumbere to recline
accumbent	1.
	syl	ac+cum+bent
	pron	<*1k^mb*nt>
	pos	adj.
	usage	Botany. of plant parts and plants
	def	lying against some other part or thing.
accumbent	2.
	syl	ac+cum+bent
	pron	<*1k^mb*nt>
	pos	adj.
	def	a rare word for {recumbent}.
accumbency	sub
	head	accumbent
	syl	ac+1cum+ben+cy
	pos	n.
accumulate	ety	C16: from Latin accumul*_atus, past participle of accumul*_are to heap up, from cumulus a heap 
accumulate	0.
	syl	ac+cu+mu+late
	pron	<*1kju:mju2lAt>
	pos	vb.
	def	to gather or become gathered together in an increasing quantity; amass; collect.
accumulable	sub
	head	accumulate
	syl	ac+1cu+mu+la:ble
	pos	adj.
accumulative	sub
	head	accumulate
	syl	ac+1cu+mu+la+tive
	pos	adj.
accumulatively	sub
	head	accumulate
	syl	ac+1cu+mu+la+tive+ly
	pos	adv.
accumulativeness	sub
	head	accumulate
	syl	ac+1cu+mu+la+tive+ness
	pos	n.
accumulation	1.
	syl	ac+cu+mu+la+tion
	pron	<*2kju:mju1lAS*n>
	pos	n.
	def	the act or process of collecting together or becoming collected.
accumulation	2.
	syl	ac+cu+mu+la+tion
	pron	<*2kju:mju1lAS*n>
	pos	n.
	def	something that has been collected, gathered, heaped, etc.
accumulation	3.a.
	syl	ac+cu+mu+la+tion
	pron	<*2kju:mju1lAS*n>
	pos	n.
	def	the continuous growth of capital by retention of interest or earnings.
accumulation	3.b.
	syl	ac+cu+mu+la+tion
	pron	<*2kju:mju1lAS*n>
	pos	n.
	usage	in computing the yield on a bond purchased at a discount
	def	the amount that is added to each yield to bring the cost of the bond into equality with its par value over its life. Compare { {amortization} (sense 2)}.
accumulation	4.
	syl	ac+cu+mu+la+tion
	pron	<*2kju:mju1lAS*n>
	pos	n.
	def	the taking of a first and an advanced university degree simultaneously.
accumulation point	0.
	syl	ac+cu+mu+la+tion point
	pos	n.
	qual	Maths.
	def	another name for {limit point}.
accumulator	1.
	syl	ac+cu+mu+la+tor
	pron	<*1kju:mju2lAt*>
	pos	n.
	def	Also called: {battery, storage battery}. a rechargeable device for storing electrical energy in the form of chemical energy, consisting of one or more separate secondary cells.
accumulator	2.
	syl	ac+cu+mu+la+tor
	pron	<*1kju:mju2lAt*>
	pos	n.
	qual	Horse racing, Brit.
	def	a collective bet, esp. on four or more races, in which the stake and winnings on each successive race are carried forward to become the stake on the next, so that both stakes and winnings accumulate progressively so long as the bet continues to be a winning one.
accumulator	3.a.
	syl	ac+cu+mu+la+tor
	pron	<*1kju:mju2lAt*>
	pos	n.
	def	a register in a calculator and the possible associated electrical circuits in which figures are stored and arithmetical operations performed on them.
accumulator	3.b.
	syl	ac+cu+mu+la+tor
	pron	<*1kju:mju2lAt*>
	pos	n.
	def	a location in a computer store in which arithmetical results are produced.
cies	infl
	head	accuracy
	syl	+cies.
	pos	n.
	mod	pl.
accuracy	1.
	syl	ac+cu+ra+cy
	pron	<1@kjur*si>
	pos	n.
	def	faithful measurement or representation of the truth; correctness; precision.
accuracy	2.
	syl	ac+cu+ra+cy
	pron	<1@kjur*si>
	pos	n.
	qual	Physics, chem.
	def	the degree of agreement between a measured value and the standard or accepted value for that measurement.
accuracy	3.
	syl	ac+cu+ra+cy
	pron	<1@kjur*si>
	pos	n.
	qual	Maths.
	def	the number of significant figures used or appearing in a number.
accurate	ety	C16: from Latin acc*_ur*_atus, past participle of acc*_ur*_are to perform with care, from c*_ura care
accurate	1.
	syl	ac+cu+rate
	pron	<1@kj*rit>
	pos	adj.
	def	faithfully representing or describ?!ing the truth.
accurate	2.
	syl	ac+cu+rate
	pron	<1@kj*rit>
	pos	adj.
	def	showing a negligible or permissible deviation from a standard.
	exam	1	an accurate ruler.
accurate	3.
	syl	ac+cu+rate
	pron	<1@kj*rit>
	pos	adj.
	def	without error; precise; meticulous.
accurately	sub
	head	accurate
	syl	ac+cu+rate+ly
	pos	adv.
accurateness	sub
	head	accurate
	syl	ac+cu+rate+ness
	pos	n.
accursed	ety	Old English *_acursod, past participle of *_acursian to put under a #7curse 
accurst	alt
	head	accursed
	or	accursed
	syl	ac+curst
	pron	<*1kR:st>
	pos	adj.
accursed	1.
	or	accurst
	syl	ac+curs+ed
	pron	<*1kR:sid>, <*1kR:st>
	pos	adj.
	def	under or subject to a curse; doomed.
accursed	2.
	or	accurst
	syl	ac+curs+ed
	pron	<*1kR:sid>, <*1kR:st>
	pos	adj.
	usage	prenominal
	def	hateful; detestable; execrable.
accursedly	sub
	head	accursed
	syl	ac+curs+ed+ly
	pron	<*1kR:sidli>
	pos	adv.
accursedness	sub
	head	accursed
	syl	ac+1curs+ed+ness
	pos	n.
accusal	0.
	syl	ac+cus+al
	pron	<*1kju:zL>
	pos	n.
	def	another word for {accusation}.
accusation	1.
	syl	ac+cu+sa+tion
	pron	<2@kju1zAS*n>
	pos	n.
	def	an allegation that a person is guilty of some fault, offence, or crime; imputation.
accusation	2.
	syl	ac+cu+sa+tion
	pron	<2@kju1zAS*n>
	pos	n.
	def	a formal charge brought against a person stating the crime that he is alleged to have committed.
accusative	ety	C15: from Latin; in grammar, from the phrase c*_asus acc*_us*_at*_ivus accusative case, a mistaken translation of Greek pt*_osis aitiatik*_e the case indicating causation. See #7accuse 
accusative	1.
	syl	ac+cu+sa+tive
	pron	<*1kju:z*tiv>
	pos	adj.
	qual	Grammar.
	def	denoting a case of nouns, pronouns, and adjectives in inflected languages that is used to identify the direct object of a finite verb, of certain prepositions, and for certain other purposes. See also { {objective} (sense 5)}.
accusative	2.
	syl	ac+cu+sa+tive
	pron	<*1kju:z*tiv>
	pos	adj.
	def	another word for {accusatorial}.
accusative	3.a.
	syl	ac+cu+sa+tive
	pron	<*1kju:z*tiv>
	pos	n.
	def	the accusative case.
accusative	3.b.
	syl	ac+cu+sa+tive
	pron	<*1kju:z*tiv>
	pos	n.
	def	a word or speech element in the accusative case.
accusatival	sub
	head	accusative
	syl	ac+cu+sa+ti+val
	pron	<*2kju:z*1tIvL>
	pos	adj.
accusatively	sub
	head	accusative
	syl	ac+1cu+sa+tive+ly
	pos	adv.
accusatory	alt
	head	accusatorial
	or	accusatorial
	syl	ac+cu+sa+to:ry
	pron	<*1kju?!:z*t*ri>, <-tri>, <2@kju1zAt*ri>
	pos	adj.
accusatorial	1.
	or	accusatory
	syl	ac+cu+sa+to+ri:al
	pron	<*2kju:z*1tc:ri*l>
	pos	adj.
	def	containing or implying blame or strong criticism.
accusatorial	2.
	or	accusatory
	syl	ac+cu+sa+to+ri:al
	pron	<*2kju:z*1tc:ri*l>
	pos	adj.
	qual	Law.
	def	denoting criminal procedure in which the prosecutor is distinct from the judge and the trial is conducted in public. Compare { {inquisitorial} (sense 3)}.
accuse	ety	C13: via Old French from Latin acc*_usare to call to account, from ad- to+ causa lawsuit
accuse	0.
	syl	ac+cuse
	pron	<*1kju:z>
	pos	vb.
	def	to charge (a person or persons) with some fault, offence, crime, etc.; impute guilt or blame.
accuser	sub
	head	accuse
	syl	ac+1cus+er
	pos	n.
accusingly	sub
	head	accuse
	syl	ac+1cus+ing+ly
	pos	adv.
accused	0.
	syl	ac+cused
	pron	<*1kju:zd>
	pos	n.
	qual	Law.
	usage	preceded by the
	def	the defendant or defendants appearing on a criminal charge.
accustom	ety	C15: from Old French acostumer, from costume #7custom 
accustom	0.
	syl	ac+cus+tom
	pron	<*1k^st*m>
	pos	vb.
	mod	tr.
	usage	usually foll. by to
	def	to make (oneself) familiar (with) or used (to), as by practice, habit, or experience.
accustomed	1.
	syl	ac+cus+tomed
	pron	<*1k^st*md>
	pos	adj.
	def	usual; customary.
accustomed	2.
	syl	ac+cus+tomed
	pron	<*1k^st*md>
	pos	adj.
	usage	postpositive; foll. by to
	def	used or inured (to).
accustomed	3.
	syl	ac+cus+tomed
	pron	<*1k^st*md>
	pos	adj.
	usage	postpositive; foll. by to
	def	in the habit (of).
	exam	1	accustomed to walking after meals.
Accutron	0.
	syl	Ac+cu+tron
	pron	<1@kju:2tron>
	pos	n.
	qual	Trademark.
	def	a type of watch in which the balance wheel and hairspring are replaced by a tuning fork kept in vibration by a tiny internal battery.
ACDC	ety	C20: humorous reference to electrical apparatus that is adaptable for #7alternating current and #7direct current 
ACDC	0.
	syl	AC/DC
	pos	adj.
	usage	Slang. of a person
	def	bisexual.
ace	ety	C13: via Old French from Latin as a unit, perhaps from a Greek variant of heis one
ace	1.
	syl	ace
	pron	<As>
	pos	n.
	def	any die, domino, or any of four playing cards with one spot.
ace	2.
	syl	ace
	pron	<As>
	pos	n.
	def	a single spot or pip on a playing card, die, etc.
ace	3.a.
	syl	ace
	pron	<As>
	pos	n.
	def	a winning serve that the opponent fails to reach.
ace	3.b.
	syl	ace
	pron	<As>
	pos	n.
	def	any winning serve.
ace	4.
	syl	ace
	pron	<As>
	pos	n.
	qual	Golf, chiefly U.S.
	def	a hole in one.
ace	5.
	syl	ace
	pron	<As>
	pos	n.
	def	a fighter pilot accredited with destroying many enemy aircraft.
ace	6.
	syl	ace
	pron	<As>
	pos	n.
	qual	Informal.
	def	an expert or highly skilled person.
	exam	1	an ace at driving.
an ace up one's sleeve	7.
	head	ace
	or	an ace in the hole
	syl	an ace up one's sleeve
	def	a hidden and powerful advantage. {~}
ace	8.
	syl	ace
	pron	<As>
	pos	n.
	qual	Informal.
	def	superb; excellent. {~}
ace	9.
	syl	ace
	pron	<As>
	pos	n.
	mod	tr.
	qual	Tennis.
	def	to serve an ace against.
ace	10.
	syl	ace
	pron	<As>
	pos	n.
	qual	Golf.
	def	to play (a hole) in one stroke.
ACE	0.
	syl	ACE
	pron	<As>
	pos	n.
	usage	in Britain; acronym for
	def	Advisory Centre for Education; a private organization offering advice on schools to parents.
-acea	ety	New Latin, from Latin, neuter plural of -*_aceus -#7aceous 
-acea	0.
	syl	-a:ce:a
	usage	suffix forming plural proper nouns.
	def	denoting animals belonging to a class or order.
	exam	1	Crustacea
-aceae	ety	New Latin, from Latin, feminine plural of -*_aceus -#7aceous 
-aceae	0.
	syl	-a:ce:ae
	usage	suffix forming plural proper nouns.
	def	denoting plants belonging to a family.
	exam	1	Liliaceae;
	exam	2	Ranunculaceae.
acedia	0.
	syl	a:ce:di:a
	pron	<*1sEdi*>
	pos	n.
	def	another word for {accidie}.
Aceldama	ety	C14: from Aramaic haq*_el dem*_a field of blood
Aceldama	0.
	syl	A:cel+da+ma
	pron	<*1seld*m*>
	pos	n.
	qual	New Testament.
	def	the place near Jerusalem that was bought with the 30 pieces of silver paid to Judas for betraying Jesus (Matthew 27:8; Acts 1:19).
acellular	0.
	syl	a:cel+lu+lar
	pron	<A1seljul*>
	pos	adj.
	qual	Biology.
	def	not made up of or containing cells.
acentric	1.
	syl	a:cen+tric
	pron	<A1sentrik>
	pos	adj.
	def	without a centre.
acentric	2.
	syl	a:cen+tric
	pron	<A1sentrik>
	pos	adj.
	def	not on centre; eccentric.
-aceous	ety	New Latin, from Latin -*_aceus of a certain kind; related to -*_ac, -*_ax, adjectival suffix
-aceous	0.
	syl	-a:ceous
	usage	suffix forming adjectives.
	def	relating to, belonging to, having the nature of, or resembling.
	exam	1	herbaceous;
	exam	2	larvaceous.
acephalous	ety	C18: via Medieval Latin from Greek akephalos. See #7a -%1#7, -#7cephalous 
acephalous	1.
	syl	a:ceph:a+lous
	pron	<*1sef*l*s>
	pos	adj.
	def	having no head or one that is reduced and indistinct, as certain insect larvae.
acephalous	2.
	syl	a:ceph:a+lous
	pron	<*1sef*l*s>
	pos	adj.
	def	having or recognizing no ruler or leader.
acerate	ety	C19: from Latin *_acer sharp+-#7ate %1
acerate	0.
	syl	ac+er+ate
	pron	<1@s*2rAt>, <-rit>
	pos	adj.
	def	another word for {acerose}.
acerbate	ety	C18: from Latin acerb*_atus, past participle of acerb*_are to make sour
acerbate	1.
	syl	ac+er+bate
	pron	<1@s*2bAt>
	pos	vb.
	mod	tr.
	def	to embitter or exasperate.
acerbate	2.
	syl	ac+er+bate
	pron	<1@s*2bAt>
	pos	vb.
	mod	tr.
	def	to make sour or bitter.
acerbic	ety	C17: from Latin acerbus sour, bitter
acerbic	0.
	syl	a:cer+bic
	pron	<*1sR:bik>
	pos	adj.
	def	harsh, bitter, or astringent; sour.
acerbities	infl
	head	acerbity
	syl	a:cer+bi:ties.
	pos	n.
	mod	pl.
acerbity	1.
	syl	a:cer+bi:ty
	pron	<*1sR:biti>
	pos	n.
	def	vitriolic or embittered speech, temper, etc.
acerbity	2.
	syl	a:cer+bi:ty
	pron	<*1sR:biti>
	pos	n.
	def	sourness or bitterness of taste.
acerose	ety	C18: from Latin acer*_osus full of chaff (erroneously used by Linnaeus as if derived from *_acer sharp)
acerous	alt
	head	acerose
	or	acerose
	syl	ac+er+ous
	pos	adj.
acerose	0.
	or	acerous
	syl	ac+er+ose
	pron	<1@s*2r*us>, <-2r*uz>
	pos	adj.
	def	shaped like a needle, as pine leaves.
acervate	ety	C19: from Latin acerv*_atus, from acerv*_are to heap up, from acervus a heap
acervate	0.
	syl	a:cer+vate
	pron	<*1sR:vit>, <-2vAt>
	pos	adj.
	qual	Botany.
	def	growing in heaps or clusters.
acervately	sub
	head	acervate
	syl	a:1cer+vate+ly
	pos	adv.
acescent	ety	C18: from Latin ac*_escent-, from ac*_escere to become sour, from *_acer sharp
acescent	0.
	syl	a:ces+cent
	pron	<*1sesNt>
	pos	adj.
	def	slightly sour or turning sour.
acescence	sub
	head	acescent
	or	acescency
	syl	a:1ces+cence
	pos	n.
acescency	sub
	head	acescent
	or	acescence
	syl	a:1ces+cen+cy
	pos	n.
acetabulum	ety	Latin: vinegar cup, hence a cuplike cavity, from ac*_etum vinegar+- abulum, suffix denot?!ing a container
acetabula	infl
	head	acetabulum
	syl	ac+e:tab:u+la
	pron	<-l*>
	pos	n.
	mod	pl.
acetabulum	1.
	syl	ac+e:tab:u+lum
	pron	<2@si1t@bjul*m>
	pos	n.
	def	the deep cuplike cavity on the side of the hipbone that receives the head of the thighbone.
acetabulum	2.
	syl	ac+e:tab:u+lum
	pron	<2@si1t@bjul*m>
	pos	n.
	def	a round muscular sucker in flatworms, leeches, and cephalopod molluscs.
acetal	ety	C19: from German Azetal, from #7aceto -#7+alcohol 
acetal	1.
	syl	ac+e:tal
	pron	<1@si2t@l>
	pos	n.
	def	a colourless volatile liquid used as a solvent and in perfumes. Formula: CH\3CH(OC\2H\5)\2.
acetal	2.
	syl	ac+e:tal
	pron	<1@si2t@l>
	pos	n.
	def	any organic compound containing the group -CH(OR\1)OR\2, where R\1 and R\2 are other organic groups.
acetaldehyde	0.
	syl	ac+et+al+de+hyde
	pron	<2@si1t@ldi2hId>
	pos	n.
	def	a colourless volatile pungent liquid, miscible with water, used in the manufacture of organic compounds and as a solvent and reducing agent. Formula: CH\3CHO.
acetamide	ety	C19: from German Azetamid, from #7aceto -#7+amide 
acetamid	alt
	head	acetamide
	or	acetamide
	syl	ac+et+am+id
	pron	<2@si1t@mid>, <*1setimid>
	pos	n.
acetamide	0.
	or	acetamid
	syl	ac+et+am+ide
	pron	<2@si1t@mId>, <*1seti2mId>
	pos	n.
	def	a white or colourless soluble deliquescent crystalline compound, used in the manufacture of organic chemicals. Formula: CH\3CONH\2.
acetanilide	ety	C19: from #7aceto -#7+aniline+ -#7ide 
acetanilid	alt
	head	acetanilide
	or	acetanilide
	syl	ac+et+an:i+lid
	pron	<2@si1t@nilid>
	pos	n.
acetanilide	0.
	or	acetanilid
	syl	ac+et+an:i+lide
	pron	<2@si1t@ni2lId>
	pos	n.
	def	a white crystalline powder used in the manufacture of dyes and rubber and as an analgesic in medicine. Formula: C\6H\5NHCOCH\3.
acetate	ety	C19: from #7acetic+ -#7ate %1
acetate	1.
	syl	ac+e:tate
	pron	<1@si2tAt>
	pos	n.
	def	any salt or ester of acetic acid, containing the monovalent ion CH\3COO%#- or the group CH\3COO%#-.
acetate	2.
	syl	ac+e:tate
	pron	<1@si2tAt>
	pos	n.
	usage	modifier
	def	consisting of, containing, or concerned with the group CH\3COO%#-.
	exam	1	acetate group or radical.
acetate	3.
	syl	ac+e:tate
	pron	<1@si2tAt>
	pos	n.
	def	short for {acetate rayon} {cellulose acetate}.
acetated	sub
	head	acetate
	syl	ac+e:tat+ed
	pos	adj.
acetate rayon	0.
	syl	ac+e:tate ray+on
	pos	n.
	def	a synthetic textile fibre made from cellulose acetate. Also called: {acetate}.
acetic	ety	C19: from Latin ac*_etum vinegar
acetic	0.
	syl	a:ce:tic
	pron	<*1sEtik>, <*1set->
	pos	adj.
	def	of, containing, producing, or derived from acetic acid or vinegar.
acetic acid	0.
	syl	a:ce:tic ac:id
	pos	n.
	def	a colourless pungent liquid, miscible with water, widely used in the manufacture of acetic anhydride, vinyl acetate, plastics, pharmaceuticals, dyes, etc. Formula: CH\3COOH. See also {glacial acetic acid, vinegar}.
acetic anhydride	0.
	syl	a:ce:tic an+hy+dride
	pos	n.
	def	a colourless pungent liquid used in the manufacture of cellulose and vinyl acetates for synthetic fabrics. Formula: (CH\3CO)\2O.
acetifies	infl
	head	acetify
	syl	a:cet:i+fies
	pos	vb.
acetifying	infl
	head	acetify
	syl	a:cet:i+fy+ing
	pos	vb.
acetified	infl
	head	acetify
	syl	a:cet:i+fied.
	pos	vb.
acetify	0.
	syl	a:cet:i+fy
	pron	<*1seti2fI>
	pos	vb.
	def	to become or cause to become acetic acid or vinegar.
acetification	sub
	head	acetify
	syl	a:2cet:i+fi+1ca+tion
	pos	n.
acetifier	sub
	head	acetify
	syl	a:1cet:i+2fi+er
	pos	n.
aceto-	ety	from Latin ac*_etum vinegar
acetometer	0.
	syl	ac+e:tom+e:ter
	pron	<2@si1tomit*>
	pos	n.
	def	a device for measuring the concentration of acetic acid in a solution, esp. in vinegar.
acetone	ety	C19: from German Azeton, from #7aceto -#7+ -#7one 
acetone	0.
	syl	ac+e:tone
	pron	<1@si2t*un>
	pos	n.
	def	a colourless volatile flammable pungent liquid, miscible with water, used in the manufacture of chemicals and as a solvent and thinner for paints, varnishes, and lacquers. Formula: CH\3COCH\3.
acetonic	sub
	head	acetone
	syl	ac+e:ton+ic
	pron	<2@si1tonik>
	pos	adj.
acetone body	0.
	syl	ac+e:tone bod:y
	pos	n.
	def	another name for {ketone body}.
acetophenetidin	0.
	syl	a:ce:to+phe+net:i+din
	pron	<*2sEt*uf*1netidin>
	pos	n.
	def	another name for {phenacetin}.
acetous	ety	C18: from Late Latin ac*_et*_osus vinegary, from ac*_etum vinegar
acetose	alt
	head	acetous
	or	acetous
	syl	ac+e:tose
	pron	<1@si2t*us>, <-2t*uz>
	pos	adj.
acetous	1.
	or	acetose
	syl	ac+e:tous
	pron	<1@sit*s>, <*1sE->
	pos	adj.
	def	containing, producing, or resembling acetic acid or vinegar.
acetous	2.
	or	acetose
	syl	ac+e:tous
	pron	<1@sit*s>, <*1sE->
	pos	adj.
	def	tasting like vinegar.
acetum	ety	Latin
acetum	1.
	syl	a:ce:tum
	pron	<*1sEt*m>
	pos	n.
	def	another name for {vinegar}.
acetum	2.
	syl	a:ce:tum
	pron	<*1sEt*m>
	pos	n.
	def	a solution that has dilute acetic acid as solvent.
acetyl	ety	C19: from #7acet(ic) +-#7yl  &- ac+e@.tyl+ic (@!@as$I#!t$Il$Ik) adj.
acetyl	0.
	syl	ac+e:tyl
	pron	<1@si2tIl>, <*1sEtIl>
	pos	n.
	usage	modifier
	def	of, consisting of, or containing the monovalent group CH\3CO-.
	exam	1	acetyl group or radical.
acetylate	1.
	syl	a:cet:y+late
	pron	<*1seti2lAt>
	pos	vb.
	mod	tr.
	def	to introduce an acetyl group into (a chemical compound).
acetylate	2.
	syl	a:cet:y+late
	pron	<*1seti2lAt>
	pos	vb.
	mod	intr.
	usage	of a chemical compound
	def	to gain or suffer substitution of an acetyl group.
acetylation	sub
	head	acetylate
	syl	a:2cet:y+1la+tion
	pos	n.
acetylcholine	0.
	syl	ac+e:tyl+cho+line
	pron	<2@sitIl1k*ulEn>, <-lin>
	pos	n.
	def	a chemical substance secreted at the ends of many nerve fibres, esp. in the autonomic nervous system, and responsible for the transmission of nervous impulses. Formula: C\7H\1\7NO\3.
acetylene	1.
	syl	a:cet:y+lene
	pron	<*1seti2lEn>
	pos	n.
	def	Also called: {ethyne}. a colourless soluble flammable gas used in the manufacture of organic chemicals and in cutting and welding metals. Formula: C\2H\2.
acetylene	2.
	syl	a:cet:y+lene
	pron	<*1seti2lEn>
	pos	n.
	def	another name for {alkyne}.
acetylenic	sub
	head	acetylene
	syl	a:cet:y+len+ic
	pron	<*2seti1lenik>
	pos	adj.
acetylide	0.
	syl	a:cet:y+lide
	pron	<*1seti2lId>
	pos	n.
	def	any of a class of carbides in which the carbon is present as a diatomic divalent ion. They are formally derivatives of acetylene.
acetylsalicylic acid	0.
	syl	ac+e:tyl+sal:i+cyl+ic ac:id
	pron	<2@sitIl2s@li1silik>, <*1sEtIl->
	pos	n.
	def	the chemical name for {aspirin}.
acey-deucy	0.
	syl	ace:y-deuc:y
	pron	<1Asi1dju:si>
	pos	n.
	def	a form of backgammon.
ACGI	0.
	syl	A.C.G.I.
	qual	abbrev. for
	def	Associate of the City and Guilds Institute.
Achaia	alt
	head	Achaea
	or	Achaea
	syl	A:cha:ia
	pron	<*1kI*>
	pos	n.
Achaea	1.
	or	Achaia
	syl	A:chae:a
	pron	<*1kE*>
	pos	n.
	def	a department of Greece, in the N Peloponnese. Capital: Patras. Pop.: 239859 (1971). Area: 3209 sq. km (1239 sq. miles). Modern Greek name: {Akha*"ia}.
Achaea	2.
	or	Achaia
	syl	A:chae:a
	pron	<*1kE*>
	pos	n.
	def	a province of ancient Greece, in the N Peloponnese on the Gulf of Corinth: enlarged as a Roman province in 27 #7b.c.
Achaian	alt
	head	Achaean
	or	Achaean
	syl	A:chai:an
	pron	<*1kI*n>
	pos	n.
Achaean	1.
	or	Achaian
	syl	A:chae+an
	pron	<*1kE*n>
	pos	n.
	def	a member of a principal Greek tribe in the Mycenaean era.
Achaean	2.
	or	Achaian
	syl	A:chae+an
	pron	<*1kE*n>
	pos	n.
	def	a native or inhabitant of the later Greek province of Achaea.
Achaean	3.
	or	Achaian
	syl	A:chae+an
	pron	<*1kE*n>
	pos	adj.
	def	of or relating to Achaea or the Achaeans.
Achaean League	0.
	syl	A:chae+an League
	pos	n.
	def	a confederation of Achaean cities formed in the early third century #7b.c., which became a political and military force in Greece, directed particularly against Macedonian domination of the Peloponnesus.
Achaemenid	ety	from Greek, after Akhaimen*_es, name of the founder
Achaemenids	infl
	head	Achaemenid
	syl	A:chae:me:nids
	pron	<2@ki1meni2dE>
	pos	n.
	mod	pl.
Achaemenidae	infl
	head	Achaemenid
	or	Achaemenides
	syl	Ach:ae:men:i:dae
	pron	<2@ki1meni2dE>
	pos	n.
	mod	pl.
Achaemenides	infl
	head	Achaemenid
	or	Achaemenidae
	syl	Ach:ae:men:i:des
	pron	<2@ki?!1meni2dEz>
	pos	n.
	mod	pl.
Achaemenid	0.
	syl	A:chae:me:nid
	pron	<*1kEm*nid>, <*1kem->
	pos	n.
	def	any member of a Persian dynasty of kings, including Cyrus the Great, that ruled from about 550 to 331 #7b.c., when Darius III was overthrown by Alexander the Great.
Achates	ety	from the name of Aeneas' faithful companion in Virgil's Aeneid 
Achates	0.
	syl	A:cha+tes
	pron	<*1kAtEz>
	pos	n.
	def	a loyal friend.
ache	ety	Old English *_acan (vb.), @ace (n.), Middle English aken (vb.), ache (n.). Compare #7bake, batch 
ache	1.
	syl	ache
	pron	<Ak>
	pos	vb.
	mod	intr.
	def	to feel, suffer, or be the source of a continuous dull pain.
ache	2.
	syl	ache
	pron	<Ak>
	pos	vb.
	mod	intr.
	def	to suffer mental anguish.
ache	3.
	syl	ache
	pron	<Ak>
	pos	n.
	mod	intr.
	def	a continuous dull pain.
achingly	sub
	head	ache
	syl	ach+ing+ly
	pos	adv.
Achelous	0.
	syl	Ach:e:lo:us
	pron	<2@ki1l*u*s>
	pos	n.
	qual	Classical myth.
	def	a river god who changed into a snake and a bull while fighting Hercules but was defeated when Hercules broke off one of his horns.
achene	ety	C19: from New Latin achaenium that which does not yawn or open, from #7a - %1#7+ Greek khainein to yawn
akene	alt
	head	achene
	or	achene
	syl	a:kene
	pron	<*1kEn>
	pos	n.
achene	0.
	or	akene
	syl	a:chene
	pron	<*1kEn>
	pos	n.
	def	a dry one-seeded indehiscent fruit with the seed distinct from the fruit wall. It may be smooth, as in the buttercup, or feathery, as in clematis.
achenial	sub
	head	achene
	or	akenial
	syl	a:1che:ni:al
	pos	adj.
akenial	sub
	head	achene
	or	achenial
	syl	a:1ke:ni:al
	pos	adj.
Achernar	ety	from Arabic *_akh*_ir al-nahr, literally: end of the river, alluding to the star's location in the constellation
Achernar	0.
	syl	A:cher+nar
	pron	<1Ak*2na:>
	pos	n.
	def	the brightest star in the constellation Eridanus, visible only in the S hemisphere. Visual magnitude: 0.6; spectral type: B5; distance: 66 light years.
Acheron	1.
	syl	Ach+er+on
	pron	<1@k*2ron>
	pos	n.
	qual	Greek myth.
	def	one of the rivers in Hades over which the souls of the dead were ferried by Charon. Compare {Styx}.
Acheron	2.
	syl	Ach+er+on
	pron	<1@k*2ron>
	pos	n.
	qual	Greek myth.
	def	the underworld or Hades.
Acheulian	ety	C20: after St. Acheul, town in northern France
Acheulean	alt
	head	Acheulian
	or	Acheulian
	syl	A:cheu+le:an
	pron	<*1Su:li*n>, <-j*n>
Acheulian	1.
	or	Acheulean
	syl	A:cheu+li:an
	pron	<*1Su:li*n>, <-j*n>
	pos	n.
	qual	Archaeol.
	usage	in Europe
	def	the period in the Lower Palaeolithic following the Abbevillian, represented by the use of soft hammerstones in hand axe production made of chipped stone, bone, antler, or wood. The Acheulian dates from the Riss glaciation.
Acheulian	2.
	or	Acheulean
	syl	A:cheu+li:an
	pron	<*1Su:li*n>, <-j*n>
	pos	n.
	qual	Archaeol.
	usage	in Africa
	def	the period represented by every stage of hand axe development.
Acheulian	3.
	or	Acheulean
	syl	A:cheu+li:an
	pron	<*1Su:li*n>, <-j*n>
	pos	adj.
	qual	Archaeol.
	def	of or relating to this period.
a cheval	ety	literally: on horseback
a cheval	0.
	syl	*`a che+val
	pron	French. <a S*1val>
	usage	of a bet, esp. in roulette
	def	made on two numbers, cards, etc.
achieve	ety	C14: from Old French achever to bring to an end, from the phrase a chef to a head, to a conclusion
achieve	1.
	syl	a:chieve
	pron	<*1CEv>
	pos	vb.
	def	to bring to a successful conclusion; accomplish; attain.
achieve	2.
	syl	a:chieve
	pron	<*1CEv>
	pos	vb.
	mod	tr.
	def	to gain as by hard work or effort.
	exam	1	to achieve success.
achievable	sub
	head	achieve
	syl	a:1chiev+a:ble
	pos	adj.
achiever	sub
	head	achieve
	syl	a:1chiev+er
	pos	n.
achievement	1.
	syl	a:chieve+ment
	pron	<*1CEvm*nt>
	pos	n.
	def	something that has been accomplished, esp. by hard work, ability, or heroism.
achievement	2.
	syl	a:chieve+ment
	pron	<*1CEvm*nt>
	pos	n.
	def	successful completion; accomplishment.
achievement	3.
	syl	a:chieve+ment
	pron	<*1CEvm*nt>
	pos	n.
	qual	Heraldry.
	def	a less common word for {hatchment}.
achievement age	0.
	syl	a:chieve+ment age
	pos	n.
	qual	Psychol.
	def	the age at which a child should be able to perform a standardized test successfully. Compare {developmental age, mental age}.
achievement quotient	0.
	syl	a:chieve+ment quo+tient
	pos	n.
	qual	Psychol.
	def	a measure of ability derived by dividing an individual's achievement age by his actual age. Abbrev.: {AQ}
achievement test	0.
	syl	a:chieve+ment test
	pos	n.
	qual	Psychol.
	def	a test designed to measure the effects that learning and teaching have on individuals.
Achilles	0.
	syl	A:chil:les
	pron	<*1kilEz>
	pos	n.
	qual	Greek myth.
	def	Greek hero, the son of Peleus and the sea goddess Thetis: in the the foremost of the Greek warriors at the siege of Troy. While he was a baby his mother plunged him into the river Styx making his body invulnerable except for the heel by which she held him. After slaying Hector, he was killed by Paris who wounded him in the heel.
Achillean	sub
	head	Achilles
	syl	Ach+il+le:an
	pron	<2@ki1lE*n>
	pos	adj.
Achilles heel	0.
	syl	A:chil:les heel
	pos	n.
	def	a small but fatal weakness.
Achilles tendon	0.
	syl	A:chil:les ten+don
	pos	n.
	def	the fibrous cord that connects the muscles of the calf to the heelbone.
Achill Island	0.
	syl	Ach+ill Is+land
	pron	<1@kil>
	pos	n.
	def	an island in Ireland, off the W coast of Co. Mayo. Area: 3133 sq. km (1210 sq. miles). Pop.: 3598 (1966).
Achitophel	0.
	syl	A:chit:o:phel
	pron	<*1kit*2fel>
	pos	n.
	qual	Bible.
	def	the Douay spelling of {Ahithophel}.
achlamydeous	0.
	syl	ach+la+myd+e:ous
	pron	<2@kl*1midi*s>
	pos	adj.
	usage	of flowers such as the willow
	def	having neither petals nor sepals.
achlorhydria	ety	C20: New Latin; see #7a -%1#7, chloro -#7, hydro -
achlorhydria	0.
	syl	a:chlor+hy+dri:a
	pron	<2Aklc:1hIdri*>
	pos	n.
	def	a marked reduction or virtual absence of free hydrochloric acid from the gastric juice.
achondrite	0.
	syl	a:chon+drite
	pron	<A1kondrIt>
	pos	n.
	def	a rare stony meteorite that consists mainly of silicate minerals and has the texture of igneous rock but contains no chondrules. Compare {chondrite}.
achondritic	sub
	head	achondrite
	syl	a:chon+drit+ic
	pron	<2Akon1dritik>
	pos	adj.
achondroplasia	ety	C20: New Latin; see #7a -%1#7, chondro -#7, -#7plasia 
achondroplasia	0.
	syl	a:chon+dro+pla+si:a
	pron	<A2kondr*u1plAzi*>
	pos	n.
	def	a skeletal disorder, characterized by failure of normal conversion of cartilage into bone, that begins during fetal life and results in dwarfism.
achondroplastic	sub
	head	achondroplasia
	syl	a:chon+dro+plas+tic
	pron	<A2kondr*u1pl@stik>
	pos	adj.
achromatic lens	alt
	head	achromat
	or	achromat
	syl	ach+ro+mat+ic lens
	pos	n.
achromat	0.
	or	achromatic lens
	syl	ach+ro+mat
	pron	<1@kr*2m@t>
	pos	n.
	def	a lens designed to bring light of two chosen wavelengths to the same focal point, thus reducing chromatic aberration. Compare {apochromat}.
achromatic	1.
	syl	ach+ro+mat+ic
	pron	<2@kr*1m@tik>
	pos	adj.
	def	without colour.
achromatic	2.
	syl	ach+ro+mat+ic
	pron	<2@kr*1m@tik>
	pos	adj.
	def	capable of reflecting or refracting light without chromatic aberration.
achromatic	3.a.
	syl	ach+ro+mat+ic
	pron	<2@kr*1m@tik>
	pos	adj.
	def	not staining with standard dyes.
achromatic	3.b.
	syl	ach+ro+mat+ic
	pron	<2@kr*1m@tik>
	pos	adj.
	def	of or relating to achromatin.
achromatic	4.a.
	syl	ach+ro+mat+ic
	pron	<2@kr*1m@tik>
	pos	adj.
	def	involving no sharps or flats.
achromatic	4.b.
	syl	ach+ro+mat+ic
	pron	<2@kr*1m@tik>
	pos	adj.
	def	another word for {diatonic}.
achromatically	sub
	head	achromatic
	syl	ach+ro+1mat:i+cal+ly
	pos	adv.
achromatism	sub
	head	achromatic
	or	achromaticity
	syl	a:chro+ma+tism
	pron	<*1kr*um*2tiz*m>
	pos	n.
achromaticity	sub
	head	achromatic
	or	achromatism
	syl	a:chro+ma+tic+i:ty
	pron	<*2kr*um*1tisiti>
	pos	n.
achromatic colour	0.
	syl	ach+ro+mat+ic col+our
	pos	n.
	qual	Physics.
	def	colour, such as white, black, and grey, that is devoid of hue. See { {colour} (sense 2)}.
achromatin	0.
	syl	a:chro+ma+tin
	pron	<*1kr*um*tin>
	pos	n.
	def	the material of the nucleus of a cell that does not stain with basic dyes. Compare {chromatin}.
achromatise	alt
	head	achromatize
	or	achromatize
	syl	a:chro+ma+tise
	pron	<*1kr*um*tIz>
	pos	vb.
	mod	tr.
achromatize	0.
	or	achromatise
	syl	a:chro+ma+tize
	pron	<*1kr*um*tIz>
	pos	vb.
	mod	tr.
	def	to make achromatic; to remove colour from.
achromatization	sub
	head	achromatize
	or	achromatisation
	syl	a:2chro+ma+ti+1za+tion
	pos	n.
achromatisation	sub
	head	achromatize
	or	achromatization
	syl	a:2chro+ma+ti+1sa+tion
	pos	n.
achromatous	0.
	syl	a:chro+ma+tous
	pron	<*1kr*um*t*s>
	pos	adj.
	def	having little or no colour or less than is normal.
achromous	alt
	head	achromic
	or	achromic
	syl	a:chro+mous
	pos	adj.
achromic	0.
	or	achromous
	syl	a+chro+mic
	pron	<*1kr*umik>
	pos	adj.
	def	colourless.
ach-y-fi	ety	Welsh, probably from ach, achy general exclamation of disgust+ fi I, me
ach-y-fi	0.
	syl	ach-y-fi
	pron	<2ax*1vE>, <2^x->
	pos	interj.
	qual	Welsh dialect.
	def	an expression of disgust or abhorrence.
acicula	ety	C19: New Latin, diminutive of acus needle
aciculae	infl
	head	acicula
	syl	a:cic:u+lae
	pron	<-2lE>
	pos	n.
	mod	pl.
acicula	0.
	syl	a:cic:u+la
	pron	<*1sikjul*>
	pos	n.
	def	a needle-shaped part, such as a spine, prickle, or crystal.
acicular	sub
	head	acicula
	syl	a:1cic:u+lar
	pos	adj.
aciculated	alt
	head	aciculate
	or	aciculate
	syl	a:cic:u+lat+ed
	pos	adj.
aciculate	1.
	or	aciculated
	syl	a:cic:u+late
	pron	<*1sikjulit>, <-2lAt>
	pos	adj.
	def	having aciculae.
aciculate	2.
	or	aciculated
	syl	a:cic:u+late
	pron	<*1sikjulit>, <-2lAt>
	pos	adj.
	def	marked with or as if with needle scratches.
aciculum	ety	C19: New Latin; see #7acicula 
aciculums	infl
	head	aciculum
	or	acicula
	syl	a:cic:u+lums
	pron	<-l*>
	pos	n.
	mod	pl.
acicula	infl
	head	aciculum
	or	aciculums
	syl	a:cic:u+la
	pron	<-l*>
	pos	n.
	mod	pl.
aciculum	0.
	syl	a:cic:u+lum
	pron	<*1sikjul*m>
	pos	n.
	def	a needle-like bristle that provides internal support for the appendages (chaetae) of some polychaete worms.
acid	ety	C17 (first used by Francis Bacon): from French acide or Latin acidus, from ac*_ere to be sour or sharp
acid	1.
	syl	ac:id
	pron	<1@sid>
	pos	n.
	def	any substance that dissociates in water to yield a sour corrosive solution containing hydrogen ions, having a pH of less than 7, and turning litmus red. See also {Lewis acid}.
acid	2.
	syl	ac:id
	pron	<1@sid>
	pos	n.
	def	a sour-tasting substance.
acid	3.
	syl	ac:id
	pron	<1@sid>
	pos	n.
	def	a slang name for {LSD}.
put the acid on (someone)	4.
	head	acid
	syl	put the acid on (someone).
	qual	Austral. informal.
	def	to apply pressure to someone, usually when seeking a favour.
acid	5.a.
	syl	ac:id
	pron	<1@sid>
	pos	adj.
	def	of, derived from, or containing acid.
	exam	1	an acid radical.
acid	5.b.
	syl	ac:id
	pron	<1@sid>
	pos	adj.
	def	being or having the properties of an acid.
	exam	1	sodium bicarbonate is an acid salt.
acid	6.
	syl	ac:id
	pron	<1@sid>
	pos	adj.
	def	sharp or sour in taste.
acid	7.
	syl	ac:id
	pron	<1@sid>
	pos	adj.
	def	cutting, sharp, or hurtful in speech, manner, etc.; vitriolic; caustic.
acid	8.
	syl	ac:id
	pron	<1@sid>
	pos	adj.
	usage	of igneous rocks
	def	having a silica content of more than two thirds the total and containing at least one tenth quartz.
acid	9.
	syl	ac:id
	pron	<1@sid>
	pos	adj.
	qual	Metallurgy.
	def	of or made by a process in which the furnace or converter is lined with an acid material.
	exam	1	acid steel.
acidly	sub
	head	acid
	syl	ac+id+ly
	pos	adv.
acidness	sub
	head	acid
	syl	ac+id+ness
	pos	n.
acidy	sub
	head	acid
	syl	ac+id:y
	pos	adj.
acid drop	0.
	syl	ac:id drop
	pos	n.
	def	a boiled sweet with a sharp taste.
acid-fast	0.
	syl	ac:id-fast
	pos	adj.
	usage	of bacteria and tissues
	def	resistant to decolorization by mineral acids after staining.
acid-forming	1.
	syl	ac:id-form:ing
	pos	adj.
	usage	of an oxide or element
	def	yielding an acid when dissolved in water or having an oxide that forms an acid in water; acidic.
acid-forming	2.
	syl	ac:id-form:ing
	pos	adj.
	usage	of foods
	def	producing an acid residue following digestion.
acid-head	0.
	syl	ac:id-head
	pos	n.
	qual	Slang.
	def	a person who uses LSD.
acidic	1.
	syl	a:cid+ic
	pron	<*1sidik>
	pos	adj.
	def	another word for {acid}.
acidic	2.
	syl	a:cid+ic
	pron	<*1sidik>
	pos	adj.
	usage	of an oxide
	def	yielding an acid in aqueous solution.
acidifies	infl
	head	acidify
	syl	a:cid:i+fies
	pos	vb.
acidifying	infl
	head	acidify
	syl	a:cid:i+fy+ing
	pos	vb.
acidified	infl
	head	acidify
	syl	a:cid:i+fied.
	pos	vb.
acidify	0.
	syl	a:cid:i+fy
	pron	<*1sidi2fI>
	pos	vb.
	def	to convert into or become acid.
acidifiable	sub
	head	acidify
	syl	a:1cid:i+2fi+a:ble
	pos	adj.
acidification	sub
	head	acidify
	syl	a:2cid:i+fi+1ca+tion
	pos	n.
acidifier	sub
	head	acidify
	syl	a:1cid:i+2fi+er
	pos	n.
acidimeter	1.
	syl	ac:i+dim+e:ter
	pron	<2@si1dimit*>
	pos	n.
	def	any instrument for determin?!ing the amount of acid in a solution.
acidimeter	2.
	syl	ac:i+dim+e:ter
	pron	<2@si1dimit*>
	pos	n.
	def	another name for {acidometer}.
acidimetric	sub
	head	acidimeter
	or	acidimetrical
	syl	ac:i+di+met+ric
	pron	<2@sid*1metrik>
	pos	adj.
acidimetrical	sub
	head	acidimeter
	or	acidimetric
	syl	ac:i+di+1met+ri+cal
	pos	adj.
acidimetry	0.
	syl	ac:i+dim+e:try
	pron	<2@si1dimitri>
	pos	n.
	def	the determination of the amount of acid present in a solution, measured by an acidimeter or by volumetric analysis.
acidimetric	sub
	head	acidimetry
	or	acidimetrical
	syl	ac:i+di+met+ric
	pron	<2@sidi1metrik>
	pos	adj.
acidimetrical	sub
	head	acidimetry
	or	acidimetric
	syl	ac:i+di+1met+ri+cal
	pos	adj.
acidimetrically	sub
	head	acidimetry
	syl	ac:i+di+1met+ri+cal+ly
	pos	adv.
acidities	infl
	head	acidity
	syl	a:cid+i:ties.
	pos	n.
	mod	pl.
acidity	1.
	syl	a:cid+i:ty
	pron	<*1siditi>
	pos	n.
	def	the quality or state of being acid.
acidity	2.
	syl	a:cid+i:ty
	pron	<*1siditi>
	pos	n.
	def	the amount of acid present in a solution, often expressed in terms of pH.
acidity	3.
	syl	a:cid+i:ty
	pron	<*1siditi>
	pos	n.
	def	another name for {hyperacidity}.
acidometer	0.
	syl	ac:i+dom+e:ter
	pron	<2@si1domit*>
	pos	n.
	def	a type of hydrometer for measuring the relative density of an acid solution, esp. the acid in a battery. Also called: {acidimeter}.
acidophil	ety	C20: see #7acid, -#7phile 
acidophile	alt
	head	acidophil
	or	acidophil
	syl	ac:i+do+phile
	pron	<1@sid*u2fIl>, <*1sid*->
	pos	adj.
acidophil	1.
	or	acidophile
	syl	ac:i+do+phil
	pron	<1@sid*u2fil>, <*1sid*->
	pos	adj.
	usage	also; of cells or cell contents
	def	easily stained by acid dyes.
acidophil	2.
	or	acidophile
	syl	ac:i+do+phil
	pron	<1@sid*u2fil>, <*1sid*->
	pos	adj.
	usage	also; of microorganisms
	def	growing well in an acid environment.
acidophil	3.
	or	acidophile
	syl	ac:i+do+phil
	pron	<1@sid*u2fil>, <*1sid*->
	pos	n.
	usage	also
	def	an acidophil organism.
acidophilus milk	0.
	syl	ac:i+doph:i+lus milk
	pron	<2@si1dofil*s>
	pos	n.
	qual	Med.
	def	milk fermented by bacteria of the species used in treating disorders of the gastrointestinal tract.
acidosis	0.
	syl	ac:i+do+sis
	pron	<2@si1d*usis>
	pos	n.
	def	a condition characterized by an abnormal increase in the acidity of the blood and extracellular fluids.
acidotic	sub
	head	acidosis
	syl	ac:i+dot+ic
	pron	<2@si1dotik>
	pos	adj.
acid rock	ety	C20: from #7acid (LSD), alluding to its supposed inspiration by drug-induced states of consciousness
acid rock	0.
	syl	ac:id rock
	pos	n.
	def	a type of rock music characterized by electronically amplified bizarre instrumental effects.
acid soil	0.
	syl	ac:id soil
	pos	n.
	def	a soil that gives a pH reaction of below 7.2, found especially in cool moist areas where soluble bases are leached away.
acid test	ety	C19: from the testing of gold with nitric acid
acid test	0.
	syl	ac:id test
	pos	n.
	def	a rigorous and conclusive test to establish worth or value.
	exam	1	the play passed the critic's acid test.
acidulate	ety	C18: #7acidulous+ -#7ate %1
acidulate	0.
	syl	a:cid:u+late
	pron	<*1sidju2lAt>
	pos	vb.
	mod	tr.
	def	to make slightly acid or sour.
acidulation	sub
	head	acidulate
	syl	a:2cid:u+1la+tion
	pos	n.
acidulous	ety	C18: from Latin acidulus sourish, diminutive of acidus sour
acidulent	alt
	head	acidulous
	or	acidulous
	syl	a:cid:u+lent
	pos	adj.
acidulous	1.
	or	acidulent
	syl	a:cid:u+lous
	pron	<*1sidjul*s>
	pos	adj.
	def	rather sour.
acidulous	2.
	or	acidulent
	syl	a:cid:u+lous
	pron	<*1sidjul*s>
	pos	adj.
	def	sharp or sour in speech, manner, etc.; acid.
acid value	0.
	syl	ac:id val:ue
	pos	n.
	def	the number of milligrams of potassium hydroxide required to neutralize the free fatty acid in one gram of a fat, oil, resin, etc.
acierate	ety	C19: from French acier steel, from Latin aci*_es sharpness
acierate	0.
	syl	ac:i+er+ate
	pron	<1@si*2rAt>
	pos	vb.
	mod	tr.
	def	to change (iron) into steel.
acieration	sub
	head	acierate
	syl	ac:i+er:1a+tion
	pos	n.
acinaciform	ety	C19: via Latin ac*_inac*_es, from Greek akinak*_es short sword, ultimately from Iranian+-#7form 
acinaciform	0.
	syl	ac:i+nac:i+form
	pron	<2@si1n@si2fc:m>
	pos	adj.
	usage	of leaves
	def	shaped like a scimitar; curved.
aciniform	ety	C19: from New Latin aciniformis; see #7acinus 
aciniform	0.
	syl	a:cin:i+form
	pron	<*1sini2fc:m>
	pos	adj.
	def	shaped like a bunch of grapes.
acinus	ety	C18: New Latin, from Latin: grape, berry
acini	infl
	head	acinus
	syl	ac:i+ni
	pron	<-2nI>
	pos	n.
	mod	pl.
acinus	1.
	syl	ac:i+nus
	pron	<1@sin*s>
	pos	n.
	qual	Anatomy.
	def	any of the terminal saclike portions of a compound gland.
acinus	2.
	syl	ac:i+nus
	pron	<1@sin*s>
	pos	n.
	qual	Botany.
	def	any of the small drupes that make up the fruit of the blackberry, raspberry, etc.
acinus	3.
	syl	ac:i+nus
	pron	<1@sin*s>
	pos	n.
	qual	Botany.
	def	a collection of berries, such as a bunch of grapes.
acinic	sub
	head	acinus
	syl	a:cin+ic
	pron	<*1sinik>
	pos	adj.
acinous	sub
	head	acinus
	or	acinose
	syl	ac:i+nous
	pos	adj.
acinose	sub
	head	acinus
	or	acinous
	syl	ac:i+nose
	pos	adj.
Acis	0.
	syl	A:cis
	pron	<1Asis>
	pos	n.
	qual	Greek myth.
	def	a Sicilian shepherd and the lover of the nymph Galatea. In jealousy, Polyphemus crushed him with a huge rock, and his blood was turned by Galatea into a river.
ack-ack	ety	C20: British signalling code term for AA, abbreviation of anti-aircraft 
ack-ack	1.a.
	syl	ack-ack
	pron	<1@k2@k>
	pos	n.
	qual	Military.
	def	anti-aircraft fire.
ack-ack	1.b.
	syl	ack-ack
	pron	<1@k2@k>
	pos	n.
	qual	Military.
	usage	as modifier
	exam	1	ack-ack guns.
ack-ack	2.
	syl	ack-ack
	pron	<1@k2@k>
	pos	n.
	qual	Military.
	def	anti-aircraft arms.
ackee	ety	C18: of African origin
akee	alt
	head	ackee
	or	ackee
	syl	ak:ee
	pron	<1@kE>
	pos	n.
ackee	1.a.
	or	akee
	syl	ack:ee
	pron	<1@kE>
	pos	n.
	def	a sapindaceous tree, native to tropical Africa and cultivated in the West Indies for its fruit, edible when cooked.
ackee	1.b.
	or	akee
	syl	ack:ee
	pron	<1@kE>
	pos	n.
	def	the red pear-shaped fruit of this tree.
ackee	2.
	or	akee
	syl	ack:ee
	pron	<1@kE>
	pos	n.
	def	a sapindaceous tree, that grows on some Caribbean islands and is valued for its timber and edible fruit.
ackee	3.
	or	akee
	syl	ack:ee
	pron	<1@kE>
	pos	n.
	def	the green tough-skinned berry of this tree.
acknowledge	ety	C15: probably from earlier knowledge, on the model of Old English oncn*_awan, Middle English aknowen to confess, recognize
acknowledge	1.
	syl	ac+knowl+edge
	pron	<*k1noliJ>
	pos	vb.
	mod	tr.
	usage	may take a clause as object
	def	to recognize or admit the existence, truth, or reality of.
acknowledge	2.
	syl	ac+knowl+edge
	pron	<*k1noliJ>
	pos	vb.
	mod	tr.
	def	to indicate recognition or awareness of, as by a greeting, glance, etc.
acknowledge	3.
	syl	ac+knowl+edge
	pron	<*k1noliJ>
	pos	vb.
	mod	tr.
	def	to express appreciation or thanks for.
	exam	1	to acknowledge a gift.
acknowledge	4.
	syl	ac+knowl+edge
	pron	<*k1noliJ>
	pos	vb.
	mod	tr.
	def	to make the receipt of known to the sender.
	exam	1	to acknowledge a letter.
acknowledge	5.
	syl	ac+knowl+edge
	pron	<*k1noliJ>
	pos	vb.
	mod	tr.
	def	to recognize, esp. in legal form, the authority, rights, or claims of.
acknowledgeable	sub
	head	acknowledge
	syl	ac+1knowl+edge+a:ble
	pos	adj.
acknowledger	sub
	head	acknowledge
	syl	ac+1knowl+edg+er
	pos	n.
acknowledgement	alt
	head	acknowledgment
	or	acknowledgment
	syl	ac+knowl+edge+ment
	pron	<*k1noliJ?!m*nt>
	pos	n.
acknowledgment	1.
	or	acknowledgement
	syl	ac+knowl+edg+ment
	pron	<*k1noliJ?!m*nt>
	pos	n.
	def	the act of acknowledging or state of being acknowl?!edged.
acknowledgment	2.
	or	acknowledgement
	syl	ac+knowl+edg+ment
	pron	<*k1noliJ?!m*nt>
	pos	n.
	def	something done or given as an expression of thanks, as a reply to a message, etc.
acknowledgment	3.
	or	acknowledgement
	syl	ac+knowl+edg+ment
	pron	<*k1noliJ?!m*nt>
	pos	n.
	mod	pl.
	def	an author's statement acknowledging his use of the works of other authors, usually printed at the front of a book.
aclinic line	ety	C19 aclinic, from Greek aklin*_es not bending, from #7a -%1+ klinein to bend, lean
aclinic line	0.
	syl	a:clin+ic line
	pron	<*1klinik>
	pos	n.
	def	another name for {magnetic equator}.
acme	ety	C16: from Greek akm*_e 
acme	0.
	syl	ac:me
	pron	<1@kmi>
	pos	n.
	def	the culminating point, as of achievement or excellence; summit; peak.
acne	ety	C19: New Latin, from a misreading of Greek akm*_e eruption on the face. See #7acme 
acne	0.
	syl	ac:ne
	pron	<1@kni>
	pos	n.
	def	a chronic skin disease common in adolescence, involving inflammation of the sebaceous glands and characterized by pustules on the face, neck, and upper trunk.
acnode	ety	C19: from Latin acus a needle+#7node 
acnode	0.
	syl	ac+node
	pron	<1@k2n*ud>
	pos	n.
	def	a point whose coordinates satisfy the equation of a curve although it does not lie on the curve; an isolated point. The origin is an acnode of the curve %2+ %2= %3.
acnodal	sub
	head	acnode
	syl	ac+1no+dal
	pos	adj.
Acol	ety	C20: named after a club in Acol Road, London
Acol	0.
	syl	Ac:ol
	pron	<1@kL>
	pos	n.
	qual	Bridge.
	def	a popular British bidding system favouring light opening bids and a flexible approach.
acolyte	ety	C16: via Old French and Medieval Latin from Greek akolouthos a follower
acolyte	1.
	syl	ac:o+lyte
	pron	<1@k*2lIt>
	pos	n.
	def	a follower or attendant.
acolyte	2.
	syl	ac:o+lyte
	pron	<1@k*2lIt>
	pos	n.
	qual	Christianity.
	def	an officer who attends or assists a priest.
Aconcagua	0.
	syl	A:con+ca+gua
	pron	Spanish <akon1ka$Gwa>
	pos	n.
	def	a mountain in W Argentina: the highest peak in the Andes and in the W Hemi?!sphere. Height: 6960 m (22835 ft.).
aconite	ety	C16: via Old French or Latin from Greek akoniton aconite, monkshood
aconitum	alt
	head	aconite
	or	aconite
	syl	ac:o+ni+tum
	pron	<2@k*1nIt*m>
	pos	n.
aconite	1.
	or	aconitum
	syl	ac:o+nite
	pron	<1@k*2nIt>
	pos	n.
	def	any of various N temperate plants of the ranunculaceous genus such as monkshood and wolfsbane, many of which are poisonous. Compare {winter aconite}.
aconite	2.
	or	aconitum
	syl	ac:o+nite
	pron	<1@k*2nIt>
	pos	n.
	def	the dried poisonous root of many of these plants, sometimes used as a narcotic and analgesic.
aconitic	sub
	head	aconite
	syl	ac:o+nit+ic
	pron	<2@k*1nitik>
	pos	adj.
Acores	0.
	syl	A:*,c*^o+res
	pron	<*1soriS>
	pos	n.
	def	the Portuguese name for (the) {Azores}.
acorn	ety	C16: variant (through influence of corn) of Old English @acern the fruit of a tree, acorn; related to Gothic akran fruit, yield
acorn	0.
	syl	a:corn
	pron	<1Akc:n>
	pos	n.
	def	the fruit of the oak tree, consisting of a smooth thick-walled nut in a woody scaly cuplike base.
shell	alt
	head	acorn barnacle
	or	acorn barnacle
	syl	shell
	pos	n.
acorn barnacle	0.
	or	shell
	syl	a:corn bar+na+cle
	pos	n.
	def	any of various barnacles, such as that live attached to rocks and have a volcano-shaped shell from the top of which protrude feathery food-catching appendages (cirri).
tube	alt
	head	acorn valve
	or	acorn valve
	syl	tube
	pos	n.
	qual	U.S.
acorn valve	0.
	or	tube
	syl	a:corn valve
	pos	n.
	def	a small electronic valve, approximately acorn-shaped with small closely-spaced electrodes, used in ultrahigh-frequency applications.
acorn worm	0.
	syl	a:corn worm
	pos	n.
	def	any of various small burrowing marine animals of the genus and related genera, having an elongated wormlike body with an acorn-shaped eversible proboscis at the head end: subphylum (hemichordates).
acotyledon	0.
	syl	a:cot:y+le:don
	pron	<*2koti1lEdN>
	pos	n.
	def	any plant, such as a fern, moss, or fungus, that does not possess cotyledons.
acotyledonous	sub
	head	acotyledon
	syl	a:2cot:y+1le:don+ous
	pos	adj.
acouchi	ety	C19: via French from a native name in Guiana
acouchy	alt
	head	acouchi
	or	acouchi
	syl	a:cou+chy
	pron	<*1ku:Si>
	pos	n.
acouchis	infl
	head	acouchi
	or	acouchies
	syl	a:cou+chis
	pos	n.
	mod	pl.
acouchies	infl
	head	acouchi
	or	acouchis
	syl	a:cou+chies.
	pos	n.
	mod	pl.
acouchi	0.
	or	acouchy
	syl	a:cou+chi
	pron	<*1ku:Si>
	pos	n.
	def	any of several South American rodents of the genus closely related to the agoutis but much smaller, with a white-tipped tail: family
acoustic	ety	C17: from Greek akoustikos, from akouein to hear
acoustical	alt
	head	acoustic
	or	acoustic
	syl	a:cous+ti+cal
	pos	adj.
acoustic	1.
	or	acoustical
	syl	a:cous+tic
	pron	<*1ku:stik>
	pos	adj.
	def	of or related to sound, the sense of hearing, or acoustics.
acoustic	2.
	or	acoustical
	syl	a:cous+tic
	pron	<*1ku:stik>
	pos	adj.
	def	designed to respond to, absorb, or control sound.
	exam	1	an acoustic tile.
acoustic	3.
	or	acoustical
	syl	a:cous+tic
	pron	<*1ku:stik>
	pos	adj.
	usage	of a musical instrument or recording
	def	without electronic amplification.
	exam	1	an acoustic bass;
	exam	2	acoustic guitar.
acoustically	sub
	head	acoustic
	syl	a:1cous+ti+cal+ly
	pos	adv.
acoustic feature	0.
	syl	a:cous+tic fea+ture
	pos	n.
	qual	Phonetics.
	def	any of the acoustic components or elements present in a speech sound and capable of being experimentally observed, recorded, and reproduced.
acoustician	0.
	syl	a:cous+ti+cian
	pron	<2@ku1stiS*n>
	pos	n.
	def	an expert in acoustics.
acoustic nerve	0.
	syl	a:cous+tic nerve
	pos	n.
	def	either one of the eighth pair of cranial nerves, which supply the cochlea and semicircular canals of the internal ear and contribute to the sense of hearing.
acoustic phonetics	0.
	syl	a:cous+tic pho+net+ics
	pos	n.
	def	the branch of phonetics concerned with the acoustic properties of human speech. Compare {ar?!ticulatory phonetics}.
acoustics	1.
	syl	a:cous+tics
	pron	<*1ku:stiks>
	pos	n.
	mod	functioning as; sing.
	def	the scientif?!ic study of sound and sound waves.
acoustics	2.
	syl	a:cous+tics
	pron	<*1ku:stiks>
	pos	n.
	mod	functioning as; pl.
	def	the characteristics of a room, auditorium, etc., that determine the fidelity with which sound can be heard within it.
acpt	0.
	syl	acpt.
	qual	Commerce. abbrev. for
	def	acceptance.
acquaint	ety	C13: via Old French and Medieval Latin from Latin accog?!nitus, from accogn*_oscere to know perfectly, from ad- (intensive)+ cogn*_oscere to know
acquaint	1.
	syl	ac+quaint
	pron	<*1kwAnt>
	pos	vb.
	mod	tr.
	usage	foll. by with or of
	def	to make (a person) familiar or conversant (with); inform (of).
acquaint	2.
	syl	ac+quaint
	pron	<*1kwAnt>
	pos	vb.
	mod	tr.
	qual	Chiefly U.S.
	usage	foll. by with
	def	to introduce (to); bring into contact (with).
acquaintance	1.
	syl	ac+quaint+ance
	pron	<*1kwAnt*ns>
	pos	n.
	def	a person with whom one has been in contact but who is not a close friend.
acquaintance	2.
	syl	ac+quaint+ance
	pron	<*1kwAnt*ns>
	pos	n.
	def	knowledge of a person or thing, esp. when slight.
make the acquaintance of	3.
	head	acquaintance
	syl	make the acquaint?!ance of.
	def	to come into social contact with.
acquaintance	4.
	syl	ac+quaint+ance
	pron	<*1kwAnt*ns>
	pos	n.
	def	those persons collectively whom one knows.
acquaintanceship	sub
	head	acquaintance
	syl	ac+1quaint+ance+2ship
	pos	n.
acquainted	1.
	syl	ac+quaint+ed
	pron	<*1kwAntid>
	pos	adj.
	usage	postpositive; sometimes foll. by with
	def	on terms of familiarity but not intimacy.
acquainted	2.
	syl	ac+quaint+ed
	pron	<*1kwAntid>
	pos	adj.
	usage	postpositive; foll. by with
	def	having knowledge or experience (of); familiar (with).
acquiesce	ety	C17: from Latin acqui*_escere to remain at rest, agree without protest, from ad- at+ qui*_escere to rest, from qui*_es #7quiet  &- @!ac+qui+#!es+cence n. ?- @!ac+qui+#!es+cent adj.
acquiesce	0.
	syl	ac+qui+esce
	pron	<2@kwi1es>
	pos	vb.
	mod	intr.
	usage	often foll. by in or to
	def	to comply (with); assent (to) without protest.
acquiescently	sub
	head	acquiesce
	syl	ac+qui+1es+cent+ly
	pos	adv.
acquire	ety	C15: via Old French from Latin acqu*_irere, from ad- in addition+ quaerere to get, seek
acquire	0.
	syl	ac+quire
	pron	<*1kwI*>
	pos	vb.
	mod	tr.
	def	to get or gain (something, such as an object, trait, or ability), esp. more or less permanently.
acquirable	sub
	head	acquire
	syl	ac+1quir+a:ble
	pos	adj.
acquirement	sub
	head	acquire
	syl	ac+1quire+ment
	pos	n.
acquirer	sub
	head	acquire
	syl	ac+1quir+er
	pos	n.
acquired characteristic	0.
	syl	ac+quired char+ac+ter+is+tic
	pos	n.
	def	a characteristic of an organism resulting from increased use or disuse of an organ or the effects of the environment. See also {Lamarckism}.
acquired taste	1.
	syl	ac+quired taste
	pos	n.
	def	a liking for something that is at first considered unpleasant.
acquired taste	2.
	syl	ac+quired taste
	pos	n.
	def	the thing so liked.
acquisition	ety	C14: from Latin acqu*_is*_iti*_on-, from acqu*_irere to #7acquire 
acquisition	1.
	syl	ac+qui+si+tion
	pron	<2@kwi1ziS*n>
	pos	n.
	def	the act of acquiring or gaining possession.
acquisition	2.
	syl	ac+qui+si+tion
	pron	<2@kwi1ziS*n>
	pos	n.
	def	something acquired.
acquisition	3.
	syl	ac+qui+si+tion
	pron	<2@kwi1ziS*n>
	pos	n.
	def	a person or thing of special merit added to a group.
acquisition	4.a.
	syl	ac+qui+si+tion
	pron	<2@kwi1ziS*n>
	pos	n.
	def	the re-establishment of communications between a spacecraft and a ground control station after a temporary blackout.
acquisition	4.b.
	syl	ac+qui+si+tion
	pron	<2@kwi1ziS*n>
	pos	n.
	def	the process of locating a spacecraft, satellite, etc., esp. by radar, in order to gather tracking and telemetric information.
acquisitive	0.
	syl	ac+quis:i+tive
	pron	<*1kwizitiv>
	pos	adj.
	def	inclined or eager to acquire things, esp. material possessions or ideas.
	exam	1	an acquisitive mind.
acquisitively	sub
	head	acquisitive
	syl	ac+1quis:i+tive+ly
	pos	adv.
acquisitiveness	sub
	head	acquisitive
	syl	ac+1quis:i+tive+ness
	pos	n.
acquit	ety	C13: from Old French aquiter, from quiter to release, free from, #7quit 
acquits	infl
	head	acquit
	syl	ac+quits
	pos	vb.
	mod	tr.
acquitting	infl
	head	acquit
	syl	ac+quit+ting
	pos	vb.
	mod	tr.
acquitted	infl
	head	acquit
	syl	ac+quit+ted.
	pos	vb.
	mod	tr.
acquit	1.a.
	syl	ac+quit
	pron	<*1kwit>
	pos	vb.
	mod	tr.
	def	to free or release (from a charge of crime).
acquit	1.b.
	syl	ac+quit
	pron	<*1kwit>
	pos	vb.
	mod	tr.
	def	to pronounce not guilty.
acquit	2.
	syl	ac+quit
	pron	<*1kwit>
	pos	vb.
	mod	tr.
	usage	foll. by of
	def	to free or relieve (from an obligation, duty, responsibility, etc.).
acquit	3.
	syl	ac+quit
	pron	<*1kwit>
	pos	vb.
	mod	tr.
	def	to repay or settle (something, such as a debt or obligation).
acquit	4.
	syl	ac+quit
	pron	<*1kwit>
	pos	vb.
	mod	tr.
	def	to perform (one's part); conduct (oneself).
acquitter	sub
	head	acquit
	syl	ac+1quit+ter
	pos	n.
acquittal	1.
	syl	ac+quit+tal
	pron	<*1kwitL>
	pos	n.
	qual	Criminal law.
	def	the deliverance and release of a person appearing before a court on a charge of crime, as by a finding of not guilty.
acquittal	2.
	syl	ac+quit+tal
	pron	<*1kwitL>
	pos	n.
	def	a discharge or release from an obligation, duty, debt, etc.
acquittance	1.
	syl	ac+quit+tance
	pron	<*1kwit*ns>
	pos	n.
	def	a release from or settlement of a debt, etc.
acquittance	2.
	syl	ac+quit+tance
	pron	<*1kwit*ns>
	pos	n.
	def	a record of this, such as a receipt.
acre	ety	Old English @acer field, acre; related to Old Norse akr, German Acker, Latin ager field, Sanskrit ajra field
acre	1.
	syl	a:cre
	pron	<1Ak*>
	pos	n.
	def	a unit of area used in certain English-speaking countries, equal to 4840 square yards or 4046.86 square metres.
acre	2.a.
	syl	a:cre
	pron	<1Ak*>
	pos	n.
	def	land, esp. a large area.
acre	2.b.
	syl	a:cre
	pron	<1Ak*>
	pos	n.
	qual	Informal.
	def	a large amount.
	exam	1	he has acres of space in his room.
Acre	1.
	syl	A:cre
	pron	<1a:kr*>
	pos	n.
	def	a territory of W Brazil: mostly unexplored tropical forests; acquired from Bolivia in 1903. Capital: Rio Branco. Pop.: 215299 (1970). Area: 148026 sq. km (57153 sq. miles).
Acre	2.
	syl	A:cre
	pron	<1Ak*>, <1a:k*>
	pos	n.
	def	a city and port in N Israel, strategically situated on the {Bay of Acre} in the E Mediterranean: taken and retaken during the Crusades (1104, 1187, 1191, 1291), taken by the Turks (1517), by Egypt (1832), and by the Turks again (1839). Pop.: 34400 (1972). Old Testament name: {Ac+cho} ($a$:#!k$$$u). Arabic name: {`Ak@.ka} ($a$:#!k$a$:). Hebrew name: {`Ak@.ko} ($a$:#!k$$$u).
acreage	0.
	syl	a:cre+age
	pron	<1Ak*riJ>
	pos	n.
	def	land area in acres.
acred	0.
	syl	a:cred
	pron	<1Ak*d>
	pos	adj.
	usage	usually in combination
	def	having acres of land.
	exam	1	a many-acred farm;
	exam	2	a well-acred nobleman.
acre-feet	infl
	head	acre-foot
	syl	a:cre-feet.
	pos	n.
	mod	pl.
acre-foot	0.
	syl	a:cre-foot
	pos	n.
	def	the volume of water that would cover an area of 1 acre to a depth of 1 foot: equivalent to 43560 cubic feet or 1233.5 cubic metres.
acre-inch	0.
	syl	a:cre-inch
	pos	n.
	def	the volume of water that would cover an area of 1 acre to a depth of 1 inch; one twelfth of an acre-foot: equivalent to 3630 cubic feet or 102.8 cubic metres.
acrid	ety	C18: from Latin *_acer sharp, sour; probably formed on the model of #7acid 
acrid	1.
	syl	ac+rid
	pron	<1@krid>
	pos	adj.
	def	unpleasantly pungent or sharp to the smell or taste.
acrid	2.
	syl	ac+rid
	pron	<1@krid>
	pos	adj.
	def	sharp or caustic, esp. in speech or nature.
acridity	sub
	head	acrid
	or	acridness
	syl	a:crid+i:ty
	pron	<*1kriditi>
	pos	n.
acridness	sub
	head	acrid
	or	acridity
	syl	ac+rid+ness
	pos	n.
acridly	sub
	head	acrid
	syl	ac+rid+ly
	pos	adv.
acridine	0.
	syl	ac+ri+dine
	pron	<1@kri2dEn>
	pos	n.
	def	a colourless crystalline solid used in the manufacture of dyes. Formula: C\1\3H\9N.
acriflavine	ety	C20: from #7acridine+ -#7flavin 
acriflavine	0.
	syl	ac+ri+fla+vine
	pron	<2@kri1flAvin>, <-vEn>
	pos	n.
	def	a brownish or orange-red powder used in medicine as an antiseptic and bacteriostat. Formula: C\1\4H\1\4N\3Cl.
acriflavine hydrochloride	0.
	syl	ac+ri+fla+vine hy:dro+chlor+ide
	pos	n.
	def	a red crystalline water-soluble solid substance obtained from acriflavine and used as an antiseptic. Also called: {flavine}.
Acrilan	0.
	syl	Ac+ri+lan
	pron	<1@kri2l@n>
	pos	n.
	qual	Trademark.
	def	an acrylic fibre or fabric, characterized by strength, softness, and crease-resistance and used for clothing, upholstery, carpets, etc.
acrimony	ety	C16: from Latin *_acrim*_onia, from *_acer sharp, sour &- ac+ri+mo+ni+ous (@!@akr$I#!m$$$un$I$$s) adj. &- @!ac+ri+#!mo+ni+ous+ly adv. &- @!ac+ri+#!mo+ni+ous+ness n.
acrimonies	infl
	head	acrimony
	syl	ac+ri+mo+nies.
	pos	n.
	mod	pl.
acrimony	0.
	syl	ac+ri+mo+ny
	pron	<1@krim*ni>
	pos	n.
	def	bitterness or sharpness of manner, speech, temper, etc.
acro-	ety	from Greek akros extreme, topmost
acro-	0.
	syl	ac:ro-
	exam	1	combining form.
acro-	1.
	syl	ac:ro-
	def	denoting something at a height, summit, top, tip, beginning, or end.
	exam	1	acropolis;
	exam	2	acrogen.
acro-	2.
	syl	ac:ro-
	def	denoting an extremity of the human body.
	exam	1	acromegaly.
acrobat	ety	C19: via French from Greek akrobat*_es acrobat, one who walks on tiptoe, from #7acro -#7+ bat-, from bainein to walk
acrobat	1.
	syl	ac+ro+bat
	pron	<1@kr*2b@t>
	pos	n.
	def	an entertainer who performs acts that require skill, agility, and coordination, such as tumbling, swinging from a trapeze, or walking a tightrope.
acrobat	2.
	syl	ac+ro+bat
	pron	<1@kr*2b@t>
	pos	n.
	qual	Informal.
	def	a person noted for his frequent and rapid changes of position or allegiances.
	exam	1	a political acrobat.
acrobatic	sub
	head	acrobat
	syl	ac+ro+1bat+ic
	pos	adj.
acrobatically	sub
	head	acrobat
	syl	ac+ro+1bat:i+cal+ly
	pos	adv.
acrobatics	1.
	syl	ac+ro+bat+ics
	pron	<2@kr*1b@tiks>
	pos	n.
	mod	functioning as; pl.
	def	the skills or feats of an acrobat.
acrobatics	2.
	syl	ac+ro+bat+ics
	pron	<2@kr*1b@tiks>
	pos	n.
	mod	functioning as; sing.
	def	the art of an acrobat.
acrobatics	3.
	syl	ac+ro+bat+ics
	pron	<2@kr*1b@tiks>
	pos	n.
	mod	functioning as; pl.
	def	any activity requiring agility and skill.
	exam	1	mental acrobatics.
acrocarpous	ety	C19: from New Latin, from Greek akrokarpos 
acrocarpous	0.
	syl	ac+ro+car+pous
	pron	<2@kr*u1ka:p*s>
	pos	adj.
	usage	of ferns, mosses, etc.
	def	having the reproductive parts at the tip of a stem.
acrodont	ety	C19: from #7acro -#7+ -#7odont 
acrodont	1.
	syl	ac+ro+dont
	pron	<1@kr*2dont>
	pos	adj.
	usage	of the teeth of some reptiles
	def	having no roots and being fused at the base to the margin of the jawbones. See also { {pleurodont} (sense 1)}.
acrodont	2.
	syl	ac+ro+dont
	pron	<1@kr*2dont>
	pos	adj.
	def	having acrodont teeth.
acrodrome	0.
	syl	ac+ro+drome
	pron	<1@kr*2dr*um>
	pos	adj.
	usage	of the veins of a leaf
	def	running parallel to the edges of the leaf and fusing at the tip. Also: {a@.crod+ro+mous} ($$#!kr$Adr$$m$$s).
acrogen	0.
	syl	ac+ro+gen
	pron	<1@kr*J*n>
	pos	n.
	def	any flowerless plant, such as a fern or moss, in which growth occurs from the tip of the main stem.
acrogenic	sub
	head	acrogen
	or	acrogenous
	syl	ac+ro+gen+ic
	pron	<2@kr*1Jenik>
	pos	adj.
acrogenous	sub
	head	acrogen
	or	acrogenic
	syl	a:crog+e:nous
	pron	<*1kroJin*s>
	pos	adj.
acrogenously	sub
	head	acrogen
	syl	a:1crog+e:nous+ly
	pos	adv.
acrolein	ety	C19: from Latin *_acer sharp+ ol*_ere to smell+-#7in 
acrolein	0.
	syl	a:cro+le:in
	pron	<*1kr*uliin>
	pos	n.
	def	a colourless or yellowish flammable poisonous pungent liquid used in the manufacture of resins and pharmaceuticals. Formula: CH\2:CHCHO.
acrolith	ety	C19: via Latin acrolithus from Greek akrolithos having stone extremities
acrolith	0.
	syl	ac+ro+lith
	pron	<1@kr*liT>
	pos	n.
	usage	esp. in ancient Greek sculpture
	def	a wooden, often draped figure with only the head, hands, and feet in stone.
acrolithic	sub
	head	acrolith
	syl	ac+ro+1lith+ic
	pos	adj.
acromegaly	ety	C19: from French acrom*'egalie, from #7acro -#7+ Greek megal-, stem of megas big
acromegaly	0.
	syl	ac+ro+meg:a+ly
	pron	<2@kr*u1meg*li>
	pos	n.
	def	a chronic disease characterized by enlargement of the bones of the head, hands, and feet. It is caused by excessive secretion of growth hormone by the pituitary gland. Compare {gigantism}.
acromegalic	sub
	head	acromegaly
	syl	ac+ro+me:gal+ic
	pron	<2@kr*umi1g@lik>
	pos	adj. n.
acromion	ety	C17: New Latin, from Greek akr*_omion the point of the shoulder, from #7acro -#7+ *_omion, diminutive of *_omos shoulder
acromia	infl
	head	acromion
	syl	a:cro+mi:a
	pron	<-mi*>
	pos	n.
	mod	pl.
acromion	0.
	syl	a:cro+mi+on
	pron	<*1kr*umi*n>
	pos	n.
	def	the outermost edge of the spine of the shoulder blade.
acronychal	ety	C16: from Greek akronychos at sunset, from #7acro -+ nykh-, nyx night
acronycal	infl
	head	acronychal
	or	acronical
	syl	a:cron:y+cal
	pron	<*1kronikL>
	pos	adj.
acronical	infl
	head	acronychal
	or	acronycal
	syl	a:cron:i+cal
	pron	<*1kronikL>
	pos	adj.
	qual	U.S.
acronychal	0.
	syl	a:cron:y+chal
	pron	<*1kronikL>
	pos	adj.
	def	occurring at sunset.
	exam	1	the star has an acronychal rising.
acronychally	sub
	head	acronychal
	syl	a:1cron:y+chal+ly
	pos	adv.
acronycally	sub
	head	acronychal
	or	acronically
	syl	a:1cron:y+cal+ly
	pos	adv.
acronically	sub
	head	acronychal
	or	acronycally
	syl	a:1cron:i+cal+ly
	pos	adv.
	qual	U.S.
acronym	ety	C20: from #7acro -#7+onym 
acronym	0.
	syl	ac+ro+nym
	pron	<1@kr*nim>
	pos	n.
	def	a word formed from the initial letters of a group of words; for example, for the
acronymic	sub
	head	acronym
	or	acronymous
	syl	ac+ro+1nym+ic
	pron	<*1kronim*s>
	pos	adj.
acronymous	sub
	head	acronym
	or	acronymic
	syl	a:cron:y+mous
	pron	<*1kronim*s>
	pos	adj.
acropetal	0.
	syl	a:crop+e:tal
	pron	<*1kropitL>
	pos	adj.
	usage	of leaves and flowers
	def	produced in order from the base upwards so that the youngest are at the apex. Compare {basipetal}.
acrophobia	ety	C19: from #7acro -+-#7phobia  &- @!ac+ro+#!pho+bic adj.
acrophobia	0.
	syl	ac+ro+pho+bi:a
	pron	<2@kr*1f*ubi*>
	pos	n.
	def	abnormal fear or dread of being at a great height.
acropolis	ety	C17: from Greek, from #7acro -#7+ polis city
acropolis	0.
	syl	a:crop:o+lis
	pron	<*1krop*lis>
	pos	n.
	def	the citadel of an ancient Greek city.
Acropolis	0.
	syl	A:crop:o+lis
	pron	<*1krop*lis>
	pos	n.
	def	the citadel of Athens on which the Parthenon and the Erechtheum stand.
acrospire	ety	C17: from obsolete akerspire, from aker #7ear %2#7+ spire sprout, #7spire %1; the modern form is influenced by #7acro -
acrospire	0.
	syl	ac+ro+spire
	pron	<1@kr*2spI*>
	pos	n.
	def	the first shoot developing from the plumule of a germinating grain seed.
across	ety	C13 on croice, acros, from Old French a croix crosswise
across	1.
	syl	a:cross
	pron	<*1kros>
	pos	prep.
	def	from one side to the other side of.
across	2.
	syl	a:cross
	pron	<*1kros>
	pos	prep.
	def	on or at the other side of.
across	3.
	syl	a:cross
	pron	<*1kros>
	pos	adv.
	def	from one side to the other.
across	4.
	syl	a:cross
	pron	<*1kros>
	pos	adv.
	def	on or to the other side.
across-the-board	1.
	syl	a:cross-the-board
	pos	adj.
	usage	of salary increases, taxation cuts, etc.
	def	affecting all levels or classes equally.
across-the-board	2.
	syl	a:cross-the-board
	pos	adj.
	qual	Horse racing, chiefly U.S.
	def	designating a bet in which equal amounts are staked on the same contestant to win or to come second or third in a race.
acrostic	ety	C16: via French from Greek akrostikhis, from #7acro -#7+ stikhos line of verse, #7stich 
acrostic	0.a.
	syl	a:cros+tic
	pron	<*1krostik>
	pos	n.
	def	a number of lines of writing, such as a poem, certain letters of which form a word, proverb, etc. A {single acrostic} is formed by the initial letters of the lines, a {double acrostic} by the initial and final letters, and a {triple acrostic} by the initial, middle, and final letters.
acrostic	0.b.
	syl	a:cros+tic
	pron	<*1krostik>
	pos	n.
	def	the word, proverb, etc., so formed.
acrostic	0.c.
	syl	a:cros+tic
	pron	<*1krostik>
	pos	n.
	usage	as modifier
	exam	1	an acrostic sonnet.
acrostically	sub
	head	acrostic
	syl	a:1cros+ti+cal+ly
	pos	adv.
acroter	ety	C18: from French, from Latin acroterium, from Greek akr*_ot*_erion summit, from akros extreme
acroter	0.
	syl	a:cro+ter
	pron	<*1kr*ut*>, <1@kr*t*>
	pos	n.
	qual	Architecture.
	def	a plinth bearing a statue, etc., at either end or at the apex of a pediment.
acrylic	ety	C20: from #7acrolein+ -#7yl+ -#7ic 
acrylic	1.
	syl	a:cryl+ic
	pron	<*1krilik>
	pos	adj.
	def	of, derived from, or concerned with acrylic acid.
acrylic	2.
	syl	a:cryl+ic
	pron	<*1krilik>
	pos	n.
	def	short for {acrylic resin}.
acrylic acid	0.
	syl	a:cryl+ic ac:id
	pos	n.
	def	a colourless corrosive pungent liquid, miscible with water, used in the manufacture of acrylic resins. Formula: CH\2:CHCOOH.
acrylic fibre	0.
	syl	a:cryl+ic fi+bre
	pos	n.
	def	a textile fibre, such as Orlon or Acrilan, produced from acrylonitrile.
acrylic resin	0.
	syl	a:cryl+ic res+in
	pos	n.
	def	any of a group of polymers or copolymers of acrylic acid, its esters, or amides, used as synthetic rubbers, textiles, paints, adhesives, and as plastics such as Perspex.
acrylonitrile	ety	C20: from #7acrylic+nitrile 
acrylonitrile	0.
	syl	ac+ry+lo+ni+trile
	pron	<2@kril*u1nItrIl>
	pos	n.
	def	a colourless liquid that is miscible with water and has toxic fumes: used in the manufacture of acrylic fibres and resins, rubber, and thermoplastics. Formula: CH\2:CHCN.
acrylyl	0.
	syl	ac+ry+lyl
	pron	<1@krilil>
	pos	n.
	usage	modifier
	def	of, consisting of, or containing the monovalent group CH\2:CHCO-.
	exam	1	acrylyl group or radical.
acs pay	0.
	syl	a/cs pay.
	qual	abbrev. for
	def	accounts payable.
acs rec	0.
	syl	a/cs rec.
	qual	abbrev. for
	def	accounts receivable.
act	ety	C14: from Latin actus a doing, performance, and actum a thing done, from the past participle of agere to do
act	1.
	syl	act
	pron	<@kt>
	pos	n.
	def	something done or performed; a deed.
act	2.
	syl	act
	pron	<@kt>
	pos	n.
	def	the performance of some physical or mental process; action.
act	3.
	syl	act
	pron	<@kt>
	pos	n.
	usage	cap. when part of a name
	def	the formally codified result of deliberation by a legislative body; a law, edict, decree, statute, etc.
act	4.
	syl	act
	pron	<@kt>
	pos	n.
	mod	often; pl.
	def	a formal written record of transactions, proceedings, etc., as of a society, committee, or legislative body.
act	5.
	syl	act
	pron	<@kt>
	pos	n.
	def	a major division of a dramatic work.
act	6.a.
	syl	act
	pron	<@kt>
	pos	n.
	def	a short performance of skill, a comic sketch, dance, etc., esp. one that is part of a programme of light entertainment.
act	6.b.
	syl	act
	pron	<@kt>
	pos	n.
	def	those giving such a performance.
act	7.
	syl	act
	pron	<@kt>
	pos	n.
	def	an assumed attitude or pose, esp. one intended to impress.
act	8.
	syl	act
	pron	<@kt>
	pos	n.
	qual	Philosophy.
	def	an occurrence effected by a human agent as opposed to one that is determined. Compare { {event} (sense 4)}.
act	9.
	syl	act
	pron	<@kt>
	pos	vb.
	mod	intr.
	def	to do something; carry out an action.
act	10.
	syl	act
	pron	<@kt>
	pos	vb.
	mod	intr.
	def	to function in a specified way; operate; react.
	exam	1	his mind acted quickly.
act	11.
	syl	act
	pron	<@kt>
	pos	vb.
	def	to perform (a part or role) in a play, etc.
act	12.
	syl	act
	pron	<@kt>
	pos	vb.
	mod	tr.
	def	to present (a play, etc.) on stage.
act	13.
	syl	act
	pron	<@kt>
	pos	vb.
	mod	intr.
	usage	usually foll. by for or as
	def	to be a substitute (for); function in place (of).
act	14.
	syl	act
	pron	<@kt>
	pos	vb.
	mod	intr.
	usage	foll. by as
	def	to serve the function or purpose (of).
	exam	1	the glass acted as protection.
act	15.
	syl	act
	pron	<@kt>
	pos	vb.
	mod	intr.
	def	to conduct oneself or behave (as if one were).
	exam	1	she usually acts like a lady;
	exam	2	she was acting tired.
act	16.
	syl	act
	pron	<@kt>
	pos	vb.
	mod	intr.
	def	to behave in an unnatural or affected way.
act	17.
	syl	act
	pron	<@kt>
	pos	vb.
	usage	copula
	def	to pose as; play the part of.
	exam	1	to act the fool.
act	18.
	syl	act
	pron	<@kt>
	pos	vb.
	usage	copula
	def	to behave in a manner appropriate to (esp. in the phrase {act one's age) }.
act	19.
	syl	act
	pron	<@kt>
	pos	vb.
	qual	Not standard.
	usage	copula
	def	to seem or pretend to be.
	exam	1	to act tired.
act	xref
	syl	act
	pron	<@kt>
	pos	n.
	def	See also {act on, act out, act up}.
actable	sub
	head	act
	syl	act+a:ble
	pos	adj.
actability	sub
	head	act
	syl	act+a:1bil+i:ty
	pos	n.
ACT	0.
	syl	A.C.T.
	qual	abbrev. for
	def	Australian Capital Territory.
Actaeon	0.
	syl	Ac:tae:on
	pron	<@k1tE*n>, <1@kti*n>
	pos	n.
	qual	Greek myth.
	def	a hunter of Boeotia who, having accidentally seen Artemis bathing, was turned into a stag and torn apart by his own hounds.
actg	0.
	syl	actg.
	qual	abbrev. for
	def	acting.
ACTH	0.
	syl	ACTH
	pos	n.
	def	adrenocorticotropic hormone; a polypeptide hormone, secreted by the anterior lobe of the pituitary gland, that stimulates growth of the adrenal gland and the synthesis and secretion of corticosteroids. It is used in treating rheumatoid arthritis, allergic and skin diseases, and many other disorders. Also called: {corticotropin}.
actin	ety	C20: from #7act+ -#7in 
actin	0.
	syl	ac+tin
	pron	<1@ktin>
	pos	n.
	def	a protein in muscle that exists in both globular and fibrous forms and associates with myosin to form the complex protein actomyosin.
actinal	ety	C19: see #7actino -#7, -#7al %1
actinal	1.
	syl	ac+ti+nal
	pron	<1@ktinL>, <@k1tInL>
	pos	adj.
	def	of or denoting the oral part of a radiate animal, such as a jellyfish, sea anemone, or sponge, from which the rays, tentacles, or arms grow.
actinal	2.
	syl	ac+ti+nal
	pron	<1@ktinL>, <@k1tInL>
	pos	adj.
	def	possessing rays or tentacles, as a jellyfish.
actinally	sub
	head	actinal
	syl	ac+ti+nal+ly
	pos	adv.
acting	1.
	syl	act+ing
	pron	<1@ktiG>
	pos	adj.
	usage	prenominal
	def	taking on duties temporarily, esp. as a substitute for another.
	exam	1	the acting president.
acting	2.
	syl	act+ing
	pron	<1@ktiG>
	pos	adj.
	usage	prenominal
	def	operating or functioning.
	exam	1	an acting order.
acting	3.
	syl	act+ing
	pron	<1@ktiG>
	pos	adj.
	usage	prenominal
	def	intended for stage performance; provided with directions for actors.
	exam	1	an acting version of @6Hedda Gabler.@9
acting	4.
	syl	act+ing
	pron	<1@ktiG>
	pos	n.
	usage	prenominal
	def	the art or profession of an actor.
actinia	ety	C18: New Latin, literally: things having a radial structure. See #7actino -#7, -#7ia 
actiniae	infl
	head	actinia
	or	actinias
	syl	ac+tin:i:ae
	pron	<-1tini2E>
	pos	n.
	mod	pl.
actinias	infl
	head	actinia
	or	actiniae
	syl	ac+tin:i:as.
	pos	n.
	mod	pl.
actinia	0.
	syl	ac+tin:i:a
	pron	<@k1tini*>
	pos	n.
	def	any sea anemone of the genus which are common in rock pools.
actinic	ety	C19: from #7actino -#7+ -#7ic 
actinic	0.
	syl	ac+tin+ic
	pron	<@k1tinik>
	pos	adj.
	usage	of radiation
	def	producing a photo?!chemical effect.
actinically	sub
	head	actinic
	syl	ac+1tin:i+cal+ly
	pos	adv.
actinism	sub
	head	actinic
	syl	ac+tin+2ism
	pos	n.
actinide	ety	C19: from #7actino -#7+ -#7ide 
actinide	0.
	syl	ac+ti+nide
	pron	<1@kti2nId>
	pos	n.
	def	a member of the actinide series. Also called: {actinon}.
actinide series	0.
	syl	ac+ti+nide se+ries
	pos	n.
	def	a series of 15 radioactive elements with increasing atomic numbers from actinium to lawrencium.
actiniform	ety	C20: from #7actino -#7+ -#7form 
actiniform	0.
	syl	ac+tin:i+form
	pron	<@k1tini2fc:m>
	pos	adj.
	def	another word for {actinoid}.
actinium	ety	C19: New Latin, from #7actino -#7+ -#7ium 
actinium	0.
	syl	ac+tin+i:um
	pron	<@k1tini*m>
	pos	n.
	def	a radioactive element of the actinide series, occurring as a decay product of uranium. It is used as an alpha-particle source and in neutron production. Symbol: Ac; atomic no.: 89; half-life of most stable isotope,%2%2%7Ac: 22 years; relative density: 10.07; melting pt.: 1050?%C; boiling pt.: 3200?%C (est.).
actinium series	0.
	syl	ac+tin+i:um se+ries
	pos	n.
	def	a radioactive series that starts with actinium-235 and ends with lead-207.
actino-	ety	from Greek aktino-, from aktis beam, ray
actino-	1.
	syl	ac:ti:no-
	usage	before a vowel
	def	indicat?!ing a radial structure.
	exam	1	actinomorphic.
actino-	2.
	syl	ac:ti:no-
	usage	before a vowel
	def	indicating radio?!activity or radiation.
	exam	1	actinometer.
actinochemistry	0.
	syl	ac+tin:o+chem+is+try
	pron	<@k2tin*u1kemistri>
	pos	n.
	def	another name for {photochemistry}.
actinoid	0.
	syl	ac+ti+noid
	pron	<1@kti2ncid>
	pos	adj.
	def	having a radiate form, as a sea anemone or starfish.
actinolite	ety	C19: from #7actino - (from the radiating crystals in some forms)+-#7lite 
actinolite	0.
	syl	ac+tin:o+lite
	pron	<@k1tin*2lIt>
	pos	n.
	def	a green mineral of the amphibole group consisting of calcium magnesium iron silicate. Formula: Ca\2(Mg,Fe)\5Si\8O\2\2(OH)\2.
actinomere	0.
	syl	ac+ti+no+mere
	pron	<1@ktin*u2mi*>
	pos	n.
	def	another name for {antimere}.
actinometer	0.
	syl	ac+ti+nom+e:ter
	pron	<2@kti1nomit*>
	pos	n.
	def	an instrument for measuring the intensity of radiation, esp. of the sun's rays.
actinometric	sub
	head	actinometer
	or	actinometrical
	syl	ac+ti+no+met+ric
	pron	<2@ktin*u1metrik>
	pos	adj.
actinometrical	sub
	head	actinometer
	or	actinometric
	syl	ac+ti+no+1met+ri+cal
	pos	adj.
actinometry	sub
	head	actinometer
	syl	ac+ti+1nom+e:try
	pos	n.
actinomorphous	alt
	head	actinomorphic
	or	actinomorphic
	syl	ac+ti+no+mor+phous
	pos	adj.
actinomorphic	0.
	or	actinomorphous
	syl	ac+ti+no+mor+phic
	pron	<2@ktin*u1mc:fik>
	pos	adj.
	usage	Botany. esp. of a flower
	def	having radial symmetry, as buttercups; capable of being cut vertically through the axis in any of two or more planes so that the two cut halves are mirror images of each other. See also {zygomorphic}.
actinomycete	0.
	syl	ac+ti+no+my+cete
	pron	<2@ktin*umI1sEt>
	pos	n.
	def	any microorganism of the group usually regarded as filamentous bacteria.
actinomycin	0.
	syl	ac+ti+no+my+cin
	pron	<2@ktin*u1mIsin>
	pos	n.
	def	any of several toxic antibiotics obtained from bacteria of the genus used in treating some cancers.
actinomycosis	0.
	syl	ac+ti+no+my+co+sis
	pron	<2@ktin*umI1k*usis>
	pos	n.
	def	a fungal disease of cattle, sometimes transmitted to man, characterized by a swelling of the affected part, most often the jaw. Nontechnical name: {lumpy jaw}.
actinomycotic	sub
	head	actinomycosis
	syl	ac+ti+no+my+cot+ic
	pron	<2@ktin*umI1kot?!ik>
	pos	adj.
actinon	ety	C20: New Latin, from #7actinium+ -#7on 
actinon	1.
	syl	ac+ti+non
	pron	<1@kti2non>
	pos	n.
	def	a radioisotope of radon that is a decay product of radium. Symbol: An or %2%1%9Rn; atomic no.: 86; half-life: 3.92s.
actinon	2.
	syl	ac+ti+non
	pron	<1@kti2non>
	pos	n.
	def	another name for {actinide}.
actinopod	0.
	syl	ac+tin:o+pod
	pron	<@k1tin*2pod>
	pos	n.
	def	any protozoan of the subclass such as a radiolarian or a heliozoan, having stiff radiating pseudopodia.
actinotherapy	0.
	syl	ac+ti+no+ther:a+py
	pron	<2@ktin*u1Ter*pi>
	pos	n.
	def	another name for {radiotherapy}.
actinouranium	0.
	syl	ac+ti+no+u:ra+ni:um
	pron	<2@ktin*uju1rAni*m>
	pos	n.
	def	the isotope of uranium that has a mass number of 235.
actinozoan	0.
	syl	ac+ti+no+zo+an
	pron	<2@ktin*u1z*u*n>
	pos	n. adj.
	def	another word for {anthozoan}.
action	ety	C14 accioun, ultimately from Latin *_acti*_on-, stem of *_acti*_o, from agere to do, act
action	1.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	the state or process of doing something or being active; operation.
action	2.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	something done, such as an act or deed.
action	3.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	movement or posture during some physical activity.
action	4.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	activity, force, or energy.
	exam	1	a man of action.
action	5.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	mod	usually; pl.
	def	conduct or behaviour.
action	6.a.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	a legal proceeding brought by one party against another, seeking redress of a wrong or recovery of what is due; lawsuit.
action	6.b.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	the right to bring such proceeding.
action	7.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	the operating mechanism, esp. in a piano, gun, watch, etc.
action	8.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	the force applied to a body.
	exam	1	the reaction is equal and opposite to the action.
action	9.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	the way in which something operates or works.
action	10.a.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	a property of a system expressed as twice the mean kinetic energy of the system over a given time interval multiplied by the time interval.
action	10.b.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	the product of work or energy and time, usually expressed in joule seconds.
	exam	1	Planck's constant of action.
action	11.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	the events that form the plot of a story, film, play, or other composition.
action	12.a.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	a minor engagement.
action	12.b.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	fighting at sea or on land.
	exam	1	he saw action in the war.
action	13.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	qual	Informal.
	def	the profits of an enterprise or transaction (esp. in the phrase {a piece of the action) }.
action	14.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	qual	Slang.
	def	the main activity, esp. social activity. {~}
action	15.
	syl	ac+tion
	pron	<1@kS*n>
	pos	n.
	def	a command given by a film director to indicate that filming is to begin. See also { {cue} %1 (senses 1, 8)}.
actionable	0.
	syl	ac+tion+a:ble
	pron	<1@kS*n*bL>
	pos	adj.
	qual	Law.
	def	affording grounds for legal action.
actionably	sub
	head	actionable
	syl	ac+tion+a:bly
	pos	adv.
action painting	0.
	syl	ac+tion paint+ing
	pos	n.
	def	a development of abstract expressionism evolved in the 1940s, characterized by broad vigorous brush strokes and accidental effects of thrown, smeared, dripped, or spattered paint. Also called: {tachisme}. See also {abstract expressionism}.
action potential	0.
	syl	ac+tion po+ten+tial
	pos	n.
	def	a localized change in electrical potential, from -70 mV to +30 mV, that occurs across a nerve fibre during transmission of a nerve impulse.
action replay	0.
	syl	ac+tion re+play
	pos	n.
	def	the rerunning of a small section of a television film or tape of a match or other sporting contest, often in slow motion. U.S. name: {instant replay}.
action stations	1.
	syl	ac+tion sta+tions
	pos	n.
	mod	pl.
	qual	Military.
	def	the positions taken up by individuals in preparation for or during a battle. {~}
action stations	2.
	syl	ac+tion sta+tions
	pos	n.
	mod	pl.
	qual	Military.
	def	a command to take up such positions.
action stations	3.
	syl	ac+tion sta+tions
	pos	n.
	mod	pl.
	qual	Military.; Informal.
	def	a warning to get ready for something.
Actium	0.
	syl	Ac+ti:um
	pron	<1@kti*m>
	pos	n.
	def	a town of ancient Greece that overlooked the naval battle in 31 #7b.c. at which Octavian's fleet under Agrippa defeated that of Mark Antony and Cleopatra.
activate	1.
	syl	ac+ti+vate
	pron	<1@kti2vAt>
	pos	vb.
	mod	tr.
	def	to make active or capable of action.
activate	2.
	syl	ac+ti+vate
	pron	<1@kti2vAt>
	pos	vb.
	mod	tr.
	qual	Physics.
	def	to make radioactive.
activate	3.a.
	syl	ac+ti+vate
	pron	<1@kti2vAt>
	pos	vb.
	mod	tr.
	def	to increase the rate of (a reaction).
activate	3.b.
	syl	ac+ti+vate
	pron	<1@kti2vAt>
	pos	vb.
	mod	tr.
	def	to treat (a substance, such as carbon or alumina) so as to increase powers of adsorption.
activate	4.
	syl	ac+ti+vate
	pron	<1@kti2vAt>
	pos	vb.
	mod	tr.
	def	to purify (sewage) by aeration.
activate	5.
	syl	ac+ti+vate
	pron	<1@kti2vAt>
	pos	vb.
	mod	tr.
	qual	U.S. military.
	def	to create, mobilize, or organize (a unit).
activation	sub
	head	activate
	syl	ac+ti+1va+tion
	pos	n.
activated alumina	0.
	syl	ac+ti+vat+ed a:lu+mi+na
	pos	n.
	def	a granular highly porous and adsorptive form of aluminium oxide, used for drying gases and as an oil-filtering material and catalyst.
activated carbon	0.
	syl	ac+ti+vat+ed car+bon
	pos	n.
	def	a porous highly adsorptive form of carbon used to remove colour or impurities from liquids and gases, in the separation and extraction of chemical compounds, and in the recovery of solvents. Also called: {activated charcoal, active carbon}.
activated sludge	0.
	syl	ac+ti+vat+ed sludge
	pos	n.
	def	a mass of aerated precipitated sewage added to untreated sewage to bring about purification by hastening bacterial decomposition.
active	ety	C14: from Latin *_act*_ivus. See #7act, -#7ive 
active	1.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	in a state of action; moving, working, or doing something.
active	2.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	busy or involved.
	exam	1	an active life.
active	3.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	physically energetic.
active	4.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	exerting influence; effective.
	exam	1	an active ingredient.
active	5.a.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	denoting a voice of verbs used to indicate that the subject of a sentence is performing the action or causing the event or process described by the verb, as in Compare { {passive} (sense 5)}.
active	5.b.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	another word for {nonstative}.
active	6.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	being fully engaged in military service (esp. in the phrase {on active service) }.
active	7.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	usage	of a volcano
	def	erupting periodically; not extinct. Compare { {dormant} (sense 3)}, { {extinct} (sense 3)}.
active	8.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	usage	Astronomy. of the sun
	def	exhibiting a large number of sunspots, solar flares, etc., and a marked variation in intensity and frequency of radio emission. Compare { {quiet} (sense 7)}.
active	9.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	qual	Commerce.
	def	producing or being used to produce profit, esp. in the form of interest.
	exam	1	active balances.
active	10.a.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	containing a source of power.
	exam	1	an active network.
active	10.b.
	syl	ac+tive
	pron	<1@ktiv>
	pos	adj.
	def	capable of amplifying a signal or controlling some function.
	exam	1	an active component;
	exam	2	an active communication satellite.
active	11.a.
	syl	ac+tive
	pron	<1@ktiv>
	pos	n.
	def	the active voice.
active	11.b.
	syl	ac+tive
	pron	<1@ktiv>
	pos	n.
	def	an active verb.
active	12.
	syl	ac+tive
	pron	<1@ktiv>
	pos	n.
	qual	Chiefly U.S.
	def	a member of an organization who par?!ticipates in its activities.
actively	sub
	head	active
	syl	ac+tive+ly
	pos	adv.
activeness	sub
	head	active
	syl	ac+tive+ness
	pos	n.
active list	0.
	syl	ac+tive list
	pos	n.
	qual	Military.
	def	a list of officers available for full duty.
activism	0.
	syl	ac+tiv+ism
	pron	<1@kti2viz*m>
	pos	n.
	def	a policy of taking direct and often militant action to achieve an end, esp. a political or social one.
activist	sub
	head	activism
	syl	ac+tiv+ist
	pos	n.
activities	infl
	head	activity
	syl	ac+tiv+i:ties.
	pos	n.
	mod	pl.
activity	1.
	syl	ac+tiv+i:ty
	pron	<@k1tiviti>
	pos	n.
	def	the state or quality of being active.
activity	2.
	syl	ac+tiv+i:ty
	pron	<@k1tiviti>
	pos	n.
	def	lively action or movement.
activity	3.
	syl	ac+tiv+i:ty
	pron	<@k1tiviti>
	pos	n.
	def	any specific deed, action, pursuit, etc..
	exam	1	recreational activities.
activity	4.
	syl	ac+tiv+i:ty
	pron	<@k1tiviti>
	pos	n.
	def	the number of disintegrations of a radioactive substance in a given unit of time, usually expressed in curies or disintegrations per second.
activity	5.a.
	syl	ac+tiv+i:ty
	pron	<@k1tiviti>
	pos	n.
	def	the capacity of a substance to undergo chemical change.
activity	5.b.
	syl	ac+tiv+i:ty
	pron	<@k1tiviti>
	pos	n.
	def	the effective concentration of a substance in a chemical system. The {absolute activity} of a substance B, #Gv\ , is defined as exp (#Gm where #Gm is the chemical potential.
act of contrition	0.
	syl	act of con+tri+tion
	pos	n.
	qual	Theol.
	def	a short prayer of penitence.
act of faith	0.
	syl	act of faith
	pos	n.
	qual	Theol.
	def	an act that demonstrates or tests a person's religious beliefs.
act of God	0.
	syl	act of God
	pos	n.
	qual	Law.
	def	a sudden and inevitable occurrence caused by natural forces and not by the agency of man, such as a flood, earthquake, or a similar catastrophe.
act of war	0.
	syl	act of war
	pos	n.
	def	an aggressive act, usually employing military force, which constitutes an immediate threat to peace.
actomyosin	0.
	syl	ac+to+my:o+sin
	pron	<2@kt*u1mI*sin>
	pos	n.
	def	a complex protein in skeletal muscle that is formed by actin and myosin and which, when stimulated, shortens to cause muscle contraction.
upon	alt
	head	act on
	or	act on
	syl	up:on
	pos	vb. prep.
	mod	intr.
act on	1.
	or	upon
	syl	act on
	pos	vb. prep.
	mod	intr.
	def	to regulate one's behaviour in accordance with (advice, information, etc.).
act on	2.
	or	upon
	syl	act on
	pos	vb. prep.
	mod	intr.
	def	to have an effect on (illness, a part of the body, etc.).
Acton	H1.0.
	syl	Ac+ton
	pron	<1@kt*n>
	pos	n.
	def	a district of the London borough of Ealing.
John Emerich Edward Dalberg	1.
	head	Acton
	syl	John Em:er:ich Ed:ward Dal:berg
	def	1st Baron Acton. 1834-1902, English historian: a proponent of Christian liberal ethics and adviser of Gladstone.
Acton	H2.2.
	syl	Ac:ton
	pron	<1@kt*n>
	pos	n.
	def	his grandfather, Sir {John Fran@.cis Ed@.ward}. 1736-1811, European naval commander and statesman: admiral of Tuscany (1774-79) and Naples (1779 onwards) and chief minister of Naples (1779-1806).
actress	alt
	head	actor
	or	actor
	syl	ac+tress
	pron	<1@ktris>
	pos	n.
	mod	fem.
actor	1.
	or	actress
	syl	ac+tor
	pron	<1@kt*>
	pos	n.
	def	a person who acts in a play, film, broadcast, etc.
actor	2.
	or	actress
	syl	ac+tor
	pron	<1@kt*>
	pos	n.
	qual	Informal.
	def	a person who puts on a false manner in order to deceive others (often in the phrase {bad actor) }.
act out	1.
	syl	act out
	pos	vb. adv.
	mod	tr.
	def	to reproduce (an idea, former event, etc.) in actions, often by mime.
act out	2.
	syl	act out
	pos	vb. adv.
	qual	Psychiatry.
	def	to express unconsciously (a repressed impulse or experience) in overt behaviour.
Acts of the Apostles	0.
	syl	Acts of the A:pos+tles
	pos	n.
	def	the fifth book of the New Testament, describing the development of the early Church from Christ's ascension into heaven to Paul's sojourn at Rome. Often shortened to {Acts}.
ACTU	0.
	syl	A.C.T.U.
	qual	abbrev. for
	def	Australian Council of Trade Unions.
actual	ety	C14 actuel existing, from Late Latin *_actu*_alis relating to acts, practical, from Latin *_actus #7act #e Usage. The excessive use of actual and actually should be avoided. They are unnecessary in sentences such as in actual fact, he is forty-two, and he did actually go to the play but did not enjoy it.
actual	1.
	syl	ac+tu:al
	pron	<1@kCu*l>
	pos	adj.
	def	existing in reality or as a matter of fact.
actual	2.
	syl	ac+tu:al
	pron	<1@kCu*l>
	pos	adj.
	def	real or genuine.
actual	3.
	syl	ac+tu:al
	pron	<1@kCu*l>
	pos	adj.
	def	existing at the present time; current.
actualities	infl
	head	actuality
	syl	ac+tu+al+i:ties.
	pos	n.
	mod	pl.
actuality	1.
	syl	ac+tu+al+i:ty
	pron	<2@kCu1@liti>
	pos	n.
	def	true existence; reality.
actuality	2.
	syl	ac+tu+al+i:ty
	pron	<2@kCu1@liti>
	pos	n.
	mod	sometimes; pl.
	def	a fact or condition that is real.
actualise	alt
	head	actualize
	or	actualize
	syl	ac+tu+al+ise
	pron	<1@kCu*2lIz>
	pos	vb.
	mod	tr.
actualize	1.
	or	actualise
	syl	ac+tu+al+ize
	pron	<1@kCu*2lIz>
	pos	vb.
	mod	tr.
	def	to make actual or real.
actualize	2.
	or	actualise
	syl	ac+tu+al+ize
	pron	<1@kCu*2lIz>
	pos	vb.
	mod	tr.
	def	to represent realistically.
actualization	sub
	head	actualize
	or	actualisation
	syl	ac+tu+al:i+1za+tion
	pos	n.
actualisation	sub
	head	actualize
	or	actualization
	syl	ac+tu+al:i+1sa+tion
	pos	n.
actually	1.a.
	syl	ac+tu+al+ly
	pron	<1@kCu*li>
	pos	adv.
	def	as an actual fact; really.
actually	1.b.
	syl	ac+tu+al+ly
	pron	<1@kCu*li>
	pos	adv.
	usage	as sentence modifier
	def	.
	exam	1	actually, I haven't seen him.
actually	2.
	syl	ac+tu+al+ly
	pron	<1@kCu*li>
	pos	adv.
	def	at present.
actually	3.
	syl	ac+tu+al+ly
	pron	<1@kCu*li>
	pos	adv.
	qual	Informal.
	def	a parenthetic filler used to add slight emphasis.
	exam	1	I don't know, actually.
actuary	ety	C16 (meaning: registrar): from Latin *_actu*_arius one who keeps accounts, from actum public business, and acta documents, deeds. See #7act, -#7ary 
actuaries	infl
	head	actuary
	syl	ac+tu+ar:ies.
	pos	n.
	mod	pl.
actuary	0.
	syl	ac+tu+ar:y
	pron	<1@kCu*ri>
	pos	n.
	def	a statistician, esp. one employed by insurance companies to calculate risks, policy premiums and dividends, and annuity rates.
actuarial	sub
	head	actuary
	syl	ac+tu+ar:i+al
	pron	<2@kCu1e*ri*l>
	pos	adj.
actuate	ety	C16: from Medieval Latin actu*_atus, from actu*_are to incite to action, from Latin *_actus #7act 
actuate	1.
	syl	ac+tu+ate
	pron	<1@kCu2At>
	pos	vb.
	mod	tr.
	def	to put into action or mechanical motion.
actuate	2.
	syl	ac+tu+ate
	pron	<1@kCu2At>
	pos	vb.
	mod	tr.
	def	to motivate or incite into action.
	exam	1	actuated by unworthy desires.
actuation	sub
	head	actuate
	syl	ac+tu:1a+tion
	pos	n.
actuator	sub
	head	actuate
	syl	ac+tu:2a+tor
	pos	n.
act up	0.
	syl	act up
	pos	vb. adv.
	mod	intr.
	qual	Informal.
	def	to behave in a troublesome way.
	exam	1	the engine began to act up.
acuity	ety	C15: from Old French, from Latin ac*_utus #7acute 
acuity	0.
	syl	a:cu+i:ty
	pron	<*1kju:iti>
	pos	n.
	def	keenness or acuteness, esp. in vision or thought.
aculeate	ety	C17: from Latin ac*_ule*_atus; see #7aculeus 
aculeated	alt
	head	aculeate
	or	aculeate
	syl	a:cu+le:at+ed
	pos	adj.
aculeate	1.
	or	aculeated
	syl	a:cu+le:ate
	pron	<*1kju:liit>, <-2At>
	pos	adj.
	def	cutting; pointed.
aculeate	2.
	or	aculeated
	syl	a:cu+le:ate
	pron	<*1kju:liit>, <-2At>
	pos	adj.
	def	having prickles or spines, as a rose.
aculeate	3.
	or	aculeated
	syl	a:cu+le:ate
	pron	<*1kju:liit>, <-2At>
	pos	adj.
	def	having a sting, as bees, wasps, and ants.
aculeus	ety	C19: from Latin, diminutive of acus needle
aculeus	1.
	syl	a:cu+le:us
	pron	<*1kju:li*s>
	pos	n.
	def	a prickle or spine, such as the thorn of a rose.
aculeus	2.
	syl	a:cu+le:us
	pron	<*1kju:li*s>
	pos	n.
	def	a sting or ovipositor.
acumen	ety	C16: from Latin: sharpness, from acuere to sharpen, from acus needle
acumen	0.
	syl	ac:u+men
	pron	<1@kju2men>, <*1kju:m*n>
	pos	n.
	def	the ability to judge well; keen discernment; insight.
acuminous	sub
	head	acumen
	syl	a:1cu+mi+nous
	pos	adj.
acuminate	ety	C17: from Latin ac*_umin*_are to sharp?!en; see #7acumen 
acuminate	1.
	syl	a:cu+mi+nate
	pron	<*1kju:minit>, <-2nAt>
	pos	adj.
	def	narrowing to a sharp point, as some types of leaf.
acuminate	2.
	syl	a:cu+mi+nate
	pron	<*1kju:mi2nAt>
	pos	vb.
	mod	tr.
	def	to make pointed or sharp.
acumination	sub
	head	acuminate
	syl	a:2cu+mi+1na+tion
	pos	n.
acupuncture	ety	C17: from Latin acus needle+#7puncture 
acupuncture	0.
	syl	ac:u+punc+ture
	pron	<1@kju2p^GkC*>
	pos	n.
	def	the insertion of the tips of needles into the skin at specific points for the purpose of treating various disorders by stimulating nerve impulses. Originally Chinese, this method of treatment is practised in many parts of the world. Also called: {stylostixis}.
acutance	0.
	syl	a:cut+ance
	pron	<*1kju:tNs>
	pos	n.
	def	a physical rather than subjective measure of the sharpness of a photographic image.
acute	ety	C14: from Latin ac*_utus, past participle of acuere to sharpen, from acus needle
acute	1.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	penetrating in perception or insight.
acute	2.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	sensitive to details; keen.
acute	3.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	of extreme importance; crucial.
acute	4.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	sharp or severe; intense.
	exam	1	acute pain;
	exam	2	an acute drought.
acute	5.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	having a sharp end or point.
acute	6.a.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	usage	of an angle
	def	less than 90?%.
acute	6.b.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	usage	of a triangle
	def	having all its interior angles less than 90?%.
acute	7.a.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	arising suddenly and manifesting intense severity.
acute	7.b.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	of relatively short duration. Compare { {chronic} (sense 2).}
acute	8.a.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	usage	of a vowel or syllable in some languages with a pitch accent, such as ancient Greek
	def	spoken or sung on a higher musical pitch relative to neighbouring syllables or vowels.
acute	8.b.
	syl	a:cute
	pron	<*1kju:t>
	pos	adj.
	def	of or relating to an accent (*' ) placed over vowels, denoting that the vowel is pronounced with higher musical pitch (as in ancient Greek), with certain special quality (as in French), etc. Compare (for a. and b.) { {grave%2} (sense 5),} {circumflex}.
acute	9.
	syl	a:cute
	pron	<*1kju:t>
	pos	n.
	def	an acute accent.
acutely	sub
	head	acute
	syl	a:1cute+ly
	pos	adv.
acuteness	sub
	head	acute
	syl	a:1cute+ness
	pos	n.
acute accent	0.
	syl	a:cute ac+cent
	pos	n.
	def	the diacritical mark (*' ), used in the writing system of some languages to indicate that the vowel over which it is placed has a special quality (as in French or that it receives the strongest stress in the word (as in Spanish .
acute arch	0.
	syl	a:cute arch
	pos	n.
	def	another name for {lancet arch}.
ACW	0.
	syl	A.C.W.
	qual	abbrev. for
	def	aircraftwoman.
acyclic	1.
	syl	a:cy+clic
	pron	<A1sIklik>, <A1siklik>
	pos	adj.
	qual	Chem.
	def	not cyclic; having an open chain structure.
acyclic	2.
	syl	a:cy+clic
	pron	<A1sIklik>, <A1siklik>
	pos	adj.
	qual	Botany.
	def	having flower parts arranged in a spiral rather than a whorl.
acyl	ety	C20: from #7acid+ -#7yl 
acyl	1.
	syl	a:cyl
	pron	<1AsIl>
	pos	n.
	usage	modifier
	def	of, denoting, or containing the monovalent group of atoms RCO-.
	exam	1	acyl group or radical;
	exam	2	acyl substitution.
acyl	2.
	syl	a:cyl
	pron	<1AsIl>
	pos	n.
	def	an organometallic compound in which a metal atom is directly bound to an acyl group.
ad	H1.0.
	syl	ad
	pron	<@d>
	pos	n.
	def	short for {advertisement}.
ad	H2.0.
	syl	ad
	pron	<@d>
	pos	n.
	qual	Tennis, U.S.
	def	short for {advantage}. Brit. word: {van}.
AD	0.
	syl	AD
	qual	Military. abbrev. for
	def	active duty.
AD	ety	Latin: in the year of the Lord#e Usage. In strict usage, #7a.d. is only employed with specific years: he died in 1621 #7a.d., but he died in the 17th century (and not the 17th century #7a.d.) #7. Formerly the practice was to write #7a.d. preceding the date (#7a.d. 1621) , and it is also strictly correct to omit in when #7a.d. is used, since this is already contained in the meaning of the Latin anno Domini (in the year of Our Lord), but this is no longer general practice. #7b.c. is used with both specific dates and indications of the period: Heraclitus was born about 540 #7b.c. ; the battle took place in the 4th century #7b.c.
AD	0.
	syl	A.D.
	qual	abbrev. for
	usage	indicating years numbered from the supposed year of the birth of Christ
	def	anno Domini.
	exam	1	70 #7a.d.
ad-	ety	from Latin: to, towards. As a prefix in words of Latin origin, ad- became ac-, af-, ag-, al-, an-, acq-, ar-, as-, and at- before c, f, g, l, n, q, r, s, and t, and became a- before gn, sc, sp, st 
ad-	1.
	syl	ad-
	pos	prefix.
	def	to; towards.
	exam	1	adsorb;
	exam	2	adverb.
ad-	2.
	syl	ad-
	pos	prefix.
	def	near; next to.
	exam	1	adrenal.
-ad	ety	via Latin from Greek -ad- (plural, -ades) , originally forming adjectives; names of epic poems are all formed on the model of the Iliad 
-ad	H1.0.
	syl	-ad
	exam	1	suffix forming nouns.
-ad	H1.1.
	syl	-ad
	def	a group or unit (having so many parts or members).
	exam	1	triad.
-ad	H1.2.
	syl	-ad
	def	an epic poem concerning (the subject indicated by the stem).
	exam	1	Dunciad.
-ad	ety	from Latin ad (preposition) to, towards
-ad	H2.0.
	syl	-ad
	usage	suffix forming adverbs.
	def	denoting direction towards a specified part in anatomical descriptions.
	exam	1	cephalad.
adactylous	ety	C19: from #7a -%1#7+dactyl+ -#7ous 
adactylous	0.
	syl	a:dac+ty+lous
	pron	<A1d@ktil*s>
	pos	adj.
	def	possessing no fingers or toes.
adage	ety	C16: via Old French from Latin adagium; related to *_aio I say
adage	0.
	syl	ad+age
	pron	<1@diJ>
	pos	n.
	def	a traditional saying that is accepted by many as true or partially true; proverb.
adagio	ety	C18: Italian, from ad at + agio ease
	infl
	head	adagio
	syl	~
	pos	adj. adv.
	qual	Music.
adagio	1.
	syl	a:da+gi:o
	pron	<*1da:Ji2*u>, Italian <a1daJo>
	pos	adj. adv.
	def	slow. {~} {+gi@.os}
adagio	2.
	syl	a:da+gi:o
	pron	<*1da:Ji2*u>, Italian <a1daJo>
	pos	adj. adv.
	def	a movement or piece to be performed slowly.
adagio	3.
	syl	a:da+gi:o
	pron	<*1da:Ji2*u>, Italian <a1daJo>
	pos	adj. adv.
	qual	Ballet.
	def	a slow section of a pas de deux.
Adam	H1.1.
	syl	Ad:am
	pron	<1@d*m>
	pos	n.
	qual	Old Testament.
	def	the first man, created by God: the progenitor of the human race (Genesis 2-3).
not know (someone) from Adam	2.
	head	Adam
	syl	not know (someone) from Adam.
	def	to fail to be acquainted with someone.
the old Adam	3.
	head	Adam
	syl	the old Adam.
	def	the evil supposedly inherent in human nature.
Adam's ale	4.
	head	Adam
	or	wine
	syl	Adam's ale
	def	water.
Robert	1.
	head	Adam
	syl	Rob:ert.
	def	1728-92, Scottish architect and furniture designer. Assisted by his brother, {James}, 1730-94, he emulated the harmony of classical and Italian Renaissance architecture.
Adam	H2.2.
	syl	Ad:am
	pron	<1@d*m>
	pos	adj.
	def	in the neoclassical style made popular by Robert Adam.
Adam-and-Eve	0.
	syl	Ad:am-and-Eve
	pos	n.
	def	another name for {puttyroot}.
adamant	ety	Old English: from Latin adamant-, stem of adamas, from Greek; literal meaning perhaps: unconquerable, from #7a -%1#7+ daman to tame, conquer
adamant	1.
	syl	ad:a+mant
	pron	<1@d*m*nt>
	pos	adj.
	def	unyielding; inflexible.
adamant	2.
	syl	ad:a+mant
	pron	<1@d*m*nt>
	pos	adj.
	def	un?!breakable; impenetrable.
adamant	3.
	syl	ad:a+mant
	pron	<1@d*m*nt>
	pos	n.
	def	any extremely hard or apparent?!ly unbreakable substance.
adamant	4.
	syl	ad:a+mant
	pron	<1@d*m*nt>
	pos	n.
	def	a legendary stone said to be impenetrable, often identified with the diamond or loadstone.
adamantine	1.
	syl	ad:a+man+tine
	pron	<2@d*1m@ntIn>
	pos	adj.
	def	having the lustre of a diamond.
adamantine	2.
	syl	ad:a+man+tine
	pron	<2@d*1m@ntIn>
	pos	adj.
	qual	Rare.
	def	another word for {adamant}.
Adamawa	0.
	syl	Ad:a+ma+wa
	pron	<2@d*1ma:w*>
	pos	n.
	def	a small group of languages of W Africa, spoken chiefly in E Nigeria, N Cameroon, the Central African Republic, and N Za*"ire, forming a branch of the Niger-Congo family.
Adamite	1.
	syl	Ad+am+ite
	pron	<1@d*2mIt>
	pos	n.
	def	a human being.
Adamite	2.
	syl	Ad+am+ite
	pron	<1@d*2mIt>
	pos	n.
	def	a nudist, esp. a member of an early Christian sect who sought to imitate Adam.
Adamitic	sub
	head	Adamite
	syl	Ad+am+it+ic
	pron	<2@d*1mitik>
	pos	adj.
Adams	H1.0.
	syl	Ad+ams
	pron	<1@d*mz>
	pos	n.
	def	a mountain in SW Washington, in the Cascade Range. Height: 3751 m (12307 ft.).
John	1.
	head	Adams
	syl	John.
	def	1735-1826, second president of the U.S. (1797-1801); U.S. ambassador to Great Britain (1785-88); helped draft the Declaration of Independence (1776).
John Couch	2.
	head	Adams
	syl	John Couch.
	def	1819-92, English astronomer who deduced the existence and position of the planet Neptune.
John Quincy	3.
	head	Adams
	syl	John Quin:cy
	def	son of John Adams. 1767-1848, sixth president of the U.S. (1825-29); secretary of state (1817-25).
Samuel	4.
	head	Adams
	syl	Sam:u:el.
	def	1722-1803, American revolutionary leader; one of the organizers of the Boston Tea Party; a signatory of the Declaration of Independence.
Adam's apple	0.
	syl	Ad+am's ap+ple
	pos	n.
	def	the visible projection of the thyroid cartilage of the larynx at the front of the neck.
adamsite	ety	C20: named after Roger Adams (born 1899), American chemist
adamsite	0.
	syl	ad+ams+ite
	pron	<1@d*m2zIt>
	pos	n.
	def	a yellow poisonous crystalline solid that readily sublimes. It is used as a tear gas; diphenyl?!aminechlorarsine. Formula: C\6H\4AsClNHC\6H\4; relative density: 1.65; melting pt.: 195?%C; boiling pt.: 410?%C.
Adam's-needle	0.
	syl	Ad:am's-nee:dle
	pos	n.
	def	a North American liliaceous plant, that has a tall woody stem, stiff pointed leaves, and large clusters of white flowers arranged in spikes. It is cultivated as an ornamental plant. See also {Spanish bayonet}.
Adams-Stokes syndrome	ety	C19: named after R. Adams (1791-1875) and W. Stokes (1804-78), Irish physicians
Adams-Stokes syndrome	0.
	syl	Ad:ams-Stokes syn+drome
	pos	n.
	def	another term for {heart block}.
Adana	0.
	syl	A:da+na
	pron	<1@d*n*>
	pos	n.
	def	a city in S Turkey, capital of Adana province. Pop.: 475384 (1975). Also called: {Seyhan}.
adapt	ety	C17: from Latin adapt*_are, from ad- to+ apt*_are to fit, from aptus #7apt  &- a@.#!dapt+a@.ble adj.
adapt	1.
	syl	a:dapt
	pron	<*1d@pt>
	pos	vb.
	usage	often foll. by to
	def	to adjust (someone or something, esp. oneself) to different conditions, a new environment, etc.
adapt	2.
	syl	a:dapt
	pron	<*1d@pt>
	pos	vb.
	mod	tr.
	def	to fit, change, or modify to suit a new or different purpose.
	exam	1	to adapt a play for use in schools.
adaptability	sub
	head	adapt
	or	adaptableness
	syl	a:2dapt+a:1bil+i:ty
	pos	n.
adaptableness	sub
	head	adapt
	or	adaptability
	syl	a:1dapt+a:ble+ness
	pos	n.
adaptation	1.
	syl	ad+ap+ta+tion
	pron	<2@d*p1tAS*n>, <2@d@p->
	pos	n.
	def	the act or process of adapting or the state of being adapted; adjustment.
adaptation	2.
	syl	ad+ap+ta+tion
	pron	<2@d*p1tAS*n>, <2@d@p->
	pos	n.
	def	something that is produced or created by adapting something else.
adaptation	3.
	syl	ad+ap+ta+tion
	pron	<2@d*p1tAS*n>, <2@d@p->
	pos	n.
	def	something that is changed or modified to suit new conditions or needs.
adaptation	4.
	syl	ad+ap+ta+tion
	pron	<2@d*p1tAS*n>, <2@d@p->
	pos	n.
	qual	Biology.
	def	an inherited or acquired modification in organisms that makes them better suited to survive and reproduce in a particular environment.
adaptor	alt
	head	adapter
	or	adapter
	syl	a:dap+tor
	pron	<*1d@pt*>
	pos	n.
adapter	1.
	or	adaptor
	syl	a:dapt+er
	pron	<*1d@pt*>
	pos	n.
	def	a person or thing that adapts.
adapter	2.
	or	adaptor
	syl	a:dapt+er
	pron	<*1d@pt*>
	pos	n.
	def	any device for connecting two parts, esp. ones that are of different sizes or have different mating fitments.
adapter	3.a.
	or	adaptor
	syl	a:dapt+er
	pron	<*1d@pt*>
	pos	n.
	def	a plug used to connect an electrical device to a mains supply when they have different types of terminals.
adapter	3.b.
	or	adaptor
	syl	a:dapt+er
	pron	<*1d@pt*>
	pos	n.
	def	a device used to connect several electrical appliances to a single mains socket.
adaptive radiation	0.
	syl	a:dap+tive ra+di:a+tion
	pos	n.
	def	the development of many different forms from an originally homogeneous group of animals as a result of the increase of the original stock and its spread and adaptation to different environments. This type of evolution occurred in the Tertiary mammals and the Mesozoic reptiles.
Adar	0.
	syl	A:dar
	pron	Hebrew <a1dar>
	pos	n.
	def	the sixth month of the civil year and the twelfth of the ecclesiastical year in the Jewish calendar, falling approximately in February and March.
Adar Sheni	ety	Hebrew: Adar the Second
Adar Sheni	0.
	syl	A:dar She+ni
	pron	Hebrew <SA1nE>
	pos	n.
	qual	Judaism.
	def	the month of Adar in leap years when an intercalary month, Adar Rishon, is inserted between Shebat and Adar.
adaxial	0.
	syl	ad+ax+i:al
	pron	<@d1@ksi*l>
	pos	adj.
	def	facing towards the axis, as the surface of a leaf that faces the stem. Compare {abaxial}.
ADC	1.
	syl	A.D.C.
	qual	abbrev. for:
	def	aide-de-camp.
ADC	2.
	syl	A.D.C.
	qual	abbrev. for:
	def	analog-digital convert?!er.
add	ety	C14: from Latin addere, literally: to put to, from ad- to+ -dere to put
add	1.
	syl	add
	pron	<@d>
	pos	vb.
	def	to combine (two or more numbers or quantities) by addition.
add	2.
	syl	add
	pron	<@d>
	pos	vb.
	mod	tr.
	usage	foll. by to
	def	to increase (a number or quantity) by another number or quantity using addition.
add	3.
	syl	add
	pron	<@d>
	pos	vb.
	mod	tr.
	usage	often foll. by to
	def	to join (something) to something else in order to increase the size, quantity, effect, or scope; unite (with).
	exam	1	to add insult to injury.
add	4.
	syl	add
	pron	<@d>
	pos	vb.
	mod	intr.
	usage	foll. by to
	def	to have an extra and increased effect (on).
	exam	1	her illness added to his worries.
add	5.
	syl	add
	pron	<@d>
	pos	vb.
	mod	tr.
	def	to say or write further.
add	6.
	syl	add
	pron	<@d>
	pos	vb.
	mod	tr.
	usage	foll. by in
	def	to include.
add	xref
	syl	add
	pron	<@d>
	pos	vb.
	def	See also {add up}.
add	1.
	syl	add.
	qual	abbrev. for:
	def	addendum.
add	2.
	syl	add.
	qual	abbrev. for:
	def	addition.
add	3.
	syl	add.
	qual	abbrev. for:
	def	additional.
add	4.
	syl	add.
	qual	abbrev. for:
	def	address.
Jane	infl
	head	Addams
	syl	Jane.
	pos	n.
Addams	0.
	syl	Ad:dams
	pron	<1@d*mz>
	pos	n.
	def	1860-1935, U.S. social reformer, feminist, and pacifist, who founded Hull House, a social settlement in Chicago: Nobel peace prize 1931.
addax	ety	C17: Latin, from an unidentified ancient N African language
addax	0.
	syl	ad+dax
	pron	<1@d@ks>
	pos	n.
	def	a large light-coloured antelope, having ribbed loosely spiralled horns and inhabiting desert regions in N Africa: family order
added sixth	0.
	syl	add+ed sixth
	pos	n.
	def	a chord much used esp. in jazz, consisting of a triad with an added sixth above the root. Also called: {added sixth chord}. Compare {sixth chord}.
addend	ety	C20: short for #7addendum 
addend	0.
	syl	ad+dend
	pron	<1@dend>, <*1dend>
	pos	n.
	def	any of a set of numbers that form a sum. Compare {augend}.
addendum	ety	C18: from Latin, literally: a thing to be added, neuter gerundive of addere to #7add 
da	infl
	head	addendum
	syl	+da
	pron	<-d*>
	pos	n.
	mod	pl.
addendum	1.
	syl	ad+den+dum
	pron	<*1dend*m>
	pos	n.
	def	something added; an addition.
addendum	2.
	syl	ad+den+dum
	pron	<*1dend*m>
	pos	n.
	def	a supplement or appendix to a book, magazine, etc.
addendum	3.
	syl	ad+den+dum
	pron	<*1dend*m>
	pos	n.
	def	the radial distance between the inner and outer pitch circles of a screw thread.
addendum	4.
	syl	ad+den+dum
	pron	<*1dend*m>
	pos	n.
	def	the radial distance between the pitch circle and tip of a gear tooth.
adder	ety	Old English n*_@adre snake; in Middle English a naddre was mistaken for an addre, whence the modern form; related to Old Norse nathr, Gothic nadrs 
adder	H1.1.
	syl	ad+der
	pron	<1@d*>
	pos	n.
	def	Also called: {viper}. a common viper, that is widely distributed in Europe, including Britain, and Asia and is typically dark greyish in colour with a black zigzag pattern along the back.
adder	H1.2.
	syl	ad+der
	pron	<1@d*>
	pos	n.
	def	any of various similar venomous or nonvenomous snakes.
adder	xref
	syl	ad+der
	pron	<1@d*>
	pos	n.
	def	See also {puff adder}.
adder	H2.0.
	syl	add+er
	pron	<1@d*>
	pos	n.
	def	a person or thing that adds.
adder's-meat	0.
	syl	ad:der's-meat
	pos	n.
	def	another name for the {greater stitchwort} (see {stitchwort) }.
adder's-mouth	0.
	syl	ad:der's-mouth
	pos	n.
	def	any of various orchids of the genus that occur in all parts of the world except Australia and New Zealand and have clusters of small usually greenish flowers. See also {bog orchid}.
adder's-tongue	1.
	syl	ad:der's-tongue
	pos	n.
	def	any of several terrestrial ferns of the genus esp. that grow in the N hemisphere and have a narrow spore-bearing body that sticks out like a spike from the leaf: family
adder's-tongue	2.
	syl	ad:der's-tongue
	pos	n.
	def	another name for { {dogtooth violet}}.
addict	ety	C16 (as adj. and as vb.; n. use C20): from Latin addictus given over, from add*_icere to give one's assent to, from ad- to+ d*_icere to say
addict	1.
	syl	ad+dict
	pron	<*1dikt>
	pos	vb.
	mod	tr.
	usage	usually passive; often foll. by to
	def	to cause (someone or oneself) to become dependent (on something, esp. a narcotic drug).
addict	2.
	syl	ad+dict
	pron	<1@dikt>
	pos	n.
	def	a person who is addicted, esp. to narcotic drugs.
addict	3.
	syl	ad+dict
	pron	<1@dikt>
	pos	n.
	qual	Informal.
	def	a person who is devoted to something.
	exam	1	a jazz addict.
addiction	0.
	syl	ad+dic+tion
	pron	<*1dikS*n>
	pos	n.
	def	the condition of being abnormally dependent on some habit, esp. compulsive dependency on narcotic drugs.
addictive	0.
	syl	ad+dic+tive
	pron	<*1diktiv>
	pos	adj.
	def	of, relating to, or causing addiction.
adding machine	0.
	syl	add+ing ma+chine
	pos	n.
	def	a mechanical device, operated manually or electrically, for adding and often subtracting, multiplying, and dividing. Compare {calculating machine}.
Henry	infl
	head	Addington
	syl	Hen:ry
	pos	n.
Addington	0.
	syl	Ad:ding:ton
	pron	<1@diGt*n>
	pos	n.
	def	1st Viscount Sidmouth. 1757-1844, English statesman; prime minister (1801-04) and home secretary (1812-21).
Addis Ababa	0.
	syl	Ad+dis Ab:a+ba
	pron	<1@dis> <1@b*b*>
	pos	n.
	def	the capital of Ethiopia, on a central plateau 2400 m (8000 ft.) above sea level: founded in 1887; became capital in 1896. Pop.: 1161267 (1975 est.).
Joseph	infl
	head	Addison
	syl	Jo:seph.
	pos	n.
Addison	0.
	syl	Ad:di:son
	pron	<1@disN>
	pos	n.
	def	1672-1719, English essayist and poet who, with Richard Steele, founded (1711-14) and contributed most of its essays, including the
Addison's disease	ety	C19: named after Thomas Addison (1793-1860), English physician who identified it
Addison's disease	0.
	syl	Ad:di:son's dis+ease
	pos	n.
	def	a disease characterized by deep bronz?!ing of the skin, anaemia, and extreme weakness, caused by underactivity of the adrenal glands. Also called: {adrenal insufficiency}.
addition	ety	C15: from Latin additi*_on-, from addere to #7add 
addition	1.
	syl	ad+di+tion
	pron	<*1diS*n>
	pos	n.
	def	the act, process, or result of adding.
addition	2.
	syl	ad+di+tion
	pron	<*1diS*n>
	pos	n.
	def	a person or thing that is added or acquired.
addition	3.
	syl	ad+di+tion
	pron	<*1diS*n>
	pos	n.
	def	a mathematical operation in which the sum of two numbers or quantities is calculated. Usually indicated by the symbol +
addition	4.
	syl	ad+di+tion
	pron	<*1diS*n>
	pos	n.
	qual	Chiefly U.S.
	def	a part added to a building or piece of land; annexe.
addition	5.
	syl	ad+di+tion
	pron	<*1diS*n>
	pos	n.
	qual	Obsolete.
	def	a title following a person's name.
in addition	6.
	head	addition
	syl	in addition.
	pos	adv.
	def	also; as well; besides.
in addition to	7.
	head	addition
	syl	in addition to.
	pos	prep.
	def	besides; as well as.
additional	0.
	syl	ad+di+tion+al
	pron	<*1diS*nL>
	pos	adj.
	def	added or supplementary.
additive	ety	C17: from Late Latin addit*_ivus, from addere to #7add 
additive	1.
	syl	ad+di+tive
	pron	<1@ditiv>
	pos	adj.
	def	characterized or produced by addition; cumulative.
additive	2.
	syl	ad+di+tive
	pron	<1@ditiv>
	pos	n.
	def	any substance added to some?!thing to improve it, prevent deterioration, etc.
addle	ety	C18 (vb.), back formation from addled, from C13 addle rotten, from Old English adela filth; related to dialect German Addel liquid manure
addle	H1.1.
	syl	ad+dle
	pron	<1@dL>
	pos	vb.
	def	to make or become confused or muddled.
addle	H1.2.
	syl	ad+dle
	pron	<1@dL>
	pos	vb.
	def	to make or become rotten.
addle	H1.3.
	syl	ad+dle
	pron	<1@dL>
	pos	adj.
	usage	in combination
	def	indicating a confused or muddled state.
	exam	1	addle-brained;
	exam	2	addle-pated.
addle	ety	C13 addlen, from Old Norse *"othlask to gain possession of property, from *_othal property
addle	H2.0.
	syl	ad+dle
	pron	<1@dL>
	pos	vb.
	qual	Northern English dialect.
	def	to earn (money or one's living).
address	ety	C14 (in the sense: to make right, adorn) and C15 (in the modern sense: to direct words): via Old French from Vulgar Latin addricti*_are (unattested) to make straight, direct oneself towards, from Latin ad- to+ d*_irectus #7direct 
address	1.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	def	the conventional form by which the location of a building is described.
address	2.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	def	the written form of this, as on a letter or parcel, preceded by the name of the person or organization for whom it is intended.
address	3.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	def	the place at which someone lives.
address	4.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	def	a speech or written communication, esp. one of a formal nature.
address	5.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	def	skilfulness or tact.
address	6.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	qual	Archaic.
	def	manner or style of speaking or conversation.
address	7.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	qual	Computer technol.
	def	a number giving the location of a piece of stored information. See also {direct access}.
address	8.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	qual	Brit. government.
	def	a statement of the opinions or wishes of either or both Houses of Parliament that is sent to the sovereign.
address	9.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	def	the alignment or position of a part, component, etc., that permits correct assembly or fitting.
address	10.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	qual	Rare.
	def	the act of dispatching or directing a ship.
address	11.
	syl	ad+dress
	pron	<*1dres>
	pos	n.
	mod	usually; pl.
	def	expressions of affection made by a man in courting a woman.
addresses	infl
	head	address
	syl	ad+dress:es
	pos	vb.
	mod	tr.
addressing dressed	infl
	head	address
	or	addrest
	syl	ad+dress+ing; +dressed
	pos	vb.
	mod	tr.
addrest	infl
	head	address
	or	addressing dressed
	syl	ad+drest.
	pos	vb.
	mod	tr.
address	12.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	to mark (a letter, parcel, etc.) with an address.
address	13.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	to speak to, refer to in speaking, or deliver a speech to.
address	14.a.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	to speak or write to.
	exam	1	he addressed himself to the chairman.
address	14.b.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	apply oneself to.
	exam	1	he addressed himself to the task.
address	15.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	to direct (a message, warning, etc.) to the attention of.
address	16.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	to consign or entrust (a ship or a ship's cargo) to a factor, merchant, etc.
address	17.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	to adopt a position facing (the ball in golf, a partner in a dance, the target in archery, etc.).
address	18.
	syl	ad+dress
	pron	<*1dres>
	pos	vb.
	mod	tr.
	def	an archaic word for {woo}.
addresser	sub
	head	address
	or	addressor
	syl	ad+1dress+er
	pos	n.
addressor	sub
	head	address
	or	addresser
	syl	ad+1dres+sor
	pos	n.
addressee	0.
	syl	ad+dress:ee
	pron	<2@dre1sE>
	pos	n.
	def	a person or organization to whom a letter, parcel, etc., is addressed.
Addressograph	0.
	syl	Ad+dres+so+graph
	pron	<*1dres*u2gra:f>, <-2gr@f>
	pos	n.
	qual	Trademark.
	def	a machine for addressing envelopes, etc.
adduce	ety	C15: from Latin add*_ucere to lead or bring to
adduce	0.
	syl	ad+duce
	pron	<*1dju:s>
	pos	vb.
	mod	tr.
	def	to cite (reasons, examples, etc.) as evidence or proof.
adduceable	sub
	head	adduce
	or	adducible
	syl	ad+1duce+a:ble
	pos	adj.
adducible	sub
	head	adduce
	or	adduceable
	syl	ad+1duc+i:ble
	pos	adj.
adducent	sub
	head	adduce
	syl	ad+1du+cent
	pos	adj.
adduction	sub
	head	adduce
	syl	ad+duc+tion
	pron	<*1d^kS*n>
	pos	n.
adduct	ety	C19: from Latin add*_ucere; see #7adduce 
adduct	0.
	syl	ad+duct
	pron	<*1d^kt>
	pos	vb.
	mod	tr.
	usage	of a muscle
	def	to draw or pull (a leg, arm, etc.) towards the median axis of the body. Compare { {abduct} (sense 2)}.
adduction	sub
	head	adduct
	syl	ad+1duc+tion
	pos	n.
adductor	0.
	syl	ad+duc+tor
	pron	<*1d^kt*>
	pos	n.
	def	a muscle that adducts.
add up	1.
	syl	add up
	pos	vb. adv.
	def	to find the sum (of).
add up	2.
	syl	add up
	pos	vb. adv.
	mod	intr.
	def	to result in a correct total.
add up	3.
	syl	add up
	pos	vb. adv.
	mod	intr.
	qual	Informal.
	def	to make sense.
add up	4.
	syl	add up
	pos	vb. adv.
	mod	intr.
	usage	foll. by to
	def	to amount to.
-ade	ety	from French, from Latin -*_ata made of, feminine past participle of verbs ending in -*_are 
-ade	0.
	syl	-ade
	usage	suffix forming nouns.
	def	a sweetened drink made of various fruits.
	exam	1	lemonade;
	exam	2	limeade.
Adelaide	0.
	syl	Ad+e:laide
	pron	<1@di2lAd>
	pos	n.
	def	the capital of South Australia: {Port Adelaide}, 11 km (7 miles) away on St. Vincent Gulf, handles the bulk of exports. Pop.: 899300 (1975 est.).
Ad'elie Coast	0.
	syl	A:d*'e:lie Coast
	pron	<1@dili>, French <adA1li>
	pos	n.
	def	a part of Antarctica, between Wilkes Land and George V Land: under French sovereignty. Also called: {Ad*'elie Land}.
ademption	ety	C16: from Latin adempti*_on- a taking away, from adimere to take away, take to (oneself), from ad- to+ emere to buy, take
ademption	0.
	syl	a:demp+tion
	pron	<*1dempS*n>
	pos	n.
	qual	Property law.
	def	the failure of a specific legacy, as by a testator disposing of the subject matter in his lifetime.
Aden	1.
	syl	A:den
	pron	<1AdN>
	pos	n.
	def	the main port and capital of Southern Yemen, on the N coast of the {Gulf of Aden} , an arm of the Indian Ocean at the entrance to the Red Sea: formerly an important port of call on shipping routes to the East. Pop.: 264326 (1973 est.).
Aden	2.
	syl	A:den
	pron	<1AdN>
	pos	n.
	def	a former British colony and protectorate on the S coast of the Arabian Peninsula: became the People's Republic of Southern Yemen in 1967. Area: 195 sq. km (75 sq. miles).
Konrad	infl
	head	Adenauer
	syl	Kon:rad
	pron	<1kcnra:t>
	pos	n.
Adenauer	0.
	syl	A:den:au:er
	pron	German <1a:d*2nau*r>
	pos	n.
	def	1876-1967, German statesman; chancellor of West Germany (l949-63).
adenectomy	ety	C19: from #7adeno -#7+ -#7ectomy 
adenectomies	infl
	head	adenectomy
	syl	ad+e:nec+to+mies.
	pos	n.
	mod	pl.
adenectomy	1.
	syl	ad+e:nec+to+my
	pron	<2@d*1nekt*mi>
	pos	n.
	def	surgical removal of a gland.
adenectomy	2.
	syl	ad+e:nec+to+my
	pron	<2@d*1nekt*mi>
	pos	n.
	def	another name for {adenoidectomy}.
adenine	0.
	syl	ad+e:nine
	pron	<1@d*nin>, <-2nEn>, <-2nIn>
	pos	n.
	def	a purine base present in animal and plant tissues as a constituent of the nucleic acids DNA and RNA and of certain coenzymes; 6-aminopurine. Formula: C\5H\5N\5; melting pt.: 360-365?%C.
adenitis	ety	C19: New Latin, from #7adeno -#7+ -#7itis 
adenitis	0.
	syl	ad+e:ni+tis
	pron	<2@d*1nItis>
	pos	n.
	def	inflammation of a gland or lymph node.
adeno-	ety	New Latin, from Greek ad*_en gland
adenocarcinomas	infl
	head	adenocarcinoma
	or	adenocarcinomata
	syl	ad+e:no+car+ci+no+mas
	pron	<-m*t*>
	pos	n.
	mod	pl.
adenocarcinomata	infl
	head	adenocarcinoma
	or	adenocarcinomas
	syl	ad+e:no+car+ci+no+ma+ta
	pron	<-m*t*>
	pos	n.
	mod	pl.
adenocarcinoma	1.
	syl	ad+e:no+car+ci+no+ma
	pron	<2@din*u2ka:si1n*um*>
	pos	n.
	def	a malignant tumour originating in glandular tissue.
adenocarcinoma	2.
	syl	ad+e:no+car+ci+no+ma
	pron	<2@din*u2ka:si1n*um*>
	pos	n.
	def	a malignant tumour with a glandlike structure.
adenohypophysis	0.
	syl	ad+e:no+hy+poph:y+sis
	pron	<2@din*uhI1pofisis>
	pos	n.
	def	the anterior lobe of the pituitary gland. Compare {neurohypophysis}.
adenoid	ety	C19: from Greek adenoeid*_es. See #7adeno -#7, -#7oid 
adenoid	1.
	syl	ad+e:noid
	pron	<1@di2ncid>
	pos	adj.
	def	of or resembling a gland.
adenoid	2.
	syl	ad+e:noid
	pron	<1@di2ncid>
	pos	adj.
	def	of or relating to lymphoid tissue, as that found in the lymph nodes, spleen, tonsils, etc.
adenoid	3.
	syl	ad+e:noid
	pron	<1@di2ncid>
	pos	adj.
	def	of or relating to the adenoids.
adenoidal	1.
	syl	ad+e:noi+dal
	pron	<2@di1ncidL>
	pos	adj.
	def	having the nasal tones or impaired breathing of one with enlarged adenoids.
adenoidal	2.
	syl	ad+e:noi+dal
	pron	<2@di1ncidL>
	pos	adj.
	def	another word for {adenoid} (for all senses).
adenoidectomies	infl
	head	adenoidectomy
	syl	ad+e:noid+ec+to+mies.
	pos	n.
	mod	pl.
adenoidectomy	0.
	syl	ad+e:noid+ec+to+my
	pron	<2@dinci1dekt*mi>
	pos	n.
	def	surgical removal of the adenoids.
adenoids	0.
	syl	ad+e:noids
	pron	<1@di2ncidz>
	pos	n.
	mod	pl.
	def	a mass of lymphoid tissue at the back of the throat behind the uvula: when enlarged it often restricts nasal breathing, esp. in young children. Technical name: {pharyngeal tonsil}.
adenomas	infl
	head	adenoma
	or	adenomata
	syl	ad+e:no+mas
	pron	<-m*t*>
	pos	n.
	mod	pl.
adenomata	infl
	head	adenoma
	or	adenomas
	syl	ad+e:no+ma+ta
	pron	<-m*t*>
	pos	n.
	mod	pl.
adenoma	1.
	syl	ad+e:no+ma
	pron	<2@di1n*um*>
	pos	n.
	def	a tumour, usually benign, occurring in glandular tissue.
adenoma	2.
	syl	ad+e:no+ma
	pron	<2@di1n*um*>
	pos	n.
	def	a tumour having a glandlike structure.
adenosine	ety	C20: a blend of #7adenine+ ribose 
adenosine	0.
	syl	a:den:o+sine
	pron	<@1den*2sEn>, <2@di1n*usEn>
	pos	n.
	qual	Biochem.
	def	a nucleoside formed by the condensation of adenine and ribose. It is present in all living cells in a combined form, as in ribonucleic acids. Formula: C\1\0H\1\3N\5O\4.
adenosine triphosphate	0.
	syl	a:den:o+sine tri+phos+phate
	pos	n.
	def	the full name of {ATP}.
adenovirus	0.
	syl	ad+e:no+vi+rus
	pron	<2@din*u1vIr*s>
	pos	n.
	def	any of a group of viruses that may cause upper respiratory diseases in man. Compare {enterovirus, myxovirus}.
adept	ety	C17: from Medieval Latin adeptus, from Latin adipisc*_i to attain, from ad- to+ apisc*_i to attain
adept	1.
	syl	a:dept
	pron	<*1dept>
	pos	adj.
	def	very proficient in something requiring skill or manual dexterity.
adept	2.
	syl	a:dept
	pron	<*1dept>
	pos	adj.
	def	skilful; expert.
adept	3.
	syl	a:dept
	pron	<1@dept>
	pos	n.
	def	a person who is skilled or proficient in something.
adeptly	sub
	head	adept
	syl	a:1dept+ly
	pos	adv.
adeptness	sub
	head	adept
	syl	a:1dept+ness
	pos	n.
adequate	ety	C17: from Latin adaequ*_are to equalize, from ad- to+ aequus #7equal 
adequate	0.
	syl	ad+e:quate
	pron	<1@dikwit>
	pos	adj.
	def	able to fulfil a need or requirement without being abundant, outstanding, etc.
adequacy	sub
	head	adequate
	syl	ad+e:qua+cy
	pron	<1@dikw*si>
	pos	n.
adequately	sub
	head	adequate
	syl	ad+e:quate+ly
	pos	adv.
a deux	0.
	syl	*`a deux
	pron	French. <a 1d$o>
	pos	adj. adv.
	def	of or for two persons.
adhere	ety	C16: via Medieval Latin adh*_er*_ere from Latin adhaer*_ere to stick to
adhere	1.
	syl	ad+here
	pron	<*d1hi*>
	pos	vb.
	mod	intr.
	usage	usually foll. by to
	def	to stick or hold fast.
adhere	2.
	syl	ad+here
	pron	<*d1hi*>
	pos	vb.
	mod	intr.
	usage	foll. by to
	def	to be devoted (to a political party, cause, religion, etc.); be a follower (of).
adhere	3.
	syl	ad+here
	pron	<*d1hi*>
	pos	vb.
	mod	intr.
	usage	foll. by to
	def	to follow closely or exactly.
	exam	1	adhere to the rules.
adherence	sub
	head	adhere
	syl	ad+1her+ence
	pos	n.
adherent	1.
	syl	ad+her+ent
	pron	<*d1hi*r*nt>
	pos	n.
	usage	usually foll. by of
	def	a supporter or follower.
adherent	2.
	syl	ad+her+ent
	pron	<*d1hi*r*nt>
	pos	adj.
	def	sticking, holding fast, or attached.
adhesion	ety	C17: from Latin adhaesi*_on- a sticking. See #7adhere 
adhesion	1.
	syl	ad+he+sion
	pron	<*d1hEZ*n>
	pos	n.
	def	the quality or condition of sticking together or holding fast.
adhesion	2.
	syl	ad+he+sion
	pron	<*d1hEZ*n>
	pos	n.
	def	ability to make firm contact without skidding or slipping.
adhesion	3.
	syl	ad+he+sion
	pron	<*d1hEZ*n>
	pos	n.
	def	attachment or fidelity, as to a political party, cause, etc.
adhesion	4.
	syl	ad+he+sion
	pron	<*d1hEZ*n>
	pos	n.
	def	an attraction or repulsion between the molecules of unlike substances in contact: distinguished from
adhesion	5.
	syl	ad+he+sion
	pron	<*d1hEZ*n>
	pos	n.
	qual	Pathol.
	def	abnormal union of structures or parts.
adhesion	6.
	syl	ad+he+sion
	pron	<*d1hEZ*n>
	pos	n.
	qual	Rare.
	def	concurrence; assent.
adhesive	1.
	syl	ad+he+sive
	pron	<*d1hEsiv>
	pos	adj.
	def	able or designed to adhere; sticky.
	exam	1	adhesive tape.
adhesive	2.
	syl	ad+he+sive
	pron	<*d1hEsiv>
	pos	adj.
	def	tenacious or clinging.
adhesive	3.
	syl	ad+he+sive
	pron	<*d1hEsiv>
	pos	n.
	def	a substance used for sticking objects together, such as glue, cement, or paste.
adhesively	sub
	head	adhesive
	syl	ad+1he+sive+ly
	pos	adv.
adhesiveness	sub
	head	adhesive
	syl	ad+1he+sive+ness
	pos	n.
adhibit	ety	C16: from Latin adhib*_ere to bring to, from ad- to+ hab*_ere to have, hold
adhibit	1.
	syl	ad+hib+it
	pron	<*d1hibit>
	pos	vb.
	mod	tr.
	qual	Rare.
	def	to administer or apply.
adhibit	2.
	syl	ad+hib+it
	pron	<*d1hibit>
	pos	vb.
	mod	tr.
	qual	Rare.
	def	to affix; attach.
adhibition	sub
	head	adhibit
	syl	ad+hi+bi+tion
	pron	<2@dhi1biS*n>
	pos	n.
ad hoc	ety	Latin, literally: to this
ad hoc	0.
	syl	ad hoc
	pron	<@d> <1hok>
	pos	adj. adv.
	def	for a particular purpose only.
	exam	1	an ad hoc decision;
	exam	2	an ad hoc committee.
ad hominem	ety	literally: to the man
ad hominem	0.
	syl	ad ho+mi+nem
	pron	Latin. <@d> <1homi2nem>
	pos	adj. adv.
	def	directed against a person rather than against his arguments.
adiabatic	ety	C19: from Greek adiabatos not to be crossed, impassable (to heat), from #7a -%1#7+ diabatos passable, from dia- across+ bainein to go
adiabatic	1.
	syl	ad:i:a+bat+ic
	pron	<2@di*1b@tik>, <2A->
	pos	adj.
	usage	of a thermodynamic process
	def	taking place without loss or gain of heat.
adiabatic	2.
	syl	ad:i:a+bat+ic
	pron	<2@di*1b@tik>, <2A->
	pos	n.
	def	a curve on a graph representing the changes in two characteristics (such as pressure and volume) of a system undergoing an adiabatic process.
adiaphorism	ety	C19: see #7adiaphorous 
adiaphorism	0.
	syl	ad:i+aph+or+ism
	pron	<2@di1@f*2riz*m>
	pos	n.
	def	a Christian Protestant theological theory that certain rites and actions are matters of indifference in religion since not forbidden by the Scriptures.
adiaphorist	sub
	head	adiaphorism
	syl	ad:i+1aph:o+rist
	pos	n.
adiaphoristic	sub
	head	adiaphorism
	syl	ad:i+2aph:o+1ris+tic
	pos	adj.
adiaphorous	ety	C17: from Greek adiaphoros indifferent, from #7a -%1#7+ diaphoros different
adiaphorous	0.
	syl	ad:i+aph:o+rous
	pron	<2@di1@f*r*s>
	pos	adj.
	qual	Med.
	def	having no effect for good or ill, as a drug or placebo.
adiathermancy	0.
	syl	ad:i:a+ther+man+cy
	pron	<2@di*1TR:m*nsi>
	pos	n.
	def	another name for {athermancy}.
adiathermanous	sub
	head	adiathermancy
	syl	ad:i:a+1ther+ma+nous
	pos	adj.
adieu	ety	C14: from Old French, from a to+ dieu God
adieus	infl
	head	adieu
	or	adieux
	syl	a:dieus
	pron	<*1dju:z>, French <a1dj$o>
	pos	interj. n.
	mod	pl.
adieux	infl
	head	adieu
	or	adieus
	syl	a:dieux
	pron	<*1dju:z>, French <a1dj$o>
	pos	interj. n.
	mod	pl.
adieu	0.
	syl	a:dieu
	pron	<*1dju:>, French <a1dj$o>, French <a1dj$o>
	pos	interj. n.
	def	goodbye farewell.
Adige	0.
	syl	A:di+ge
	pron	Italian <1a:diJA>
	pos	n.
	def	a river in N Italy, flowing southeast to the Adriatic. Length: 354 km (220 miles).
ad infinitum	ety	Latin
ad infinitum	0.
	syl	ad in+fi+ni+tum
	pron	<@d> <2infi1nIt*m>
	pos	adv.
	def	without end; endlessly; to infinity. Abbrev.: {ad inf}.
ad interim	ety	Latin
ad interim	0.
	syl	ad in+ter+im
	pron	<@d> <1int*rim>
	pos	adj. adv.
	def	for the meantime; for the present.
	exam	1	ad interim measures.
ad interim	xref
	syl	ad in+ter+im
	pron	<@d> <1int*rim>
	pos	adj. adv.
	def	Abbrev.: {ad int}.
adios	ety	literally: to God
adios	0.
	syl	a:di+os
	pron	<2a:di1os>, Spanish <a1@djos>
	pos	interj.
	def	goodbye; farewell.
adipocere	ety	C19: via French from New Latin adiposus fat (see #7adipose) #7+ French cire wax
adipocere	0.
	syl	ad:i+po+cere
	pron	<2@dip*u1si*>
	pos	n.
	def	a waxlike fatty substance formed during the decomposition of corpses. Nontechnical name: {grave-wax}.
adipocerous	sub
	head	adipocere
	syl	ad:i+poc+er+ous
	pron	<2@di1pos?!*r*s>, <adj>
adipose	ety	C18: from New Latin adiposus, from Latin adeps fat
adipose	1.
	syl	ad:i+pose
	pron	<1@di2p*us>, <-2p*uz>
	pos	adj.
	def	of, resembling, or containing fat; fatty.
adipose	2.
	syl	ad:i+pose
	pron	<1@di2p*us>, <-2p*uz>
	pos	n.
	def	animal fat.
adipose fin	0.
	syl	ad:i+pose fin
	pos	n.
	def	a posterior dorsal fin occurring in the salmon and related fishes.
Adirondacks	alt
	head	Adirondack Mountains
	or	Adirondack Mountains
	syl	Ad:i+ron+dacks
	pos	n.
	mod	pl.
Adirondack Mountains	0.
	or	Adirondacks
	syl	Ad:i+ron+dack Moun+tains
	pron	<2@di1rond@k>
	pos	n.
	mod	pl.
	def	a mountain range in NE New York State. Highest peak: Mount Marcy, 1629 m (5344 ft.).
adit	ety	C17: from Latin aditus an approach, from ad*_ire, from ad- towards+ *_ire to go
adit	0.
	syl	ad:it
	pron	<1@dit>
	pos	n.
	def	an almost horizontal shaft into a mine, for access or drainage.
Adivasi	ety	Sanskrit, from adi beginning+ vasi dweller
Adivasi	0.
	syl	A:di+va+si
	pron	<1a:di2va:si>
	pos	n.
	def	a member of any of the aboriginal peoples of India.
adj	1.
	syl	adj.
	qual	abbrev. for:; Maths.
	def	adjacent.
adj	2.
	syl	adj.
	qual	abbrev. for:
	def	adjective.
adj	3.
	syl	adj.
	qual	abbrev. for:
	def	adjunct.
adj	4.
	syl	adj.
	qual	abbrev. for:
	def	ad?!journed.
adj	5.
	syl	adj.
	qual	abbrev. for:; Insurance, banking, etc.
	def	adjustment.
adj	6.
	syl	adj.
	qual	abbrev. for:
	def	Also: {adjt}. adjutant.
adjacent	ety	C15: from Latin adjac*_ere to lie next to, from ad- near+ jac*_ere to lie
adjacent	1.
	syl	ad+ja+cent
	pron	<*1JAsNt>
	pos	adj.
	def	being near or close, esp. having a common boundary; adjoining; contiguous.
adjacent	2.
	syl	ad+ja+cent
	pron	<*1JAsNt>
	pos	n.
	def	the side lying between a specified angle and a right angle in a right-angled triangle.
adjacency	sub
	head	adjacent
	syl	ad+1ja+cen+cy
	pos	n.
adjacently	sub
	head	adjacent
	syl	ad+1ja+cent+ly
	pos	adv.
adjective	ety	C14: from Late Latin adject*_ivus attributive, from adjicere to throw to, add, from ad- to+ jacere to throw; in grammatical sense, from the Latin phrase n*_omen adject*_ivum attributive noun
adjective	1.a.
	syl	ad+jec+tive
	pron	<1@Jiktiv>
	pos	n.
	def	a word imputing a characteristic to a noun or pronoun.
adjective	1.b.
	syl	ad+jec+tive
	pron	<1@Jiktiv>
	pos	n.
	usage	as modifier; an adjective phrase.
	def	Abbrev.: {adj}.
adjective	2.
	syl	ad+jec+tive
	pron	<1@Jiktiv>
	pos	adj.
	def	additional or dependent.
adjective	3.
	syl	ad+jec+tive
	pron	<1@Jiktiv>
	pos	adj.
	usage	of law
	def	relating to court practice and procedure, as opposed to the principles of law dealt with by the courts. Compare {{substantive} (sense 7)}.
adjectival	sub
	head	adjective
	syl	ad+jec+ti+val
	pron	<2@Jik1tIvL>
	pos	adj.
adjoin	ety	C14: via Old French from Latin adjungere, from ad- to+ jungere to join
adjoin	1.
	syl	ad+join
	pron	<*1Jcin>
	pos	vb.
	def	to be next to (an area of land, etc.).
adjoin	2.
	syl	ad+join
	pron	<*1Jcin>
	pos	vb.
	mod	tr.
	usage	foll. by to
	def	to join; affix or attach.
adjoining	0.
	syl	ad+join+ing
	pron	<*1JciniG>
	pos	adj.
	def	being in contact; connected or neighbouring.
adjoint	0.
	syl	ad+joint
	pron	<1@d2Jcint>
	pos	n.
	qual	Maths.
	def	another name for {Hermitian conjugate}.
adjourn	ety	C14: from Old French ajourner to defer to an arranged day, from a- to+ jour day, from Late Latin diurnum, from Latin diurnus daily, from di*_es day
adjourn	1.
	syl	ad+journ
	pron	<*1JR:n>
	pos	vb.
	mod	intr.
	usage	of a court, etc.
	def	to close at the end of a session.
adjourn	2.
	syl	ad+journ
	pron	<*1JR:n>
	pos	vb.
	def	to postpone or be postponed, esp. temporarily or to another place.
adjourn	3.
	syl	ad+journ
	pron	<*1JR:n>
	pos	vb.
	mod	tr.
	def	to put off (a problem, discussion, etc.) for later consideration; defer.
adjourn	4.a.
	syl	ad+journ
	pron	<*1JR:n>
	pos	vb.
	def	to move elsewhere.
	exam	1	let's adjourn to the kitchen.
adjourn	4.b.
	syl	ad+journ
	pron	<*1JR:n>
	pos	vb.
	def	to stop work.
adjournment	sub
	head	adjourn
	syl	ad+1journ+ment
	pos	n.
adjt	0.
	syl	adjt.
	qual	abbrev. for
	def	adjutant.
adjudge	ety	C14: via Old French from Latin adj*_udic*_are. See #7adjudicate 
adjudge	1.
	syl	ad+judge
	pron	<*1J^J>
	pos	vb.
	mod	tr.
	usage	usually passive
	def	to pronounce formally; declare.
	exam	1	he was adjudged the winner.
adjudge	2.a.
	syl	ad+judge
	pron	<*1J^J>
	pos	vb.
	mod	tr.
	usage	usually passive
	def	to determine judicially; judge.
adjudge	2.b.
	syl	ad+judge
	pron	<*1J^J>
	pos	vb.
	mod	tr.
	usage	usually passive
	def	to order or pronounce by law; decree.
	exam	1	he was adjudged bankrupt.
adjudge	2.c.
	syl	ad+judge
	pron	<*1J^J>
	pos	vb.
	mod	tr.
	usage	usually passive
	def	to award (costs, damages, etc.).
adjudge	3.
	syl	ad+judge
	pron	<*1J^J>
	pos	vb.
	mod	tr.
	qual	Archaic.
	usage	usually passive
	def	to sentence or condemn.
adjudicate	ety	C18: from Latin adj*_udic*_are to award something to someone, from ad- to+ j*_udic*_are to act as a judge, from j*_udex judge &- ad+@!ju+di+#!ca+tion n.
adjudicate	1.
	syl	ad+ju+di+cate
	pron	<*1Ju:di2kAt>
	pos	vb.
	mod	when; intr.
	usage	usually foll. by upon
	def	to decide (an issue) judicially; pass or sit in judgment.
adjudicate	2.
	syl	ad+ju+di+cate
	pron	<*1Ju:di2kAt>
	pos	vb.
	mod	tr.
	qual	Chess.
	def	to determine the likely result of (a game) by counting relative value of pieces, positional strength, etc.
adjudicate	3.
	syl	ad+ju+di+cate
	pron	<*1Ju:di2kAt>
	pos	vb.
	mod	intr.
	def	to serve as a judge or arbiter, as in a competition.
adjunct	ety	C16: from Latin adjunctus, past participle of ad?!jungere to #7adjoin 
adjunct	1.
	syl	ad+junct
	pron	<1@J^Gkt>
	pos	n.
	def	something incidental or not essential that is added to something else.
adjunct	2.
	syl	ad+junct
	pron	<1@J^Gkt>
	pos	n.
	def	a person who is subordinate to another.
adjunct	3.a.
	syl	ad+junct
	pron	<1@J^Gkt>
	pos	n.
	def	part of a sentence other than the subject or the predicate.
adjunct	3.b.
	syl	ad+junct
	pron	<1@J^Gkt>
	pos	n.
	def	part of a sentence that may be omitted without making the sentence ungrammatical; a modifier.
adjunct	4.
	syl	ad+junct
	pron	<1@J^Gkt>
	pos	n.
	qual	Logic.
	def	another name for { {accident} (sense 5)}.
adjunct	5.
	syl	ad+junct
	pron	<1@J^Gkt>
	pos	adj.
	def	added or connected in a secondary or subordinate position; auxiliary.
adjunctive	sub
	head	adjunct
	syl	ad+junc+tive
	pron	<*1J^Gktiv>
	pos	adj.
adjunctly	sub
	head	adjunct
	syl	ad+junct+ly
	pos	adv.
adjure	ety	C14: from Latin adj*_ur*_are to swear to, from ad- to+ j*_ur*_are to swear, from j*_us oath
adjure	1.
	syl	ad+jure
	pron	<*1Ju*>
	pos	vb.
	mod	tr.
	def	to command, often by exacting an oath; charge.
adjure	2.
	syl	ad+jure
	pron	<*1Ju*>
	pos	vb.
	mod	tr.
	def	to appeal earnestly to.
adjuration	sub
	head	adjure
	syl	ad+ju+ra+tion
	pron	<2@Ju*1rAS*n>
	pos	n.
adjuratory	sub
	head	adjure
	syl	ad+1jur:a+to:ry
	pos	adj.
adjurer	sub
	head	adjure
	or	adjuror
	syl	ad+1jur+er
	pos	n.
adjuror	sub
	head	adjure
	or	adjurer
	syl	ad+1ju+ror
	pos	n.
adjust	ety	C17: from Old French adjuster, from ad- to+ juste right, #7just 
adjust	1.
	syl	ad+just
	pron	<*1J^st>
	pos	vb.
	mod	tr.
	def	to alter slightly, esp. to achieve accuracy; regulate.
	exam	1	to adjust the television.
adjust	2.
	syl	ad+just
	pron	<*1J^st>
	pos	vb.
	def	to adapt, as to a new environment, etc.
adjust	3.
	syl	ad+just
	pron	<*1J^st>
	pos	vb.
	mod	tr.
	def	to put into order.
adjust	4.
	syl	ad+just
	pron	<*1J^st>
	pos	vb.
	mod	tr.
	qual	Insurance.
	def	to determine the amount payable in settlement of (a claim).
adjustable	sub
	head	adjust
	syl	ad+1just+a:ble
	pos	adj.
adjustably	sub
	head	adjust
	syl	ad+1just+a:bly
	pos	adv.
adjustment	1.
	syl	ad+just+ment
	pron	<*1J^stm*nt>
	pos	n.
	def	the act of adjusting or state of being adjusted.
adjustment	2.
	syl	ad+just+ment
	pron	<*1J^stm*nt>
	pos	n.
	def	a control for regulating.
	exam	1	the adjustment for volume is beside the speaker.
adjutant	ety	C17: from Latin adj*_ut*_are to #7aid 
adjutant	1.
	syl	ad+ju+tant
	pron	<1@J*t*nt>
	pos	n.
	def	an officer who acts as administrative assistant to a superior officer.
adjutant	2.
	syl	ad+ju+tant
	pron	<1@J*t*nt>
	pos	n.
	def	short for {adjutant bird}.
adjutancy	sub
	head	adjutant
	syl	ad+ju+tan+cy
	pos	n.
stork	alt
	head	adjutant bird
	or	adjutant bird
	syl	stork
	pos	n.
adjutant bird	0.
	or	stork
	syl	ad+ju+tant bird
	pos	n.
	def	either of two large carrion-eating storks, or which are closely related and similar to the marabou and occur in S and SE Asia.
adjutants general	infl
	head	adjutant general
	syl	ad+ju+tants gen+er+al.
	pos	n.
	mod	pl.
adjutant general	1.a.
	syl	ad+ju+tant gen+er+al
	pos	n.
	def	the head of a department of the general staff.
adjutant general	1.b.
	syl	ad+ju+tant gen+er+al
	pos	n.
	def	a general's executive officer.
adjutant general	2.
	syl	ad+ju+tant gen+er+al
	pos	n.
	qual	U.S. Army.
	def	the adjutant of a military unit with general staff.
adjuvant	ety	C17: from Latin adjuv*_ans, present participle of adjuv*_are, from juv*_are to help
adjuvant	1.
	syl	ad+ju+vant
	pron	<1@J*v*nt>
	pos	adj.
	def	aiding or assisting.
adjuvant	2.
	syl	ad+ju+vant
	pron	<1@J*v*nt>
	pos	n.
	def	something that aids or assists; auxiliary.
Alfred	infl
	head	Adler
	syl	Al:fred
	pron	<1alfrA:t>
	pos	n.
Adler	1.
	syl	Ad:ler
	pron	German <1adl*r>
	pos	n.
	def	1870-1937, Austrian psychiatrist, noted for his descriptions of overcompensation and inferiority feelings.
Larry	infl
	head	Adler
	syl	Lar:ry
	pos	n.
Adler	2.
	syl	Ad:ler
	pron	<1@dl*>
	pos	n.
	def	original name born 1914, U.S. harmonica player.
Adlerian	sub
	head	Adler
	syl	Ad+ler+i:an
	pron	<@d1li*ri*n>
	pos	adj.
ad-lib	ety	C18: short for Latin ad libitum, literally: according to pleasure
ad-libs	infl
	head	ad-lib
	syl	ad-libs
	pos	vb.
ad-libbing	infl
	head	ad-lib
	syl	ad-lib:bing
	pos	vb.
ad-libbed	infl
	head	ad-lib
	syl	ad-libbed.
	pos	vb.
ad-lib	1.
	syl	ad-lib
	pron	<@d1lib>
	pos	vb.
	def	to improvise and deliver spontaneously (a speech, musical performance, etc.). {~} ({ad lib} when predicative)
ad-lib	2.
	syl	ad-lib
	pron	<@d1lib>
	pos	vb.
	def	improvised; impromptu. {~} {ad lib}.
ad-lib	3.
	syl	ad-lib
	pron	<@d1lib>
	pos	vb.
	def	spontaneously; freely.
ad-lib	4.
	syl	ad-lib
	pron	<@d1lib>
	pos	n.
	def	an improvised performance, often humorous.
ad-libber	sub
	head	ad-lib
	syl	ad-1lib:ber
	pos	n.
ad litem	0.
	syl	ad li+tem
	pron	Latin. <@d> <1lItem>
	pos	adj.
	usage	esp. of a guardian
	def	appoint?!ed for a lawsuit.
Adm	1.
	syl	Adm.
	qual	abbrev. for:
	def	Admiral.
Adm	2.
	syl	Adm.
	qual	abbrev. for:
	def	Admiralty.
admen	infl
	head	adman
	syl	ad+men.
	pos	n.
	mod	pl.
adman	0.
	syl	ad+man
	pron	<1@d2m@n>, <-m*n>
	pos	n.
	qual	Informal.
	def	a person who works in advertising.
admass	ety	C20: from #7ad %1 + #7mass 
admass	0.
	syl	ad+mass
	pron	<1@dm@s>
	pos	n.
	def	the section of the public that is susceptible or responsive to advertising, publicity, etc.
admeasure	ety	Cl4 amesuren, from Old French amesurer, from mesurer to #7measure ; the modern form derives from #7ad -#7+measure 
admeasure	1.
	syl	ad+meas+ure
	pron	<@d1meZ*>
	pos	vb.
	def	to measure out (land, etc.) as a share; apportion.
admeasure	2.
	syl	ad+meas+ure
	pron	<@d1meZ*>
	pos	vb.
	mod	tr.
	def	to determine the dimensions, capacity, weight, and other details of (a vessel), as for an official registration, documentation, or yacht handicap rating.
admeasurement	sub
	head	admeasure
	syl	ad+1meas+ure+ment
	pos	n.
Admetus	0.
	syl	Ad:me:tus
	pron	<@d1mEt*s>
	pos	n.
	qual	Greek myth.
	def	a king of Thessaly, one of the Argonauts, who was married to Alcestis.
admin	0.
	syl	ad+min
	pron	<1@dmin>
	pos	n.
	qual	Informal.
	def	short for {administration}.
adminicle	ety	C16: from Latin adminiculum support
adminicle	0.
	syl	ad+min:i+cle
	pron	<@d1minikL>
	pos	n.
	qual	Law.
	def	something contributing to prove a point without itself being complete proof.
administer	ety	C14 amynistre via Old French from Latin administrare, from ad- to+ ministr*_are to #7minister 
administer	1.
	syl	ad+min+is+ter
	pron	<*d1minist*>
	pos	vb.
	mod	also; intr.
	def	to direct or control (the affairs of a business, government, etc.).
administer	2.
	syl	ad+min+is+ter
	pron	<*d1minist*>
	pos	vb.
	mod	mainly; tr.
	def	to put into execution; dispense.
	exam	1	administer justice.
administer	3.
	syl	ad+min+is+ter
	pron	<*d1minist*>
	pos	vb.
	mod	when; intr.
	usage	foll. by to
	def	to give or apply (medicine, assistance, etc.) as a remedy or relief.
administer	4.
	syl	ad+min+is+ter
	pron	<*d1minist*>
	pos	vb.
	mod	mainly; tr.
	def	to apply formally; perform.
	exam	1	to administer extreme unction.
administer	5.
	syl	ad+min+is+ter
	pron	<*d1minist*>
	pos	vb.
	mod	mainly; tr.
	def	to supervise or impose the taking of (an oath, etc.).
administer	6.
	syl	ad+min+is+ter
	pron	<*d1minist*>
	pos	vb.
	mod	mainly; tr.
	def	to manage or distribute (an estate, property, etc.).
administrate	0.
	syl	ad+min+is+trate
	pron	<*d1mini2strAt>
	pos	vb.
	def	to manage or direct (the affairs of a business, institution, etc.).
administration	1.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	management of the affairs of an organization, such as a business or institution.
administration	2.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	the duties of an administrator.
administration	3.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	the body of people who administer an organization.
administration	4.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	the conduct of the affairs of government.
administration	5.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	term of office: often used of presidents, governments, etc.
administration	6.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	the executive branch of government along with the public service; the government as a whole.
administration	7.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	qual	Chiefly U.S.
	usage	often cap.
	def	the political executive, esp. of the U.S.; the government.
administration	8.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	qual	Chiefly U.S.
	def	a government board, agency, authority, etc.
administration	9.a.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	the conduct or disposal of the estate of a deceased person.
administration	9.b.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	the management by a trustee of an estate subject to a trust.
administration	10.
	syl	ad+min+is+tra+tion
	pron	<*d2mini1strAS*n>
	pos	n.
	def	something administered, such as a sacrament, oath, or medical treatment.
administrative	sub
	head	administration
	syl	ad+1min+is+tra+tive
	pos	adj.
administratively	sub
	head	administration
	syl	ad+1min+is+tra+tive+ly
	pos	adv.
administrator	1.
	syl	ad+min+is+tra+tor
	pron	<*d1mini2strAt*>
	pos	n.
	def	a person who administers the affairs of an organization, official body, etc.
administrator	2.
	syl	ad+min+is+tra+tor
	pron	<*d1mini2strAt*>
	pos	n.
	qual	Property law.
	def	a person authorized to manage an estate, esp. when the owner has died intestate or without having appointed executors.
administratrix	sub
	head	administrator
	syl	ad+2min+is+1tra+trix
	pos	n.
	mod	fem.
admirable	0.
	syl	ad+mi+ra:ble
	pron	<1@dm*r*bL>
	pos	adj.
	def	deserving or inspiring admiration; excellent.
admirably	sub
	head	admirable
	syl	ad+mi+ra:bly
	pos	adv.
admiral	ety	C13 amyral, from Old French amiral emir, and from Medieval Latin adm*_ir*_alis (the spelling with d probably influenced by adm*_ir*_abilis admirable); both from Arabic am*_ir emir, commander, esp. in the phrase am*_ir-al command?!er of, as in am*_ir-al-bahr command?!er of the sea
admiral	1.
	syl	ad+mi+ral
	pron	<1@dm*r*l>
	pos	n.
	def	the supreme commander of a fleet or navy.
admiral	2.
	syl	ad+mi+ral
	pron	<1@dm*r*l>
	pos	n.
	def	Also called: {admiral of the fleet, fleet admiral}. a naval officer of the highest rank, equivalent to general of the army or field marshal.
admiral	3.
	syl	ad+mi+ral
	pron	<1@dm*r*l>
	pos	n.
	def	a senior naval officer entitled to fly his own flag. See also {rear admiral, vice admiral}.
admiral	4.
	syl	ad+mi+ral
	pron	<1@dm*r*l>
	pos	n.
	qual	Chiefly Brit.
	def	the master of a fishing fleet.
admiral	5.
	syl	ad+mi+ral
	pron	<1@dm*r*l>
	pos	n.
	def	any of various nymphalid butterflies, esp. the red admiral or white admiral.
admiralship	sub
	head	admiral
	syl	ad+mi+ral+2ship
	pos	n.
admiralties	infl
	head	admiralty
	syl	ad+mi+ral+ties.
	pos	n.
	mod	pl.
admiralty	1.
	syl	ad+mi+ral+ty
	pron	<1@dm*r*lti>
	pos	n.
	def	the office or jurisdiction of an admiral.
admiralty	2.a.
	syl	ad+mi+ral+ty
	pron	<1@dm*r*lti>
	pos	n.
	def	jurisdiction over naval affairs.
admiralty	2.b.
	syl	ad+mi+ral+ty
	pron	<1@dm*r*lti>
	pos	n.
	usage	as modifier
	exam	1	admiralty law.
Admiralthe	infl
	head	Admiralty Board
	syl	Ad+mi+ral+the.
	pos	n.
Admiralty Board	0.
	syl	Ad+mi+ral+ty Board
	pos	n.
	def	a department of the British Ministry of Defence, responsible for the administration and planning of the Royal Navy.
Admiralty House	0.
	syl	Ad+mi+ral+ty House
	pos	n.
	def	the official residence of the governor general of Australia, in Sydney.
Admiralty Islands	0.
	syl	Ad+mi+ral+ty Is+lands
	pos	n.
	mod	pl.
	def	a group of about 40 volcanic and coral islands in the SW Pacific, part of Papua New Guinea, in the Bismarck Archipelago: main island: Manus. Pop.: 20647 (1966). Area: about 2000 sq. km (800 sq. miles). Also called: {Admiralties}.
Admiralty mile	0.
	syl	Ad+mi+ral+ty mile
	pos	n.
	def	another name for {nautical mile}.
Admiralty Range	0.
	syl	Ad+mi+ral+ty Range
	pos	n.
	def	a mountain range in Antarctica, on the coast of Victoria Land, northwest of the Ross Sea.
admiration	1.
	syl	ad+mi+ra+tion
	pron	<2@dm*1rAS*n>
	pos	n.
	def	pleasurable contemplation or surprise.
admiration	2.
	syl	ad+mi+ra+tion
	pron	<2@dm*1rAS*n>
	pos	n.
	def	a person or thing that is admired.
	exam	1	she was the admiration of the court.
admiration	3.
	syl	ad+mi+ra+tion
	pron	<2@dm*1rAS*n>
	pos	n.
	qual	Archaic.
	def	wonder.
admire	ety	C16: from Latin adm*_ir*_ari to wonder at, from ad- to, at+ m*_ir*_ari to wonder, from m*_irus wonderful
admire	1.
	syl	ad+mire
	pron	<*d1mI*>
	pos	vb.
	mod	tr.
	def	to regard with esteem, respect, approval, or pleased surprise.
admire	2.
	syl	ad+mire
	pron	<*d1mI*>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to wonder at.
admiringly	sub
	head	admire
	syl	ad+1mir+ing+ly
	pos	adv.
admissible	1.
	syl	ad+mis+si:ble
	pron	<*d1mis*bL>
	pos	adj.
	def	able or deserving to be considered or allowed.
admissible	2.
	syl	ad+mis+si:ble
	pron	<*d1mis*bL>
	pos	adj.
	def	deserving to be admitted or allowed to enter.
admissible	3.
	syl	ad+mis+si:ble
	pron	<*d1mis*bL>
	pos	adj.
	usage	Law. esp. of evidence
	def	capable of being or bound to be admitted in a court of law.
admissibility	sub
	head	admissible
	or	admissibleness
	syl	ad+2mis+si:1bil+i:ty
	pos	n.
admissibleness	sub
	head	admissible
	or	admissibility
	syl	ad+1mis+si:ble+ness
	pos	n.
admission	ety	C15: from Latin admissi*_on-, from admittere to #7admit 
admission	1.
	syl	ad+mis+sion
	pron	<*d1miS*n>
	pos	n.
	def	permission to enter or the right, authority, etc., to enter.
admission	2.
	syl	ad+mis+sion
	pron	<*d1miS*n>
	pos	n.
	def	the price charged for entrance.
admission	3.
	syl	ad+mis+sion
	pron	<*d1miS*n>
	pos	n.
	def	acceptance for a position, office, etc.
admission	4.
	syl	ad+mis+sion
	pron	<*d1miS*n>
	pos	n.
	def	a confession, as of a crime, mistake, etc.
admission	5.
	syl	ad+mis+sion
	pron	<*d1miS*n>
	pos	n.
	def	an acknowledgment of the truth or validity of something.
admissive	sub
	head	admission
	syl	ad+1mis+sive
	pos	adj.
admit	ety	C14: from Latin admittere to let come or go to, from ad- to+ mittere to send
admits	infl
	head	admit
	syl	ad+mits
	pos	vb.
	mod	mainly; tr.
admitting	infl
	head	admit
	syl	ad+mit+ting
	pos	vb.
	mod	mainly; tr.
admitted	infl
	head	admit
	syl	ad+mit+ted.
	pos	vb.
	mod	mainly; tr.
admit	1.
	syl	ad+mit
	pron	<*d1mit>
	pos	vb.
	mod	mainly; tr.
	usage	may take a clause as object
	def	to confess or acknowledge (a crime, mistake, etc.).
admit	2.
	syl	ad+mit
	pron	<*d1mit>
	pos	vb.
	mod	mainly; tr.
	usage	may take a clause as object
	def	to concede (the truth or validity of something).
admit	3.
	syl	ad+mit
	pron	<*d1mit>
	pos	vb.
	mod	mainly; tr.
	def	to allow to enter; let in.
admit	4.
	syl	ad+mit
	pron	<*d1mit>
	pos	vb.
	mod	mainly; tr.
	usage	foll. by to
	def	to allow participation (in) or the right to be part (of).
	exam	1	to admit to the profession.
admit	5.
	syl	ad+mit
	pron	<*d1mit>
	pos	vb.
	mod	when; intr.
	usage	foll. by of
	def	to allow (of); leave room (for).
admit	6.
	syl	ad+mit
	pron	<*d1mit>
	pos	vb.
	mod	intr.
	def	to give access.
	exam	1	the door admits onto the lawn.
admittance	1.
	syl	ad+mit+tance
	pron	<*d1mitNs>
	pos	n.
	def	the right or authority to enter.
admittance	2.
	syl	ad+mit+tance
	pron	<*d1mitNs>
	pos	n.
	def	the act of giving entrance.
admittance	3.
	syl	ad+mit+tance
	pron	<*d1mitNs>
	pos	n.
	def	the reciprocal of impedance, usually measured in reciprocal ohms or siemens. It can be expressed as a complex quantity, the real part of which is the conductance and the imaginary part the susceptance. Symbol.
	exam	1	y
admittedly	0.
	syl	ad+mit+ted+ly
	pron	<*d1mitidli>
	pos	adv.
	usage	sentence modifier
	def	willingly conceded.
	exam	1	admittedly I am afraid.
admix	ety	C16: back formation from obsolete admixt, from Latin adm*_isc*_ere to mix with
admix	0.
	syl	ad+mix
	pron	<*d1miks>
	pos	vb.
	mod	tr.
	qual	Rare.
	def	to mix or blend.
admixture	1.
	syl	ad+mix+ture
	pron	<*d1miksC*>
	pos	n.
	def	a less common word for {mixture}.
admixture	2.
	syl	ad+mix+ture
	pron	<*d1miksC*>
	pos	n.
	def	anything added in mixing; ingredient.
admonish	ety	C14: via Old French from Vulgar Latin admonest*_are (unattested), from Latin admon*_ere to put one in mind of, from mon*_ere to advise
admonish	1.
	syl	ad+mon+ish
	pron	<*d1moniS>
	pos	vb.
	mod	tr.
	def	to reprove firmly but not harshly.
admonish	2.
	syl	ad+mon+ish
	pron	<*d1moniS>
	pos	vb.
	mod	tr.
	def	to advise to do or against doing something; warn; caution.
admonisher	sub
	head	admonish
	or	admonitor
	syl	ad+1mon+ish+er
	pos	n.
admonitor	sub
	head	admonish
	or	admonisher
	syl	ad+1mon:i+tor
	pos	n.
admonition	sub
	head	admonish
	syl	ad+mo+ni+tion
	pron	<2@dm*1niS*n>
	pos	n.
admonitory	sub
	head	admonish
	syl	ad+1mon:i+to:ry
	pos	adj.
adnate	ety	C17: from Latin adn*_atus, a variant form of agn*_atus #7agnate 
adnate	0.
	syl	ad+nate
	pron	<1@dnAt>
	pos	adj.
	qual	Botany.
	def	growing closely attached to an adjacent part or organ.
ad nauseam	ety	Latin: to (the point of) nausea
ad nauseam	0.
	syl	ad nau+se:am
	pron	<@d> <1nc:zi2@m>, <-si->
	pos	adv.
	def	to a disgusting extent.
adnominal	1.
	syl	ad+nom:i+nal
	pron	<*d1nominL>
	pos	n.
	qual	Grammar.
	def	a word modifying a noun.
adnominal	2.
	syl	ad+nom:i+nal
	pron	<*d1nominL>
	pos	adj.
	qual	Grammar.
	def	of or relating to an adnoun.
adnoun	ety	C18: from Latin ad to+#7noun, formed on the model of #7adverb 
adnoun	0.
	syl	ad+noun
	pron	<1@dnaun>
	pos	n.
	def	an adjective used as a noun; absolute adjective.
ado	ety	C14: from the phrase at do a to-do, from Old Norse at to (marking the infinitive)+#7do %1
ado	0.
	syl	a:do
	pron	<*1du:>
	pos	n.
	def	bustling activity; fuss; bother; delay (esp. in the phrases {without more ado, with much ado) }.
adobe	ety	C19: from Spanish
adobe	1.a.
	syl	a:do+be
	pron	<*1d*ubi>
	pos	n.
	def	a sun-dried brick used for building.
adobe	1.b.
	syl	a:do+be
	pron	<*1d*ubi>
	pos	n.
	usage	as modifier
	exam	1	an adobe house.
adobe	2.
	syl	a:do+be
	pron	<*1d*ubi>
	pos	n.
	def	a building constructed of such bricks.
adobe	3.
	syl	a:do+be
	pron	<*1d*ubi>
	pos	n.
	def	the clayey material from which such bricks are made.
adobe flat	0.
	syl	a:do+be flat
	pos	n.
	qual	Chiefly U.S.
	def	a gently sloping clayey plain formed by a short-lived stream or flood water.
adolescence	ety	C15: via Old French from Latin adol*_escentia, from adol*_escere to grow up, from al*_escere to grow, from al*_ere to feed, nourish
adolescence	0.
	syl	ad:o+les+cence
	pron	<2@d*1les*ns>
	pos	n.
	def	the period in human development that occurs between the beginning of puberty and adulthood.
adolescent	1.
	syl	ad:o+les+cent
	pron	<2@d*1lesNt>
	pos	adj.
	def	of or relating to adoles?!cence.
adolescent	2.
	syl	ad:o+les+cent
	pron	<2@d*1lesNt>
	pos	adj.
	qual	Informal.
	def	behaving in an immature way; puerile.
adolescent	3.
	syl	ad:o+les+cent
	pron	<2@d*1lesNt>
	pos	n.
	def	an adolescent person.
Adonai	ety	C15: from Hebrew: lord; compare A#7donis 
Adonai	0.
	syl	Ad:o:nai
	pron	<2@do1nI>, <-1nAI>
	pos	n.
	qual	Judaism.
	def	a name for God.
Adonic	1.
	syl	A:don+ic
	pron	<*1d*unik>
	pos	adj.
	usage	in classical prosody
	def	of or relating to a verse line consisting of a dactyl (*_ *u *u ) followed by a spondee (*_ *_ ) or by a trochee (*_ *_ *u ), thought to have been first used in laments for Adonis.
Adonic	2.
	syl	A:don+ic
	pron	<*1d*unik>
	pos	adj.
	def	of or relating to Adonis.
Adonic	3.
	syl	A:don+ic
	pron	<*1d*unik>
	pos	n.
	def	an Adonic line or verse.
Adonis	ety	C16: from Latin, via Greek Ad*_onis from Phoenician ad*_oni my lord, a title of the god Tammuz; related to Hebrew A#7donai 
Adonis	1.
	syl	A:do:nis
	pron	<*1d*unis>
	pos	n.
	qual	Greek myth.
	def	a handsome youth loved by Aphrodite. Killed by a wild boar, he was believed to spend part of the year in the underworld and part on earth, symbolizing the vegetative cycle.
Adonis	2.
	syl	A:do:nis
	pron	<*1d*unis>
	pos	n.
	def	a handsome young man.
adopt	ety	C16: from Latin adopt*_are to choose for oneself, from opt*_are to choose &- a@.#!dop+tion n.
adopt	1.
	syl	a:dopt
	pron	<*1dopt>
	pos	vb.
	mod	tr.
	qual	Law.
	def	to bring (a person) into a specific relationship, esp. to take (another's child) as one's own child.
adopt	2.
	syl	a:dopt
	pron	<*1dopt>
	pos	vb.
	mod	tr.
	def	to choose and follow (a plan, technique, etc.).
adopt	3.
	syl	a:dopt
	pron	<*1dopt>
	pos	vb.
	mod	tr.
	def	to take over (an idea, etc.) as if it were one's own.
adopt	4.
	syl	a:dopt
	pron	<*1dopt>
	pos	vb.
	mod	tr.
	def	to take on; assume.
	exam	1	to adopt a title.
adopt	5.
	syl	a:dopt
	pron	<*1dopt>
	pos	vb.
	mod	tr.
	def	to accept (a report, etc.).
adopted	0.
	syl	a:dopt+ed
	pron	<*1doptid>
	pos	adj.
	def	having been adopted; fostered.
	exam	1	an adopted child.
adoptive	0.
	syl	a:dop+tive
	pron	<*1doptiv>
	pos	adj.
	def	due to adoption; foster.
	exam	1	an adoptive parent.
adorable	1.
	syl	a:dor+a:ble
	pron	<*1dc:r*bL>
	pos	adj.
	def	very attractive; charming; lovable.
adorable	2.
	syl	a:dor+a:ble
	pron	<*1dc:r*bL>
	pos	adj.
	qual	Becoming rare.
	def	deserving or eliciting adoration.
adorably	sub
	head	adorable
	syl	a:1dor+a:bly
	pos	adv.
adoration	1.
	syl	ad:o+ra+tion
	pron	<2@d*1rAS*n>
	pos	n.
	def	deep love or esteem.
adoration	2.
	syl	ad:o+ra+tion
	pron	<2@d*1rAS*n>
	pos	n.
	def	the act of worshipping.
adore	ety	Cl5: via French from Latin ad*_or*_are, from ad- to+ *_or*_are to pray
adore	1.
	syl	a:dore
	pron	<*1dc:>
	pos	vb.
	mod	tr.
	def	to love intensely or deeply.
adore	2.
	syl	a:dore
	pron	<*1dc:>
	pos	vb.
	def	to worship (a god) with religious rites.
adore	3.
	syl	a:dore
	pron	<*1dc:>
	pos	vb.
	mod	tr.
	qual	Informal.
	def	to like very much.
	exam	1	I adore chocolate.
adorer	sub
	head	adore
	syl	a:1dor+er
	pos	n.
adoringly	sub
	head	adore
	syl	a:1dor+ing+ly
	pos	adv.
adorn	ety	C14: via Old French from Latin ad*_orn*_are, from *_orn*_are to furnish, prepare
adorn	1.
	syl	a:dorn
	pron	<*1dc:n>
	pos	vb.
	mod	tr.
	def	to decorate.
	exam	1	she adorned her hair with flowers.
adorn	2.
	syl	a:dorn
	pron	<*1dc:n>
	pos	vb.
	mod	tr.
	def	to increase the beauty, distinction, etc., of.
adornment	sub
	head	adorn
	syl	a:1dorn+ment
	pos	n.
Adowa	0.
	syl	A:do+wa
	pron	<1a:du2wa:>
	pos	n.
	def	a variant spelling of {Aduwa}.
ADP	0.
	syl	ADP
	pos	n.
	qual	Biochem.
	def	adenosine diphosphate; a nucleotide derived from ATP with the liberation of energy that is then used in the performance of muscular work.
ADP	0.
	syl	A.D.P.
	qual	abbrev. for
	def	automatic data processing.
Adrastus	0.
	syl	A:dras:tus
	pron	<*1dr@st*s>
	pos	n.
	qual	Greek myth.
	def	a king of Argos and leader of the Seven against Thebes of whom he was the sole survivor.
ad rem	0.
	syl	ad rem
	pron	Latin. <@d> <1rem>
	pos	adj. adv.
	def	to the point; without digression.
	exam	1	to reply ad rem;
	exam	2	an ad rem discussion.
adrenal	ety	C19: from #7ad - (near)+#7renal 
adrenal	1.
	syl	ad+re+nal
	pron	<*1drEnL>
	pos	adj.
	def	on or near the kidneys.
adrenal	2.
	syl	ad+re+nal
	pron	<*1drEnL>
	pos	adj.
	def	of or relating to the adrenal glands or their secretions.
adrenal	3.
	syl	ad+re+nal
	pron	<*1drEnL>
	pos	n.
	def	an adrenal gland.
adrenal gland	0.
	syl	ad+re+nal gland
	pos	n.
	def	an endocrine gland at the anterior end of each kidney. Its medulla secretes adrenaline and noradrenaline and its cortex secretes several steroid hormones. Also called: {suprarenal gland}.
Adrenalin	0.
	syl	A:dren:a+lin
	pron	<*1dren*lin>
	pos	n.
	qual	Trademark.
	def	a brand of {adrenaline}.
adrenaline	0.
	syl	a:dren:a+line
	pron	<*1dren*lin>, <-2lEn>
	pos	n.
	def	a hormone that is secreted by the adrenal medulla in response to stress and increases heart rate, pulse rate, and blood pressure, and raises the blood levels of glucose and lipids. It is extracted from animals or synthesized for such medical uses as the treatment of asthma. Chemical name: aminohydroxyphenylpropionic acid; formula: C\9H\1\3NO\3. U.S. name: {epinephrine}.
adrenal insufficiency	0.
	syl	ad+re+nal in+suf+fi+cien+cy
	pos	n.
	def	another name for {Addison's disease}.
adrenergic	ety	C20: #7adrena?!line+ Greek ergon work
adrenergic	0.
	syl	ad+ren+er+gic
	pron	<2@dr*1nR:Jik>
	pos	adj.
	def	releasing or activated by adrenaline or an adrenaline-like substance.
adrenocorticotrophic	alt
	head	adrenocorticotropic
	or	adrenocorticotropic
	syl	a:dre+no+cor?!+ti+co+troph+ic
	pron	<*2drEn*u2kc:t*k*u1trofik>
	pos	adj.
adrenocorticotropic	0.
	or	adrenocorticotrophic
	syl	a:dre+no+cor+ti+co+trop+ic
	pron	<*2drEn*u2kc:t*k*u1tropik>
	pos	adj.
	def	stimulating the adrenal cortex.
adrenocorticotropic hormone	0.
	syl	a:dre+no+cor+ti+co+trop+ic hor+mone
	pos	n.
	def	the full name of {ACTH}.
Edgar Douglas	infl
	head	Adrian
	syl	Ed:gar Doug:las
	pos	n.
Adrian	0.
	syl	A:dri:an
	pron	<1Adri*n>
	pos	n.
	def	Baron Adrian. born 1889, English physiologist, noted particularly for his research into the function of neurons: shared with Sherrington the Nobel prize for medicine (1932).
Adrian IV	0.
	syl	A:dri:an IV
	pos	n.
	def	original name ??1100-59, the only English pope (1154-59).
Adrianopolis	alt
	head	Adrianople
	or	Adrianople
	syl	A:dri:a+nop:o+lis
	pron	<2Adri*?!1nop*lis>
	pos	n.
Adrianople	0.
	or	Adrianopolis
	syl	A:dri+an:o+ple
	pron	<2Adri*1n*upL>
	pos	n.
	def	former names of {Edirne}.
Adriatic	1.
	syl	A:dri+at+ic
	pron	<2Adri1@tik>
	pos	adj.
	def	of or relating to the Adriatic Sea, or to the inhabitants of its coast or islands.
Adriathe	2.
	head	Adriatic
	syl	A:dri+athe.
	def	short for the {Adriatic Sea}.
Adriatic Sea	0.
	syl	A:dri+at+ic Sea
	pos	n.
	def	an arm of the Mediterranean between Italy and Yugoslavia.
adrift	1.
	syl	a:drift
	pron	<*1drift>
	pos	adj. postpositive; adv.
	def	floating without steering or mooring; drifting.
adrift	2.
	syl	a:drift
	pron	<*1drift>
	pos	adj. postpositive; adv.
	def	without purpose; aimless.
adrift	3.
	syl	a:drift
	pron	<*1drift>
	pos	adj. postpositive; adv.
	qual	Informal.
	def	off course or amiss.
	exam	1	the project went adrift.
adroit	ety	C17: from French *`a droit according to right, rightly
adroit	1.
	syl	a:droit
	pron	<*1drcit>
	pos	adj.
	def	skilful or dexterous.
adroit	2.
	syl	a:droit
	pron	<*1drcit>
	pos	adj.
	def	quick in thought or reaction.
adroitly	sub
	head	adroit
	syl	a:1droit+ly
	pos	adv.
adroitness	sub
	head	adroit
	syl	a:1droit+ness
	pos	n.
adscititious	ety	C17: from Latin adsc*_itus admitted (from outside), from adsc*_iscere to admit, from sc*_iscere to seek to know, from sc*_ire to know. See -#7itious 
adscititious	0.
	syl	ad+sci+ti+tious
	pron	<2@dsi1tiS*s>
	pos	adj.
	def	added or supplemental; additional.
adscititiously	sub
	head	adscititious
	syl	ad+sci+1ti+tious+ly
	pos	adv.
adscription	0.
	syl	ad+scrip+tion
	pron	<*d1skripS*n>
	pos	n.
	def	a less common word for {ascription}.
adsorb	ety	C19: #7ad -#7+ -sorb as in #7absorb 
adsorb	0.
	syl	ad+sorb
	pron	<*d1sc:b>, <-1zc:b>
	pos	vb.
	def	to undergo or cause to undergo a process in which a substance, usually a gas, accumulates on the surface of a solid forming a thin film, often only one molecule thick.
	exam	1	to adsorb hydrogen on nickel;
	exam	2	oxygen adsorbs on tungsten.
adsorbable	sub
	head	adsorb
	syl	ad+1sorb+a:ble
	pos	adj.
adsorbability	sub
	head	adsorb
	syl	ad+2sorb+a:1bil+i:ty
	pos	n.
adsorption	sub
	head	adsorb
	syl	ad+1sorp+tion
	pos	n.
adsorbate	0.
	syl	ad+sorb+ate
	pron	<*d1sc:bAt>, <-bit>, <-1zc:->
	pos	n.
	def	a substance that has been or is to be adsorbed on a surface.
adsorbent	1.
	syl	ad+sor+bent
	pron	<*d1sc:b*nt>, <-1zc:->
	pos	adj.
	def	capable of adsorption.
adsorbent	2.
	syl	ad+sor+bent
	pron	<*d1sc:b*nt>, <-1zc:->
	pos	n.
	def	a material, such as activated charcoal, on which adsorption can occur.
adsuki bean	0.
	syl	ad+su+ki bean
	pron	<@d1su:ki>, <-1zu:->
	pos	n.
	def	a variant spelling of {adzuki bean}.
adularia	ety	C18: via Italian from French adulaire, after Adula, a group of mountains in Switzerland
adularia	0.
	syl	ad:u+lar:i:a
	pron	<2@dju1le*ri*>
	pos	n.
	def	a white or colourless glassy variety of orthoclase in the form of prismatic crystals. It occurs in metamorphic rocks and is a minor gemstone. Formula: KAlSi\3O\8.
adulate	ety	C17: back formation from C15 adulation, from Latin ad*_ul*_ari to flatter &- @!ad@.u+#!la+tion n. ?- #!ad@.u+@!la+tor n.
adulate	0.
	syl	ad:u+late
	pron	<1@dju2lAt>
	pos	vb.
	mod	tr.
	def	to flatter or praise obsequiously.
adulatory	sub
	head	adulate
	syl	ad:u+la+to:ry
	pron	<2@dju1lAt*ri>, <1@dju2lAt*ri>
	pos	adj.
Adullamite	ety	C19: originally applied to members of the British House of Commons who withdrew from the Liberal party (1866); alluding to the cave of Abdullam in the Bible, to which David and others fled (1 Samuel 22: 1-2)
Adullamite	0.
	syl	A:dul+la+mite
	pron	<*1d^l*2mIt>
	pos	n.
	def	a person who has withdrawn from a political group and joined with a few others to form a dissident group.
adult	ety	C16: from Latin adultus, from adol*_escere to grow up, from al*_escere to grow, from al*_ere to feed, nourish
adult	1.
	syl	a:dult
	pron	<1@d^lt>, <*1d^lt>
	pos	adj.
	def	having reached maturity; fully developed.
adult	2.
	syl	a:dult
	pron	<1@d^lt>, <*1d^lt>
	pos	adj.
	def	of or intended for mature people.
	exam	1	adult education;
	exam	2	adult films.
adult	3.
	syl	a:dult
	pron	<1@d^lt>, <*1d^lt>
	pos	n.
	def	a person who has attained maturity; a grownup.
adult	4.
	syl	a:dult
	pron	<1@d^lt>, <*1d^lt>
	pos	n.
	def	a mature fully grown animal or plant.
adult	5.
	syl	a:dult
	pron	<1@d^lt>, <*1d^lt>
	pos	n.
	qual	Law.
	def	a person who has attained the age of legal majority (18 years for most purposes). Compare {infant}.
adulthood	sub
	head	adult
	syl	a:1dult+hood
	pos	n.
adulterant	1.
	syl	a:dul+ter+ant
	pron	<*1d^lt*r*nt>
	pos	n.
	def	a substance or ingredient that adulterates.
adulterant	2.
	syl	a:dul+ter+ant
	pron	<*1d^lt*r*nt>
	pos	adj.
	def	adulterating.
adulterate	ety	C16: from Latin adulter*_are to corrupt, commit adultery, probably from alter another, hence to approach another, commit adultery
adulterate	1.
	syl	a:dul+ter+ate
	pron	<*1d^lt*2rAt>
	pos	vb.
	mod	tr.
	def	to debase by adding inferior material.
	exam	1	to adulterate milk with water.
adulterate	2.
	syl	a:dul+ter+ate
	pron	<*1d^lt*rit>, <-2rAt>
	pos	adj.
	def	adulterated; debased or impure.
adulterate	3.
	syl	a:dul+ter+ate
	pron	<*1d^lt*rit>, <-2rAt>
	pos	adj.
	def	a less common word for {adulterous}.
adulteration	sub
	head	adulterate
	syl	a:2dul+ter:1a+tion
	pos	n.
adulterator	sub
	head	adulterate
	syl	a:1dul+ter:2a+tor
	pos	n.
adulterer	ety	C16: originally also adulter, from Latin adulter, back formation from adulter*_are to #7adulterate 
adulteress	alt
	head	adulterer
	or	adulterer
	syl	a:dul+ter+ess
	pos	n.
	mod	fem.
adulterer	0.
	or	adulteress
	syl	a:dul+ter+er
	pron	<*1d^lt*r*>
	pos	n.
	def	a person who has committed adultery.
adulterine	1.
	syl	a:dul+ter+ine
	pron	<*1d^lt*rin>, <-2rEn>, <-2rIn>
	pos	adj.
	def	of or made by adulteration; fake.
adulterine	2.
	syl	a:dul+ter+ine
	pron	<*1d^lt*rin>, <-2rEn>, <-2rIn>
	pos	adj.
	def	conceived in adultery.
	exam	1	an adulterine child.
adulterous	1.
	syl	a:dul+ter+ous
	pron	<*1d^lt*r*s>
	pos	adj.
	def	of, characterized by, or inclined to adultery.
adulterous	2.
	syl	a:dul+ter+ous
	pron	<*1d^lt*r*s>
	pos	adj.
	def	an obsolete word for { {adulterate} (sense 2)}.
adulterously	sub
	head	adulterous
	syl	a:1dul+ter+ous+ly
	pos	adv.
adultery	ety	C15 adulterie, altered (as if directly from Latin adulterium) from C14 avoutrie, via Old French from Latin adulterium, from adulter, back formation from adulter*_are. See #7adulterate 
adulteries	infl
	head	adultery
	syl	a:dul+ter:ies.
	pos	n.
	mod	pl.
adultery	0.
	syl	a:dul+ter:y
	pron	<*1d^lt*ri>
	pos	n.
	def	voluntary sexual intercourse between a married man or woman and partner other than the legal spouse.
adumbral	ety	C19: from #7ad - (in the sense: in)+Latin umbra shadow
adumbral	0.
	syl	ad+um+bral
	pron	<@d1^mbr*l>
	pos	adj.
	qual	Usually poetic.
	def	shadowy.
adumbrate	ety	C16: from Latin adumbr*_atus represented only in outline, from adumbr*_are to cast a shadow on, from umbra shadow
adumbrate	1.
	syl	ad+um+brate
	pron	<1@d^m2brAt>
	pos	vb.
	mod	tr.
	def	to outline; give a faint indication of.
adumbrate	2.
	syl	ad+um+brate
	pron	<1@d^m2brAt>
	pos	vb.
	mod	tr.
	def	to foreshadow.
adumbrate	3.
	syl	ad+um+brate
	pron	<1@d^m2brAt>
	pos	vb.
	mod	tr.
	def	to overshadow; obscure.
adumbration	sub
	head	adumbrate
	syl	ad+um+1bra+tion
	pos	n.
adumbrative	sub
	head	adumbrate
	syl	ad+um+bra+tive
	pron	<@d1^mbr*tiv>
	pos	adj.
adumbratively	sub
	head	adumbrate
	syl	ad+1um+bra+tive+ly
	pos	adv.
adust	ety	C14 (in the sense: gloomy): from Latin ad*_ustus, from ad*_urere to set fire to, from *_urere to burn
adust	1.
	syl	a:dust
	pron	<*1d^st>
	pos	adj.
	qual	Archaic.
	def	dried up or darkened by heat; burnt or scorched.
adust	2.
	syl	a:dust
	pron	<*1d^st>
	pos	adj.
	qual	Archaic.
	def	gloomy or melancholy.
Adowa	alt
	head	Aduwa
	or	Aduwa
	syl	A:do+wa
	pron	<1a:du2wa:>
	pos	n.
Aduwa	0.
	or	Adowa
	syl	A:du+wa
	pron	<1a:du2wa:>
	pos	n.
	def	a town in N Ethiopia: Emperor Menelik II defeated the Italians here in 1896. Pop.: 16430 (1971 est.). Italian name: {A@.du@.a} (a#!dua).
adv	ety	Latin: against
adv	1.
	syl	adv.
	qual	abbrev. for:
	def	adverb.
adv	2.
	syl	adv.
	qual	abbrev. for:
	def	adverbial.
adv	3.
	syl	adv.
	qual	abbrev. for:
	def	adversus.
adv	4.
	syl	adv.
	qual	abbrev. for:
	def	advertisement.
adv	5.
	syl	adv.
	qual	abbrev. for:
	def	advocate.
ad val	0.
	syl	ad val.
	qual	abbrev. for
	def	ad valorem.
ad valorem	ety	from Latin
ad valorem	0.
	syl	ad va+lo+rem
	pron	<@d> <v*1lc:r*m>
	pos	adj. adv.
	usage	of taxes
	def	in proportion to the estimated value of the goods taxed. Abbrev.: {ad val}.
advance	ety	C15 advauncen, altered (on the model of words beginning with Latin ad-) from C13 avauncen, via Old French from Latin abante from before, from ab- away from+ ante before
advance	1.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	def	to go or bring forward in position.
advance	2.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	usage	foll. by on
	def	to move (towards) in a threatening manner.
advance	3.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	mod	tr.
	def	to present for consideration; suggest.
advance	4.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	def	to bring or be brought to a further stage of development; improve; further.
advance	5.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	mod	tr.
	def	to cause (an event) to occur earlier.
advance	6.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	mod	tr.
	def	to supply (money, goods, etc.) beforehand, either for a loan or as an initial payment.
advance	7.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	def	to increase (a price, value, rate of occurrence, etc.) or (of a price, etc.) to be increased.
advance	8.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	mod	intr.
	def	to improve one's position; be promoted.
	exam	1	he advanced rapidly in his job.
advance	9.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to promote in rank, status, or position.
advance	10.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	forward movement; progress in time or space.
advance	11.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	improvement; progress in development.
advance	12.a.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	the supplying of commodities or funds before receipt of an agreed consideration.
advance	12.b.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	the commodities or funds supplied in this manner.
advance	12.c.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	usage	as modifier
	exam	1	an advance supply.
advance	13.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	Also called: {advance payment}. a money payment made before it is legally due.
advance	14.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	increase in price, value, rate of occurrence, etc.
advance	15.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	a less common word for { {advancement} (sense 1)}.
advance	16.a.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	def	beforehand.
	exam	1	payment in advance.
advance	16.b.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	usage	foll. by of
	def	ahead in time or development.
	exam	1	ideas in advance of the time.
advance	17.
	syl	ad+vance
	pron	<*d1va:ns>
	pos	n.
	usage	modifier
	def	forward in position or time.
	exam	1	advance booking;
	exam	2	an advance warning.
advancer	sub
	head	advance
	syl	ad+1vanc+er
	pos	n.
advancingly	sub
	head	advance
	syl	ad+1vanc+ing+ly
	pos	adv.
advanced	1.
	syl	ad+vanced
	pron	<*d1va:nst>
	pos	adj.
	def	being ahead in development, knowledge, progress, etc..
	exam	1	advanced studies.
advanced	2.
	syl	ad+vanced
	pron	<*d1va:nst>
	pos	adj.
	def	having reached a comparatively late stage.
	exam	1	a man of advanced age.
advanced	3.
	syl	ad+vanced
	pron	<*d1va:nst>
	pos	adj.
	def	ahead of the times.
	exam	1	advanced views on religion.
advanced gas-cooled reactor	0.
	syl	ad+vanced gas-cooled re+ac+tor
	pos	n.
	def	a nuclear reactor using carbon dioxide as the coolant, graphite as the moderator, and ceramic uranium dioxide cased in stainless steel as the fuel. Abbrev.: {AGR}
advance guard	1.
	syl	ad+vance guard
	pos	n.
	def	a military unit sent ahead of an advanc?!ing formation to ensure its progress, etc.
advance guard	2.
	syl	ad+vance guard
	pos	n.
	def	Also called: {ad?!vanced guard}. another name for {avant-garde}.
advancement	1.
	syl	ad+vance+ment
	pron	<*d1va:nsm*nt>
	pos	n.
	def	promotion in rank, status, etc.; preferment.
advancement	2.
	syl	ad+vance+ment
	pron	<*d1va:nsm*nt>
	pos	n.
	def	a less common word for { {advance} (senses 10, 11)}.
advancement	3.
	syl	ad+vance+ment
	pron	<*d1va:nsm*nt>
	pos	n.
	qual	Property law.
	def	the transfer during the life of a testator of money or property to a person (usually a child) to which the person is entitled.
advance poll	0.
	syl	ad+vance poll
	pos	n.
	usage	Canadian. in an election
	def	a poll held prior to election day to permit voters who expect to be absent then to cast their ballots.
advances	0.
	syl	ad+vanc:es
	pron	<*d1va:nsiz>
	pos	n.
	mod	pl. sometimes; sing.
	usage	often foll. by to or towards
	def	personal overtures made in an attempt to become friendly, gain a favour, etc.
advantage	ety	C14 avantage (later altered to advantage on the model of words beginning with Latin ad-) , from Old French avant before, from Latin abante from before, away. See #7advance 
advantage	1.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	n.
	usage	often foll. by over or of
	def	superior or more favourable position or power.
	exam	1	he had an advantage over me because of his experience.
advantage	2.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	n.
	def	benefit or profit (esp. in the phrase {to one's advantage) }.
advantage	3.a.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	n.
	def	the point scored after deuce.
advantage	3.b.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	n.
	def	the resulting state of the score.
advantage	4.a.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	n.
	def	to make good use of.
advantage	4.b.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	n.
	def	to impose upon the weakness, good nature, etc., of; abuse.
advantage	4.c.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	n.
	def	to seduce.
to advantage	5.
	head	advantage
	syl	to advantage.
	def	to good effect.
	exam	1	he used his height to advantage at the game.
you have the advantage of me	6.
	head	advantage
	syl	you have the advantage of me.
	def	you know me but I do not know you.
advantage	7.
	syl	ad+van+tage
	pron	<*d1va:ntiJ>
	pos	vb.
	mod	tr.
	def	to put in a better position; favour.
advantageous	0.
	syl	ad+van+ta+geous
	pron	<2@dv*n1tAJ*s>
	pos	adj.
	def	producing advantage.
advantageously	sub
	head	advantageous
	syl	ad+van+1ta+geous+ly
	pos	adv.
advantageousness	sub
	head	advantageous
	syl	ad+van+1ta+geous+ness
	pos	n.
advection	ety	C20: from Latin advecti*_o conveyance, from advehere, from ad- to+ vehere to carry
advection	0.
	syl	ad+vec+tion
	pron	<*d1vekS*n>
	pos	n.
	def	the transference of heat energy in a horizontal stream of gas, esp. of air.
advent	ety	C12: from Latin adventus, from adven*_ire, from ad- to+ ven*_ire to come
advent	0.
	syl	ad+vent
	pron	<1@dvent>, <-v*nt>
	pos	n.
	def	an arrival or coming, esp. one which is awaited.
Advent	0.
	syl	Ad+vent
	pron	<1@dvent>, <-v*nt>
	pos	n.
	qual	Christianity.
	def	the season including the four Sundays preceding Christmas.
Adventist	0.
	syl	Ad+vent+ist
	pron	<1@dventist>, <1@dv*n->
	pos	n.
	def	a member of any of the Christian groups, such as the {Seventh Day Adventists}, that hold that the Second Coming of Christ is imminent.
adventitia	ety	C19: New Latin, from the neuter plural of Latin advent*_icius; see #7adventitious 
adventitia	0.
	syl	ad+ven+ti+ti:a
	pron	<2@dven1tiSi*>, <-1tiS*>
	pos	n.
	def	the outermost covering of an organ or part, esp. the outer coat of a blood vessel.
adventitious	ety	C17: from Latin advent*_icius coming from outside, from adventus a coming
adventitious	1.
	syl	ad+ven+ti+tious
	pron	<2@dven1tiS*s>
	pos	adj.
	def	added or appearing accidentally or unexpectedly.
adventitious	2.
	syl	ad+ven+ti+tious
	pron	<2@dven1tiS*s>
	pos	adj.
	usage	of a plant or animal part
	def	developing in an abnormal position, as a root that grows from a stem.
adventitiously	sub
	head	adventitious
	syl	ad+ven+1ti+tious+ly
	pos	adv.
Advent Sunday	0.
	syl	Ad+vent Sun+day
	pos	n.
	def	the first of the four Sundays of Advent, and the one that falls nearest to November 30.
adventure	ety	C13 aventure (later altered to adventure after the Latin spelling), via Old French ultimately from Latin adven*_ire to happen to (someone), arrive
adventure	1.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	n.
	def	a risky undertaking of unknown outcome.
adventure	2.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	n.
	def	an exciting or unexpected event or course of events.
adventure	3.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	n.
	def	a hazardous financial operation; commercial speculation.
adventure	4.a.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	n.
	def	danger or misadventure.
adventure	4.b.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	n.
	def	chance.
adventure	5.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	vb.
	def	to take a risk or put at risk.
adventure	6.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	vb.
	mod	intr.
	usage	foll. by into, on, upon
	def	to dare to go or enter (into a place, dangerous activity, etc.).
adventure	7.
	syl	ad+ven+ture
	pron	<*d1venC*>
	pos	vb.
	def	to dare to say (something).
	exam	1	he adventured his opinion.
adventureful	sub
	head	adventure
	syl	ad+1ven+ture+ful
	pos	adj.
adventure playground	0.
	syl	ad+ven+ture play+ground
	pos	n.
	qual	Brit.
	def	a playground for children that contains building materials, discarded industrial parts, etc., used by the children to build with, hide in, climb on, etc.
adventuress	alt
	head	adventurer
	or	adventurer
	syl	ad+ven+tur+ess
	pos	n.
	mod	fem.
adventurer	1.
	or	adventuress
	syl	ad+ven+tur+er
	pron	<*d1venC*r*>
	pos	n.
	def	a person who seeks adventure, esp. one who seeks success or money through daring exploits.
adventurer	2.
	or	adventuress
	syl	ad+ven+tur+er
	pron	<*d1venC*r*>
	pos	n.
	def	a person who seeks money or power by unscrupulous means.
adventurer	3.
	or	adventuress
	syl	ad+ven+tur+er
	pron	<*d1venC*r*>
	pos	n.
	def	a speculator.
adventurism	0.
	syl	ad+ven+tur+ism
	pron	<*d1venC*2riz*m>
	pos	n.
	def	recklessness, esp. in politics and finance.
adventurist	sub
	head	adventurism
	syl	ad+1ven+tur+ist
	pos	n.
adventurous	1.
	syl	ad+ven+tur+ous
	pron	<*d1venC*r*s>
	pos	adj.
	def	Also: {ad+ven+ture+some}. daring or enterprising.
adventurous	2.
	syl	ad+ven+tur+ous
	pron	<*d1venC*r*s>
	pos	adj.
	def	dangerous; involving risk.
adventurously	sub
	head	adventurous
	syl	ad+1ven+tur+ous+ly
	pos	adv.
adverb	ety	C15-C16: from Latin adverbium adverb, literally: added word, a translation of Greek epirrh*_ema a word spoken afterwards
adverb	0.a.
	syl	ad+verb
	pron	<1@d2vR:b>
	pos	n.
	def	a word or group of words that serves to modify a whole sentence, a verb, another adverb, or an adjective; for example, and respectively in the sentence
adverb	0.b.
	syl	ad+verb
	pron	<1@d2vR:b>
	pos	n.
	usage	as modifier; an adverb marker.
	def	Abbrev.: {adv}.
adverbial	1.
	syl	ad+ver+bi:al
	pron	<@d1vR:bi*l>
	pos	n.
	def	a word or group of words playing the grammatical role of an adverb, such as in the sentence
adverbial	2.
	syl	ad+ver+bi:al
	pron	<@d1vR:bi*l>
	pos	adj.
	def	of or relating to an adverb or adverbial.
adversary	ety	C14: from Latin advers*_arius, from adversus against. See #7adverse 
adversaries	infl
	head	adversary
	syl	ad+ver+sar:ies.
	pos	n.
	mod	pl.
adversary	1.
	syl	ad+ver+sar:y
	pron	<1@dv*s*ri>
	pos	n.
	def	a person or group that is hostile to someone; enemy.
adversary	2.
	syl	ad+ver+sar:y
	pron	<1@dv*s*ri>
	pos	n.
	def	an opposing contestant in a game or sport.
adversative	1.
	syl	ad+ver+sa+tive
	pron	<*d1vR:s*tiv>
	pos	adj.
	qual	Grammar.
	usage	of a word, phrase, or clause
	def	implying opposition or contrast. and are adversative conjunctions introducing adversative clauses.
adversative	2.
	syl	ad+ver+sa+tive
	pron	<*d1vR:s*tiv>
	pos	n.
	qual	Grammar.
	def	an adversative word or speech element.
adverse	ety	C14: from Latin ad?!versus opposed to, hostile, from advertere to turn towards, from ad- to, towards+ vertere to turn
adverse	1.
	syl	ad+verse
	pron	<1@dvR:s>, <@d1vR:s>
	pos	adj.
	def	antagonistic or inimical; hostile.
	exam	1	adverse criticism.
adverse	2.
	syl	ad+verse
	pron	<1@dvR:s>, <@d1vR:s>
	pos	adj.
	def	unfavourable to one's interests.
	exam	1	adverse circumstances.
adverse	3.
	syl	ad+verse
	pron	<1@dvR:s>, <@d1vR:s>
	pos	adj.
	def	contrary or opposite in direction or position.
	exam	1	adverse winds.
adverse	4.
	syl	ad+verse
	pron	<1@dvR:s>, <@d1vR:s>
	pos	adj.
	usage	of leaves, flowers, etc.
	def	facing the main stem. Compare {{averse} (sense 2)}.
adversely	sub
	head	adverse
	syl	ad+1verse+ly
	pos	adv.
adverseness	sub
	head	adverse
	syl	ad+1verse+ness
	pos	n.
adverse possession	0.
	syl	ad+verse pos+ses+sion
	pos	n.
	qual	Property law.
	def	the occupation or possession of land by a person not legally entitled to it. If continued unopposed for a period specifed by law, such occupation extinguishes the title of the rightful owner.
adversities	infl
	head	adversity
	syl	ad+ver+si:ties.
	pos	n.
	mod	pl.
adversity	1.
	syl	ad+ver+si:ty
	pron	<*d1vR:siti>
	pos	n.
	def	distress; affliction; hardship.
adversity	2.
	syl	ad+ver+si:ty
	pron	<*d1vR:siti>
	pos	n.
	def	an unfortunate event or incident.
advert	ety	C15: from Latin advertere to turn one's attention to. See #7adverse 
advert	H1.0.
	syl	ad+vert
	pron	<*d1vR:t>
	pos	vb.
	mod	intr.
	usage	foll. by to
	def	to draw attention (to); refer (to).
advert	H2.0.
	syl	ad+vert
	pron	<1@dvR:t>
	pos	n.
	qual	Brit. informal.
	def	short for {advertisement}.
advertency	alt
	head	advertence
	or	advertence
	syl	ad+vert+en+cy
	pos	n.
advertence	0.
	or	advertency
	syl	ad+vert+ence
	pron	<*d1vR:t*ns>
	pos	n.
	def	heedfulness or attentiveness.
advertent	sub
	head	advertence
	syl	ad+1vert+ent
	pos	adj.
advertently	sub
	head	advertence
	syl	ad+1vert+ent+ly
	pos	adv.
advertise	ety	C15: from a lengthened stem of Old French avertir, ultimately from Latin advertere to turn one's attention to. See #7adverse 
advertize	alt
	head	advertise
	or	advertise
	syl	ad+ver+tize
	pron	<1@dv*2tIz>
	pos	vb.
	qual	U.S. (sometimes
advertise	1.
	or	advertize
	syl	ad+ver+tise
	pron	<1@dv*2tIz>
	pos	vb.
	def	to present or praise (goods, a service, etc.) to the public, esp. in order to encourage sales.
advertise	2.
	or	advertize
	syl	ad+ver+tise
	pron	<1@dv*2tIz>
	pos	vb.
	def	to make (something, such as a vacancy, article for sale, etc.) publicly known, as to possible applicants, buyers, etc..
	exam	1	to advertise a job.
advertise	3.
	or	advertize
	syl	ad+ver+tise
	pron	<1@dv*2tIz>
	pos	vb.
	mod	intr.
	usage	foll. by for
	def	to make a public request (for), esp. in a newspaper, etc..
	exam	1	she advertised for a cook.
advertise	4.
	or	advertize
	syl	ad+ver+tise
	pron	<1@dv*2tIz>
	pos	vb.
	qual	Obsolete.
	def	to warn; caution.
advertiser	sub
	head	advertise
	syl	ad+ver+2tis+er
	pos	n.
advertizement	alt
	head	advertisement
	or	advertisement
	syl	ad+ver+tize+ment
	pron	<*d1vR:tism*nt>, <-tiz->
	pos	n.
	qual	U.S. (sometimes
advertisement	0.
	or	advertizement
	syl	ad+ver+tise+ment
	pron	<*d1vR:tism*nt>, <-tiz->
	pos	n.
	def	any public notice, as a printed display in a newspaper, short film on television, announcement on radio, etc., designed to sell goods, publicize an event, etc. Shortened forms: {ad, advert}.
advertizing	alt
	head	advertising
	or	advertising
	syl	ad+ver+tiz+ing
	pron	<1@dv*?!2tIziG>
	pos	n.
	qual	U.S. (sometimes
advertising	1.
	or	advertizing
	syl	ad+ver+tis+ing
	pron	<1@dv*?!2tIziG>
	pos	n.
	def	the action or practice of drawing public attention to goods, services, events, etc., as by the distribution of printed notices, broadcasting, etc.
advertising	2.
	or	advertizing
	syl	ad+ver+tis+ing
	pron	<1@dv*?!2tIziG>
	pos	n.
	def	the business that specializes in creating such publicity.
advertising	3.
	or	advertizing
	syl	ad+ver+tis+ing
	pron	<1@dv*?!2tIziG>
	pos	n.
	def	advertisements collectively; pub?!licity.
advice	ety	C13 avis (later advise) , via Old French from a Vulgar Latin phrase based on Latin ad to, according to+ v*_isum view (hence: according to one's view, opinion)
advice	1.
	syl	ad+vice
	pron	<*d1vIs>
	pos	n.
	def	recommendation as to appropriate choice of action; counsel.
advice	2.
	syl	ad+vice
	pron	<*d1vIs>
	pos	n.
	mod	sometimes; pl.
	def	formal notification of facts, esp. when communicated from a distance.
advisable	0.
	syl	ad+vis+a:ble
	pron	<*d1vIz*bL>
	pos	adj.
	def	worthy of recommendation; prudent; sensible.
advisably	sub
	head	advisable
	syl	ad+1vis+a:bly
	pos	adv.
advise	ety	C14: via Old French from Vulgar Latin adv*_is*_are (un?!attested) to consider, from Latin ad- to+ vis*_are (unattested), from v*_isere to view, from vid*_ere to see#e Usage. Advise is often used in the same sense as inform: as we advised you in our last communication, the order is being dealt with. This use is accepted and common in business corre?!spondence. Careful users of English prefer inform, notify, or tell in general English: when he returned home, the police informed him (not advised him) that his car had been stolen.
advise	1.
	syl	ad+vise
	pron	<*d1vIz>
	pos	vb.
	mod	when; tr.
	usage	an infinitive
	def	to offer advice (to a person or persons); counsel.
	exam	1	he advised the king;
	exam	2	to advise caution;
	exam	3	he advised her to leave.
advise	2.
	syl	ad+vise
	pron	<*d1vIz>
	pos	vb.
	mod	tr.
	usage	an infinitive; sometimes foll. by of
	def	to inform or notify.
advise	3.
	syl	ad+vise
	pron	<*d1vIz>
	pos	vb.
	mod	intr.
	qual	Chiefly U.S., obsolete in Brit.
	usage	an infinitive; foll. by with
	def	to consult or discuss.
advised	0.
	syl	ad+vised
	pron	<*d1vIzd>
	pos	adj.
	def	resulting from deliberation. See also {ill-advised, well-advised}. &- {ad+vis+ed+ly} ($$d#!va$Iz$Idl$I)
advisement	0.
	syl	ad+vise+ment
	pron	<*d1vIzm*nt>
	pos	n.
	qual	Chiefly U.S., archaic in Brit.
	def	consultation; deliberation.
advisor	alt
	head	adviser
	or	adviser
	syl	ad+vi+sor
	pron	<*d1vIz*>
	pos	n.
adviser	1.
	or	advisor
	syl	ad+vis+er
	pron	<*d1vIz*>
	pos	n.
	def	a person who advises.
adviser	2.
	or	advisor
	syl	ad+vis+er
	pron	<*d1vIz*>
	pos	n.
	qual	Education.
	def	a person responsible for advising students on academic matters, career guidance, etc.
adviser	3.
	or	advisor
	syl	ad+vis+er
	pron	<*d1vIz*>
	pos	n.
	qual	Brit. education.
	def	a subject specialist who advises heads of schools on current teaching methods and facilities.
advisory	0.
	syl	ad+vi+so+ry
	pron	<*d1vIz*ri>
	pos	adj.
	def	giving advice; empowered to make recommendations.
	exam	1	an advisory body.
advocaat	ety	C20: Dutch, from advocatenborrel, from advocaat #7advocate (n.)+ borrel drink
advocaat	0.
	syl	ad+vo+caat
	pron	<1@dv*u2ka:>, <-2ka:t>, <1@dv*->
	pos	n.
	def	a liqueur having a raw egg base.
cies	infl
	head	advocacy
	syl	+cies.
	pos	n.
	mod	pl.
advocacy	0.
	syl	ad+vo+ca+cy
	pron	<1@dv*k*si>
	pos	n.
	def	active support, esp. of a cause.
advocate	ety	C14: via Old French from Latin advoc*_atus legal witness, advocate, from advoc*_are to call as witness, from voc*_are to call
advocate	1.
	syl	ad+vo+cate
	pron	<1@dv*2kAt>
	pos	vb.
	mod	tr.
	usage	may take a clause as object
	def	to support or recommend publicly; plead for or speak in favour of.
advocate	2.
	syl	ad+vo+cate
	pron	<1@dv*kit>, <-2kAt>
	pos	n.
	def	a person who upholds or defends a cause; supporter.
advocate	3.
	syl	ad+vo+cate
	pron	<1@dv*kit>, <-2kAt>
	pos	n.
	def	a person who intercedes on behalf of another.
advocate	4.
	syl	ad+vo+cate
	pron	<1@dv*kit>, <-2kAt>
	pos	n.
	def	a person who pleads his client's cause in a court of law. See also {barrister, solicitor, counsellor}.
advocate	5.
	syl	ad+vo+cate
	pron	<1@dv*kit>, <-2kAt>
	pos	n.
	qual	Scottish law.
	def	the usual word for {counsel}.
advocatory	sub
	head	advocate
	syl	ad+vo+1ca+to:ry
	pos	adj.
Advocate Depute	0.
	syl	Ad+vo+cate De+pute
	pos	n.
	def	a Scottish law officer with the functions of public prosecutor.
advocation	0.
	syl	ad+vo+ca+tion
	pron	<2@dv*1kAS*n>
	pos	n.
	qual	Scottish and papal law.
	def	the transfer to itself by a superior court of an action pending in a lower court.
advocatus diaboli	0.
	syl	ad+vo+ca+tus di+ab:o+li
	pron	Latin. <2@dv*1ka:t*s> <dI1@b*2lI>
	pos	n.
	def	another name for the {devil's advocate}.
advowson	ety	C13: via Anglo-French and Old French from Latin advoc*_ati*_on- the act of summoning, from advoc*_are to summon
advowson	0.
	syl	ad+vow+son
	pron	<*d1vauzN>
	pos	n.
	qual	English ecclesiastical law.
	def	the right of presentation to a vacant benefice.
advt	0.
	syl	advt.
	qual	abbrev. for
	def	advertisement.
Adyghe	alt
	head	Adygei
	or	Adygei
	syl	A:dy+ghe
	pron	<1a:di2gA>, <2a:di1gA>, <2a:di1ge>
	pos	n.
Adygei	infl
	or	Adyghe
	syl	A:dy+gei
	pos	n.
	mod	pl.
Adygeis	infl
	head	Adygei
	or	Adyghes
	syl	A:dy+geis
	pos	n.
	mod	pl.
Adyghe	infl
	head	Adygei
	or	Adygei
	syl	A:dy+ghe
	pos	n.
	mod	pl.
Adyghes	infl
	head	Adygei
	or	Adygeis
	syl	A:dy+ghes
	pos	n.
	mod	pl.
Adygei	1.
	or	Adyghe
	syl	A:dy+gei
	pron	<1a:di2gA>, <2a:di1gA>, <2a:di1ge>
	pos	n.
	def	a member of a Circassian people of the Northwest Caucasus.
Adygei	2.
	or	Adyghe
	syl	A:dy+gei
	pron	<1a:di2gA>, <2a:di1gA>, <2a:di1ge>
	pos	n.
	def	the Circassian language.
Adygei Autonomous Region	0.
	syl	A:dy+gei Au:ton:o+mous Re+gion
	pos	n.
	def	an administrative division of the SW Soviet Union, bordering on the Caucasus Mountains: chiefly agricultural. Capital: Maikop. Pop.: 385644 (1970). Area: 7600 sq. km (2934 sq. miles).
adynamia	ety	C19: New Latin, from #7a -%1+ -dynamia, from Greek dunamis strength, force
adynamia	0.
	syl	ad:y+na+mi:a
	pron	<2@di1nAmi*>
	pos	n.
	def	loss of vital power or strength, esp. as the result of illness; weakness or debility.
adynamic	sub
	head	adynamia
	syl	ad:y+nam+ic
	pron	<2@di1n@mik>
	pos	adj.
adytum	ety	C17: Latin, from Greek aduton a place not to be entered, from #7a -%1#7+ duein to enter
adyta	infl
	head	adytum
	syl	ad:y+ta
	pron	<-t*>
	pos	n.
	mod	pl.
adytum	0.
	syl	ad:y+tum
	pron	<1@dit*m>
	pos	n.
	def	the most sacred place of worship in an ancient temple from which the laity was prohibited.
adze	ety	Old English adesa, of unknown origin
adz	alt
	head	adze
	or	adze
	syl	adz
	pron	<@dz>
	pos	n.
	qual	U.S.
adze	0.
	or	adz
	syl	adze
	pron	<@dz>
	pos	n.
	def	a heavy hand tool with a steel cutting blade attached at right angles to a wooden handle, used for dressing timber.
Adzhar Autonomous Soviet Socialist Republic	0.
	syl	A:dzhar Au:ton:o+mous So+vi+et So+cial+ist Re+pub+lic
	pron	<*1Ja:>
	pos	n.
	def	an administrative division of the S Soviet Union, in the SW Georgian SSR on the Black Sea: part of Turkey from the 17th century until 1878; mostly mountainous, reaching 2805 m (9350 ft.), with a subtropical coastal strip. Capital: Batumi. Pop.: 309768 (1970). Area: 3000 sq. km (1160 sq. miles). Also called: {A@.dzha+ri@.a} ($$#!d#f$a$:r$I$$).
adzuki bean	ety	 adzuki, from Japanese: red bean
adsuki bean	alt
	head	adzuki bean
	or	adzuki bean
	syl	ad+su+ki bean
	pos	n.
adzuki bean	1.
	or	adsuki bean
	syl	ad+zu+ki bean
	pron	<@d1zu:ki>
	pos	n.
	def	a papilionaceous plant, that has yellow flowers and pods containing edible brown seeds and is widely cultivated as a food crop in China and Japan.
adzuki bean	2.
	or	adsuki bean
	syl	ad+zu+ki bean
	pron	<@d1zu:ki>
	pos	n.
	def	the seed of this plant.
AE	alt
	or	AE
	syl	AE
	pos	n.
AE	0.
	or	AE
	syl	A.E.
	pos	n.
	def	the pen name of (George William) {Russell}.
ae	ety	Latin: at the age of; aged
ae	0.
	syl	ae.
	qual	abbrev. for
	def	aetatis.
AEA	0.
	syl	A.E.A.
	qual	abbrev. for
	usage	in Britain
	def	Atomic Energy Authority.
AE  P	0.
	syl	A.E. ?& P.
	qual	abbrev. for
	def	Ambassador Extraordinary and Plenipotentiary.
AEC	0.
	syl	A.E.C.
	qual	abbrev. for
	usage	in the U.S.
	def	Atomic Energy Commission.
aeciospore	ety	C20: from #7aecium+spore 
aeciospore	0.
	syl	ae:ci:o+spore
	pron	<1Esi*2spc:>
	pos	n.
	def	any of the spores produced in an aecium of the rust fungi, which spread to and infect the primary host.
aecium	ety	C19: New Latin, from Greek aikia injury (so called because of the damage the fungi cause)
aecidium	alt
	head	aecium
	or	aecium
	syl	ae:cid+i:um
	pron	<E1sidi*m>
	pos	n.
aecia	infl
	head	aecium
	or	aecidia
	syl	ae:ci:a
	pron	<-si*>
	pos	n.
	mod	pl.
aecidia	infl
	head	aecium
	or	aecia
	syl	ae:cid:i:a
	pron	<-1sidi*>
	pos	n.
	mod	pl.
aecium	0.
	or	aecidium
	syl	ae:ci:um
	pron	<1Esi*m>
	pos	n.
	def	a globular or cup-shaped structure in some rust fungi in which aeciospores are produced.
aedes	ety	C20: New Latin, from Greek a*_ed*_es unpleasant, from #7a -%1#7+ *_edos pleasant
aedes	0.
	syl	a:e:des
	pron	<A1EdEz>
	pos	n.
	def	any mosquito of the genus (formerly of tropical and subtropical regions, esp. which transmits yellow fever and dengue.
aedile	ety	C16: from Latin aed*_ilis concerned with buildings, from aed*_es a building
aedile	alt
	or	aedile
	syl	ae:dile
	pron	<1EdIl>
	pos	n.
	qual	U.S. (sometimes
aedile	0.
	or	aedile
	syl	ae:dile
	pron	<1EdIl>
	pos	n.
	def	a magistrate of ancient Rome in charge of public works, games, buildings, and roads.
Aeetes	0.
	syl	Ae:*"e:tes
	pron	<E1EtEz>
	pos	n.
	qual	Greek myth.
	def	a king of Colchis, father of Medea and keeper of the Golden Fleece.
Aegean	1.
	syl	Ae:ge:an
	pron	<E1JE*n>
	pos	adj.
	def	of or relating to the Aegean Sea or Islands.
Aegean	2.
	syl	Ae:ge:an
	pron	<E1JE*n>
	pos	adj.
	def	of or relating to the Bronze Age civilization of Greece, Asia Minor, and the Aegean Islands.
Aegean Islands	0.
	syl	Ae:ge:an Is+lands
	pos	n.
	mod	pl.
	def	the islands of the Aegean Sea, including the Cyclades, Dodecanese, Euboea, and Sporades. The majority are under Greek administration.
Aegean Sea	0.
	syl	Ae:ge:an Sea
	pos	n.
	def	an arm of the Mediterranean between Greece and Turkey.
Aegeus	0.
	syl	Ae:ge:us
	pron	<E1JEu:s>, <1EJi*s>
	pos	n.
	qual	Greek myth.
	def	an Athenian king and father of Theseus.
Aegina	1.
	syl	Ae:gi+na
	pron	<E1JIn*>
	pos	n.
	def	an island in the Aegean Sea, in the Saronic Gulf. Area: 85 sq. km (33 sq. miles).
Aegina	2.
	syl	Ae:gi+na
	pron	<E1JIn*>
	pos	n.
	def	a town on the coast of this island: a city-state of ancient Greece.
Gulf of	3.
	head	Aegina
	syl	Gulf of.
	def	another name for the {Saronic Gulf}.
Aegina	xref
	syl	Ae:gi+na
	pron	<E1JIn*>
	pos	n.
	def	Greek name: {Aiyina}.
Aegir	0.
	syl	Ae:gir
	pron	<1EJi*>
	pos	n.
	qual	Norse myth.
	def	the god of the sea.
aegis	ety	C18: from Latin, from Greek aigis shield of Zeus, perhaps related to aig-, stem of aix goat
aegis	alt
	or	aegis
	syl	ae:gis
	pron	<1EJis>
	pos	n.
	qual	U.S. (sometimes
aegis	1.
	or	aegis
	syl	ae:gis
	pron	<1EJis>
	pos	n.
	def	sponsorship or protection; auspices (esp. in the phrase {under the aegis of) }.
aegis	2.
	or	aegis
	syl	ae:gis
	pron	<1EJis>
	pos	n.
	qual	Greek myth.
	def	the shield of Zeus, often represented in art as a goatskin.
Aegisthus	0.
	syl	Ae:gis:thus
	pron	<E1JisT*s>
	pos	n.
	qual	Greek myth.
	def	a cousin to and the murderer of Agamemnon, whose wife Clytemnestra he had seduced. He usurped the kingship of Mycenae until Orestes, Agamemnon's son, returned home and killed him.
Aegospotami	0.
	syl	Ae:gos+pot:a+mi
	pron	<2Eg*s1pot*2mI>
	pos	n.
	def	a river of ancient Thrace that flowed into the Hellespont. At its mouth the Spartan fleet under Lysander defeated the Athenians in 405 #7b.c., ending the Peloponnesian War.
aegrotat	ety	C19: Latin, literally: he is ill
aegrotat	1.
	syl	ae:gro+tat
	pron	<1Igr*u2t@t>, <1E-> <E1gr*ut@t>
	pos	n.
	usage	in British and certain other universities
	def	a certificate allowing a candidate to pass an examination although he has missed part of it through illness.
aegrotat	2.
	syl	ae:gro+tat
	pron	<1Igr*u2t@t>, <1E-> <E1gr*ut@t>
	pos	n.
	def	a degree obtained in such circumstances.
Aegyptus	0.
	syl	Ae:gyp:tus
	pron	<E1Jipt*s>
	pos	n.
	qual	Greek myth.
	def	a king of Egypt and twin brother of Dana*"us.
-aemia	ety	New Latin, from Greek -aimia, from haima blood
-haemia	alt
	head	-aemia
	or	-hemia
	syl	-hae:mi:a
	pos	n.
-emia	infl
	head	-aemia
	or	-aemia
	syl	-e:mi:a
	pos	n.
	qual	U.S.
-hemia	infl
	head	-aemia
	or	-haemia
	syl	-he:mi:a
	pos	n.
	qual	U.S.
-aemia	0.
	or	-emia
	syl	-ae:mi:a
	pos	n.
	usage	combining form.
	def	denoting blood, esp. a specified condition of the blood in names of diseases.
	exam	1	leucaemia.
Aeneas	0.
	syl	Ae:ne:as
	pron	<i1nE*s>
	pos	n.
	qual	Classical myth.
	def	a Trojan prince, the son of Anchises and Aphrodite, who escaped the sack of Troy and sailed to Italy via Carthage and Sicily. After seven years, he and his followers established themselves near the site of the future Rome.
Aeneas Sylvius	alt
	head	Aeneas Silvius
	or	Aeneas Silvius
	syl	Ae:ne:as Syl:vi:us
	pron	<1silvi*s>
	pos	n.
Aeneas Silvius	0.
	or	Aeneas Sylvius
	syl	Ae:ne:as Sil:vi:us
	pron	<1silvi*s>
	pos	n.
	def	the literary name of {Pius II}.
Aeneid	0.
	syl	Ae:ne+id
	pron	<i1nEid>
	pos	n.
	def	an epic poem in Latin by Virgil relating the experiences of Aeneas after the fall of Troy, written chiefly to provide an illustrious historical background for Rome.
aeneous	ety	C19: from Latin a*_eneus of bronze, from aes bronze
aeneous	0.
	syl	a:e:ne:ous
	pron	<A1Eni*s>
	pos	adj.
	qual	Rare.
	def	of a lustrous bronze colour.
Eolian	alt
	head	Aeolian
	or	Aeolian
	syl	E:o:li:an
	pron	<E1*uli*n>
	pos	n.
Aeolian	1.
	or	Eolian
	syl	Ae:o+li:an
	pron	<E1*uli*n>
	pos	n.
	def	a member of a Hellenic people who settled in Thessaly and Boeotia and colonized Lesbos and parts of the Aegean coast of Asia Minor.
Aeolian	2.
	or	Eolian
	syl	Ae:o+li:an
	pron	<E1*uli*n>
	pos	adj.
	def	of or relating to this people or their dialect of Ancient Greek; Aeolic.
Aeolian	3.
	or	Eolian
	syl	Ae:o+li:an
	pron	<E1*uli*n>
	pos	adj.
	def	of or relating to Aeolus.
Aeolian	4.
	or	Eolian
	syl	Ae:o+li:an
	pron	<E1*uli*n>
	pos	adj.
	def	denoting or relating to an authentic mode represented by the ascending natural diatonic scale from A to A: the basis of the modern minor key. See also {Hypo-}.
aeolian harp	0.
	syl	ae:o+li:an harp
	pos	n.
	def	a stringed instrument that produces a musical sound when a current of air or wind passes over the strings. Also called: {wind harp}.
Aeolian Islands	0.
	syl	Ae:o+li:an Is+lands
	pos	n.
	mod	pl.
	def	another name for the {Lipari Islands}.
Eolic	alt
	head	Aeolic
	or	Aeolic
	syl	E:ol+ic
	pron	<E1olik>, <E1*ulik>
	pos	adj.
Aeolic	1.
	or	Eolic
	syl	Ae:ol+ic
	pron	<E1olik>, <E1*ulik>
	pos	adj.
	def	of or relating to the Aeolians or their dialect.
Aeolic	2.
	or	Eolic
	syl	Ae:ol+ic
	pron	<E1olik>, <E1*ulik>
	pos	n.
	def	one of four chief dialects of Ancient Greek, spoken chiefly in Thessaly, Boeotia, and Aeolis. Compare {Arcadic, Doric, Ionic}.
aeolipile	ety	C17: from Latin aeol*_ipilae balls of A#7eolus or aeol*_ipylae gates of A#7eolus 
aeolipile	0.
	syl	ae:ol:i+pile
	pron	<E1oli2pIl>
	pos	n.
	def	a device illustrating the reactive forces of a gas jet: usually a spherical vessel mounted so as to rotate and equipped with angled exit pipes from which steam within it escapes.
Aeolia	alt
	head	Aeolis
	or	Aeolis
	syl	Ae:o+li:a
	pron	<E1*uli*>
	pos	n.
Aeolis	0.
	or	Aeolia
	syl	Ae:o+lis
	pron	<1E*lis>
	pos	n.
	def	the ancient name for the coastal region of NW Asia Minor, including the island of Lesbos, settled by the Aeolian Greeks (about 1000 #7b.c.)
aeolotropic	ety	C19: from Greek aiolos fickle+-#7tropic 
aeolotropic	0.
	syl	ae:o+lo+trop+ic
	pron	<2E*l*u1tropik>
	pos	adj.
	def	a less common word for {anisotropic}.
Aeolus	1.
	syl	Ae:o:lus
	pron	<1E*l*s>, <E1*ul*s>
	pos	n.
	qual	Greek myth.
	def	the god of the winds.
Aeolus	2.
	syl	Ae:o:lus
	pron	<1E*l*s>, <E1*ul*s>
	pos	n.
	qual	Greek myth.
	def	the founding king of the Aeolians in Thessaly.
aeon	ety	C17: from Greek ai*_on an infinitely long time
aeon	alt
	or	aeon
	syl	ae:on
	pron	<1E*n>, <1Eon>
	pos	n.
	qual	U.S.
aeon	1.
	or	aeon
	syl	ae:on
	pron	<1E*n>, <1Eon>
	pos	n.
	def	an immeasurably long period of time; age.
aeon	2.
	or	aeon
	syl	ae:on
	pron	<1E*n>, <1Eon>
	pos	n.
	qual	Geology.
	def	the longest division of geological time, comprising two or more eras.
aeon	3.
	or	aeon
	syl	ae:on
	pron	<1E*n>, <1Eon>
	pos	n.
	qual	Gnosticism.
	usage	often cap.
	def	one of the powers emanating from the supreme being and culminating in the demiurge.
aeonian	alt
	or	aeonian
	syl	ae:o+ni:an
	pron	<E1*uni*n>
	pos	adj.
aeonian	0.
	or	aeonian
	syl	ae:o+ni:an
	pron	<E1*uni*n>
	pos	adj.
	qual	Literary.
	def	everlasting.
aepyornis	ety	C19: New Latin, from Greek aipus high+ ornis bird
aepyornis	0.
	syl	ae:py+or+nis
	pron	<2Epi1c:nis>
	pos	n.
	def	any of the large extinct flightless birds of the genus remains of which have been found in Madagascar.
aer-	0.
	syl	aer-
	usage	combining form.
	def	variant of {aero-} before a vowel.
aerate	1.
	syl	aer+ate
	pron	<1e*rAt>
	pos	vb.
	mod	tr.
	def	to charge (a liquid) with a gas, esp. carbon dioxide, as in the manufacture of effervescent drink.
aerate	2.
	syl	aer+ate
	pron	<1e*rAt>
	pos	vb.
	mod	tr.
	def	to expose to the action or circulation of the air, so as to purify.
aeration	sub
	head	aerate
	syl	aer:1a+tion
	pos	n.
aerator	sub
	head	aerate
	syl	aer:a+tor
	pos	n.
aeri-	0.
	syl	aer:i-
	usage	combining form.
	def	variant of {aero-}.
aerial	ety	C17: via Latin from Greek a*_erios, from a*_er air
aerial	1.
	syl	aer+i:al
	pron	<1e*ri*l>
	pos	adj.
	def	of, relating to, or resembling air.
aerial	2.
	syl	aer+i:al
	pron	<1e*ri*l>
	pos	adj.
	def	existing, occurring, moving, or operating in the air.
	exam	1	aerial cable car;
	exam	2	aerial roots of a plant.
aerial	3.
	syl	aer+i:al
	pron	<1e*ri*l>
	pos	adj.
	def	ethereal; light and delicate.
aerial	4.
	syl	aer+i:al
	pron	<1e*ri*l>
	pos	adj.
	def	imaginary; visionary.
aerial	5.
	syl	aer+i:al
	pron	<1e*ri*l>
	pos	adj.
	def	extending high into the air; lofty.
aerial	6.
	syl	aer+i:al
	pron	<1e*ri*l>
	pos	adj.
	def	of or relating to aircraft.
	exam	1	aerial combat.
aerial	7.
	syl	aer+i:al
	pron	<1e*ri*l>
	pos	n.
	def	Also called: {antenna}. the part of a radio or television system having any of various shapes, such as a dipole, Yagi, long-wire, or vertical aerial, by means of which radio waves are transmitted or received.
aerialist	0.
	syl	aer:i+al+ist
	pron	<1e*ri*2list>
	pos	n.
	qual	Chiefly U.S.
	def	a trapeze artist or tightrope walker.
aerial ladder	0.
	syl	aer+i:al lad+der
	pos	n.
	def	the U.S. term for {turntable ladder}.
aerial perspective	0.
	syl	aer+i:al per+spec+tive
	pos	n.
	usage	in painting and drawing
	def	a means of indicating relative distance in terms of a gradation of clarity, tone, and colour, esp. blue. Also called: {atmospheric perspective}.
aerial pingpong	0.
	syl	aer+i:al ping+pong
	pos	n.
	qual	Austral., facetious.
	def	Australian Rules football.
aerie	0.
	syl	aer:ie
	pron	<1e*ri>, <1i*ri>
	pos	n.
	def	a variant spelling (esp. U.S.) of {eyrie}.
aeriform	1.
	syl	aer:i+form
	pron	<1e*ri2fc:m>
	pos	adj.
	def	having the form of air; gaseous.
aeriform	2.
	syl	aer:i+form
	pron	<1e*ri2fc:m>
	pos	adj.
	def	unsubstantial.
aerifies	infl
	head	aerify
	syl	aer:i+fies
	pos	vb.
aerifying	infl
	head	aerify
	syl	aer:i+fy+ing
	pos	vb.
aerified	infl
	head	aerify
	syl	aer:i+fied.
	pos	vb.
aerify	1.
	syl	aer:i+fy
	pron	<1e*ri2fI>
	pos	vb.
	def	to change or cause to change into a gas.
aerify	2.
	syl	aer:i+fy
	pron	<1e*ri2fI>
	pos	vb.
	def	to mix or combine with air.
aerification	sub
	head	aerify
	syl	aer:i+fi+1ca+tion
	pos	n.
aero	0.
	syl	aer:o
	pron	<1e*r*u>
	pos	n.
	usage	modifier
	def	of or relating to aircraft or aeronautics.
	exam	1	an aero engine.
aero-	ety	ultimately from Greek a*_er air
aeri-	infl
	head	aero-
	syl	aer:i-
aero-	1.
	syl	aer:o-
	usage	before a vowel
	def	denoting air, atmosphere, or gas.
	exam	1	aerodynamics.
aero-	2.
	syl	aer:o-
	usage	before a vowel
	def	denoting aircraft.
	exam	1	aeronautics.
aeroballistics	0.
	syl	aer:o+bal+lis+tics
	pron	<2e*r*ub*1listiks>
	pos	n.
	mod	pl.
	def	the ballistics of projectiles dropped, launched, or fired from aircraft.
aerobatics	ety	C20: from #7aero -#7+ (#7acro) #7batics 
aerobatics	0.
	syl	aer:o+bat+ics
	pron	<2e*r*u1b@tiks>
	pos	n.
	mod	pl.
	def	spectacular or dangerous manoeuvres, such as loops or rolls, performed in an aircraft or glider; stunt flying.
aerobe	ety	C19: from #7aero -#7+ Greek bios life. Compare #7microbe 
aerobium	alt
	head	aerobe
	or	aerobe
	syl	aer:o+bi:um
	pron	<e*1r*ubi*m>
	pos	n.
aerobes	infl
	head	aerobe
	or	aerobia
	syl	aer+obes
	pron	<-1*ubi*>
	pos	n.
	mod	pl.
aerobia	infl
	head	aerobe
	or	aerobes
	syl	aer+o+bi:a
	pron	<-1*ubi*>
	pos	n.
	mod	pl.
aerobe	0.
	or	aerobium
	syl	aer+obe
	pron	<1e*r*ub>
	pos	n.
	def	an organism that requires free oxygen or air for respiration. Compare {anaerobe}.
aerobic	1.
	syl	aer:o+bic
	pron	<e*1r*ubik>
	pos	adj.
	usage	of an organism or process
	def	de?!pending on free oxygen or air.
aerobic	2.
	syl	aer:o+bic
	pron	<e*1r*ubik>
	pos	adj.
	def	of or relating to aerobes.
aerobic	xref
	syl	aer:o+bic
	pron	<e*1r*ubik>
	pos	adj.
	def	Compare {anaerobic}.
aerobiology	0.
	syl	aer:o+bi+ol+o:gy
	pron	<2e*r*ubI1oliJi>
	pos	n.
	def	the study of airborne microorganisms, spores, etc., esp. those causing disease. &- {@!aer@.o+bi@.o+#!log@.i+cal}
aerobiologically	sub
	head	aerobiology
	syl	aer:o+bi:o+1log:i+cal+ly
	pos	adv.
aerobiologist	sub
	head	aerobiology
	syl	aer:o+bi+1ol:o+gist
	pos	n.
aerobiosis	0.
	syl	aer:o+bi:o+sis
	pron	<2e*r*ubI1*usis>
	pos	n.
	def	life in the presence of free oxygen. &- {aer@.o+bi@.o+tic} (@!$e$$r$$$uba$I#!$At$Ik)
aerodonetics	ety	C20: from Greek aerodonetos tossed in the air, from #7aero -#7+ don*_etos, past participle of donein to toss
aerodonetics	0.
	syl	aer:o+do+net+ics
	pron	<2e*r*ud*1netiks>
	pos	n.
	mod	functioning as; sing.
	def	the study of soaring or gliding flight, esp. the study of gliders.
airdrome	alt
	head	aerodrome
	or	aerodrome
	syl	air+drome
	pron	<1e*2dr*um>
	pos	n.
	qual	U.S.
aerodrome	0.
	or	airdrome
	syl	aer:o+drome
	pron	<1e*r*2dr*um>
	pos	n.
	qual	Brit.
	def	a landing area, esp. for private aircraft, that is usually smaller than an airport.
aerodynamics	0.
	syl	aer:o+dy+nam+ics
	pron	<2e*r*udI1n@miks>
	pos	n.
	mod	functioning as; sing.
	def	the study of the dynamics of gases, esp. of the forces acting on a body passing through air. Compare {{aerostatics} (sense 1).}
aerodynamic	sub
	head	aerodynamics
	syl	aer:o+dy+1nam+ic
	pos	adj.
aerodynamically	sub
	head	aerodynamics
	syl	aer:o+dy+1nam:i+cal+ly
	pos	adv.
aerodyne	ety	C20: back formation from #7aerodynamic ; see #7dyne 
aerodyne	0.
	syl	aer:o+dyne
	pron	<1e*r*u2dIn>
	pos	n.
	def	any heavier-than-air machine, such as an aircraft, that derives the greater part of its lift from aerodynamic forces.
aeroembolism	0.
	syl	aer:o+em+bo+lism
	pron	<2e*r*u1emb*2liz*m>
	pos	n.
	def	the presence in the tissues and blood of nitrogen bubbles, caused by an abrupt and substantial reduction in atmospheric pressure. See {decompression sickness}.
aero engine	0.
	syl	aer:o en:gine
	pos	n.
	def	an engine for powering an aircraft.
airfoil	alt
	head	aerofoil
	or	aerofoil
	syl	air+foil
	pron	<1e*2fcil>
	pos	n.
	qual	U.S.
aerofoil	0.
	or	airfoil
	syl	aer:o+foil
	pron	<1e*r*u2fcil>
	pos	n.
	qual	Brit.
	def	a surface, such as an aileron, wing, or tailplane, that is designed to produce lift or to control an aircraft in flight.
aerogel	0.
	syl	aer:o+gel
	pron	<1e*r*2Jel>
	pos	n.
	def	a colloid that has a continuous solid phase containing dispersed gas.
aerogramme	alt
	head	aerogram
	or	aerogram
	syl	aer:o+gramme
	pron	<1e*r*2gr@m>
	pos	n.
aerogram	1.
	or	aerogramme
	syl	aer:o+gram
	pron	<1e*r*2gr@m>
	pos	n.
	def	Also called: {air letter}. an air-mail letter written on a single sheet of lightweight paper that folds and is sealed to form an envelope.
aerogram	2.
	or	aerogramme
	syl	aer:o+gram
	pron	<1e*r*2gr@m>
	pos	n.
	def	another name for {radiotelegram}.
aerography	0.
	syl	aer+og+ra+phy
	pron	<e*1rogr*fi>
	pos	n.
	def	the description of the character of the atmosphere.
aerolite	0.
	syl	aer:o+lite
	pron	<1e*r*2lIt>
	pos	n.
	def	a stony meteorite consisting of silicate minerals.
aerology	0.
	syl	aer+ol+o:gy
	pron	<e*1rol*Ji>
	pos	n.
	def	the study of the atmosphere, including its upper layers.
aerologic	sub
	head	aerology
	or	aerological
	syl	aer:o+lo+gic
	pron	<2e*r*1loJik>
	pos	adj.
aerological	sub
	head	aerology
	or	aerologic
	syl	aer:o+1log:i+cal
	pos	adj.
aerologist	sub
	head	aerology
	syl	aer+1ol:o+gist
	pos	n.
aeromechanic	1.
	syl	aer:o+me:chan+ic
	pron	<2e*r*umi1k@nik>
	pos	n.
	def	an aircraft mechanic.
aeromechanic	2.
	syl	aer:o+me:chan+ic
	pron	<2e*r*umi1k@nik>
	pos	adj.
	def	of or relating to aeromechanics.
aeromechanics	0.
	syl	aer:o+me:chan+ics
	pron	<2e*r*umi1k@niks>
	pos	n.
	mod	functioning as; sing.
	def	the mechanics of gases, esp. air.
aeromechanical	sub
	head	aeromechanics
	syl	aer:o+me:1chan:i+cal
	pos	adj.
aerometeorograph	0.
	syl	aer:o+me:te+or:o+graph
	pron	<2e*r*u1mEti*r*2gra:f>, <-2gr@f>
	pos	n.
	qual	Chiefly U.S.
	def	an aircraft instrument that records temperature, humidity, and atmospheric pressure.
aerometer	0.
	syl	aer+om+e:ter
	pron	<e*1romit*>
	pos	n.
	def	an instrument for determining the mass or density of a gas, esp. air.
aerometric	sub
	head	aerometer
	syl	aer:o+met+ric
	pron	<2e*r*?!1metrik>
	pos	adj.
aerometry	0.
	syl	aer+om+e:try
	pron	<e*1romitri>
	pos	n.
	def	another name for {pneumatics}.
aeron	1.
	syl	aeron.
	qual	abbrev. for:
	def	aeronautics.
aeron	2.
	syl	aeron.
	qual	abbrev. for:
	def	aeronautical.
aeronaut	0.
	syl	aer:o+naut
	pron	<1e*r*2nc:t>
	pos	n.
	def	a person who flies in a lighter-than-air craft, esp. the pilot or navigator.
aeronautical	0.
	syl	aer:o+nau+ti+cal
	pron	<2e*r*1nc:tikL>
	pos	adj.
	def	of or relating to aeronauts or aeronautics.
aeronautically	sub
	head	aeronautical
	syl	aer:o+1nau+ti+cal+ly
	pos	adv.
aeronautical engineering	0.
	syl	aer:o+nau+ti+cal en+gi+neer+ing
	pos	n.
	def	the branch of engineering concerned with the design, production, and maintenance of aircraft.
aeronautical engineer	sub
	head	aeronautical engineering
	syl	aer:o+nau+ti+cal en+gi+neer
	pos	n.
aeronautics	0.
	syl	aer:o+naut+ics
	pron	<2e*r*1nc:tiks>
	pos	n.
	mod	functioning as; sing.
	def	the study or practice of all aspects of flight through the air.
aeroneurosis	0.
	syl	aer:o+neu+ro+sis
	pron	<2e*r*unju1r*usis>
	pos	n.
	def	a functional disorder of aeroplane pilots characterized by anxiety and various psychosomatic disturbances, caused by insufficient oxygen at high altitudes and the emotional tension of flying.
aeropause	0.
	syl	aer:o+pause
	pron	<1e*r*2pc:z>
	pos	n.
	def	the region of the upper atmosphere above which aircraft cannot fly.
aerophagia	0.
	syl	aer:o+pha+gi:a
	pron	<2e*r*1fAJi*>, <-J*>
	pos	n.
	def	spasmodic swallowing of air, sometimes occurring in hysteria.
aerophobia	0.
	syl	aer:o+pho+bi:a
	pron	<2e*r*1f*ubi*>
	pos	n.
	def	an abnormal fear of draughts of air.
aerophobic	sub
	head	aerophobia
	syl	aer:o+1pho+bic
	pos	adj.
aerophyte	0.
	syl	aer:o+phyte
	pron	<1e*r*2fIt>
	pos	n.
	def	another name for {epiphyte}.
aeroplane	ety	C19: from French a*'eroplane, from #7aero -#7+ Greek -planos wandering, related to #7planet 
airplane	alt
	head	aeroplane
	or	aeroplane
	syl	air+plane
	pron	<1e*2plAn>
	pos	n.
	qual	U.S.
aeroplane	0.
	or	airplane
	syl	aer:o+plane
	pron	<1e*r*2plAn>
	pos	n.
	qual	Brit.
	def	a heavier-than-air powered flying vehicle with fixed wings.
fabric	alt
	head	aeroplane cloth
	or	aeroplane cloth
	syl	fab+ric
	pos	n.
aeroplane cloth	1.
	or	fabric
	syl	aer:o+plane cloth
	pos	n.
	def	a strong fabric made from cotton, linen, and nylon yarns, used for some light aircraft fuselages and wings.
aeroplane cloth	2.
	or	fabric
	syl	aer:o+plane cloth
	pos	n.
	def	a similar lightweight fabric used for clothing.
aeroplane cloth	xref
	or	fabric
	syl	aer:o+plane cloth
	pos	n.
	def	Also called: {aircraft fabric}.
aeroplane spin	0.
	syl	aer:o+plane spin
	pos	n.
	def	a wrestling attack in which a wrestler lifts his opponent onto his shoulders and spins around, leaving the opponent dizzy.
aerosol	ety	C20: from #7aero -#7+sol (#7ution) 
aerosol	1.
	syl	aer:o+sol
	pron	<1e*r*2sol>
	pos	n.
	def	a colloidal dispersion of solid or liquid particles in a gas; smoke or fog.
aerosol	2.
	syl	aer:o+sol
	pron	<1e*r*2sol>
	pos	n.
	def	a substance, such as a paint, polish, or insecticide, dispensed from a small metal container by a propellant under pressure.
aerosol	3.
	syl	aer:o+sol
	pron	<1e*r*2sol>
	pos	n.
	def	Also called: {air spray}. such a substance together with its container.
aerospace	1.
	syl	aer:o+space
	pron	<1e*r*2spAs>
	pos	n.
	def	the atmosphere and space beyond.
aerospace	2.
	syl	aer:o+space
	pron	<1e*r*2spAs>
	pos	n.
	usage	modifier
	def	of or relating to rockets, missiles, space vehicles, etc., that fly or operate in aerospace.
	exam	1	the aerospace industry.
aerosphere	0.
	syl	aer:o+sphere
	pron	<1e*r*2sfi*>
	pos	n.
	def	the entire atmosphere surrounding the earth.
aerostat	ety	C18: from French a*'erostat, from #7aero -#7+ Greek -statos standing
aerostat	0.
	syl	aer:o+stat
	pron	<1e*r*2st@t>
	pos	n.
	def	a lighter-than-air craft, such as a balloon.
aerostatic	sub
	head	aerostat
	or	aerostatical
	syl	aer:o+1stat+ic
	pos	adj.
aerostatical	sub
	head	aerostat
	or	aerostatic
	syl	aer:o+1stat:i+cal
	pos	adj.
aerostatics	1.
	syl	aer:o+stat+ics
	pron	<2e*r*1st@tiks>
	pos	n.
	mod	functioning as; sing.
	def	the study of gases in equilibrium and bodies held in equilibrium in gases. Compare {aerodynamics}.
aerostatics	2.
	syl	aer:o+stat+ics
	pron	<2e*r*1st@tiks>
	pos	n.
	mod	functioning as; sing.
	def	the study of lighter-than-air craft, such as balloons.
aerostation	0.
	syl	aer:o+sta+tion
	pron	<1e*r*2stAS*n>
	pos	n.
	def	the science of operating lighter-than-air craft.
aerothermodynamics	0.
	syl	aer:o+ther+mo+dy+nam+ics
	pron	<2e*r*u2TR:m*udI1n@miks>
	pos	n.
	mod	functioning as; sing.
	def	the study of the exchange of heat be?!tween solids and gases, esp. of the heating effect on aircraft flying through the air at very high speeds.
aerothermodynamic	sub
	head	aerothermodynamics
	syl	aer:o+2ther+mo+dy+1nam+ic
	pos	adj.
aerugo	ety	C18: from Latin, from aes copper, bronze
aerugo	0.
	syl	ae:ru+go
	pron	<i1ru:g*u>
	pos	n.
	usage	esp. of old bronze
	def	another name for {verdigris}.
aeruginous	sub
	head	aerugo
	syl	ae:ru+gin+ous
	pron	<i1ru:Jin*s>
	pos	adj.
aery	ety	C16: via Latin from Greek a*_erios, from a*_er #7air 
aery	H1.1.
	syl	aer:y
	pron	<1e*ri>, <1A*ri>
	pos	adj.
	qual	Poetic.
	def	a variant spelling of {airy}.
aery	H1.2.
	syl	aer:y
	pron	<1e*ri>, <1A*ri>
	pos	adj.
	qual	Poetic.
	def	lofty, insubstantial, or visionary.
aeries	infl
	head	aery
	syl	aer:ies.
	pos	n.
	mod	pl.
aery	H2.0.
	syl	aer:y
	pron	<1e*ri>, <1i*ri>
	pos	n.
	def	a variant spelling of {eyrie}.
Aeschines	0.
	syl	Aes:chi:nes
	pron	<1Esk*2nEz>
	pos	n.
	def	??389-??314 #7b.c., Athenian orator; the main political opponent of Demosthenes.
Aeschylus	0.
	syl	Aes:chy:lus
	pron	<1Esk*l*s>
	pos	n.
	def	??525-??456 #7b.c., Greek dramatist, regarded as the father of Greek tragedy. Seven of his plays are extant, including and the trilogy of the
Aesculapian	0.
	syl	Aes+cu+la+pi:an
	pron	<2Eskju1lApi*n>
	pos	adj.
	def	of or relating to Aesculapius or to the art of medicine.
Aesculapius	0.
	syl	Aes:cu:la:pi:us
	pron	<2Eskju1lApi*s>
	pos	n.
	def	the Roman god of medicine or healing. Greek counterpart: {Asclepius}.
Aesir	ety	Old Norse, literally: gods
Aesir	0.
	syl	Ae:sir
	pron	<1Asi*>
	pos	n.
	def	the chief gods of Norse mythology dwelling in Asgard.
Aesop	0.
	syl	Ae:sop
	pron	<1Esop>
	pos	n.
	def	??620-564 #7b.c. Greek author of fables in which animals are given human characters and used to satirize human failings.
Aesopian	sub
	head	Aesop
	or	Aesopic
	syl	Ae:1sop+i:an
	pos	adj.
Aesopic	sub
	head	Aesop
	or	Aesopian
	syl	Ae:1sop+ic
	pos	adj.
aesthesia	ety	C20: back formation from #7anaesthesia 
aesthesia	alt
	or	aesthesia
	syl	aes+the+si:a
	pron	<Es1TEzi*>
	pos	n.
	qual	U.S.
aesthesia	0.
	or	aesthesia
	syl	aes+the+si:a
	pron	<Es1TEzi*>
	pos	n.
	def	the normal ability to experience sensation, perception, or sensitivity.
aesthete	ety	C19: back formation from #7aesthetics 
aesthete	alt
	or	aesthete
	syl	aes+thete
	pron	<1EsTEt>
	pos	n.
	qual	U.S.
aesthete	0.
	or	aesthete
	syl	aes+thete
	pron	<1EsTEt>
	pos	n.
	def	a person who has or who affects a highly developed appreciation of beauty, esp. in poetry and the visual arts.
aesthetical	infl
	head	aesthetic
	or	aesthetic
	syl	aes+thet:i+cal
	pos	adj.
aesthetic	infl
	or	aesthetical
	syl	aes+thet+ic
	pos	adj.
	qual	U.S. (sometimes
aesthetical	infl
	head	aesthetic
	syl	aes+thet:i+cal
	pos	adj.
	qual	U.S. (sometimes
aesthetic	1.
	syl	aes+thet+ic
	pron	<Es1Tetik>, <is->
	pos	adj.
	def	connected with aesthetics or its principles.
aesthetic	2.a.
	syl	aes+thet+ic
	pron	<Es1Tetik>, <is->
	pos	adj.
	def	relating to pure beauty rather than to other considerations.
aesthetic	2.b.
	syl	aes+thet+ic
	pron	<Es1Tetik>, <is->
	pos	adj.
	def	artistic or relating to good taste.
	exam	1	an aesthetic consideration.
aesthetically	sub
	head	aesthetic
	or	aesthetically
	syl	aes+1thet:i+cal+ly
	pos	adv.
aesthetically	sub
	head	aesthetic
	or	aesthetically
	syl	aes+1thet:i+cal+ly
	pos	adv.
	qual	U.S. (sometimes
aesthetician	alt
	or	aesthetician
	syl	aes+the+ti+cian
	pron	<2EsTi1tiS*n>, <2es->
	pos	n.
	qual	U.S. (sometimes
aesthetician	0.
	or	aesthetician
	syl	aes+the+ti+cian
	pron	<2EsTi1tiS*n>, <2es->
	pos	n.
	def	a student of aesthetics.
aestheticism	alt
	or	aestheticism
	syl	aes+thet:i+cism
	pron	<Es1Teti?!2siz*m>, <is->
	pos	n.
	qual	U.S. (sometimes
aestheticism	1.
	or	aestheticism
	syl	aes+thet:i+cism
	pron	<Es1Teti?!2siz*m>, <is->
	pos	n.
	def	the doctrine that aesthetic principles are of supreme importance and that works of art should be judged accordingly.
aestheticism	2.
	or	aestheticism
	syl	aes+thet:i+cism
	pron	<Es1Teti?!2siz*m>, <is->
	pos	n.
	def	sensitivity to beauty, esp. in art, music, literature, etc.
aesthetics	alt
	or	aesthetics
	syl	aes+thet+ics
	pron	<Es1Tetiks>, <is->
	pos	n.
	mod	functioning as; sing.
	qual	U.S. (sometimes
aesthetics	1.
	or	aesthetics
	syl	aes+thet+ics
	pron	<Es1Tetiks>, <is->
	pos	n.
	mod	functioning as; sing.
	def	the branch of philosophy concerned with the study of such concepts as beauty, taste, etc.
aesthetics	2.
	or	aesthetics
	syl	aes+thet+ics
	pron	<Es1Tetiks>, <is->
	pos	n.
	mod	functioning as; sing.
	def	the study of the rules and principles of art.
aestival	ety	C14: from French, from Late Latin aest*_iv*_alis, from Latin aest*_as summer
aestival	alt
	or	aestival
	syl	aes+ti+val
	pron	<E1stIvL>, <1esti->
	pos	adj.
	qual	U.S.
aestival	0.
	or	aestival
	syl	aes+ti+val
	pron	<E1stIvL>, <1esti->
	pos	adj.
	qual	Rare.
	def	of or occurring in summer.
aestivate	ety	C17: from Latin aest*_iv*_atus, from aest*_iv*_are to stay during the summer, from aest*_as summer
aestivate	alt
	or	aestivate
	syl	aes+ti+vate
	pron	<1Esti2vAt>, <1es->
	pos	vb.
	mod	intr.
	qual	U.S.
aestivate	1.
	or	aestivate
	syl	aes+ti+vate
	pron	<1Esti2vAt>, <1es->
	pos	vb.
	mod	intr.
	def	to pass the summer.
aestivate	2.
	or	aestivate
	syl	aes+ti+vate
	pron	<1Esti2vAt>, <1es->
	pos	vb.
	mod	intr.
	usage	of animals such as the lungfish
	def	to pass the summer or dry season in a dormant condition. Compare {hibernate}.
aestivator	sub
	head	aestivate
	or	aestivator
	syl	aes+ti+2va+tor
	pos	n.
aestivator	sub
	head	aestivate
	or	aestivator
	syl	aes+ti+2va+tor
	pos	n.
	qual	U.S.
aestivation	alt
	or	aestivation
	syl	aes+ti+va+tion
	pron	<2Esti1vAS*n>, <2es->
	pos	n.
	qual	U.S.
aestivation	1.
	or	aestivation
	syl	aes+ti+va+tion
	pron	<2Esti1vAS*n>, <2es->
	pos	n.
	def	the act or condition of aestivating.
aestivation	2.
	or	aestivation
	syl	aes+ti+va+tion
	pron	<2Esti1vAS*n>, <2es->
	pos	n.
	def	the arrangement of the parts of a flower bud, esp. the sepals and petals.
aet	ety	Latin: at the age of
aetat	alt
	head	aet
	or	aet
	syl	aetat.
aet	0.
	or	aetat
	syl	aet.
	qual	abbrev. for
	def	aetatis.
aether	0.
	syl	ae:ther
	pron	<1ET*>
	pos	n.
	def	a variant spelling of {ether} (senses 3-5).
aethereal	0.
	syl	ae:the+re:al
	pron	<i1Ti*ri*l>
	pos	n.
	def	a variant spelling of { {ethereal} (senses 1, 2, 3).}
aethereality	sub
	head	aethereal
	syl	ae:the+re:al+i:ty
	pron	<i2Ti*ri1@liti>
	pos	n.
aethereally	sub
	head	aethereal
	syl	ae:1the+re:al+ly
	pos	adv.
aetiology	ety	C16: from Late Latin aetiologia, from Greek aitiologia, from aitia cause
aetiology	alt
	or	aetiology
	syl	ae:ti+ol+o:gy
	pron	<2Eti1ol*Ji>
	pos	n.
	qual	U.S.
aetiologies	infl
	head	aetiology
	syl	ae:ti+ol+o:gies.
	pos	n.
	mod	pl.
aetiology	1.
	or	aetiology
	syl	ae:ti+ol+o:gy
	pron	<2Eti1ol*Ji>
	pos	n.
	def	the philosophy or study of causation.
aetiology	2.
	or	aetiology
	syl	ae:ti+ol+o:gy
	pron	<2Eti1ol*Ji>
	pos	n.
	def	the study of the causes of diseases.
aetiology	3.
	or	aetiology
	syl	ae:ti+ol+o:gy
	pron	<2Eti1ol*Ji>
	pos	n.
	def	the cause of a disease.
aetiological	sub
	head	aetiology
	or	aetiological
	syl	ae:ti:o+log:i+cal
	pron	<2Eti*1loJikL>
	pos	adj.
aetiological	sub
	head	aetiology
	or	aetiological
	syl	ae:ti:o+log:i+cal
	pron	<2Eti*1loJikL>
	pos	adj.
	qual	U.S.
aetiologically	sub
	head	aetiology
	or	aetiologically
	syl	ae:ti:o+1log:i+cal+ly
	pos	adv.
aetiologically	sub
	head	aetiology
	or	aetiologically
	syl	ae:ti:o+1log:i+cal+ly
	pos	adv.
	qual	U.S.
aetiologist	sub
	head	aetiology
	or	aetiologist
	syl	ae:ti+1ol:o+gist
	pos	n.
aetiologist	sub
	head	aetiology
	or	aetiologist
	syl	ae:ti+1ol:o+gist
	pos	n.
	qual	U.S.
Aetna	0.
	syl	Aet+na
	pron	<1etn*>
	pos	n.
	def	the Latin name for Mount {Etna}.
Aetolia	0.
	syl	Ae:to+li:a
	pron	<E1t*uli*>
	pos	n.
	def	a mountainous region forming a department of W central Greece, north of the Gulf of Patras: a powerful federal state in the 3rd century #7b.c. Chief city: Missolonghi. Pop. (with Acarnania): 228719 (1971). Area: 5390 sq. km. (2081 sq. miles).
AEU	0.
	syl	A.E.U.
	qual	abbrev. for
	usage	in Britain
	def	Amalgamated Engineering Union.
Af	0.
	syl	Af.
	qual	abbrev. for
	def	Africa(n).
af	0.
	syl	a.f.
	qual	abbrev. for
	def	audio frequency.
AF	0.
	syl	A.F.
	qual	abbrev. for
	def	Anglo-French.
AF	0.
	syl	A/F
	qual	abbrev. for
	usage	in auction catalogues, etc.
	def	as found.
AFAM	0.
	syl	A.F.A.M.
	qual	abbrev. for
	def	Ancient Free and Accepted Masons.
afar	ety	C14 a fer, altered from earlier on fer and of fer; see #7a -%2#7, far 
afar	1.
	syl	a:far
	pron	<*1fa:>
	pos	adv.
	def	at, from, or to a great distance.
afar	2.
	syl	a:far
	pron	<*1fa:>
	pos	n.
	def	a great distance (esp. in the phrase {from afar) }.
Territory of the	infl
	head	Afars and the Issas
	syl	Territory of the.
	pos	n.
Afars and the Issas	0.
	syl	A:fars and the Is+sas
	pron	<1a:fa:z>, <1Esa:s>
	pos	n.
	def	a former French territory in E Africa (1946-77), now the independent republic of Djibouti. Former name (until 1967): {French Somaliland}.
AFB	0.
	syl	AFB
	usage	abbrev. for U.S.
	def	Air Force Base.
AFC	1.
	syl	A.F.C.
	qual	abbrev. for:
	def	Air Force Cross.
AFC	2.
	syl	A.F.C.
	qual	abbrev. for:
	def	Association Football Club.
AFC	3.
	syl	A.F.C.
	qual	abbrev. for:
	def	automatic flight control.
AFC	4.
	syl	A.F.C.
	qual	abbrev. for:
	def	automatic frequency control.
afeard	ety	Old English *_af*_@ared, from af*_@aran to frighten, from f*_@aran to #7fear 
afeared	alt
	head	afeard
	or	afeard
	syl	a:feared
	pron	<*1fi*d>
	pos	adj.
afeard	0.
	or	afeared
	syl	a:feard
	pron	<*1fi*d>
	pos	adj.
	usage	postpositive
	def	an archaic or dialect word for {afraid}.
afebrile	0.
	syl	a:fe:brile
	pron	<@1fEbrIl>, <A->
	pos	adj.
	def	without fever.
affable	ety	C16: from Latin aff*_abilis easy to talk to, from aff*_ar*_i to talk to, from ad- to+ f*_ari to speak; compare #7fable, fate 
affable	1.
	syl	af+fa:ble
	pron	<1@f*bL>
	pos	adj.
	def	showing warmth and friendliness; kindly; mild; benign.
affable	2.
	syl	af+fa:ble
	pron	<1@f*bL>
	pos	adj.
	def	easy to converse with; approachable; amicable.
affability	sub
	head	affable
	syl	af+fa:1bil+i:ty
	pos	n.
affair	ety	C13: from Old French, from *`a faire to do
affair	1.
	syl	af+fair
	pron	<*1fe*>
	pos	n.
	def	a thing to be done or attended to; matter; business.
	exam	1	this affair must be cleared up.
affair	2.
	syl	af+fair
	pron	<*1fe*>
	pos	n.
	def	an event or happening.
	exam	1	a strange affair.
affair	3.
	syl	af+fair
	pron	<*1fe*>
	pos	n.
	usage	descriptive phrase
	def	something previously specified, esp. a man-made object; thing.
	exam	1	our house is a tumbledown affair.
affair	4.
	syl	af+fair
	pron	<*1fe*>
	pos	n.
	def	a sexual relationship between two people who are not married to each other.
affaire	0.
	syl	af+faire
	pron	French. <a1fe:r>
	pos	n.
	def	a love affair.
affaires d'honneur	infl
	head	affaire d'honneur
	syl	af+faires d'hon+neur
	pron	<afer> <dc1n@o:r>
	pos	n.
	mod	pl.
affaire d'honneur	0.
	syl	af+faire d'hon+neur
	pron	French. <afer> <dc1n@o:r>
	pos	n.
	def	a duel.
affairs	1.
	syl	af+fairs
	pron	<*1fe*z>
	pos	n.
	mod	pl.
	def	personal or business interests.
	exam	1	his affairs were in disorder.
affairs	2.
	syl	af+fairs
	pron	<*1fe*z>
	pos	n.
	mod	pl.
	def	matters of public interest.
	exam	1	current affairs.
affect	ety	C17: from Latin affectus, past participle of afficere to act upon, from ad- to+ facere to do
affect	H1.1.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	tr.
	def	to act upon or influence, esp. in an adverse way.
	exam	1	damp affected the sparking plugs.
affect	H1.2.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	tr.
	def	to move or disturb emotionally or mentally.
	exam	1	her death affected him greatly.
affect	H1.3.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	tr.
	usage	of pain, disease, etc.
	def	to attack.
affect	H1.4.
	syl	af+fect
	pron	<1@fekt>, <*1fekt>
	pos	n.
	mod	tr.
	qual	Psychol.
	def	the emotion associated with an idea or set of ideas. See also {affection}.
affect	ety	C15: from Latin affect*_are to strive after, pretend to have; related to afficere to #7affect %1
affect	H2.1.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	mainly; tr.
	def	to put on an appearance or show of; make a pretence of.
	exam	1	to affect ignorance.
affect	H2.2.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	mainly; tr.
	def	to imitate or assume, esp. pretentiously.
	exam	1	to affect an accent.
affect	H2.3.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	mainly; tr.
	def	to have or use by preference.
	exam	1	she always affects funereal clothing.
affect	H2.4.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	mainly; tr.
	def	to adopt the character, manner, etc., of.
	exam	1	he was always affecting the politician.
affect	H2.5.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	mainly; tr.
	usage	of plants or animals
	def	to live or grow in.
	exam	1	penguins affect an arctic climate.
affect	H2.6.
	syl	af+fect
	pron	<*1fekt>
	pos	vb.
	mod	mainly; tr.
	def	to incline naturally or habitually towards.
	exam	1	falling drops of liquid affect roundness.
affectation	ety	C16: from Latin affect*_ati*_on- an aiming at, striving after, from affect*_are; see #7affect %2
affectation	1.
	syl	af+fec+ta+tion
	pron	<2@fek1tAS*n>
	pos	n.
	def	an assumed manner of speech, dress, or behaviour, esp. one that is intended to impress others.
affectation	2.
	syl	af+fec+ta+tion
	pron	<2@fek1tAS*n>
	pos	n.
	usage	often foll. by of
	def	deliberate pretence or false display.
	exam	1	affectation of nobility.
affected	ety	C17: from #7af?!fect %1#7+ -#7ed %2
affected	H1.1.
	syl	af+fect+ed
	pron	<*1fektid>
	pos	adj.
	usage	usually postpositive
	def	deeply moved, esp. by sorrow or grief.
	exam	1	he was greatly affected by her departure.
affected	H1.2.
	syl	af+fect+ed
	pron	<*1fektid>
	pos	adj.
	usage	usually postpositive
	def	changed, esp. detrimentally.
affected	ety	C16: from #7affect %2#7+ -#7ed %2
affected	H2.1.
	syl	af+fect+ed
	pron	<*1fektid>
	pos	adj.
	def	behaving, speaking, etc., in an artificial or assumed way, esp. in order to impress others.
affected	H2.2.
	syl	af+fect+ed
	pron	<*1fektid>
	pos	adj.
	def	feigned.
	exam	1	affected indifference.
affected	H2.3.
	syl	af+fect+ed
	pron	<*1fektid>
	pos	adj.
	qual	Archaic.
	def	inclined; disposed.
affectedly	sub
	head	affected
	syl	af+1fect+ed+ly
	pos	adv.
affectedness	sub
	head	affected
	syl	af+1fect+ed+ness
	pos	n.
affecting	0.
	syl	af+fect+ing
	pron	<*1fektiG>
	pos	adj.
	def	evoking feelings of pity, sympathy, or pathos; moving.
affectingly	sub
	head	affecting
	syl	af+1fect+ing+ly
	pos	adv.
affection	ety	C13: from Latin affecti*_on- disposition, from afficere to #7affect %1
affection	1.
	syl	af+fec+tion
	pron	<*1fekS*n>
	pos	n.
	def	a feeling of fondness or tenderness for a person or thing; attachment.
affection	2.
	syl	af+fec+tion
	pron	<*1fekS*n>
	pos	n.
	mod	often; pl.
	def	emotion, feeling, or sentiment.
	exam	1	to play on a person's affections.
affection	3.
	syl	af+fec+tion
	pron	<*1fekS*n>
	pos	n.
	qual	Pathol.
	def	any disease or pathological condition.
affection	4.
	syl	af+fec+tion
	pron	<*1fekS*n>
	pos	n.
	qual	Psychol.
	def	any form of mental functioning that involves emotion. See also {affect} %1.
affection	5.
	syl	af+fec+tion
	pron	<*1fekS*n>
	pos	n.
	def	the act of affecting or the state of being affected.
affection	6.
	syl	af+fec+tion
	pron	<*1fekS*n>
	pos	n.
	qual	Archaic.
	def	inclination or disposition.
affectional	sub
	head	affection
	syl	af+1fec+tion+al
	pos	adj.
affectionally	sub
	head	affection
	syl	af+1fec+tion+al+ly
	pos	adv.
affectionate	0.
	syl	af+fec+tion+ate
	pron	<*1fekS*nit>
	pos	adj.
	def	having or displaying tender feelings, affection, or warmth.
	exam	1	an affectionate mother;
	exam	2	an affectionate letter.
affectionately	sub
	head	affectionate
	syl	af+1fec+tion+ate+ly
	pos	adv.
affective	1.
	syl	af+fec+tive
	pron	<*1fektiv>
	pos	n.
	qual	Psychol.
	def	relating to affects.
affective	2.
	syl	af+fec+tive
	pron	<*1fektiv>
	pos	adj.
	def	concerned with or arousing the emotions or affection.
affectivity	sub
	head	affective
	or	affectiveness
	syl	af+fec+tiv+i:ty
	pron	<2@fek1tiviti>
	pos	n.
affectiveness	sub
	head	affective
	or	affectivity
	syl	af+1fec+tive+ness
	pos	n.
affenpinscher	ety	German, literally: monkey-terrier, so called because its face resembles a monkey's
affenpinscher	0.
	syl	af+fen+pin+scher
	pron	<1@f*n2pinS*>
	pos	n.
	def	a small wire-haired breed of dog of European origin, having tufts of hair on the muzzle.
afferent	ety	C19: from Latin afferre to carry to, from ad- to+ ferre to carry
afferent	0.
	syl	af+fer+ent
	pron	<1@f*r*nt>
	pos	adj.
	def	bringing or directing inwards to a part or an organ of the body, esp. towards the brain or spinal cord. Compare {efferent}.
affettuoso	ety	C18: from Italian
affettuoso	0.
	syl	af+fet+tu:o+so
	pron	<@2feCu:1*us*u>
	pos	adj. adv.
	qual	Music.
	def	with feeling.
affiance	ety	C14: via Old French from Medieval Latin aff*_id*_are to trust (oneself) to, from f*_id*_are to trust, from f*_idus faithful
affiance	1.
	syl	af+fi+ance
	pron	<*1fI*ns>
	pos	vb.
	mod	tr.
	def	to bind (a person or oneself) in a promise of marriage; betroth.
affiance	2.
	syl	af+fi+ance
	pron	<*1fI*ns>
	pos	n.
	qual	Archaic.
	def	a solemn pledge, esp. a marriage contract.
affiant	ety	C19: Old French, from affier to trust to, from Medieval Latin aff*_id*_are; see #7affiance 
affiant	0.
	syl	af+fi+ant
	pron	<*1fI*nt>
	pos	n.
	qual	U.S. law.
	def	a person who makes an affidavit.
affiche	ety	C18: from afficher to post
affiche	0.
	syl	af+fiche
	pron	French. <a1fiS>
	pos	n.
	def	a poster or advertisement, esp. one drawn by an artist, as for the opening of an exhibition.
affidavit	ety	C17: from Medieval Latin, literally: he declares on oath, from aff*_idare to trust (oneself) to; see #7affiance 
affidavit	0.
	syl	af+fi+da+vit
	pron	<2@fi1dAvit>
	pos	n.
	qual	Law.
	def	a declaration in writing made upon oath before a person authorized to administer oaths.
affiliate	ety	C18: from Medieval Latin aff*_ili*_atus adopted as a son, from aff*_il*_iare, from Latin filius son
affiliate	1.
	syl	af+fil:i+ate
	pron	<*1fili2At>
	pos	vb.
	mod	tr.
	usage	foll. by to or with
	def	to receive into close connection or association (with a larger body, group, organization, etc.); adopt as a member, branch, etc.
affiliate	2.
	syl	af+fil:i+ate
	pron	<*1fili2At>
	pos	vb.
	usage	foll. by with
	def	to associate (oneself) or be associated, esp. as a subordinate or subsidiary; bring or come into close connection.
	exam	1	he affiliated himself with the Union.
affiliate	3.a.
	syl	af+fil:i+ate
	pron	<*1filiit>, <-2At>
	pos	n.
	def	a person or organization that is affiliated with another.
affiliate	3.b.
	syl	af+fil:i+ate
	pron	<*1filiit>, <-2At>
	pos	n.
	usage	as modifier
	exam	1	an affiliate member.
affiliation	sub
	head	affiliate
	syl	af+2fil:i:1a+tion
	pos	n.
affiliation order	0.
	syl	af+fil:i:a+tion or+der
	pos	n.
	qual	Law.
	def	an order made by a magistrates' court that a man adjudged to be the father of an illegitimate child shall contribute a specified periodic sum towards the child's maintenance.
affiliation proceedings	0.
	syl	af+fil:i:a+tion pro+ceed+ings
	pos	n.
	mod	pl.
	def	legal proceedings, usu?!ally initiated by an unwed mother, claiming legal recognition that a particular man is the father of her child, often associated with a claim for financial support.
affine	ety	C16: via French from Latin aff*_inis bordering on, related
affine	0.
	syl	af+fine
	pron	<1@fIn>
	pos	adj.
	qual	Maths.
	def	of, characterizing, or involving a transformation that has a combination of single transformations, such as translation, rotation, and reflection in an axis.
affined	0.
	syl	af+fined
	pron	<*1fInd>
	pos	adj.
	def	closely related; connected.
affinity	ety	C14: via Old French from Latin aff*_init*_at- connected by marriage, from aff*_inis bordering on, related
affinities	infl
	head	affinity
	syl	af+fin+i:ties.
	pos	n.
	mod	pl.
affinity	1.
	syl	af+fin+i:ty
	pron	<*1finiti>
	pos	n.
	def	a natural liking, taste, or inclination for a person or thing.
affinity	2.
	syl	af+fin+i:ty
	pron	<*1finiti>
	pos	n.
	def	the person or thing so liked.
affinity	3.
	syl	af+fin+i:ty
	pron	<*1finiti>
	pos	n.
	def	a close similarity in appearance or quality; inherent likeness.
affinity	4.
	syl	af+fin+i:ty
	pron	<*1finiti>
	pos	n.
	def	relationship by marriage or by ties other than of blood, as by adoption. Compare {consanguinity}.
affinity	5.
	syl	af+fin+i:ty
	pron	<*1finiti>
	pos	n.
	def	similarity in structure, form, etc., between different animals, plants, or languages.
affinity	6.a.
	syl	af+fin+i:ty
	pron	<*1finiti>
	pos	n.
	def	the force holding atoms together in a molecule; chemical attraction.
affinity	6.b.
	syl	af+fin+i:ty
	pron	<*1finiti>
	pos	n.
	def	a measure of the tendency of a chemical reaction to take place expressed in terms of the free energy change. Symbol.
	exam	1	A
affinitive	sub
	head	affinity
	syl	af+1fin:i+tive
	pos	adj.
affirm	ety	C14: via Old French from Latin affirm*_are to present (something) as firm or fixed, assert, from ad- to+ firm*_are to make #7firm 
affirm	1.
	syl	af+firm
	pron	<*1fR:m>
	pos	vb.
	mod	mainly; tr.
	usage	may take a clause as object
	def	to declare to be true; assert positively.
affirm	2.
	syl	af+firm
	pron	<*1fR:m>
	pos	vb.
	mod	mainly; tr.
	def	to uphold, confirm, or ratify.
affirm	3.
	syl	af+firm
	pron	<*1fR:m>
	pos	vb.
	mod	intr.
	qual	Law.
	def	to make an affirmation.
affirmer	sub
	head	affirm
	or	affirmant
	syl	af+1firm+er
	pos	n.
affirmant	sub
	head	affirm
	or	affirmer
	syl	af+1firm+ant
	pos	n.
affirmation	1.
	syl	af+fir+ma+tion
	pron	<2@f*1mAS*n>
	pos	n.
	def	the act of affirming or the state of being affirmed.
affirmation	2.
	syl	af+fir+ma+tion
	pron	<2@f*1mAS*n>
	pos	n.
	def	a statement of the existence or truth of something; assertion.
affirmation	3.
	syl	af+fir+ma+tion
	pron	<2@f*1mAS*n>
	pos	n.
	qual	Law.
	def	a solemn declaration permitted on grounds of conscientious objection to taking an oath.
affirmative	1.
	syl	af+firm:a+tive
	pron	<*1fR:m*tiv>
	pos	adj.
	def	confirming or asserting something as true or valid.
	exam	1	an affirmative statement.
affirmative	2.
	syl	af+firm:a+tive
	pron	<*1fR:m*tiv>
	pos	adj.
	def	indicating agreement or assent.
	exam	1	an affirmative answer.
affirmative	3.
	syl	af+firm:a+tive
	pron	<*1fR:m*tiv>
	pos	adj.
	usage	Logic. of a proposition
	def	affirming the truth of the predicate, as in the propositions Compare {{negative} (sense 12).}
affirmative	4.
	syl	af+firm:a+tive
	pron	<*1fR:m*tiv>
	pos	n.
	def	a positive assertion.
affirmative	5.
	syl	af+firm:a+tive
	pron	<*1fR:m*tiv>
	pos	n.
	def	a word or phrase stating agreement or assent, such as (esp. in the phrase {answer in the affirmative) }.
affirmative	6.
	syl	af+firm:a+tive
	pron	<*1fR:m*tiv>
	pos	n.
	qual	Logic.
	def	a proposition that affirms the truth of the predicate.
the affirmative	7.
	head	affirmative
	syl	the affirmative.
	qual	Chiefly U.S.
	def	the side in a debate that supports the proposition.
affirmative	8.
	syl	af+firm:a+tive
	pron	<*1fR:m*tiv>
	pos	adj.
	usage	sentence substitute. Military, etc.
	def	a signal codeword used to express assent or confirmation.
affirmatively	sub
	head	affirmative
	syl	af+1firm:a+tive+ly
	pos	adv.
affix	ety	C15: from Medieval Latin affix*_are, from ad- to+ fix*_are to #7fix  &- af+fix@.a+tion (@!@af$Ik#!se$I#s$$n) or
affix	1.
	syl	af+fix
	pron	<*1fiks>
	pos	vb.
	mod	tr.
	usage	usually foll. by to or on
	def	to attach, fasten, join, or stick.
	exam	1	to affix a poster to the wall.
affix	2.
	syl	af+fix
	pron	<*1fiks>
	pos	vb.
	mod	tr.
	usage	usually foll. by to or on
	def	to add or append.
	exam	1	to affix a signature to a document.
affix	3.
	syl	af+fix
	pron	<*1fiks>
	pos	vb.
	mod	tr.
	usage	usually foll. by to or on
	def	to attach or attribute (guilt, blame, etc.).
affix	4.
	syl	af+fix
	pron	<1@fiks>
	pos	n.
	mod	tr.
	usage	usually foll. by to or on
	def	a linguistic element added to a word or root to produce a derived or inflected form.
	exam	1	-ment
affix	5.
	syl	af+fix
	pron	<1@fiks>
	pos	n.
	mod	tr.
	usage	usually foll. by to or on
	def	something fastened or attached; appendage.
affixture	sub
	head	affix
	syl	af+fix+ture
	pron	<*1fiksC*>
	pos	n.
afflatus	ety	C17: Latin, from affl*_atus, from affl*_are to breathe or blow on, from fl*_are to blow
afflatus	0.
	syl	af+fla+tus
	pron	<*1flAt*s>
	pos	n.
	def	an impulse of creative power or inspiration, esp. in poetry, considered to be of divine origin (esp. in the phrase {divine afflatus) }.
afflict	ety	C14: from Latin afflictus, past participle of affl*_igere to knock against, from fl*_igere to knock, to strike
afflict	0.
	syl	af+flict
	pron	<*1flikt>
	pos	vb.
	mod	tr.
	def	to cause suffering or unhappiness to; distress greatly.
afflictive	sub
	head	afflict
	syl	af+1flic+tive
	pos	adj.
affliction	1.
	syl	af+flic+tion
	pron	<*1flikS*n>
	pos	n.
	def	a condition of great distress, pain, or suffering.
affliction	2.
	syl	af+flic+tion
	pron	<*1flikS*n>
	pos	n.
	def	something responsible for physical or mental suffering, such as a disease, grief, etc.
affluence	1.
	syl	af+flu+ence
	pron	<1@flu*ns>
	pos	n.
	def	an abundant supply of money, goods, or property; wealth.
affluence	2.
	syl	af+flu+ence
	pron	<1@flu*ns>
	pos	n.
	qual	Rare.
	def	abundance or profusion.
affluent	ety	C15: from Latin affluent-, present participle of affluere to flow towards, from fluere to flow
affluent	1.
	syl	af+flu+ent
	pron	<1@flu*nt>
	pos	adj.
	def	rich; wealthy.
affluent	2.
	syl	af+flu+ent
	pron	<1@flu*nt>
	pos	adj.
	def	abundant; copious.
affluent	3.
	syl	af+flu+ent
	pron	<1@flu*nt>
	pos	adj.
	def	flowing freely. {~}
affluent	4.
	syl	af+flu+ent
	pron	<1@flu*nt>
	pos	adj.
	def	a tributary stream.
afflux	ety	C17: from Latin affluxus, from fluxus #7flux 
afflux	0.
	syl	af+flux
	pron	<1@fl^ks>
	pos	n.
	def	a flowing towards a point.
	exam	1	an afflux of blood to the head.
afford	ety	Old English geforthian to further, promote, from forth #7forth ; the Old English prefix ge- was later reduced to a-, and the modern spelling (C16) is influenced by words beginning aff -
afford	1.
	syl	af+ford
	pron	<*1fc:d>
	pos	vb.
	usage	preceded by can, could, etc.
	def	to be able to do or spare something, esp. without incurring financial difficulties or without risk of undesirable consequences.
	exam	1	we can afford to buy a small house;
	exam	2	I can afford to give you one of my chess sets;
	exam	3	we can't afford to miss this play.
afford	2.
	syl	af+ford
	pron	<*1fc:d>
	pos	vb.
	def	to give, yield, or supply.
	exam	1	the meeting afforded much useful information.
afforest	ety	C15: from Medieval Latin afforest*_are, from forestis #7forest 
afforest	0.
	syl	af+for+est
	pron	<*1forist>
	pos	vb.
	mod	tr.
	def	to plant trees on; convert into forested land.
afforestation	sub
	head	afforest
	syl	af+2for+est:1a+tion
	pos	n.
affranchise	ety	C15: from Old French afranchiss-, a stem of afranchir, from franchir to free; see #7frank %1
affranchise	0.
	syl	af+fran+chise
	pron	<*1fr@nCIz>
	pos	vb.
	mod	tr.
	def	to release from servitude or an obligation.
affranchisement	sub
	head	affranchise
	syl	af+1fran+chise+ment
	pos	n.
affray	ety	C14: via Old French from Vulgar Latin exfrid*_are (unattested) to break the peace; compare German Friede peace
affray	1.
	syl	af+fray
	pron	<*1frA>
	pos	n.
	qual	Law.
	def	a fight, noisy quarrel, or disturbance between two or more persons in a public place.
affray	2.
	syl	af+fray
	pron	<*1frA>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to frighten.
affreightment	ety	C19: from French affr*'eter to charter a ship, from fret #7freight 
affreightment	0.
	syl	af+freight+ment
	pron	<*1frAtm*nt>
	pos	n.
	def	a contract hiring a ship to carry goods.
affricate	ety	C19: from Latin affric*_are to rub against, from fric*_are to rub; compare #7friction 
affricate	0.
	syl	af+fri+cate
	pron	<1@fri2kit>
	pos	n.
	def	a composite speech sound consisting of a stop and a fricative articulated at the same point, such as the sound written as in
affricative	1.
	syl	af+fric:a+tive
	pron	<*1frik*tiv>, <1@fr*2kA->
	pos	n.
	def	another word for {affricate}.
affricative	2.
	syl	af+fric:a+tive
	pron	<*1frik*tiv>, <1@fr*2kA->
	pos	adj.
	def	of, relating to, or denoting an affricate.
affright	ety	Old English *_afyrhtan, from a-, a prefix indicating the beginning or end of an action+ fyrhtan to #7fright 
affright	1.
	syl	af+fright
	pron	<*1frIt>
	pos	vb.
	mod	tr.
	qual	Archaic or poetic.
	def	to frighten.
affright	2.
	syl	af+fright
	pron	<*1frIt>
	pos	n.
	qual	Archaic or poetic.
	def	a sudden terror.
affront	ety	C14: from Old French afront?!er to strike in the face, from Vulgar Latin affront*_are (unattested), from the Latin phrase ad frontem to the face
affront	1.
	syl	af+front
	pron	<*1fr^nt>
	pos	n.
	def	a deliberate insult.
affront	2.
	syl	af+front
	pron	<*1fr^nt>
	pos	vb.
	mod	tr.
	def	to insult, esp. openly.
affront	3.
	syl	af+front
	pron	<*1fr^nt>
	pos	vb.
	mod	tr.
	def	to offend the pride or dignity of.
affront	4.
	syl	af+front
	pron	<*1fr^nt>
	pos	vb.
	mod	tr.
	qual	Obsolete.
	def	to confront defiantly.
affusion	ety	C17: from Late Latin aff*_usi*_on- a pouring upon, from af?!fundere, from fundere to pour
affusion	0.
	syl	af+fu+sion
	pron	<*1fju:Z*n>
	pos	n.
	def	the baptizing of a person by pouring water onto his head. Compare {{aspersion} (sense 3),} {immersion}.
Afgh	alt
	head	Afg
	or	Afg
	syl	Afgh.
Afg	0.
	or	Afgh
	syl	Afg.
	qual	abbrev. for
	def	Afghanistan.
afghan	1.
	syl	af+ghan
	pron	<1@fg@n>, <-g*n>
	pos	n.
	def	a knitted or crocheted wool blanket or shawl, esp. one with a geometric pattern.
afghan	2.
	syl	af+ghan
	pron	<1@fg@n>, <-g*n>
	pos	n.
	def	a sheepskin coat, often embroidered and having long fur trimming around the edges.
Afghani	alt
	head	Afghan
	or	Afghan
	syl	Af+ghan:i
	pron	<@f1g@ni>, <-1ga:->
	pos	n.
Afghan	1.
	or	Afghani
	syl	Af+ghan
	pron	<1@fg@n>, <-g*n>
	pos	n.
	def	a native, citizen, or inhabitant of Afghanistan.
Afghan	2.
	or	Afghani
	syl	Af+ghan
	pron	<1@fg@n>, <-g*n>
	pos	n.
	def	another name for {Pashto} (the language).
Afghan	3.
	or	Afghani
	syl	Af+ghan
	pron	<1@fg@n>, <-g*n>
	pos	adj.
	def	denoting or relating to Afghanistan, its people, or their language.
Afghan hound	0.
	syl	Af+ghan hound
	pos	n.
	def	a tall graceful breed of hound with a long silky coat.
afghani	0.
	syl	af+ghan:i
	pron	<@f1ga:ni>
	pos	n.
	def	the standard monetary unit of Afghanistan, divided into 100 puls.
Afghanistan	0.
	syl	Af+ghan:i+stan
	pron	<@f1g@ni2sta:n>, <-2st@n>
	pos	n.
	def	a republic in central Asia: became independent in 1919; generally arid and mountainous, with the Hindu Kush range rising over 7500 m (25000 ft.) and fertile valleys of the Amu Darya, Helmand, and Kabul Rivers. Languages: Pashto and Tadzhik. Religion: Muslim. Currency: afghani. Capital: Kabul. Pop.: 18796000 (1974 UN est.). Area: 657500 sq. km (250000 sq. miles).
aficionado	ety	Spanish, from aficionar to arouse affection, from aficion #7affection 
aficionados	infl
	head	aficionado
	syl	a:fi+cio+na+dos
	pron	<-d*uz>, Spanish <-Dos>
	pos	n.
	mod	pl.
aficionado	1.
	syl	a:fi+cio+na+do
	pron	<*2fiSj*1na:d*u>, Spanish <a2fiTjo1naDo>, Spanish <-Dos>
	pos	n.
	def	an ardent supporter or devotee.
	exam	1	a jazz aficionado.
aficionado	2.
	syl	a:fi+cio+na+do
	pron	<*2fiSj*1na:d*u>, Spanish <a2fiTjo1naDo>, Spanish <-Dos>
	pos	n.
	def	a devotee of bullfighting.
afield	1.
	syl	a:field
	pron	<*1fEld>
	pos	adv. adj.
	usage	postpositive
	def	away from one's usual surroundings or home (esp. in the phrase {far afield) }.
afield	2.
	syl	a:field
	pron	<*1fEld>
	pos	adv. adj.
	usage	postpositive
	def	off the subject; away from the point (esp. in the phrase {far afield) }.
afield	3.
	syl	a:field
	pron	<*1fEld>
	pos	adv. adj.
	usage	postpositive
	def	in or to the field, esp. the battlefield.
afire	1.
	syl	a:fire
	pron	<*1fI*>
	pos	adv. adj.
	usage	postpositive
	def	on fire; ablaze.
afire	2.
	syl	a:fire
	pron	<*1fI*>
	pos	adv. adj.
	usage	postpositive
	def	intensely interested or passionate.
	exam	1	he was afire with enthusiasm for the new plan.
aflame	1.
	syl	a:flame
	pron	<*1flAm>
	pos	adv. adj.
	usage	postpositive
	def	in flames; ablaze.
aflame	2.
	syl	a:flame
	pron	<*1flAm>
	pos	adv. adj.
	usage	postpositive
	def	deeply aroused, as with passion.
	exam	1	he was aflame with desire.
aflame	3.
	syl	a:flame
	pron	<*1flAm>
	pos	adv. adj.
	usage	postpositive; of the face
	def	red or inflamed.
aflatoxin	ety	C20: from A (spergillus) fla (vus) + #7toxin 
aflatoxin	0.
	syl	af+la+tox+in
	pron	<2@fl*1toksin>
	pos	n.
	def	a toxin produced by the fungus growing on peanuts, maize, etc., thought to cause liver disease (esp. cancer) in man.
AFL-CIO	0.
	syl	AFL-CIO
	qual	abbrev. for
	def	American Federation of Labor and Congress of Industrial Organizations; a federation of independ?!ent American trade unions formed by the union of these two groups in 1955.
afloat	1.
	syl	a:float
	pron	<*1fl*ut>
	pos	adj. postpositive; adv.
	def	floating.
afloat	2.
	syl	a:float
	pron	<*1fl*ut>
	pos	adj. postpositive; adv.
	def	aboard ship; at sea.
afloat	3.
	syl	a:float
	pron	<*1fl*ut>
	pos	adj. postpositive; adv.
	def	covered with water; flooded.
afloat	4.
	syl	a:float
	pron	<*1fl*ut>
	pos	adj. postpositive; adv.
	def	aimlessly drifting.
	exam	1	afloat in a sea of indecision.
afloat	5.
	syl	a:float
	pron	<*1fl*ut>
	pos	adj. postpositive; adv.
	def	in circulation; afoot.
	exam	1	nasty rumours were afloat.
afloat	6.
	syl	a:float
	pron	<*1fl*ut>
	pos	adj. postpositive; adv.
	def	free of debt; solvent.
aflutter	0.
	syl	a:flut+ter
	pron	<*1fl^t*>
	pos	adj. postpositive; adv.
	def	in or into a nervous or excited state.
AFM	0.
	syl	A.F.M.
	qual	abbrev. for
	def	Air Force Medal.
afoot	1.
	syl	a:foot
	pron	<*1fut>
	pos	adj. postpositive; adv.
	def	in circulation or operation; astir.
	exam	1	mischief was afoot.
afoot	2.
	syl	a:foot
	pron	<*1fut>
	pos	adj. postpositive; adv.
	def	on or by foot.
afore	0.
	syl	a:fore
	pron	<*1fc:>
	pos	adv. prep. conj.
	def	an archaic or dialect word for {before}.
aforementioned	0.
	syl	a:fore+men+tioned
	pron	<*1fc:2menS*nd>
	pos	adj.
	usage	usually prenominal; chiefly in legal documents
	def	stated or mentioned before or already.
aforesaid	0.
	syl	a:fore+said
	pron	<*1fc:2sed>
	pos	adj.
	usage	usually prenominal; chiefly in legal documents
	def	spoken of or referred to previously.
aforethought	0.
	syl	a:fore+thought
	pron	<*1fc:2Tc:t>
	pos	adj.
	usage	immediately postpositive
	def	premeditated (esp. in the phrase {malice aforethought) }.
aforetime	0.
	syl	a:fore+time
	pron	<*1fc:2tIm>
	pos	adv.
	qual	Archaic.
	def	formerly.
a fortiori	ety	Latin
a fortiori	0.
	syl	a for+ti:o+ri
	pron	<A2fc:ti1c:rI>, <-ri>, <a:->
	pos	adv.
	def	for a stronger, more convincing, or more certain reason.
	exam	1	if Britain cannot afford a space programme, then, a fortiori, neither can India.
afoul	1.
	syl	a:foul
	pron	<*1faul>
	pos	adv. adj.
	usage	postpositive; usually foll. by of
	def	in or into a state of difficulty, confusion, or conflict (with).
afoul	2.
	syl	a:foul
	pron	<*1faul>
	pos	adv. adj.
	usage	postpositive; often foll. by of
	def	in or into an entanglement or collision (with) (often in the phrase {run afoul of) }.
	exam	1	a yacht with its sails afoul;
	exam	2	the boat ran afoul of a steamer.
Afr	0.
	syl	Afr.
	qual	abbrev. for
	def	Africa(n).
afraid	ety	C14 affraied, past participle of #7affray (to frighten)
afraid	1.
	syl	a:fraid
	pron	<*1frAd>
	pos	adj.
	usage	postpositive; often foll. by of
	def	feeling fear or apprehension; frightened.
	exam	1	he was afraid of cats.
afraid	2.
	syl	a:fraid
	pron	<*1frAd>
	pos	adj.
	usage	postpositive
	def	reluctant (to do something), as through fear or timidity.
	exam	1	he was afraid to let himself go.
afraid	3.
	syl	a:fraid
	pron	<*1frAd>
	pos	adj.
	usage	postpositive; often foll. by that; used to lessen the effect of an unpleasant statement
	def	regretful.
	exam	1	I'm afraid that I shall have to tell you to go.
afreet	ety	C19: from Arabic `ifr*_it 
afrit	alt
	head	afreet
	or	afreet
	syl	af+rit
	pron	<1@frEt>, <*1frEt>
	pos	n.
afreet	0.
	or	afrit
	syl	af+reet
	pron	<1@frEt>, <*1frEt>
	pos	n.
	qual	Arabian myth.
	def	a powerful evil demon or giant monster.
afresh	0.
	syl	a:fresh
	pron	<*1freS>
	pos	adv.
	def	once more; once again; anew.
Africa	0.
	syl	Af+ri+ca
	pron	<1@frik*>
	pos	n.
	def	the second largest of the continents, on the Mediterranean in the north, the Atlantic in the west, and the Red Sea, Gulf of Aden, and Indian Ocean in the east. The Sahara Desert divides the continent unequally into North Africa (an early centre of civilization, in close contact with Europe and W Asia, now inhabited chiefly by Arabs) and Africa south of the Sahara (relatively isolated from the rest of the world until the 19th century and inhabited chiefly by Negro peoples). It was colonized mainly in the 18th and 19th centuries by Europeans and now comprises chiefly independent nations. The largest lake is Lake Victoria and the chief rivers are the Nile, Niger, Congo, and Zambezi. Pop.: 346015000 (1969 est.). Area: about 30300000 sq. km (11700000 sq. miles).
African	1.
	syl	Af+ri+can
	pron	<1@frik*n>
	pos	adj.
	def	denoting or relating to Africa or any of its peoples, languages, nations, etc.
African	2.
	syl	Af+ri+can
	pron	<1@frik*n>
	pos	n.
	def	a native, inhabitant, or citizen of any of the countries of Africa.
African	3.
	syl	Af+ri+can
	pron	<1@frik*n>
	pos	n.
	def	a member or descendant of any of the peoples of Africa, esp. a Negro.
Africanism	0.
	syl	Af+ri+can+ism
	pron	<1@frik*2niz*m>
	pos	n.
	def	something characteristic of Africa or Africans, esp. a characteristic feature of an African language when introduced into a non-African language.
Africanist	0.
	syl	Af+ri+can+ist
	pron	<1@frik*nist>
	pos	n.
	def	a person specializing in the study of African affairs or culture.
Africanise	alt
	head	Africanize
	or	Africanize
	syl	Af+ri+can+ise
	pron	<1@frik*2nIz>
	pos	vb.
	mod	tr.
Africanize	0.
	or	Africanise
	syl	Af+ri+can+ize
	pron	<1@frik*2nIz>
	pos	vb.
	mod	tr.
	def	to make African, esp. to give control of (policy, government, etc.) to Africans.
Africanization	sub
	head	Africanize
	or	Africanisation
	syl	Af+ri+can:i+1za+tion
	pos	n.
Africanisation	sub
	head	Africanize
	or	Africanization
	syl	Af+ri+can:i+1sa+tion
	pos	n.
African lily	0.
	syl	Af+ri+can lil:y
	pos	n.
	def	a liliaceous plant, of southern Africa, having rounded clusters of blue or white funnel-shaped flowers.
African mahogany	1.
	syl	Af+ri+can ma+hog:a+ny
	pos	n.
	def	any of several African trees of the meliaceous genus esp. that have wood similar to that of true mahogany.
African mahogany	2.
	syl	Af+ri+can ma+hog:a+ny
	pos	n.
	def	the wood of any of these trees, used for furniture, etc.
African mahogany	3.
	syl	Af+ri+can ma+hog:a+ny
	pos	n.
	def	any of various other African woods that resemble true mahogany.
African violet	0.
	syl	Af+ri+can vi:o+let
	pos	n.
	def	any of several tropical African plants of the genus esp. cultivated as house plants, with violet, white, or pink flowers and hairy leaves: family
Afrikaans	ety	C20: from Dutch: African
Afrikaans	0.
	syl	Af+ri+kaans
	pron	<2@fri1ka:ns>, <-1ka:nz>
	pos	n.
	def	an official language of all the Republic of South Africa, closely related to Dutch and Flemish. Also called: {South African Dutch, Taal}.
Afrikander	ety	C19: from South African Dutch, formed on the model of Hollander 
Africander	alt
	head	Afrikander
	or	Afrikander
	syl	Af+ri+can+der
	pron	<2afri1k@nd*>, <2@f->
	pos	n.
Afrikander	1.
	or	Africander
	syl	Af+ri+kan+der
	pron	<2afri1k@nd*>, <2@f->
	pos	n.
	def	a breed of humped-back beef cattle originally raised in southern Africa.
Afrikander	2.
	or	Africander
	syl	Af+ri+kan+der
	pron	<2afri1k@nd*>, <2@f->
	pos	n.
	def	a southern African breed of fat-tailed sheep.
Afrikander	3.
	or	Africander
	syl	Af+ri+kan+der
	pron	<2afri1k@nd*>, <2@f->
	pos	n.
	def	a former name for an {Afrikaner}.
Afrikaner	0.
	syl	Af+ri+ka+ner
	pron	<2afri1ka:n*>, <2@f->
	pos	n.
	def	a White native of the Republic of South Africa whose mother tongue is Afrikaans. See also {Boer}.
Afrikanerdom	0.
	syl	Af+ri+ka+ner+dom
	pron	<2afri1ka:n*d*m>, <2@f->
	pos	n.
	usage	in South Africa
	def	Afrikaner nationalism based on pride in the Afrikaans language and culture, conservative Calvinism, and a sense of heritage as pioneers.
Afrikanerise	alt
	head	Afrikanerize
	or	Afrikanerize
	syl	Af+ri+ka+ner+ise
	pron	<2afri1ka:n*2rIz>, <2@f->
	pos	vb.
	mod	tr.
Afrikanerize	0.
	or	Afrikanerise
	syl	Af+ri+ka+ner+ize
	pron	<2afri1ka:n*2rIz>, <2@f->
	pos	vb.
	mod	tr.
	qual	Chiefly S. African.
	def	to make (a person) Afrikaans in attitudes, language, etc.
Afrikanerization	sub
	head	Afrikanerize
	or	Afrikanerisation
	syl	Af+ri+ka+ner:i+1za+tion
	pos	n.
Afrikanerisation	sub
	head	Afrikanerize
	or	Afrikanerization
	syl	Af+ri+ka+ner:i+1sa+tion
	pos	n.
afrit	0.
	syl	af+rit
	pron	<1@frEt>, <*1frEt>
	pos	n.
	def	a variant spelling of {afreet}.
Afro	ety	C20: independent use of A#7fro-
Afros	infl
	head	Afro
	syl	Af:ros.
	pos	n.
	mod	pl.
Afro	0.
	syl	Af:ro
	pron	<1@fr*u>
	pos	n.
	def	a hair style in which the hair is shaped into a wide frizzy bush, popular esp. among Negroes.
Afro-	0.
	syl	Af:ro-
	pron	<1@fr*u->
	usage	combining form.
	def	indicating Africa or African.
	exam	1	Afro-Asiatic.
Afro-American	1.
	syl	Af:ro-A:mer:i:can
	pos	n.
	def	an American Negro.
Afro-American	2.
	syl	Af:ro-A:mer:i:can
	pos	adj.
	def	de?!noting or relating to American Negroes, their history, or their culture.
Afro-Asian	0.
	syl	Af:ro-A:sian
	pos	adj.
	def	of or relating to both Africa and Asia, esp. as part of the Third World.
Afro-Asiatic	1.
	syl	Af:ro-A:si:at:ic
	pos	n.
	def	Also called: {Semito-Hamitic}. a family of languages of SW Asia and N Africa, consisting of the Semitic, ancient Egyptian, Berber, Cushitic, and Chadic subfamilies.
Afro-Asiatic	2.
	syl	Af:ro-A:si:at:ic
	pos	adj.
	def	denoting, belonging to, or relating to this family of languages.
Afro-chain	0.
	syl	Af:ro-chain
	pos	n.
	usage	in the Caribbean
	def	a large chain necklace with a central pendant: usually worn with a dashiki by men.
Afro-comb	0.
	syl	Af:ro-comb
	pos	n.
	usage	in the Caribbean
	def	a hand-shaped comb with long metal teeth used in tending an Afro.
Afro-Cuban	0.
	syl	Af:ro-Cu:ban
	pos	adj.
	def	of or relating to a type of jazz influenced by Cuban variants of African rhythms. Compare {Cu-bop}.
afrormosia	ety	C20: from #7afro -+ Ormosia (genus name)
afrormosia	0.
	syl	af+ror+mo+si:a
	pron	<2@frc:1m*uzi*>
	pos	n.
	def	a hard teaklike wood obtained from tropical African trees of the leguminous genus
aft	ety	C17: perhaps a shortened form of earlier #7abaft 
aft	0.
	syl	aft
	pron	<a:ft>
	pos	adv. adj.
	qual	Chiefly nautical.
	def	towards or at the stern or rear.
	exam	1	the aft deck;
	exam	2	aft of the engines.
after	ety	Old English @after; related to Old Norse aptr back, eptir after, Old High German aftar 
after	1.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	following in time; in succession to.
	exam	1	after dinner;
	exam	2	time after time.
after	2.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	following in space; behind.
	exam	1	they entered one after another.
after	3.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	in pursuit or search of.
	exam	1	chasing after a thief;
	exam	2	he's only after money.
after	4.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	concerning.
	exam	1	to inquire after his health.
after	5.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	considering.
	exam	1	after what you have done, you shouldn't complain.
after	6.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	next in excellence or importance to.
	exam	1	he ranked Jonson after Shakespeare.
after	7.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	in imitation of; in the manner of.
	exam	1	a statue after classical models.
after	8.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	in accordance with or in conformity to.
	exam	1	a man after her own heart.
after	9.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	with a name derived from.
	exam	1	Mary was named after her grandmother.
after	10.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	qual	U.S.
	def	past (the hour of).
	exam	1	twenty after three.
after	11.a.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	when everything is considered.
	exam	1	after all, why worry about it??
after	11.b.
	syl	af+ter
	pron	<1a:ft*>
	pos	prep.
	def	in spite of expectations, efforts, etc..
	exam	1	he won the race after all&!
after you	12.
	head	after
	syl	after you.
	def	please go, enter, etc., before me.
after	13.
	syl	af+ter
	pron	<1a:ft*>
	pos	adv.
	def	at a later time; afterwards.
after	14.
	syl	af+ter
	pron	<1a:ft*>
	pos	adv.
	def	coming afterwards; in pursuit.
after	15.
	syl	af+ter
	pron	<1a:ft*>
	pos	adv.
	qual	Nautical.
	def	further aft; sternwards.
after	16.
	syl	af+ter
	pron	<1a:ft*>
	pos	conj.
	usage	subordinating
	def	at a time later than that at which.
	exam	1	he came after I had left.
after	17.
	syl	af+ter
	pron	<1a:ft*>
	pos	adj.
	qual	Nautical.
	def	further aft.
	exam	1	the after cabin.
afterbirth	0.
	syl	af:ter+birth
	pron	<1a:ft*2bR:T>
	pos	n.
	def	the placenta and fetal membranes expelled from the uterus after the birth of offspring.
afterbodies	infl
	head	afterbody
	syl	af:ter+bod:ies.
	pos	n.
	mod	pl.
afterbody	0.
	syl	af:ter+bod:y
	pron	<1a:ft*2bodi>
	pos	n.
	def	any discarded part that continues to trail a satellite, rocket, etc., in orbit.
afterbrain	0.
	syl	af:ter+brain
	pron	<1a:ft*2brAn>
	pos	n.
	def	a nontechnical name for {myelencephalon}.
afterburner	1.
	syl	af:ter+burn:er
	pron	<1a:ft*2bR:n*>
	pos	n.
	def	a device in the exhaust system of an internal-combustion engine for removing or rendering harmless potentially dangerous components in the exhaust gases.
afterburner	2.
	syl	af:ter+burn:er
	pron	<1a:ft*2bR:n*>
	pos	n.
	def	a device placed in the jet pipe of an aircraft jet engine to produce afterburning.
afterburning	1.
	syl	af:ter+burn:ing
	pron	<1a:ft*2bR:niG>
	pos	n.
	def	Also called: {reheat}. a process in which additional fuel is ignited in the exhaust gases of a jet engine to produce additional thrust.
afterburning	2.
	syl	af:ter+burn:ing
	pron	<1a:ft*2bR:niG>
	pos	n.
	def	irregular burning of fuel in a rocket motor after the main burning has ceased.
afterburning	3.
	syl	af:ter+burn:ing
	pron	<1a:ft*2bR:niG>
	pos	n.
	def	persistence of combustion in an internal-combustion engine, either in an incorrect part of the cycle or after the ignition has been switched off.
aftercare	0.
	syl	af:ter+care
	pron	<1a:ft*2ke*>
	pos	n.
	qual	Med.
	def	the care of a patient recovering from a serious illness or operation.
afterdamp	0.
	syl	af:ter+damp
	pron	<1a:ft*2d@mp>
	pos	n.
	def	a poisonous gas, consisting main?!ly of carbon monoxide, formed after the explosion of firedamp in coal mines. See also {white damp}.
afterdeck	0.
	syl	af:ter+deck
	pron	<1a:ft*2dek>
	pos	n.
	qual	Nautical.
	def	the unprotected deck behind the bridge of a ship.
aftereffect	1.
	syl	af:ter+ef:fect
	pron	<1a:ft*ri2fekt>
	pos	n.
	def	any result occurring some time after its cause.
aftereffect	2.
	syl	af:ter+ef:fect
	pron	<1a:ft*ri2fekt>
	pos	n.
	qual	Med.
	def	any delayed response to a stimulus or agent. Compare {side effect}.
afterglow	1.
	syl	af:ter+glow
	pron	<1a:ft*2gl*u>
	pos	n.
	def	the glow left after a light has disappeared, such as that sometimes seen after sunset.
afterglow	2.
	syl	af:ter+glow
	pron	<1a:ft*2gl*u>
	pos	n.
	def	the glow of an incandescent metal after the source of heat has been removed.
afterglow	3.
	syl	af:ter+glow
	pron	<1a:ft*2gl*u>
	pos	n.
	qual	Physics.
	def	luminescence persisting in a gas discharge after the source of power has been removed.
afterglow	4.
	syl	af:ter+glow
	pron	<1a:ft*2gl*u>
	pos	n.
	def	a trace, impression, etc., of past emotion, brilliance, etc.
afterheat	0.
	syl	af:ter+heat
	pron	<1a:ft*2hEt>
	pos	n.
	def	the heat generated in a nuclear reactor after it has been shut down, produced by residual radioactivity in the fuel elements.
afterimage	0.
	syl	af:ter+im:age
	pron	<1a:ft*r2imiJ>
	pos	n.
	def	a sustained or renewed sensation, esp. visual, after the original stimulus has ceased. Also called: {aftersensation}.
afterlife	0.
	syl	af:ter+life
	pron	<1a:ft*2lIf>
	pos	n.
	def	life after death or at a later time in a person's lifetime.
aftermath	ety	C16: #7after+ math a mowing, from Old English m@ath 
aftermath	1.
	syl	af:ter+math
	pron	<1a:ft*2ma:T>, <-2m@T>
	pos	n.
	def	signs or results of an event or occurrence considered collectively, esp. of a catas?!trophe or disaster.
	exam	1	the aftermath of war.
aftermath	2.
	syl	af:ter+math
	pron	<1a:ft*2ma:T>, <-2m@T>
	pos	n.
	qual	Agriculture.
	def	a second mowing or crop of grass from land that has already yielded one crop earlier in the same year.
aftermost	0.
	syl	af:ter+most
	pron	<1a:ft*2m*ust>
	pos	adj.
	def	closer or closest to the rear or (in a vessel) the stern; last.
afternoon	1.a.
	syl	af:ter+noon
	pron	<2a:ft*1nu:n>
	pos	n.
	def	the period of the day between noon and evening.
afternoon	1.b.
	syl	af:ter+noon
	pron	<2a:ft*1nu:n>
	pos	n.
	usage	as modifier
	exam	1	afternoon tea.
afternoon	2.
	syl	af:ter+noon
	pron	<2a:ft*1nu:n>
	pos	n.
	def	a middle or later part.
	exam	1	the afternoon of life.
afternoons	0.
	syl	af:ter+noons
	pron	<2a:ft*1nu:nz>
	pos	adv.
	qual	Informal.
	def	during the afternoon, esp. regularly.
afterpains	0.
	syl	af:ter+pains
	pron	<1a:ft*2pAnz>
	pos	n.
	mod	pl.
	def	cramplike pains caused by contraction of the uterus after childbirth.
afterpiece	0.
	syl	af:ter+piece
	pron	<1a:ft*2pEs>
	pos	n.
	def	a brief usually comic dramatic piece presented after a play.
afters	0.
	syl	af+ters
	pron	<1a:ft*z>
	pos	n.
	mod	functioning as; sing. pl.
	qual	Brit. informal.
	def	dessert; sweet.
aftersensation	0.
	syl	af:ter+sen:sa:tion
	pron	<1a:ft*sen2sAS*n>
	pos	n.
	def	another word for {after?!image}.
aftershaft	0.
	syl	af:ter+shaft
	pron	<1a:ft*2Sa:ft>
	pos	n.
	qual	Ornithol.
	def	a secondary feather arising near the base of a contour feather.
aftershave lotion	0.
	syl	af:ter+shave lo+tion
	pron	<1a:ft*2SAv>
	pos	n.
	def	a lotion, usually styptic and perfumed, for application to the face after shaving. Often shortened to {aftershave}.
aftershock	0.
	syl	af:ter+shock
	pron	<1a:ft*2Sok>
	pos	n.
	def	one of a series of minor tremors occurring after the main shock of an earthquake.
aftertaste	1.
	syl	af:ter+taste
	pron	<1a:ft*2tAst>
	pos	n.
	def	a taste that lingers on after eating or drinking.
aftertaste	2.
	syl	af:ter+taste
	pron	<1a:ft*2tAst>
	pos	n.
	def	a lingering impression or sensation.
afterthought	1.
	syl	af:ter+thought
	pron	<1a:ft*2Tc:t>
	pos	n.
	def	a comment, reply, etc., that occurs to one after the opportunity to deliver it has passed.
afterthought	2.
	syl	af:ter+thought
	pron	<1a:ft*2Tc:t>
	pos	n.
	def	an addition to something already completed.
afterwards	ety	Old English @afterweard, @afteweard, from #7aft+ward 
afterward	alt
	head	afterwards
	or	afterwards
	syl	af:ter+ward
	pos	adv.
afterwards	0.
	or	afterward
	syl	af:ter+wards
	pron	<1a:ft*w*dz>
	pos	adv.
	def	after an earlier event or time; subsequently.
afterword	0.
	syl	af:ter+word
	pron	<1a:ft*2wR:d>
	pos	n.
	def	an epilogue or postscript in a book, etc.
afterworld	0.
	syl	af:ter+world
	pron	<1a:ft*2wR:ld>
	pos	n.
	def	a world inhabited after death.
Ag	ety	from Latin argentum 
Ag	0.
	syl	Ag
	usage	the chemical symbol for
	def	silver.
AG	ety	German: joint-stock company
AG	1.
	syl	A.G.
	qual	abbrev. for:
	def	Adjutant General.
AG	2.
	syl	A.G.
	qual	abbrev. for:
	def	Attorney General.
AG	3.
	syl	A.G.
	qual	abbrev. for:
	def	Aktiengesellschaft.
aga	ety	C17: Turkish, literally: lord
agha	alt
	head	aga
	or	aga
	syl	a:gha
	pron	<1a:g*>
	pos	n.
aga	1.
	or	agha
	syl	a:ga
	pron	<1a:g*>
	pos	n.
	usage	in the Ottoman Empire
	def	a title of respect, often used with the title of a senior position.
aga	2.
	or	agha
	syl	a:ga
	pron	<1a:g*>
	pos	n.
	usage	in the Ottoman Empire
	def	a military commander.
Agadir	0.
	syl	A:ga+dir
	pron	<2@g*1di*>
	pos	n.
	def	a port in SW Morocco, which became the centre of an international crisis (1911), when a gunboat arrived to protect German interests. Britain issued a strong warning to Germany but the French negotiated and war was averted. In 1960 the town was virtually destroyed by an earthquake, about 10000 people being killed. Pop.: 61192 (1971).
again	ety	Old English ongegn opposite to, from #7a -%2#7+ gegn straight
again	1.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	def	another or second time; once more; anew.
	exam	1	he had to start again.
again	2.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	def	once more in a previously experienced or encountered place, state, or condition.
	exam	1	he is ill again;
	exam	2	he came back again.
again	3.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	def	in addition to the original amount, quantity, etc. (esp. in the phrases {as much again; half as much again) }.
again	4.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	usage	sentence modifier
	def	on the other hand.
	exam	1	he might come and then again he might not.
again	5.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	def	besides; also.
	exam	1	she is beautiful and, again, intelligent.
again	6.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	qual	Archaic.
	def	in reply; back.
	exam	1	he answered again to the questioning voice.
again and again	7.
	head	again
	syl	again and again.
	def	continuously; repeatedly.
again	8.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	qual	Caribbean.
	usage	used with a negative
	def	any more; any longer.
	exam	1	I don't eat pumpkin again.
again	9.
	syl	a:gain
	pron	<*1gen>, <*1gAn>
	pos	adv.
	usage	sentence connector.
	def	moreover; furthermore.
	exam	1	again, it could be said that he is not dead.
against	ety	C12 ageines, from again, ageyn, etc., #7again+ -es genitive ending; the spelling with -t (C16) was probably due to confusion with superlatives ending in -st 
against	1.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	def	opposed to; in conflict or disagreement with.
	exam	1	they fought against the legislation.
against	2.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	def	standing or leaning beside or in front of.
	exam	1	a ladder against the wall.
against	3.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	def	coming in contact with.
	exam	1	the branches of a tree brushed against the bus.
against	4.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	def	in contrast to.
	exam	1	silhouettes are outlines against a light background.
against	5.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	def	having an adverse or unfavourable effect on.
	exam	1	the economic system works against small independent companies.
against	6.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	def	as a protection from or means of defence from the adverse effects of.
	exam	1	a safeguard against contaminated water.
against	7.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	def	in exchange for or in return for.
against	8.
	syl	a:gainst
	pron	<*1genst>, <*1gAnst>
	pos	prep.
	qual	Now rare.
	def	in preparation for.
	exam	1	he gave them warm clothing against their journey through the night.
as against	9.
	head	against
	syl	as against.
	def	as opposed to or as compared with.
	exam	1	he had two shots at him this time as against only one last time.
Aga Khan	0.
	syl	A:ga Khan
	def	%1 (#!$a$:g$$ #!k$a$:n) the hereditary title of the head of the Ismaili Islamic sect.
Aga Khan	0.
	syl	A:ga Khan
	def	%2 (#!$a$:g$$ #!k$a$:n) Prince {Sa@.drud@.din} (s$$#!dru$:d$In). born 1933, Iranian international civil servant; United Nations High Commissioner for Refugees (1965-77).
Aga Khan IV	0.
	syl	A:ga Khan IV
	pos	n.
	def	Prince {Ka@.rim} (k$$#!ri$:m). born 1936, spiritual leader of the Ismaili sect of Muslims since 1957.
agalloch	ety	C17: from Greek agallokhon
agalloch	0.
	syl	a:gal+loch
	pron	<*1g@l*k>
	pos	n.
	def	another name for {eaglewood}.
agama	ety	C19: Carib
agama	1.
	syl	ag:a+ma
	pron	<1@g*m*>, <*1g@m*>
	pos	n.
	def	any small terrestrial lizard of the genus which inhabit warm regions of the Old World: family
agama	2.
	syl	ag:a+ma
	pron	<1@g*m*>, <*1g@m*>
	pos	n.
	def	Also called: {agamid} (#!@ag$$m$Id, $$#!g@am$Id). any other lizard of the family which occur in the Old World and Australia and show a wide range of habits and diversity of structure.
Agamemnon	0.
	syl	Ag:a:mem:non
	pron	<2@g*1memnon>
	pos	n.
	qual	Greek myth.
	def	a king of Mycenae who led the Greeks at the siege of Troy. On his return home he was murdered by his wife Clytemnestra and her lover Aegisthus. See also {Menelaus}.
agamete	ety	C19: from Greek agametos unmarried; see #7a -%1#7, gamete 
agamete	0.
	syl	a:gam+ete
	pron	<*1g@mEt>
	pos	n.
	def	a reproductive cell, such as the merozoite of some protozoans, that develops into a new form without fertilization.
agamic	ety	C19: from Greek agamos unmarried, from #7a -%1#7+ gamos marriage
agamic	0.
	syl	a:gam+ic
	pron	<*1g@mik>
	pos	adj.
	def	asexual; occurring or reproducing without fertilization.
agamically	sub
	head	agamic
	syl	a:1gam:i+cal+ly
	pos	adv.
agamogenesis	ety	C19: #7agamic+genesis 
agamogenesis	0.
	syl	ag:a+mo+gen+e:sis
	pron	<2@g*m*u1Jenisis>
	pos	n.
	def	asexual reproduction, such as fission or parthenogenesis.
agamogenetic	sub
	head	agamogenesis
	syl	ag:a+mo+ge:net+ic
	pron	<2@g*m*uJ*1netik>
	pos	adj.
agamogenetically	sub
	head	agamogenesis
	syl	ag:a+mo+ge:1net:i+cal+ly
	pos	adv.
Agana	0.
	syl	A:ga+*~na
	pron	<*1ga:nj*>
	pos	n.
	def	the capital of the Pacific island of Guam, on its W coast. Pop.: 2119 (1970).
agapanthus	ety	C19: New Latin, from Greek agap*_e love+ anthos flower
agapanthus	0.
	syl	ag:a+pan+thus
	pron	<2@g*1p@nT*s>
	pos	n.
	def	any African liliaceous plant of the genus esp. the African lily, with rounded clusters of blue or white flowers.
agape	ety	C17: #7a -%2#7+gape 
agape	1.
	syl	a:gape
	pron	<*1gAp>
	pos	adj.
	usage	postpositive; esp. of the mouth
	def	wide open.
agape	2.
	syl	a:gape
	pron	<*1gAp>
	pos	adj.
	usage	postpositive
	def	very surprised, expectant, or eager, esp. as indicated by a wide open mouth.
Agape	ety	C17: Greek agap*_e love
Agape	1.
	syl	A:ga:pe
	pron	<1@g*pi>
	pos	n.
	qual	Christianity.
	def	Christian love, esp. as contrasted with erotic love; charity.
Agape	2.
	syl	A:ga:pe
	pron	<1@g*pi>
	pos	n.
	qual	Christianity.
	def	a communal meal in the early Church taken in commemoration of the Last Supper; love feast.
agar	ety	C19: Malay
agar	0.
	syl	a:gar
	pron	<1Ag*>
	pos	n.
	def	a complex gelatinous carbohydrate obtained from seaweeds, esp. those of the genus used as a culture medium for bacteria, a laxative, in food, etc. Also called: {agar-agar}.
agaric	ety	C16: via Latin agaricum, from Greek agarikon, perhaps named after Agaria, a town in Sarmatia
agaric	1.
	syl	ag:a+ric
	pron	<1@g*rik>, <*1g@rik>
	pos	n.
	def	any saprophytic basidio?!mycetous fungus of the family having gills on the underside of the cap. The group includes the edible mushrooms and poisonous forms such as the fly agaric.
agaric	2.
	syl	ag:a+ric
	pron	<1@g*rik>, <*1g@rik>
	pos	n.
	def	the dried spore-producing bodies of certain fungi, esp. (or formerly used in medicine.
agaricaceous	sub
	head	agaric
	syl	a:gar:i+ca+ceous
	pron	<*2g@ri1kAS*s>
	pos	adj.
Agartala	0.
	syl	A:gar+ta+la
	pron	<1^g*t*2la:>
	pos	n.
	def	a city in NE India, capital of the state of Tripura. Pop.: 100264 (1971).
agate	ety	C16: via French from Latin ach*_at*_es, from Greek akhat*_es 
agate	1.
	syl	ag+ate
	pron	<1@git>
	pos	n.
	def	an impure microcrystalline form of quartz consisting of a variegated, usually banded chalcedony, used as a gemstone and in making pestles and mortars, burnishers, and polishers. Formula: SiO\2.
agate	2.
	syl	ag+ate
	pron	<1@git>
	pos	n.
	def	a playing marble of this quartz or resembling it.
agate	3.
	syl	ag+ate
	pron	<1@git>
	pos	n.
	qual	Printing.
	def	the U.S. name for {ruby} (sense 5).
agate line	0.
	syl	ag+ate line
	pos	n.
	qual	U.S.
	def	a measure of advertising space, one column wide and one fourteenth of an inch deep. Sometimes shortened to {line}.
agateware	0.
	syl	ag:ate+ware
	pron	<1@git2we*>
	pos	n.
	def	ceramic ware made to resemble agate or marble.
agave	ety	C18: New Latin, from Greek agau*_e, feminine of agauos illustrious, probably alluding to the height of the plant
agave	0.
	syl	a:ga+ve
	pron	<*1gAvi>, <1@gAv>
	pos	n.
	def	any plant of the genus native to tropical America with tall flower stalks rising from thick fleshy leaves: family Some species are the source of fibres such as sisal or of alcoholic beverages such as pulque and tequila. See also {century plant}.
AGC	0.
	syl	AGC
	qual	abbrev. for
	def	automatic gain control.
agcy	0.
	syl	agcy.
	qual	abbrev. for
	def	agency.
age	ety	C13: via Old French from Vulgar Latin aetat*_icum (unattested), from Latin aet*_as, ultimately from aevum lifetime; compare #7aeon 
age	1.
	syl	age
	pron	<AJ>
	pos	n.
	def	the period of time that a person, animal, or plant has lived or is expected to live.
	exam	1	the age of a tree;
	exam	2	what age was he when he died??
	exam	3	the age of a horse is up to thirty years.
age	2.
	syl	age
	pron	<AJ>
	pos	n.
	def	the period of existence of an object, material, group, etc..
	exam	1	the age of this table is 200 years.
age	3.a.
	syl	age
	pron	<AJ>
	pos	n.
	def	a period or state of human life.
	exam	1	he should know better at his age;
	exam	2	she had got beyond the giggly age.
age	3.b.
	syl	age
	pron	<AJ>
	pos	n.
	usage	as modifier
	exam	1	age group.
age	4.
	syl	age
	pron	<AJ>
	pos	n.
	def	the latter part of life.
age	5.a.
	syl	age
	pron	<AJ>
	pos	n.
	def	a period of history marked by some feature or characteristic; era.
age	5.b.
	syl	age
	pron	<AJ>
	pos	n.
	usage	cap. when part of a name
	exam	1	the Middle Ages;
	exam	2	the Space Age.
age	6.
	syl	age
	pron	<AJ>
	pos	n.
	def	generation.
	exam	1	the Edwardian age.
age	7.a.
	syl	age
	pron	<AJ>
	pos	n.
	def	a period of the earth's history distinguished by special characteristics.
	exam	1	the age of reptiles.
age	7.b.
	syl	age
	pron	<AJ>
	pos	n.
	def	the period during which a stage of rock strata is formed; a subdivision of an epoch.
age	8.
	syl	age
	pron	<AJ>
	pos	n.
	qual	Myth.
	def	any of the successive periods in the legendary history of man, which were, according to Hesiod, the golden, silver, bronze, heroic, and iron ages.
age	9.
	syl	age
	pron	<AJ>
	pos	n.
	mod	often; pl.
	qual	Informal.
	def	a relatively long time.
	exam	1	she was an age washing her hair;
	exam	2	I've been waiting ages.
age	10.
	syl	age
	pron	<AJ>
	pos	n.
	qual	Psychol.
	def	the level in years that a person has reached in any area of development, such as mental or emotional, compared with the normal level for his chronological age. See also {achievement age, mental age}.
age before beauty	11.
	head	age
	syl	age before beauty.
	usage	often said humorously when yielding precedence
	def	older people take precedence over young?!er people.
of age	12.
	head	age
	syl	of age.
	def	adult and legally responsible for one's actions (usually at 18 or 21 years).
ages	infl
	head	age
	or	aging
	syl	ag:es
	pos	vb.
ageing	infl
	head	age
	or	aged
	syl	age+ing
	pos	vb.
aging	infl
	head	age
	or	ages
	syl	ag+ing
	pos	vb.
aged	infl
	head	age
	or	ageing
	syl	aged.
	pos	vb.
age	13.
	syl	age
	pron	<AJ>
	pos	vb.
	def	to grow or make old or apparently old; become or cause to become old or aged.
age	14.
	syl	age
	pron	<AJ>
	pos	vb.
	def	to begin to seem older.
	exam	1	to have aged a lot in the past year.
age	15.
	syl	age
	pron	<AJ>
	pos	vb.
	qual	Brewing.
	def	to mature or cause to mature.
-age	ety	from Old French, from Late Latin -*_aticum, noun suffix, neuter of -*_aticus, adjectival suffix, from -*_atus -#7ate -%1#7+ -icus -#7ic 
-age	0.
	syl	-age
	exam	1	suffix forming nouns.
-age	1.
	syl	-age
	def	indicating a collection, set, or group.
	exam	1	acreage;
	exam	2	baggage.
-age	2.
	syl	-age
	def	indicating a process or action or the result of an action.
	exam	1	haulage;
	exam	2	passage;
	exam	3	breakage.
-age	3.
	syl	-age
	def	indicat?!ing a state, condition, or relationship.
	exam	1	bondage;
	exam	2	parent?!age.
-age	4.
	syl	-age
	def	indicating a house or place.
	exam	1	orphanage.
-age	5.
	syl	-age
	def	indicating a charge or fee.
	exam	1	postage.
-age	6.
	syl	-age
	def	indicating a rate.
	exam	1	dosage;
	exam	2	mileage.
aged	1.a.
	syl	a:ged
	pron	<1AJid>
	pos	adj.
	def	advanced in years; old.
aged	1.b.
	syl	a:ged
	pron	<1AJid>
	pos	as collective; n.
	usage	preceded by the
	exam	1	the aged.
aged	2.
	syl	a:ged
	pron	<1AJid>
	pos	adj.
	def	of, connected with, or characteristic of old age.
aged	3.
	syl	a:ged
	pron	<AJd>
	pos	adj.
	usage	postpositive
	def	having the age of.
	exam	1	a woman aged twenty.
aged	4.
	syl	a:ged
	pron	<1AJid>
	pos	adj.
	qual	Geography.
	def	having reached an advanced stage of erosion.
agee	ety	C19: #7a -%2#7+#7{gee %1}
ajee	alt
	head	agee
	or	agee
	syl	a:jee
	pron	<*1JE>
	pos	adj.
agee	0.
	or	ajee
	syl	a:gee
	pron	<*1JE>
	pos	adj.
	qual	Scot. and Brit. dialect.
	def	awry, crooked, or ajar.
age hardening	0.
	syl	age har+den+ing
	pos	n.
	def	the hardening of metals by spontaneous structural changes over a period of time. See also {precipitation hardening}.
ageless	1.
	syl	age+less
	pron	<1AJlis>
	pos	adj.
	def	apparently never growing old.
ageless	2.
	syl	age+less
	pron	<1AJlis>
	pos	adj.
	def	timeless; eternal.
	exam	1	an ageless quality.
Agen	0.
	syl	A:gen
	pron	French <a1Z*~e>
	pos	n.
	def	a market town in SW France, on the Garonne river. Pop.: 35839 (1975).
agency	ety	C17: from Medieval Latin agentia, from Latin agere to do
agencies	infl
	head	agency
	syl	a:gen+cies.
	pos	n.
	mod	pl.
agency	1.
	syl	a:gen+cy
	pron	<1AJ*nsi>
	pos	n.
	def	a business or other organization providing a specific service.
	exam	1	an employment agency.
agency	2.
	syl	a:gen+cy
	pron	<1AJ*nsi>
	pos	n.
	def	the place where an agent conducts business.
agency	3.
	syl	a:gen+cy
	pron	<1AJ*nsi>
	pos	n.
	def	the business, duties, or functions of an agent.
agency	4.
	syl	a:gen+cy
	pron	<1AJ*nsi>
	pos	n.
	def	action, power, or operation.
	exam	1	the agency of fate.
agency	5.
	syl	a:gen+cy
	pron	<1AJ*nsi>
	pos	n.
	def	intercession or mediation.
agency	6.
	syl	a:gen+cy
	pron	<1AJ*nsi>
	pos	n.
	qual	Chiefly U.S.
	def	one of the administrative organizations of a government.
agenda	ety	C17: Latin, literally: things to be done, from agere to do
agenda	1.
	syl	a:gen+da
	pron	<*1Jend*>
	pos	n.
	mod	functioning as; sing.
	def	a schedule or list of items to be attended to. Also: {a@.gen+dum}.
agenda	2.
	syl	a:gen+da
	pron	<*1Jend*>
	pos	n.
	mod	functioning as; pl.
	def	matters to be attended to, as at a meeting of a committee. Also: {a@.gen+das, a@.gen+dums}.
agenesis	1.
	syl	a:gen+e:sis
	pron	<A1Jenisis>
	pos	n.
	usage	of an animal or plant
	def	imperfect development.
agenesis	2.
	syl	a:gen+e:sis
	pron	<A1Jenisis>
	pos	n.
	def	impotence or sterility.
agenetic	sub
	head	agenesis
	syl	a:ge:net+ic
	pron	<2AJ*1net?!ik>
	pos	adj.
agent	ety	C15: from Latin agent-, noun use of the present participle of agere to do
agent	1.
	syl	a:gent
	pron	<1AJ*nt>
	pos	n.
	def	a person who acts on behalf of another person, group, business, government, etc.; representative.
agent	2.
	syl	a:gent
	pron	<1AJ*nt>
	pos	n.
	def	a person or thing that acts or has the power to act.
agent	3.
	syl	a:gent
	pron	<1AJ*nt>
	pos	n.
	def	a phenomenon, substance, or organism that exerts some force or effect.
	exam	1	a chemical agent.
agent	4.
	syl	a:gent
	pron	<1AJ*nt>
	pos	n.
	def	the means by which something occurs or is achieved; instrument.
	exam	1	wind is an agent of plant pollination.
agent	5.
	syl	a:gent
	pron	<1AJ*nt>
	pos	n.
	def	a person representing a business concern, esp. a travelling salesman.
agent	6.
	syl	a:gent
	pron	<1AJ*nt>
	pos	n.
	qual	Brit.
	def	short for {estate agent}.
agent	7.
	syl	a:gent
	pron	<1AJ*nt>
	pos	n.
	def	short for {secret agent}.
agential	sub
	head	agent
	syl	a:gen+tial
	pron	<A1JenS*l>
	pos	adj.
agents-general	infl
	head	agent-general
	syl	a:gents-gen:er:al.
	pos	n.
	mod	pl.
agent-general	0.
	syl	a:gent-gen:er:al
	pos	n.
	def	a representative in London of a Canadian province or an Australian state.
agential	alt
	head	agentive
	or	agentive
	syl	a:gen+tial
	pron	<A1JenS*l>
agentive	1.
	or	agential
	syl	a:gen+tive
	pron	<1AJ*ntiv>
	pos	adj.
	qual	Grammar.
	usage	in some inflected languages
	def	denoting a case of nouns, etc., indicating the agent described by the verb.
agentive	2.
	or	agential
	syl	a:gen+tive
	pron	<1AJ*ntiv>
	pos	adj.
	qual	Grammar.
	usage	of a speech element
	def	indicating agency.
	exam	1	@6-er@9 in @6worker@9 is an agentive suffix.
agentive	3.a.
	or	agential
	syl	a:gen+tive
	pron	<1AJ*ntiv>
	pos	n.
	qual	Grammar.
	def	the agentive case.
agentive	3.b.
	or	agential
	syl	a:gen+tive
	pron	<1AJ*ntiv>
	pos	n.
	qual	Grammar.
	def	a word or element in the agentive case.
agent of production	0.
	syl	a:gent of pro+duc+tion
	pos	n.
	def	another name for {factor of production}.
agents provocateurs	infl
	head	agent provocateur
	syl	a:gents pro+vo+ca+teurs
	pron	<a1Z?~a> <prcvcka1t@o:r>
	pos	n.
	mod	pl.
agent provocateur	0.
	syl	a:gent pro+vo+ca+teur
	pron	French. <a1Z?~a> <prcvcka1t@o:r>
	pos	n.
	def	a secret agent employed to provoke suspected persons to commit illegal acts and so be discredited or liable to punishment.
age of consent	0.
	syl	age of con+sent
	pos	n.
	def	the age at which a person, esp. a female, is considered legally competent to consent to marriage or sexual intercourse.
Age of Reason	0.
	syl	Age of Rea+son
	pos	n.
	usage	usually preceded by the
	def	the 18th century in W Europe. See also {Enlightenment}.
age-long	alt
	head	age-old
	or	age-old
	syl	age-long
	pos	adj.
age-old	0.
	or	age-long
	syl	age-old
	pos	adj.
	def	very old or of long duration; ancient.
ageratum	ety	C16: New Latin, via Latin from Greek ag*_eraton that which does not age, from #7a -%1#7+ g*_erat-, stem of g*_eras old age; the flowers of the plant remain vivid for a long time
ageratum	0.
	syl	ag+er:a+tum
	pron	<2@J*1rAt*m>
	pos	n.
	def	any tropical American plant of the genus such as and which have thick clusters of purplish-blue flowers.
agger	ety	C14: from Latin agger a heap, from ad- to+ gerere to carry, bring
agger	0.
	syl	ag+ger
	pron	<1@J*>
	pos	n.
	def	an earthwork or mound forming a rampart, esp. in a Roman military camp.
aggiornamenti	infl
	head	aggiornamento
	syl	ag+gior+na+men+ti
	pos	n.
	mod	pl.
agglomerate	ety	C17: from Latin agglomer*_are, from glomer*_are to wind into a ball, from glomus ball, mass
agglomerate	1.
	syl	ag+glom+er+ate
	pron	<*1glom*2rAt>
	pos	vb.
	def	to form or be formed into a mass or cluster; collect.
agglomerate	2.
	syl	ag+glom+er+ate
	pron	<*1glom*?!rit>, <-2rAt>
	pos	n.
	def	a confused mass.
agglomerate	3.
	syl	ag+glom+er+ate
	pron	<*1glom*?!rit>, <-2rAt>
	pos	n.
	def	a volcanic rock consisting of angular fragments within a groundmass of lava. Compare {{conglomerate} (sense 2).} {~} ($$#!gl$Am$$r$It, -@!re$It).
agglomerate	4.
	syl	ag+glom+er+ate
	pron	<*1glom*?!rit>, <-2rAt>
	pos	n.
	def	formed into a mass.
agglomeration	sub
	head	agglomerate
	syl	ag+2glom+er:1a+tion
	pos	n.
agglomerative	sub
	head	agglomerate
	syl	ag+1glom+er:a+tive
	pos	adj.
agglutinate	ety	C16: from Latin aggl*_utin*_are to glue to, from gluten glue
agglutinate	1.
	syl	ag+glu+ti+nate
	pron	<*1glu:ti2nAt>
	pos	vb.
	def	to cause to adhere, as with glue.
agglutinate	2.
	syl	ag+glu+ti+nate
	pron	<*1glu:ti2nAt>
	pos	vb.
	qual	Linguistics.
	def	to combine or be combined by agglutination.
agglutinate	3.
	syl	ag+glu+ti+nate
	pron	<*1glu:ti2nAt>
	pos	vb.
	mod	tr.
	def	to cause (bacteria, red blood cells, etc.) to clump together.
agglutinate	4.
	syl	ag+glu+ti+nate
	pron	<*1glu:tinit>, <-2nAt>
	pos	adj.
	def	united or stuck, as by glue.
agglutinability	sub
	head	agglutinate
	syl	ag+2glu+ti+na:1bil+i:ty
	pos	n.
agglutinable	sub
	head	agglutinate
	syl	ag+1glu+ti+na:ble
	pos	adj.
agglutinant	sub
	head	agglutinate
	syl	ag+1glu+ti+nant
	pos	adj.
agglutination	1.
	syl	ag+glu+ti+na+tion
	pron	<*2glu:ti1nAS*n>
	pos	n.
	def	the act or process of agglutinating.
agglutination	2.
	syl	ag+glu+ti+na+tion
	pron	<*2glu:ti1nAS*n>
	pos	n.
	def	the condition of being agglutinated; adhesion.
agglutination	3.
	syl	ag+glu+ti+na+tion
	pron	<*2glu:ti1nAS*n>
	pos	n.
	def	a united mass or group of parts.
agglutination	4.
	syl	ag+glu+ti+na+tion
	pron	<*2glu:ti1nAS*n>
	pos	n.
	qual	Linguistics.
	def	the building up of words from component morphemes in such a way that these undergo little or no change of form or meaning in the process of combination.
agglutinative	1.
	syl	ag+glu+ti+na+tive
	pron	<*1glu:tin*tiv>
	pos	adj.
	def	tending to join or capable of joining.
agglutinative	2.
	syl	ag+glu+ti+na+tive
	pron	<*1glu:tin*tiv>
	pos	adj.
	def	Also: {agglomerative}. denot?!ing languages, such as Hungarian, whose morphology is characterized by agglutination. Compare {{analytic} (sense 3)}, {{synthetic} (sense 3)}, {{polysynthetic}}.
agglutinin	ety	C19: #7agglutinate+ -#7in 
agglutinin	0.
	syl	ag+glu+ti+nin
	pron	<*1glu:tinin>
	pos	n.
	def	an antibody that causes agglutination.
agglutinogen	ety	C20: from #7agglutinate+ -#7gen 
agglutinogen	0.
	syl	ag+glu+tin:o+gen
	pron	<2@glu1tin*J*n>
	pos	n.
	def	an antigen that reacts with or stimulates the formation of a specific agglutinin.
aggrade	0.
	syl	ag+grade
	pron	<*1grAd>
	pos	vb.
	mod	tr.
	def	to build up the level of (any land surface) by the deposition of sediment. Compare {{degrade} (sense 4).}
aggradation	sub
	head	aggrade
	syl	ag+grad:a+tion
	pron	<2@gr*1dAS*n>
	pos	n.
aggrandize	ety	C17: from Old French aggrandiss-, long stem of aggrandir to make bigger, from Latin grandis #7grand ; the ending -ize is due to the influence of verbs ending in -ise, -ize 
aggrandise	alt
	head	aggrandize
	or	aggrandize
	syl	ag+gran+dise
	pron	<1@gr*n2dIz>, <*1gr@ndIz>
	pos	vb.
	mod	tr.
aggrandize	1.
	or	aggrandise
	syl	ag+gran+dize
	pron	<1@gr*n2dIz>, <*1gr@ndIz>
	pos	vb.
	mod	tr.
	def	to increase the power, wealth, prestige, scope, etc., of.
aggrandize	2.
	or	aggrandise
	syl	ag+gran+dize
	pron	<1@gr*n2dIz>, <*1gr@ndIz>
	pos	vb.
	mod	tr.
	def	to cause (something) to seem greater; magnify; exaggerate.
aggrandizement	sub
	head	aggrandize
	or	aggrandisement
	syl	ag+gran+dize+ment
	pron	<*1gr@ndizm*nt>
	pos	n.
aggrandisement	sub
	head	aggrandize
	or	aggrandizement
	syl	ag+gran+dise+ment
	pron	<*1gr@ndizm*nt>
	pos	n.
aggrandizer	sub
	head	aggrandize
	or	aggrandiser
	syl	ag+gran+2diz+er
	pos	n.
aggrandiser	sub
	head	aggrandize
	or	aggrandizer
	syl	ag+gran+2dis+er
	pos	n.
aggravate	ety	C16: from Latin aggrav*_are to make heavier, from gravis heavy
aggravate	1.
	syl	ag+gra+vate
	pron	<1@gr*2vAt>
	pos	vb.
	mod	tr.
	def	to make (a disease, situation, problem, etc.) worse or more severe.
aggravate	2.
	syl	ag+gra+vate
	pron	<1@gr*2vAt>
	pos	vb.
	mod	tr.
	qual	Informal.
	def	to annoy; exasperate.
aggravation	sub
	head	aggravate
	syl	ag+gra+1va+tion
aggregate	ety	C16: from Latin aggreg*_are to add to a flock or herd, attach (oneself) to, from grex flock #!ag+gre+gate+ly adv.
aggregate	1.
	syl	ag+gre+gate
	pron	<1@grigit>, <-2gAt>
	pos	adj.
	def	formed of separate units collected into a whole; collective; corporate.
aggregate	2.
	syl	ag+gre+gate
	pron	<1@grigit>, <-2gAt>
	pos	adj.
	usage	of fruits and flowers
	def	composed of a dense cluster of carpels or florets.
aggregate	3.
	syl	ag+gre+gate
	pron	<1@grigit>, <-2gAt>
	pos	n.
	def	a sum or assemblage of many separate units; sum total.
aggregate	4.
	syl	ag+gre+gate
	pron	<1@grigit>, <-2gAt>
	pos	n.
	qual	Geology.
	def	a rock, such as granite, consisting of a mixture of minerals.
aggregate	5.
	syl	ag+gre+gate
	pron	<1@grigit>, <-2gAt>
	pos	n.
	def	the sand, etc., mixed with cement and water to make concrete.
in the aggregate	6.
	head	aggregate
	syl	in the aggregate.
	def	taken as a whole.
aggregate	7.
	syl	ag+gre+gate
	pron	<1@gri2gAt>
	pos	vb.
	def	to combine or be combined into a body, etc.
aggregate	8.
	syl	ag+gre+gate
	pron	<1@gri2gAt>
	pos	vb.
	mod	tr.
	def	to amount to (a number).
aggregation	sub
	head	aggregate
	syl	ag+gre+1ga+tion
	pos	n.
aggregative	sub
	head	aggregate
	syl	ag+gre+ga+tive
	pron	<1@gri2gAtiv>
	pos	adj.
aggress	ety	C16: from Medieval Latin aggress*_are to attack, from Latin aggred*_i to attack, approach
aggress	0.
	syl	ag+gress
	pron	<*1gres>
	pos	vb.
	mod	intr.
	def	to attack first or begin a quarrel.
aggression	ety	C17: from Latin aggression-, from aggr*_edi to attack
aggression	1.
	syl	ag+gres+sion
	pron	<*1greS*n>
	pos	n.
	def	an attack or harmful action, esp. an unprovoked attack by one country against another.
aggression	2.
	syl	ag+gres+sion
	pron	<*1greS*n>
	pos	n.
	def	any offensive activity, practice, etc..
	exam	1	an aggression against personal liberty.
aggression	3.
	syl	ag+gres+sion
	pron	<*1greS*n>
	pos	n.
	qual	Psychol.
	def	a hostile or destructive mental attitude or behaviour.
aggressor	sub
	head	aggression
	syl	ag+gres+sor
	pron	<*1gres*>
	pos	n.
aggressive	1.
	syl	ag+gres+sive
	pron	<*1gresiv>
	pos	adj.
	def	quarrelsome or belligerent.
	exam	1	an aggressive remark.
aggressive	2.
	syl	ag+gres+sive
	pron	<*1gresiv>
	pos	adj.
	def	assertive; vigorous.
	exam	1	an aggressive businessman.
aggressively	sub
	head	aggressive
	syl	ag+1gres+sive+ly
	pos	adv.
aggrieve	ety	C14 agreven, via Old French from Latin aggrav*_are to #7aggravate 
aggrieve	1.
	syl	ag+grieve
	pron	<*1grEv>
	pos	vb.
	mod	tr.
	usage	passive
	def	to grieve; distress; afflict.
	exam	1	it aggrieved her much that she could not go.
aggrieve	2.
	syl	ag+grieve
	pron	<*1grEv>
	pos	vb.
	mod	tr.
	def	to injure unjustly, esp. by infringing a person's legal rights.
aggrievedly	sub
	head	aggrieve
	syl	ag+griev+ed+ly
	pron	<*1grEvidli>
	pos	adv.
aggro	ety	C20: from #7aggravation 
aggro	0.
	syl	ag+gro
	pron	<1@gr*u>
	pos	n.
	qual	Brit. slang.
	def	aggressive behaviour, esp. by youths in a gang.
agha	0.
	syl	a:gha
	pron	<1a:g*>
	pos	n.
	def	a variant spelling of {aga}.
aghast	ety	C13 agast, from Old English g@astan to frighten. The spelling with gh is on the model of #7ghastly 
aghast	0.
	syl	a:ghast
	pron	<*1ga:st>
	pos	adj.
	usage	postpositive
	def	overcome with amazement or horror.
agile	ety	C15: from Latin agilis, from agere to do, act
agile	1.
	syl	ag+ile
	pron	<1@JIl>
	pos	adj.
	def	quick in movement; nimble.
agile	2.
	syl	ag+ile
	pron	<1@JIl>
	pos	adj.
	def	mentally quick or acute.
agilely	sub
	head	agile
	syl	ag+ile+ly
	pos	adv.
agility	sub
	head	agile
	syl	a:gil+i:ty
	pron	<*1Jiliti>
	pos	n.
Agincourt	0.
	syl	Ag+in+court
	pron	<1aJin2kc:t>, French <aZ?~e1ku:r>
	pos	n.
	def	a battle fought in 1415 near the village of Agincourt, N France: a decisive victory for English longbowmen under Henry V over French forces vastly superior in number.
agio	ety	C17: from Italian, literally: ease
agio	1.a.
	syl	ag:i:o
	pron	<1@Ji*u>
	pos	n.
	def	the difference between the nominal and actual values of a currency.
agio	1.b.
	syl	ag:i:o
	pron	<1@Ji*u>
	pos	n.
	def	the charge payable for conversion of the less valuable currency.
agio	2.
	syl	ag:i:o
	pron	<1@Ji*u>
	pos	n.
	def	a percentage payable for the exchange of one currency into another.
agio	3.
	syl	ag:i:o
	pron	<1@Ji*u>
	pos	n.
	def	an allowance granted to compensate for differences in currency values, as on foreign bills of exchange.
agio	4.
	syl	ag:i:o
	pron	<1@Ji*u>
	pos	n.
	def	an informal word for {agiotage}.
agiotage	ety	C19: French, from #7agio 
agiotage	1.
	syl	ag:io+tage
	pron	<1@J*tiJ>
	pos	n.
	def	the business of exchanging currencies.
agiotage	2.
	syl	ag:io+tage
	pron	<1@J*tiJ>
	pos	n.
	def	speculative dealing in stock exchange securities or foreign exchange.
agist	ety	C14: from Old French agister, from gister to lodge, ultimately from Latin jac*_ere to lie down
agist	1.
	syl	a:gist
	pron	<*1Jist>
	pos	vb.
	mod	tr.
	qual	Law.
	def	to care for and feed (cattle or horses) for payment.
agist	2.
	syl	a:gist
	pron	<*1Jist>
	pos	vb.
	mod	tr.
	qual	Law.
	def	to assess and charge (land or its owner) with a public burden, such as a tax.
agitate	ety	C16: from Latin agit*_atus, from agit*_are to move to and fro, set into motion, from agere to act, do
agitate	1.
	syl	ag:i+tate
	pron	<1@Ji2tAt>
	pos	vb.
	mod	tr.
	def	to excite, disturb, or trouble (a person, the mind or feelings); worry.
agitate	2.
	syl	ag:i+tate
	pron	<1@Ji2tAt>
	pos	vb.
	mod	tr.
	def	to cause to move vigorously; shake, stir, or disturb.
agitate	3.
	syl	ag:i+tate
	pron	<1@Ji2tAt>
	pos	vb.
	mod	intr.
	usage	often foll. by for or against
	def	to attempt to stir up public opinion for or against something.
agitate	4.
	syl	ag:i+tate
	pron	<1@Ji2tAt>
	pos	vb.
	mod	tr.
	def	to discuss or debate in order to draw attention to or gain support for (a cause, etc.).
	exam	1	to agitate a political cause.
agitation	sub
	head	agitate
	syl	ag:i+1ta+tion
	pos	n.
agitato	0.
	syl	a:gi+ta+to
	pron	<2@Ji1ta:t*u>
	pos	adj. adv.
	qual	Music.
	def	in an agitated manner.
agitator	1.
	syl	ag:i+ta+tor
	pron	<1@Ji2tAt*>
	pos	n.
	def	a person who agitates for or against a cause, etc.
agitator	2.
	syl	ag:i+ta+tor
	pron	<1@Ji2tAt*>
	pos	n.
	def	a device, machine, or part used for mixing, shaking, or vibrating a material.
agitprop	ety	C20: short for Russian Agitpropbyuro 
agitprop	1.
	syl	ag:it+prop
	pron	<1@Jit2prop>
	pos	n.
	usage	often cap.
	def	a bureau of the Central Committee of the Communist Party of the Soviet Union, in charge of agitation and propaganda on behalf of Communism.
agitprop	2.
	syl	ag:it+prop
	pron	<1@Jit2prop>
	pos	n.
	def	any promotion of political agitation and propaganda, esp. of a Communist nature.
Aglaia	ety	Greek: splendour, from aglaos splendid
Aglaia	0.
	syl	A:glai:a
	pron	<*1glI*>
	pos	n.
	qual	Greek myth.
	def	one of the three Graces.
agleam	0.
	syl	a:gleam
	pron	<*1glEm>
	pos	adj.
	usage	postpositive
	def	glowing; gleaming.
aglet	ety	C15: from Old French aiguillette a small needle
aiglet	alt
	head	aglet
	or	aglet
	syl	ai:glet
	pos	n.
aglet	1.
	or	aiglet
	syl	ag+let
	pron	<1@glit>
	pos	n.
	def	a metal sheath or tag at the end of a shoelace, ribbon, etc.
aglet	2.
	or	aiglet
	syl	ag+let
	pron	<1@glit>
	pos	n.
	def	a variant spelling of {aiguillette}.
aglet	3.
	or	aiglet
	syl	ag+let
	pron	<1@glit>
	pos	n.
	def	any ornamental pendant.
agley	ety	from gley squint
agley	0.
	syl	a:gley
	pron	<*1glA>, <*1glE>
	pos	adj.
	qual	Scot.
	def	awry.
aglimmer	0.
	syl	a:glim+mer
	pron	<*1glim*>
	pos	adj.
	usage	postpositive
	def	glimmering.
aglitter	0.
	syl	a:glit+ter
	pron	<*1glit*>
	pos	adj.
	usage	postpositive
	def	sparkling; glittering.
aglow	0.
	syl	a:glow
	pron	<*1gl*u>
	pos	adj.
	usage	postpositive
	def	glowing.
AGM	0.
	syl	A.G.M.
	qual	abbrev. for
	def	annual general meeting.
agma	0.
	syl	ag:ma
	pron	<1@gm*>
	pos	n.
	qual	Phonetics.
	def	the symbol (&n), used to represent a velar nasal consonant, as in (l$A&n) or (t@a&nk).
agminate	ety	C19: from Latin agmen a moving throng
agminate	0.
	syl	ag+mi+nate
	pron	<1@gminit>, <-2nAt>
	pos	adj.
	def	gathered or clustered together.
agnail	0.
	syl	ag+nail
	pron	<1@g2nAl>
	pos	n.
	def	another name for {hangnail}.
agnate	ety	C16: from Latin agn*_atus born in addition, added by birth, from agn*_asci, from ad- in addition+ gn*_asci to be born
agnate	1.
	syl	ag+nate
	pron	<1@gnAt>
	pos	adj.
	def	related by descent from a common male ancestor.
agnate	2.
	syl	ag+nate
	pron	<1@gnAt>
	pos	adj.
	def	related in any way; cognate.
agnate	3.
	syl	ag+nate
	pron	<1@gnAt>
	pos	n.
	def	a male or female descendant by male links from a common male ancestor.
agnatic	sub
	head	agnate
	syl	ag+nat+ic
	pron	<@g1n@tik>
	pos	adj.
agnation	sub
	head	agnate
	syl	ag+1na+tion
	pos	n.
Saint	infl
	head	Agnes
	syl	Saint.
	pos	n.
Agnes	0.
	syl	Ag:nes
	pron	<1@gnis>
	pos	n.
	def	??292-??304 #7a.d., Christian child martyr under Diocletian. Feast day: Jan. 21.
Agni	ety	Sanskrit: fire
Agni	0.
	syl	Ag:ni
	pron	<1^gni>
	pos	n.
	qual	Hinduism.
	def	the god of fire, one of the three chief deities of the Vedas.
agnomen	ety	C18: from Late Latin, from ad- in addition to+ n*_omen name
agnomina	infl
	head	agnomen
	syl	ag+nom:i+na
	pron	<-1nomin*>
	pos	n.
	mod	pl.
agnomen	1.
	syl	ag+no+men
	pron	<@g1n*umen>
	pos	n.
	def	the fourth name or second cognomen occasionally acquired by an ancient Roman. See also {cognomen, nomen, praenomen}.
agnomen	2.
	syl	ag+no+men
	pron	<@g1n*umen>
	pos	n.
	def	another word for {nickname}.
agnominal	sub
	head	agnomen
	syl	ag+nom:i+nal
	pron	<@g1nominL>
	pos	adj.
agnostic	ety	C19: coined l869 by T. H. Huxley from #7a -%1#7+gnostic 
agnostic	1.
	syl	ag+nos+tic
	pron	<@g1nostik>
	pos	n.
	def	a person who holds that only material phenomena can be known and knowledge of a Supreme Being, ultimate cause, etc., is impossible.
agnostic	2.
	syl	ag+nos+tic
	pron	<@g1nostik>
	pos	adj.
	def	of or relating to agnostics.
agnosticism	sub
	head	agnostic
	syl	ag+1nos+ti+cism
	pos	n.
Agnus Dei	ety	Latin: Lamb of God
Agnus Dei	1.
	syl	Ag+nus De:i
	pron	<1@gnus> <1dAi>
	pos	n.
	qual	Christianity.
	def	the figure of a lamb bearing a cross or banner, emblematic of Christ.
Agnus Dei	2.
	syl	Ag+nus De:i
	pron	<1@gnus> <1dAi>
	pos	n.
	qual	Christianity.
	def	a chant beginning with these words or a translation of them, forming part of the Roman Catholic Mass or sung as an anthem in the Anglican liturgy.
Agnus Dei	3.
	syl	Ag+nus De:i
	pron	<1@gnus> <1dAi>
	pos	n.
	qual	Christianity.
	def	a wax medallion stamped with a lamb as emblem of Christ and blessed by the pope.
ago	ety	C14 ago, from Old English *_ag*_an to pass away #e Usage. The use of ago with since (it's ten years ago since he wrote the novel) is redundant and is therefore avoided in careful English. Ago should be followed by that: it was ten years ago that he wrote the novel.
ago	0.
	syl	a:go
	pron	<*1g*u>
	pos	adv.
	def	in the past.
	exam	1	five years ago;
	exam	2	long ago.
agog	ety	C15: perhaps from Old French en gogues in merriments, origin unknown
agog	0.
	syl	a:gog
	pron	<*1gog>
	pos	adj.
	usage	postpositive
	def	highly impatient, eager, or curious.
a gogo	ety	C20: from French
a gogo	0.
	syl	*`a go:go
	pron	<*> <1g*u2g*u>
	pos	adj. adv.
	qual	Informal.
	def	as much as one likes; galore.
	exam	1	champagne *`a gogo.
-agogue	ety	via Late Latin from Greek ag*_ogos leading, from agein to lead
-agogue	1.
	syl	-a:gogue
	usage	esp. U.S.
	def	indicating a person or thing that leads or incites to action.
	exam	1	pedagogue;
	exam	2	demagogue.
-agogue	2.
	syl	-a:gogue
	usage	esp. U.S.
	def	denoting a substance that stimulates the secretion of something.
	exam	1	galactagogue.
-agogic	sub
	head	-agogue
	syl	-a:gog:ic
-agogy	sub
	head	-agogue
	syl	-a:go:gy
agon	ety	C17: Greek: contest, from agein to lead
agones	infl
	head	agon
	syl	a:go+nes
	pron	<*1g*unEz>
	pos	n.
	mod	pl.
agon	0.
	syl	ag:on
	pron	<1@g*un>, <-gon>
	pos	n.
	usage	in ancient Greece
	def	a festival at which competitors contended for prizes. Among the best known were the Olympic, Pythias, Nemean, and Isthmian Games.
agone	0.
	syl	a:gone
	pron	<*1gon>
	pos	adv.
	def	an archaic word for {ago}.
agonic	ety	C19: from Greek ag*_onos, from #7a -%1#7+ g*_onia angle
agonic	0.
	syl	a:gon+ic
	pron	<*1gonik>, <A1gonik>
	pos	adj.
	def	forming no angle.
agonic line	0.
	syl	a:gon+ic line
	pos	n.
	def	an imaginary line on the surface of the earth connecting points of zero magnetic declination.
agonist	ety	C17: from Greek ag*_on #7agon 
agonist	1.
	syl	ag:o+nist
	pron	<1@g*nist>
	pos	n.
	def	any muscle that is opposed in action by another muscle. Compare {antagonist}.
agonist	2.
	syl	ag:o+nist
	pron	<1@g*nist>
	pos	n.
	def	a competitor, as in an agon.
agonistic	ety	C17: via Late Latin from Greek ag*_onistikos, from ag*_on contest
agonistic	1.
	syl	ag:o+nis+tic
	pron	<2@g*1nistik>
	pos	adj.
	def	striving for effect; strained.
agonistic	2.
	syl	ag:o+nis+tic
	pron	<2@g*1nistik>
	pos	adj.
	def	eager to win in discussion or argument; competitive.
agonize	ety	C16: via Medieval Latin from Greek ag*_onizesthai to contend for a prize, from ag*_on #7agon 
agonise	alt
	head	agonize
	or	agonize
	syl	ag:o+nise
	pron	<1@g*2nIz>
	pos	vb.
agonize	1.
	or	agonise
	syl	ag:o+nize
	pron	<1@g*2nIz>
	pos	vb.
	def	to suffer or cause to suffer agony.
agonize	2.
	or	agonise
	syl	ag:o+nize
	pron	<1@g*2nIz>
	pos	vb.
	mod	intr.
	def	to make a desperate effort; struggle; strive.
agonizingly	sub
	head	agonize
	or	agonisingly
	syl	ag:o+2niz+ing+ly
	pos	adv.
agonisingly	sub
	head	agonize
	or	agonizingly
	syl	ag:o+2nis+ing+ly
	pos	adv.
agony	ety	C14: via Late Latin from Greek ag*_onia struggle, from ag*_on contest
agonies	infl
	head	agony
	syl	ag:o+nies.
	pos	n.
	mod	pl.
agony	1.
	syl	ag:o+ny
	pron	<1@g*ni>
	pos	n.
	def	acute physical or mental pain; anguish.
agony	2.
	syl	ag:o+ny
	pron	<1@g*ni>
	pos	n.
	def	the suffering or struggle preceding death.
put	infl
	head	agony
	or	turn on the agony
	syl	put
turn on the agony	infl
	head	agony
	or	put
	syl	turn on the agony.
pile	3.
	head	agony
	syl	pile
	qual	Brit. informal.
	def	to exaggerate one's distress for sympathy or greater effect.
agony column	0.
	syl	ag:o+ny col+umn
	pos	n.
	qual	Brit. informal.
	def	a newspaper column devoted to advertisements relating esp. to personal problems.
agora	ety	from Greek, from agorein to gather
agorae	infl
	head	agora
	or	agoras
	syl	ag:o+rae
	pron	<-rE>, <-rI>
	pos	n.
	mod	pl.
agoras	infl
	head	agora
	or	agorae
	syl	ag:o+ras.
	pos	n.
	mod	pl.
agora	H1.0.a.
	syl	ag:o+ra
	pron	<1@g*r*>
	pos	n.
	usage	often cap.
	def	the marketplace in Athens, used for popular meetings, or any similar place of assembly in ancient Greece.
agora	H1.0.b.
	syl	ag:o+ra
	pron	<1@g*r*>
	pos	n.
	usage	often cap.
	def	the meeting itself.
agora	ety	Hebrew, from *_ag*_or to collect
agorot	infl
	head	agora
	syl	ag:o+rot
	pron	<-1rot>
	pos	n.
	mod	pl.
agora	H2.0.
	syl	ag:o+ra
	pron	<2@g*1ra:>
	pos	n.
	def	an Israeli monetary unit worth one hundredth of a pound.
agoraphobia	0.
	syl	ag:o+ra+pho+bi:a
	pron	<2@g*r*1f*ubi*>
	pos	n.
	def	an abnormal dread of open spaces.
agoraphobic	sub
	head	agoraphobia
	syl	ag:o+ra+1pho+bic
	pos	adj. n.
Giacomo	infl
	head	Agostini
	syl	Gia:co:mo
	pron	<1Ja:komo>
	pos	n.
Agostini	0.
	syl	A:gos:ti:ni
	pron	Italian <agos1tEni>
	pos	n.
	def	born 1944, Italian racing motorcyclist: world champion (500 cc. class) 1966-72; (350 cc. class) 1968-74.
agouti	ety	C18: via French and Spanish from Guarani
agoutis	infl
	head	agouti
	or	agouties
	syl	a:gou+tis
	pos	n.
	mod	pl.
agouties	infl
	head	agouti
	or	agoutis
	syl	a:gou+ties.
	pos	n.
	mod	pl.
agouti	1.
	syl	a:gou+ti
	pron	<*1gu:ti>
	pos	n.
	def	any hystricomorph rodent of the genus of Central and South America and the West Indies: family Agoutis are agile and long-legged, with hooflike claws, and are valued for their meat.
agouti	2.
	syl	a:gou+ti
	pron	<*1gu:ti>
	pos	n.
	def	a pattern of fur in certain rodents, characterized by irregular stripes.
agric	alt
	head	agr
	or	agr
	syl	agric.
agr	1.
	or	agric
	syl	agr.
	qual	abbrev. for:
	def	agricultural.
agr	2.
	or	agric
	syl	agr.
	qual	abbrev. for:
	def	agriculture.
agr	3.
	or	agric
	syl	agr.
	qual	abbrev. for:
	def	agricultur(al)ist.
AGR	0.
	syl	AGR
	qual	abbrev. for
	def	advanced gas-cooled reactor.
Agra	0.
	syl	A:gra
	pron	<1a:gr*>
	pos	n.
	def	a city in N India, in W Uttar Pradesh on the Jumna River: a capital of the Mogul empire until 1658; famous for its Mogul architecture, esp. the Taj Mahal. Pop.: 591917 (1971).
agraffe	ety	C18: from French, from grafe a hook
agrafe	alt
	head	agraffe
	or	agraffe
	syl	a:grafe
	pron	<*1gr@f>
	pos	n.
	qual	U.S. (sometimes
agraffe	1.
	or	agrafe
	syl	a:graffe
	pron	<*1gr@f>
	pos	n.
	def	a fastening consisting of a loop and hook, formerly used in armour and clothing.
agraffe	2.
	or	agrafe
	syl	a:graffe
	pron	<*1gr@f>
	pos	n.
	def	a metal cramp used to connect stones.
Agram	0.
	syl	A:gram
	pron	<1a:gram>
	pos	n.
	def	the German name for {Zagreb}.
agranulocytosis	ety	C20: New Latin; see #7a -%1#7, granule, -#7cyte, -#7osis 
agranulocytosis	0.
	syl	a:gran+u:lo+cy+to:sis
	pron	<*2gr@njul*usI1t*usis>
	pos	n.
	def	a serious and sometimes fatal illness characterized by a marked reduction of leucocytes, usually caused by hypersensitivity to certain drugs.
agrapha	ety	Greek: things not written, from #7a -%1#7+ graphein to write
agrapha	0.
	syl	ag+ra+pha
	pron	<1@gr*f*>
	pos	n.
	mod	pl.
	def	sayings of Jesus not recorded in the canonical Gospels.
agraphia	ety	C19: New Latin, from #7a -%1#7+ Greek graphein to write
agraphia	0.
	syl	a:graph:i:a
	pron	<*1gr@fi*>
	pos	n.
	def	loss of the ability to write, resulting from a brain lesion.
agrarian	ety	C16: from Latin agr*_arius, from ager field, land
agrarian	1.
	syl	a:grar+i:an
	pron	<*1gre*ri*n>
	pos	adj.
	def	of or relating to land or its cultivation or to systems of dividing landed property.
agrarian	2.
	syl	a:grar+i:an
	pron	<*1gre*ri*n>
	pos	adj.
	def	of or relating to rural or agricultural matters.
agrarian	3.
	syl	a:grar+i:an
	pron	<*1gre*ri*n>
	pos	adj.
	usage	of plants
	def	growing wild. {~}
agrarian	4.
	syl	a:grar+i:an
	pron	<*1gre*ri*n>
	pos	adj.
	def	a person who favours the redistribution of landed property.
agrarianism	sub
	head	agrarian
	syl	a:1grar:i+an+ism
	pos	n.
agree	ety	C14: from Old French agreer, from the phrase a gre at will or pleasure
agrees	infl
	head	agree
	syl	a:grees
	pos	vb.
	mod	mainly; intr.
agreeing	infl
	head	agree
	syl	a:gree+ing
	pos	vb.
	mod	mainly; intr.
agreed	infl
	head	agree
	syl	a:greed.
	pos	vb.
	mod	mainly; intr.
agree	1.
	syl	a:gree
	pron	<*1grE>
	pos	vb.
	mod	mainly; intr.
	usage	often foll. by with
	def	to be of the same opinion; concur.
agree	2.
	syl	a:gree
	pron	<*1grE>
	pos	vb.
	mod	also; tr. when; intr. often foll. by to; when; tr.
	usage	an infinitive
	def	to give assent; consent.
	exam	1	she agreed to go home;
	exam	2	I'll agree to that.
agree	3.
	syl	a:gree
	pron	<*1grE>
	pos	vb.
	mod	also; tr. when; intr. foll. by on or about; when; tr.
	usage	may take a clause as object
	def	to come to terms (about); arrive at a settlement (on).
agree	4.
	syl	a:gree
	pron	<*1grE>
	pos	vb.
	mod	mainly; intr.
	usage	foll. by with
	def	to be similar or consistent; harmonize; correspond.
agree	5.
	syl	a:gree
	pron	<*1grE>
	pos	vb.
	mod	mainly; intr.
	usage	foll. by with
	def	to be agreeable or suitable (to one's health, temperament, etc.).
agree	6.
	syl	a:gree
	pron	<*1grE>
	pos	vb.
	mod	mainly; intr.
	qual	Grammar.
	def	to undergo agreement.
agree	7.
	syl	a:gree
	pron	<*1grE>
	pos	vb.
	mod	tr.
	usage	takes a clause as object
	def	to concede or grant; admit.
	exam	1	they agreed that the price was too high.
agreeable	1.
	syl	a:gree+a:ble
	pron	<*1grE*bL>
	pos	adj.
	def	pleasing; pleasant.
agreeable	2.
	syl	a:gree+a:ble
	pron	<*1grE*bL>
	pos	adj.
	def	prepared to consent.
agreeable	3.
	syl	a:gree+a:ble
	pron	<*1grE*bL>
	pos	adj.
	usage	foll. by to or with
	def	in keeping; consistent.
	exam	1	salaries agreeable with current trends.
agreeable	4.
	syl	a:gree+a:ble
	pron	<*1grE*bL>
	pos	adj.
	usage	foll. by to
	def	to one's liking.
	exam	1	the terms were not agreeable to him.
agreeableness	sub
	head	agreeable
	syl	a:1gree+a:ble+ness
	pos	n.
agreeably	sub
	head	agreeable
	syl	a:1gree+a:bly
	pos	adv.
agreed	0.
	syl	a:greed
	pron	<*1grEd>
	pos	adj.
	def	determined by common consent.
	exam	1	the agreed price.
agreement	ety	C14: from Old French
agreement	1.
	syl	a:gree+ment
	pron	<*1grEm*nt>
	pos	n.
	def	the act of agreeing.
agreement	2.
	syl	a:gree+ment
	pron	<*1grEm*nt>
	pos	n.
	def	a settlement, esp. one that is legally enforceable; covenant; treaty.
agreement	3.
	syl	a:gree+ment
	pron	<*1grEm*nt>
	pos	n.
	def	a contract or document containing such a settlement.
agreement	4.
	syl	a:gree+ment
	pron	<*1grEm*nt>
	pos	n.
	def	the state of being of the same opinion; concord; harmony.
agreement	5.
	syl	a:gree+ment
	pron	<*1grEm*nt>
	pos	n.
	def	the state of being similar or consistent; correspondence; conformity.
agreement	6.
	syl	a:gree+ment
	pron	<*1grEm*nt>
	pos	n.
	qual	Grammar.
	def	the determination of the inflectional form of one word by some grammatical feature, such as number or gender, of another word, esp. one in the same sentence. Also called: {concord}.
agrestal	0.
	syl	a:gres+tal
	pron	<*1grest*l>
	pos	adj.
	usage	of uncultivated plants such as weeds
	def	growing on cultivated land.
agrestic	ety	C17: from Latin agrestis, from ager field
agrestic	1.
	syl	a:gres+tic
	pron	<*1grestik>
	pos	adj.
	def	rural; rustic.
agrestic	2.
	syl	a:gres+tic
	pron	<*1grestik>
	pos	adj.
	def	unpolished; uncouth.
agribusiness	ety	C20: from #7agri (#7culture) +#7business 
agribusiness	0.
	syl	ag+ri+busi+ness
	pron	<1@gri2biznis>
	pos	n.
	def	the various businesses collectively that process, distribute, and support farm products.
agr	alt
	head	agric
	or	agric
	syl	agr.
agric	1.
	or	agr
	syl	agric.
	qual	abbrev. for:
	def	agricultural.
agric	2.
	or	agr
	syl	agric.
	qual	abbrev. for:
	def	agriculture.
agric	3.
	or	agr
	syl	agric.
	qual	abbrev. for:
	def	agricultur(al)ist.
Georgius	1.
	head	Agricola
	syl	Geor:gi:us
	pron	<1Jc:Ji*s>
	def	original name 1494-1555, German mineralogist, metallurgist, and author, commonly regarded as the father of mineralogy.
Gnaeus Julius	2.
	head	Agricola
	syl	Gnae:us Ju:li:us
	pron	<1nE*s> <1Ju:li*s>
	def	40-93 #7a.d., Roman general; governor of Britain who advanced Roman rule north to the Firth of Forth.
agriculture	ety	C17: from Latin agricult*_ura, from ager field, land+ cult*_ura #7culture 
agriculture	0.
	syl	ag+ri+cul+ture
	pron	<1@gri2k^lC*>
	pos	n.
	def	the science or occupation of cultivating land and rearing crops and livestock; farming; husbandry.
agricultural	sub
	head	agriculture
	syl	ag+ri+1cul+tur+al
	pos	adj.
agriculturally	sub
	head	agriculture
	syl	ag+ri+1cul+tur+al+ly
	pos	adv.
agriculturist	sub
	head	agriculture
	or	agriculturalist
	syl	ag+ri+1cul+tur+ist
	pos	n.
agriculturalist	sub
	head	agriculture
	or	agriculturist
	syl	ag+ri+1cul+tur+al+ist
	pos	n.
Agrigento	0.
	syl	A:gri+gen+to
	pron	Italian <agri1Jento>
	pos	n.
	def	a town in Italy, in SW Sicily: site of six Greek temples. Pop.: 49213 (1971). Former name (until 1927): {Girgenti}.
agrimony	ety	C15: altered from egrimonie (C14), via Old French from Latin agrim*_onia, variant of argem*_onia from Greek argem*_on*_e poppy
agrimony	1.
	syl	ag+ri+mo+ny
	pron	<1@grim*ni>
	pos	n.
	def	any of various temperate rosaceous plants of the genus which have compound leaves, long spikes of small yellow flowers, and bristly burlike fruits.
agrimony	2.
	syl	ag+ri+mo+ny
	pron	<1@grim*ni>
	pos	n.
	def	any of several other plants, such as hemp agrimony.
Marcus Vipsanius	infl
	head	Agrippa
	syl	Mar:cus Vip:sa:ni:us
	pron	<1ma:k*s> <vip1sA?!ni*s>
	pos	n.
Agrippa	0.
	syl	A:grip:pa
	pron	<*1grip*>
	pos	n.
	def	63-12 #7b.c., Roman general: chief adviser and later son-in-law of Augustus.
Agrippina	1.
	syl	Ag:rip:pi:na
	pron	<2@gri1pEn*>
	pos	n.
	def	called 14 #7b.c. -33 #7a.d., Roman matron: granddaughter of Augustus: wife of Germanicus, mother of Caligula and Agrippina the Younger.
Agrippina	2.
	syl	Ag:rip:pi:na
	pron	<2@gri1pEn*>
	pos	n.
	def	called 15-59 #7a.d., mother of Nero, who put her to death after he became emperor.
agro-	ety	from Greek agros field
agro-	0.
	syl	ag:ro-
	usage	combining form.
	def	denoting fields, soil, or agriculture.
	exam	1	agronomy.
agrobiology	0.
	syl	ag+ro+bi+ol+o:gy
	pron	<2@gr*ubI1ol*Ji>
	pos	n.
	def	the science of plant growth and nutrition in relation to agriculture.
agrobiological	sub
	head	agrobiology
	syl	ag+ro+bi:o+log:i+cal
	pron	<2@gr*u2bI*1loJikL>
	pos	adj.
agrobiologist	sub
	head	agrobiology
	syl	ag+ro+bi+1ol:o+gist
	pos	n.
agrology	0.
	syl	a:grol+o:gy
	pron	<*1grol*Ji>
	pos	n.
	def	the scientific study of soils and their potential productivity.
agrological	sub
	head	agrology
	syl	ag+ro+log:i+cal
	pron	<2@gr*1loJikL>
	pos	adj.
agron	0.
	syl	agron.
	qual	abbrev. for
	def	agronomy.
agronomics	0.
	syl	ag+ro+nom+ics
	pron	<2@gr*1nomiks>
	pos	n.
	mod	functioning as; sing.
	def	the branch of economy dealing with the distribution, management, and productivity of land.
agronomic	sub
	head	agronomics
	or	agronomical
	syl	ag+ro+1nom+ic
	pos	adj.
agronomical	sub
	head	agronomics
	or	agronomic
	syl	ag+ro+1nom:i+cal
	pos	adj.
agronomy	0.
	syl	a:gron:o+my
	pron	<*1gron*mi>
	pos	n.
	def	the science of cultivation of land, soil management, and crop production.
agronomist	sub
	head	agronomy
	syl	a:1gron:o+mist
	pos	n.
agrostology	ety	C19: from Greek agr*_ostis a type of grass+-#7logy 
agrostology	0.
	syl	ag+ros+tol+o:gy
	pron	<2@gr*1stol*Ji>
	pos	n.
	def	the branch of botany concerned with the study of grasses.
aground	0.
	syl	a:ground
	pron	<*1graund>
	pos	adv. adj.
	usage	postpositive
	def	on or onto the ground or bottom, as in shallow water.
agrypnotic	ety	C20: from Greek agrupnos wakeful, from agrein to pursue+ hupnos sleep
agrypnotic	1.
	syl	ag+ryp+not+ic
	pron	<2@grip1notik>
	pos	adj.
	def	inducing, relating to, or characterized by insomnia.
agrypnotic	2.
	syl	ag+ryp+not+ic
	pron	<2@grip1notik>
	pos	n.
	def	a drug or agent that induces insomnia.
agt	1.
	syl	agt.
	qual	abbrev. for:
	def	agent.
agt	2.
	syl	agt.
	qual	abbrev. for:
	def	agreement.
aguardiente	ety	C19: Spanish: burning water
aguardiente	0.
	syl	a:guar+dien+te
	pron	Spanish. <a$Gwar1DjAntA>
	pos	n.
	def	any inferior brandy or similar spirit, esp. from Spain, Portugal, or South America.
Aguascalientes	1.
	syl	A:guas+ca+lien+tes
	pron	Spanish <2a$Gwaska1ljAntAs>
	pos	n.
	def	a state in central Mexico. Pop.: 338142 (1970). Area: 6472 sq. km (2499 sq. miles).
Aguascalientes	2.
	syl	A:guas+ca+lien+tes
	pron	Spanish <2a$Gwaska1ljAntAs>
	pos	n.
	def	a city in central Mexico, capital of Aguascalientes state, about 1900 m (6200 ft.) above sea level, with hot springs. Pop.: 221538 (1975 est.).
ague	ety	C14: from Old French (fievre) ague acute fever; see #7acute 
ague	1.
	syl	a:gue
	pron	<1Agju:>
	pos	n.
	def	malarial fever with successive stages of fever and chills.
ague	2.
	syl	a:gue
	pron	<1Agju:>
	pos	n.
	def	a fit of shivering.
agueweed	1.
	syl	a:gue+weed
	pron	<1Agju:2wEd>
	pos	n.
	def	a North American gentianaceous plant, that has clusters of pale blue-violet or white flowers.
agueweed	2.
	syl	a:gue+weed
	pron	<1Agju:2wEd>
	pos	n.
	def	another name for {boneset}.
Cape	infl
	head	Agulhas
	syl	Cape.
	pos	n.
Agulhas	0.
	syl	A:gul+has
	pron	<*1g^l*s>
	pos	n.
	def	a headland in South Africa, the southernmost point of the African Continent.
ah	0.
	syl	ah
	pron	<a:>
	pos	interj.
	def	an exclamation expressing pleasure, pain, sympathy, etc., according to the intonation of the speaker.
ah	0.
	syl	a.h.
	qual	abbrev. for
	def	ampere-hour.
AH	ety	Latin
AH	0.
	syl	A.H.
	qual	abbrev. for
	usage	indicating years in the Muslim system of dating, numbered from the Hegira (622 #7a.d.
	def	anno Hegirae.
aha	0.
	syl	a:ha
	pron	<a:1ha:>
	pos	interj.
	def	an exclamation expressing triumph, surprise, etc., according to the intonation of the speaker.
Ahab	0.
	syl	A:hab
	pron	<1Ah@b>
	pos	n.
	qual	Old Testament.
	def	the king of Israel from approximately 869 to 850 #7b.c. and husband of Jezebel: rebuked by Elijah (I Kings 16:29-22:40).
Ahasuerus	0.
	syl	A:has:u:e:rus
	pron	<*2h@zju:1i*r*s>
	pos	n.
	qual	Old Testament.
	def	a king of ancient Persia and husband of Esther, generally identified with Xerxes.
ahead	1.
	syl	a:head
	pron	<*1hed>
	pos	adj.
	usage	postpositive
	def	in front; in advance.
ahead	2.
	syl	a:head
	pron	<*1hed>
	pos	adv.
	def	at or in the front; in advance; before.
ahead	3.
	syl	a:head
	pron	<*1hed>
	pos	adv.
	def	onwards; forwards.
	exam	1	go straight ahead.
ahead	4.a.
	syl	a:head
	pron	<*1hed>
	pos	adv.
	def	in front of; at a further advanced position than.
ahead	4.b.
	syl	a:head
	pron	<*1hed>
	pos	adv.
	qual	Stock Exchange.
	def	in anticipation of.
	exam	1	the share price rose ahead of the annual figures.
be ahead	infl
	head	ahead
	syl	be ahead.
	pos	adv.
	qual	Informal.
ahead	5.
	syl	a:head
	pron	<*1hed>
	pos	adv.
	def	to have an advantage; be winning.
	exam	1	ahead on points.
get ahead	6.
	head	ahead
	syl	get ahead.
	def	to advance or attain success.
ahem	0.
	syl	a:hem
	pron	<*1hem>
	pos	interj.
	def	a clearing of the throat, used to attract attention, express doubt, etc.
ahimsa	ety	Sanskrit, from #7a -%1#7+ hims*_a injury
ahimsa	0.
	syl	a:him+sa
	pron	<a:1himsa:>
	pos	n.
	usage	in Hindu, Buddhist, and Jainist philosophy
	def	the law of reverence for, and nonviolence to, every form of life.
ahistoric	alt
	head	ahistorical
	or	ahistorical
	syl	a:his+tor+ic
	pos	adj.
ahistorical	0.
	or	ahistoric
	syl	a:his+tor:i+cal
	pron	<2Ahis1torik*l>
	pos	adj.
	def	not related to history; not historical.
Achitophel	alt
	head	Ahithophel
	or	Ahithophel
	syl	A:chit:o:phel
	pos	n.
Ahithophel	0.
	or	Achitophel
	syl	A:hith:o:phel
	pron	<*1hiT*2fel>
	pos	n.
	qual	Old Testament.
	def	a member of David's council, who became one of Absalom's advisers in his rebellion and hanged himself when his advice was overruled (II Samuel 15:12-17:23).
Ahmadabad	alt
	head	Ahmedabad
	or	Ahmedabad
	syl	Ah+mad:a+bad
	pron	<1a:m*d*2ba:d>
	pos	n.
Ahmedabad	0.
	or	Ahmadabad
	syl	Ah+med:a+bad
	pron	<1a:m*d*2ba:d>
	pos	n.
	def	a city in W India, capital of Gujarat state: famous for its mosque. Pop.: 1585544 (1971).
Ahmadnagar	alt
	head	Ahmednagar
	or	Ahmednagar
	syl	Ah+mad+na+gar
	pron	<2a:m*d1n^g*>
	pos	n.
Ahmednagar	0.
	or	Ahmadnagar
	syl	Ah+med+na+gar
	pron	<2a:m*d1n^g*>
	pos	n.
	def	a city in W India, in Maharashtra: formerly one of the kingdoms of Deccan. Pop.: 118236 (1971).
A horizon	0.
	syl	A ho+ri+zon
	pos	n.
	def	the top layer of a soil profile, usually dark coloured and containing humus, from which the soluble salts have been leached. See {B horizon, C horizon}.
ahoy	0.
	syl	a:hoy
	pron	<*1hci>
	pos	interj.
	qual	Nautical.
	def	a hail used to call a ship or to attract attention.
AHQ	0.
	syl	AHQ
	qual	abbrev. for
	def	Army Headquarters.
Ahriman	0.
	syl	Ah:ri:man
	pron	<1a:rim*n>
	pos	n.
	qual	Zoroastrianism.
	def	the supreme evil spirit and diabolical opponent of Ormazd.
Ahura Mazda	0.
	syl	A:hu:ra Maz:da
	pron	<*1hu*r*> <1m@zd*>
	pos	n.
	qual	Zoroastrianism.
	def	another name for {Ormazd}.
Ahvenanmaa	0.
	syl	Ah+ve+nan+maa
	pron	<1ahvenamma:>
	pos	n.
	def	the Finnish name for the {*%Aland Islands}.
Ahvaz	alt
	head	Ahwaz
	or	Ahwaz
	syl	Ah+vaz
	pron	<a:1va:z>
	pos	n.
Ahwaz	0.
	or	Ahvaz
	syl	Ah+waz
	pron	<a:1wa:z>
	pos	n.
	def	a town in SW Iran, on the Karun River. Pop.: 302000 (1973 est.).
ai	ety	C17: from Portuguese, from Tupi
ais	infl
	head	ai
	syl	a:is.
	pos	n.
	mod	pl.
ai	0.
	syl	a:i
	pron	<1a:i>
	pos	n.
	def	another name for {three-toed sloth} (see {{sloth} (sense 1)}).
AI	0.
	syl	A.I.
	qual	abbrev. for
	def	artificial insemination.
AIA	0.
	syl	A.I.A.
	qual	abbrev. for
	def	Associate of the Institute of Actuaries.
AICC	0.
	syl	A.I.C.C.
	qual	abbrev. for
	def	All India Congress Committee: the national assembly of the Indian National Congress.
aid	ety	C15: via Old French aidier from Latin adj*_ut*_are to help, from juv*_are to help
aid	1.
	syl	aid
	pron	<Ad>
	pos	vb.
	def	to give support to (someone to do something); help or assist.
aid	2.
	syl	aid
	pron	<Ad>
	pos	vb.
	mod	tr.
	def	to assist financially.
aid	3.
	syl	aid
	pron	<Ad>
	pos	n.
	def	assistance; help; support.
aid	4.
	syl	aid
	pron	<Ad>
	pos	n.
	def	a person, device, etc., that helps or assists.
	exam	1	a teaching aid.
aid	5.
	syl	aid
	pron	<Ad>
	pos	n.
	usage	in medieval Europe; in England after 1066
	def	a feudal payment made to the king or any lord by his vassals, usually on certain occasions such as the marriage of a daughter or the knighting of an eldest son.
in aid of	6.
	head	aid
	syl	in aid of.
	qual	Brit. informal.
	def	in support of; for the purpose of.
aider	sub
	head	aid
	syl	aid+er
	pos	n.
AID	1.
	syl	A.I.D.
	qual	abbrev. for:
	def	acute infectious disease.
AID	2.
	syl	A.I.D.
	qual	abbrev. for:
	def	artificial insemination (by) donor.
AID	3.
	syl	A.I.D.
	qual	abbrev. for:
	def	Agency for International Development.
Saint	infl
	head	Aidan
	syl	Saint.
	pos	n.
Aidan	0.
	syl	Ai:dan
	pron	<1AdN>
	pos	n.
	def	died 651 #7a.d. Irish missionary in Northumbria, who founded the monastery at Lindisfarne (635).
aide	1.
	syl	aide
	pron	<Ad>
	pos	n.
	def	short for {aide-de-camp}.
aide	2.
	syl	aide
	pron	<Ad>
	pos	n.
	def	an assistant.
aide-de-camp	ety	C17: from French: camp assistant
aid-de-camp	alt
	head	aide-de-camp
	or	aide-de-camp
	syl	aid-de-camp
	pron	<1Ad> <d*> <1koG>
	pos	n.
aides-de-camp	infl
	head	aide-de-camp
	or	aids-de-camp
	syl	aides-de-camp
	pos	n.
	mod	pl.
aids-de-camp	infl
	head	aide-de-camp
	or	aides-de-camp
	syl	aids-de-camp.
	pos	n.
	mod	pl.
aide-de-camp	0.
	or	aid-de-camp
	syl	aide-de-camp
	pron	<1Ad> <d*> <1koG>
	pos	n.
	def	a military officer serving as personal assistant to a senior. Abbrev.: {A.D.C., ADC, a.d.c}.
aide-m'emoire	ety	from aider to help+ m*'emoire memory
aides-m'emoire	infl
	head	aide-m'emoire
	syl	aides-m*'e:moire
	pron	<ed> <mA1mwa:r>, English <1Adz> <mem1wa:>
	pos	n.
	mod	pl.
aide-m'emoire	0.
	syl	aide-m*'e:moire
	pron	French. <ed> <mA1mwa:r>, English <1Ad> <mem1wa:>, English <1Adz> <mem1wa:>
	pos	n.
	def	a memorandum or summary of the items of an agreement, etc.
Aidin	0.
	syl	Ai:din
	pron	<1Idin>
	pos	n.
	def	a variant spelling of {Aydin}.
AIF	0.
	syl	A.I.F.
	qual	abbrev. for
	def	Australian Imperial Force.
aiglet	0.
	syl	ai:glet
	pron	<1Aglit>
	pos	n.
	def	a variant of {aglet}.
aigret	alt
	head	aigrette
	or	aigrette
	syl	ai:gret
	pron	<1Agret>, <A1gret>
	pos	n.
aigrette	1.
	or	aigret
	syl	ai:grette
	pron	<1Agret>, <A1gret>
	pos	n.
	def	a long plume worn on hats or as a headdress, esp. one of long egret feathers.
aigrette	2.
	or	aigret
	syl	ai:grette
	pron	<1Agret>, <A1gret>
	pos	n.
	def	an ornament or piece of jewellery in imitation of a plume of feathers.
aiguille	ety	C19: French, literally: needle
aiguille	1.
	syl	ai:guille
	pron	<A1gwEl>, <1AgwEl>
	pos	n.
	def	a rock mass or mountain peak shaped like a needle.
aiguille	2.
	syl	ai:guille
	pron	<A1gwEl>, <1AgwEl>
	pos	n.
	def	an instrument for boring holes in rocks or masonry.
aiguillette	1.
	syl	ai:guil+lette
	pron	<2Agwi1let>
	pos	n.
	def	a metal tip or tag on loops of ornamental braid on military uniforms.
aiguillette	2.
	syl	ai:guil+lette
	pron	<2Agwi1let>
	pos	n.
	def	a variant of {aglet}.
AIH	0.
	syl	A.I.H.
	qual	abbrev. for
	def	artificial insemination (by) husband.
aikido	ety	from Japanese, from ai to harmonize+ ki control, breath+ do way
aikido	0.
	syl	ai:kid:o
	pron	<1Ikid*u>
	pos	n.
	def	a Japanese system of self-defence employing similar principles to judo.
aikona	ety	from Zulu
aikona	0.
	syl	ai:ko+na
	pron	<1Ikc:n*>
	pos	interj.
	qual	S. African.
	def	an informal word express?!ing strong negation.
ail	ety	Old English eglan to trouble, from egle troublesome, painful, related to Gothic agls shameful
ail	1.
	syl	ail
	pron	<Al>
	pos	vb.
	mod	tr.
	def	to trouble; afflict.
ail	2.
	syl	ail
	pron	<Al>
	pos	vb.
	mod	intr.
	def	to feel unwell.
ailanthus	ety	C19: New Latin, from Amboinese ai lanto tree (of) the gods
ailanthuses	infl
	head	ailanthus
	syl	ai:lan+thus:es.
	pos	n.
	mod	pl.
ailanthus	0.
	syl	ai:lan+thus
	pron	<A1l@nT*s>
	pos	n.
	def	an E Asian simaroubaceous deciduous tree, planted in Europe and North America, having pinnate leaves, small greenish flowers, and winged fruits. Also called: {tree of heaven}.
aileron	ety	C20: from French, diminutive of aile wing
aileron	0.
	syl	ai:ler+on
	pron	<1Al*2ron>
	pos	n.
	def	a flap hinged to the trailing edge of an aircraft wing to provide lateral control, as in a bank or roll.
ailing	0.
	syl	ail+ing
	pron	<1AliG>
	pos	adj.
	def	unwell, esp. over a long period.
ailment	0.
	syl	ail+ment
	pron	<1Alm*nt>
	pos	n.
	def	a slight but often persistent illness.
ailurophile	ety	C20: facetious coinage from Greek ailuros cat+-#7phile 
ailurophile	0.
	syl	ai:lu+ro+phile
	pron	<I1lu*r*2fIl>
	pos	n.
	def	a person who likes cats.
ailurophilia	sub
	head	ailurophile
	syl	ai:lu+ro+phil:i:a
	pron	<I2lu*r*1fili*>
	pos	n.
ailurophobe	ety	C20: from Greek ailuros cat+-#7phobe 
ailurophobe	0.
	syl	ai:lu+ro+phobe
	pron	<I1lu*r*2f*ub>
	pos	n.
	def	a person who dislikes or is afraid of cats.
aim	ety	C14: via Old French aesmer from Latin aestim*_are to #7estimate 
aim	1.
	syl	aim
	pron	<Am>
	pos	vb.
	def	to point (a weapon, missile, etc.) or direct (a blow) at a particular person or object; level.
aim	2.
	syl	aim
	pron	<Am>
	pos	vb.
	mod	tr.
	def	to direct (satire, criticism, etc.) at a person, object, etc.
aim	3.
	syl	aim
	pron	<Am>
	pos	vb.
	mod	intr.
	usage	foll. by at or an infinitive
	def	to propose or intend.
	exam	1	we aim to leave early.
aim	4.
	syl	aim
	pron	<Am>
	pos	vb.
	mod	intr.
	usage	often foll. by at or for
	def	to direct one's efforts or strive (towards).
	exam	1	to aim at better communications;
	exam	2	to aim high.
aim	5.
	syl	aim
	pron	<Am>
	pos	n.
	def	the action of directing something at an object.
aim	6.
	syl	aim
	pron	<Am>
	pos	n.
	def	the direction in which something is pointed; line of sighting (esp. in the phrase {to take aim}) .
aim	7.
	syl	aim
	pron	<Am>
	pos	n.
	def	the object at which something is aimed; target.
aim	8.
	syl	aim
	pron	<Am>
	pos	n.
	def	intention; purpose.
aimless	0.
	syl	aim+less
	pron	<1Amlis>
	pos	adj.
	def	having no goal, purpose, or direction.
aimlessly	sub
	head	aimless
	syl	aim+less+ly
	pos	adv.
aimlessness	sub
	head	aimless
	syl	aim+less+ness
	pos	n.
ain	H1.0.
	syl	ain
	pron	<An>
	pos	determiner.
	def	a Scot. word for {own}.
ain	H2.0.
	syl	a:in
	pron	<1a:jin>
	pos	n.
	def	a variant spelling of {ayin}.
Ain	1.
	syl	Ain
	pron	French <?~e>
	pos	n.
	def	a department in E central France, in Rh*^one-Alpes region. Capital: Bourg. Pop.: 386943 (1975). Area: 5785 sq. km (2256 sq. miles).
Ain	2.
	syl	Ain
	pron	French <?~e>
	pos	n.
	def	a river in E France, rising in the Jura Mountains and flowing south to the Rh*^one. Length: 190 km (118 miles).
ain't	0.
	syl	ain't
	pron	<Ant>
	qual	Not standard. contraction of
	def	am not, is not, are not, have not, has not.
	exam	1	I ain't seen it. #e
Aintab	0.
	syl	Ain+tab
	pron	<In1ta:b>
	pos	n.
	def	the former name (until 1921) of {Gaziantep}.
Ainu	ety	Ainu: man
Ainus	infl
	head	Ainu
	or	Ainu
	syl	Ai:nus
	pos	n.
	mod	pl.
Ainu	infl
	or	Ainus
	syl	Ai:nu
	pos	n.
	mod	pl.
Ainu	1.
	syl	Ai:nu
	pron	<1Inu:>
	pos	n.
	def	a member of the aboriginal people of Japan, now mostly intermixed with Mongoloid immigrants whose skin colour is more yellowish.
Ainu	2.
	syl	Ai:nu
	pron	<1Inu:>
	pos	n.
	def	the language of this people, of no known relationships, still spoken in parts of Hokkaido and elsewhere.
aioli	ety	from French ail garlic
aioli	0.
	syl	a*"i:o:li
	pron	<I1*uli>, <A->
	pos	n.
	def	garlic mayonnaise.
air	ety	C13: via Old French and Latin from Greek a*_er the lower atmosphere
air	1.
	syl	air
	pron	<e*>
	pos	n.
	def	the mixture of gases that forms the earth's atmosphere. At sea level dry air has a density of 1.226 kilograms per sq. metre and consists of 78.08 per cent nitrogen, 20.95 per cent oxygen, 0.93 per cent argon, 0.03 per cent carbon dioxide, with smaller quantities of ozone and inert gases; water vapour varies between 0 and 4 per cent and in industrial areas sulphur gases may be present as pollutants.
air	2.
	syl	air
	pron	<e*>
	pos	n.
	def	the space above and around the earth; sky. Related adj.: {aerial}.
air	3.
	syl	air
	pron	<e*>
	pos	n.
	def	breeze; slight wind.
air	4.
	syl	air
	pron	<e*>
	pos	n.
	def	public expression; utterance.
	exam	1	to give air to one's complaints.
air	5.
	syl	air
	pron	<e*>
	pos	n.
	def	a distinctive quality.
	exam	1	an air of mystery.
air	6.
	syl	air
	pron	<e*>
	pos	n.
	def	a person's distinctive appearance, manner, or bearing.
air	7.a.
	syl	air
	pron	<e*>
	pos	n.
	def	a simple tune for either vocal or instrumental performance.
air	7.b.
	syl	air
	pron	<e*>
	pos	n.
	def	another word for {aria}.
air	8.
	syl	air
	pron	<e*>
	pos	n.
	def	transportation in aircraft (esp. in the phrase {by air) }.
air	9.
	syl	air
	pron	<e*>
	pos	n.
	def	an archaic word for {{breath} (senses 1-3).}
clear the air	10.
	head	air
	syl	clear the air.
	def	to rid a situation of tension or discord by settling misunderstandings, etc.
give (someone) the air	11.
	head	air
	syl	give (someone) the air.
	qual	Slang.
	def	to reject or dismiss (someone).
air	12.a.
	syl	air
	pron	<e*>
	pos	n.
	def	in circulation; current.
air	12.b.
	syl	air
	pron	<e*>
	pos	n.
	def	in the process of being decided; unsettled.
into thin air	13.
	head	air
	syl	into thin air.
	def	leaving no trace behind.
on	14.
	head	air
	or	off the air
	syl	on
	usage	not
	def	in the act of broadcasting or (not) being broadcast on radio or television.
take the air	15.
	head	air
	syl	take the air.
	def	to go out of doors, as for a short walk or ride.
air	16.a.
	syl	air
	pron	<e*>
	pos	n.
	def	uncertain.
air	16.b.
	syl	air
	pron	<e*>
	pos	n.
	qual	Informal.
	def	agitated or excited.
walk	17.
	head	air
	or	tread on air
	syl	walk
	def	to feel elated.
air	18.
	syl	air
	pron	<e*>
	pos	n.
	qual	Astrology.
	usage	modifier
	def	of or relating to a group of three signs of the zodiac, Gemini, Libra, and Aquarius. Compare {{earth} (sense 10)}, {{fire} (sense 24)}, {{water} (sense 12).}
air	19.
	syl	air
	pron	<e*>
	pos	vb.
	def	to expose or be exposed to the air so as to cool or freshen; ventilate.
	exam	1	to air a room.
air	20.
	syl	air
	pron	<e*>
	pos	vb.
	def	to expose or be exposed to warm or heated air so as to dry.
	exam	1	to air linen.
air	21.
	syl	air
	pron	<e*>
	pos	vb.
	mod	tr.
	def	to make known publicly; display; publicize.
	exam	1	to air one's opinions.
Air	0.
	syl	A:*"ir
	pron	<1a:i*>
	pos	n.
	def	a mountainous region of N central Niger, in the Sahara, rising to 1500 m (5000 ft.): a former native kingdom. Area: about 77700 sq. km (30000 sq. miles). Also called: {Asben, Azbine}.
AIR	0.
	syl	A.I.R.
	qual	abbrev. for
	def	All India Radio.
air alert	1.
	syl	air a:lert
	pos	n.
	qual	Military.
	def	the condition in which combat aircraft are airborne and ready for an operation.
air alert	2.
	syl	air a:lert
	pos	n.
	qual	Military.
	def	a signal to prepare for this.
air bag	0.
	syl	air bag
	pos	n.
	def	a safety device in a car, consisting of a bag that inflates automatically in an accident and prevents the passengers from being thrown forwards.
air base	0.
	syl	air base
	pos	n.
	def	a centre from which military aircraft operate. Also called: {air station}.
air bed	0.
	syl	air bed
	pos	n.
	def	an inflatable mattress.
air bladder	1.
	syl	air blad+der
	pos	n.
	qual	Ichthyol.
	def	an air-filled sac, lying above the alimentary canal in bony fishes, that regulates buoyancy at different depths by a variation in the pressure of the air. Also called: {swim bladder}.
air bladder	2.
	syl	air blad+der
	pos	n.
	def	any air-filled sac, such as one of the bladders of seaweeds.
airboat	0.
	syl	air+boat
	pron	<1e*2b*ut>
	pos	n.
	def	another name for {swamp boat}.
airborne	1.
	syl	air+borne
	pron	<1e*2bc:n>
	pos	adj.
	def	conveyed by or through the air.
airborne	2.
	syl	air+borne
	pron	<1e*2bc:n>
	pos	adj.
	usage	of aircraft
	def	flying; in the air.
air brake	1.
	syl	air brake
	pos	n.
	def	a brake operated by compressed air, esp. in heavy vehicles and trains.
air brake	2.
	syl	air brake
	pos	n.
	def	an articulated flap or small parachute for reducing the speed of an aircraft. Also called: {dive brake}.
air brake	3.
	syl	air brake
	pos	n.
	def	a rotary fan or propeller connected to a shaft to reduce its speed.
airbrick	0.
	syl	air+brick
	pron	<1e*2brik>
	pos	n.
	qual	Chiefly Brit.
	def	a brick with holes in it, put into the wall of a building for ventilation.
air bridge	0.
	syl	air bridge
	pos	n.
	qual	Brit.
	def	a link by air transport between two places, esp. two places separated by a stretch of sea.
airbrush	0.
	syl	air+brush
	pron	<1e*2br^S>
	pos	n.
	def	an atomizer for spraying paint or varnish by means of compressed air.
airburst	0.
	syl	air+burst
	pron	<1e*2bR:st>
	pos	n.
	def	the explosion of a bomb, shell, etc., in the air.
airbus	0.
	syl	air+bus
	pron	<1e*2b^s>
	pos	n.
	def	an airliner operated over short distances.
air chief marshal	0.
	syl	air chief mar+shal
	pos	n.
	def	a senior officer of the Royal Air Force and certain other air forces, of equivalent rank to admiral in the Royal Navy.
air commodore	0.
	syl	air com+mo+dore
	pos	n.
	def	a senior officer of the Royal Air Force and certain other air forces, of equivalent rank to brigadier in the Army.
air-condition	0.
	syl	air-con:di:tion
	pos	vb.
	mod	tr.
	def	to apply air conditioning to.
air conditioning	0.
	syl	air con+di+tion+ing
	pos	n.
	def	a system or process for controlling the temperature and sometimes the humidity and purity of the air in a house, etc.
air conditioner	sub
	head	air conditioning
	syl	air con+di+tion+er
	pos	n.
air-cool	0.
	syl	air-cool
	pos	vb.
	mod	tr.
	def	to cool (an engine, etc.) by a flow of air. Compare {water-cool}.
air corridor	0.
	syl	air cor+ri+dor
	pos	n.
	def	an air route along which aircraft are allowed to fly.
air cover	0.a.
	syl	air cov+er
	pos	n.
	def	the support of military forces by additional airborne units.
air cover	0.b.
	syl	air cov+er
	pos	n.
	def	the aircraft providing this. Also called: {air support}.
aircraft	infl
	syl	air+craft.
	pos	n.
	mod	pl.
aircraft	0.
	syl	air+craft
	pron	<1e*2kra:ft>
	pos	n.
	def	any machine capable of flying by means of buoyancy or aerodynamic forces, such as a glider, helicopter, or aeroplane.
aircraft carrier	0.
	syl	air+craft car+ri+er
	pos	n.
	def	a warship built with an extensive flat deck space for the launch and recovery of aircraft.
aircrafabric	alt
	head	aircraft cloth
	or	aircraft cloth
	syl	air+crafab+ric
	pos	n.
aircraft cloth	0.
	or	aircrafabric
	syl	air+craft cloth
	pos	n.
	def	variants of {aeroplane cloth}.
aircraftsman	alt
	head	aircraftman
	or	aircraftman
	syl	air+crafts+man
	pos	n.
aircraftmen	infl
	head	aircraftman
	syl	air+craft+men.
	pos	n.
	mod	pl.
aircraftman	0.
	or	aircraftsman
	syl	air+craft+man
	pron	<1e*2kra:ftm*n>
	pos	n.
	def	a serviceman of the most junior rank in the RAF. {?-#!air+craft+@!wom@.an} {#!air+crafts+@!wom@.an}
aircrew	0.
	syl	air+crew
	pron	<1e*2kru:>
	pos	n.
	def	the crew of an aircraft.
air curtain	0.
	syl	air cur+tain
	pos	n.
	def	an air stream across a doorway to exclude draughts, etc.
air cushion	1.
	syl	air cush+ion
	pos	n.
	def	an inflatable cushion, usually made of rubber or plastic.
air cushion	2.
	syl	air cush+ion
	pos	n.
	def	the pocket of air that supports a hovercraft.
air cushion	3.
	syl	air cush+ion
	pos	n.
	def	a form of pneumatic suspension consisting of an enclosed volume of air. See also {air spring}.
air cylinder	0.
	syl	air cyl+in+der
	pos	n.
	def	a cylinder containing air, esp. one fitted with a piston and used for damping purposes.
Airdrie	0.
	syl	Air+drie
	pron	<1e*dri>
	pos	n.
	def	a burgh and town in W central Scotland, E of Glasgow: coal and iron industries. Pop.: 37736 (1971).
airdrome	0.
	syl	air+drome
	pron	<1e*2dr*um>
	pos	n.
	def	the U.S. name for {aerodrome}.
airdrop	1.
	syl	air+drop
	pron	<1e*2drop>
	pos	n.
	def	a delivery of supplies, troops, etc., from an aircraft by parachute.
airdrops	infl
	head	airdrop
	syl	air+drops
	pos	vb.
airdropping	infl
	head	airdrop
	syl	air+drop+ping
	pos	vb.
airdropped	infl
	head	airdrop
	syl	air+dropped.
	pos	vb.
airdrop	2.
	syl	air+drop
	pron	<1e*2drop>
	pos	vb.
	mod	tr.
	def	to deliver (supplies, etc.) by an airdrop.
air-dries	infl
	head	air-dry
	syl	air-dries
	pos	vb.
	mod	tr.
air-drying	infl
	head	air-dry
	syl	air-dry+ing
	pos	vb.
	mod	tr.
air-dried	infl
	head	air-dry
	syl	air-dried.
	pos	vb.
	mod	tr.
air-dry	0.
	syl	air-dry
	pos	vb.
	mod	tr.
	def	to dry by exposure to the air.
Aire	0.
	syl	Aire
	pron	<e*>
	pos	n.
	def	a river in N England rising in the Pennines and flowing southeast mainly through West Yorkshire to the Ouse. Length: 112 km (70 miles).
Airedale	ety	C19: name of a district in Yorkshire
Airedale	0.
	syl	Aire+dale
	pron	<1e*2dAl>
	pos	n.
	def	a large rough-haired tan-coloured breed of terrier characterized by a black saddle-shaped patch on the back. Also called: {Airedale terrier}.
air embolism	0.
	syl	air em+bo+lism
	pos	n.
	def	another name for {aeroembolism}.
airfield	0.
	syl	air+field
	pron	<1e*2fEld>
	pos	n.
	def	a landing and taking-off area for aircraft, usually with permanent buildings.
airflow	0.
	syl	air+flow
	pron	<1e*2fl*u>
	pos	n.
	def	the flow of air in a wind tunnel or past a moving aircraft, car, train, etc.; airstream.
airfoil	0.
	syl	air+foil
	pron	<1e*2fcil>
	pos	n.
	def	the U.S. name for {aerofoil}.
air force	1.a.
	syl	air force
	pos	n.
	def	the branch of a nation's armed services primarily responsible for military aircraft.
air force	1.b.
	syl	air force
	pos	n.
	usage	as modifier
	exam	1	an air-force base.
air force	2.
	syl	air force
	pos	n.
	def	a formation in the U.S. and certain other air forces larger than an air division but smaller than an air command.
airframe	0.
	syl	air+frame
	pron	<1e*2frAm>
	pos	n.
	def	the body of an aircraft, excluding its engines.
air gas	0.
	syl	air gas
	pos	n.
	def	another name for {producer gas}.
airglow	0.
	syl	air+glow
	pron	<1e*2gl*u>
	pos	n.
	def	the faint light from the upper atmosphere in the night sky, esp. in low latitudes.
air gun	0.
	syl	air gun
	pos	n.
	def	a gun discharged by means of compressed air.
airhead	0.
	syl	air+head
	pron	<1e*2hed>
	pos	n.
	qual	Military, chiefly U.S.
	def	an area secured in hostile territory of sufficient size to allow the continuous supply of troops and equipment by air.
air hole	1.
	syl	air hole
	pos	n.
	def	a hole that allows the passage of air, esp. for ventilation.
air hole	2.
	syl	air hole
	pos	n.
	def	a section of open water in a frozen surface.
air hole	3.
	syl	air hole
	pos	n.
	def	a less common name for {{air pocket} (sense 1).}
air hostess	0.
	syl	air host+ess
	pos	n.
	def	a stewardess on an airliner.
airily	1.
	syl	air:i+ly
	pron	<1e*rili>
	pos	adv.
	def	in a jaunty or high-spirited manner.
airily	2.
	syl	air:i+ly
	pron	<1e*rili>
	pos	adv.
	def	in a light or delicate manner.
airiness	1.
	syl	air:i+ness
	pron	<1e*rinis>
	pos	n.
	def	the quality or condition of being fresh, light, or breezy.
airiness	2.
	syl	air:i+ness
	pron	<1e*rinis>
	pos	n.
	def	lightness of heart; gaiety.
airing	1.a.
	syl	air+ing
	pron	<1e*riG>
	pos	n.
	def	exposure to air or warmth, as for drying or ventilation.
airing	1.b.
	syl	air+ing
	pron	<1e*riG>
	pos	n.
	usage	as modifier
	exam	1	airing cupboard.
airing	2.
	syl	air+ing
	pron	<1e*riG>
	pos	n.
	def	an excursion in the open air.
airing	3.
	syl	air+ing
	pron	<1e*riG>
	pos	n.
	def	exposure to public debate.
air-intake	1.a.
	syl	air-in:take
	pos	n.
	def	an opening in an aircraft through which air is drawn, esp. for the engines.
air-intake	1.b.
	syl	air-in:take
	pos	n.
	def	the amount of air drawn in.
air-intake	2.
	syl	air-in:take
	pos	n.
	def	the part of a carburettor or similar device through which air enters an internal-combustion engine.
air-intake	3.
	syl	air-in:take
	pos	n.
	def	any opening, etc., through which air enters.
air jacket	1.
	syl	air jack+et
	pos	n.
	def	an air-filled envelope or compartment surround?!ing a machine or part to reduce the rate at which heat is transferred to or from it. Compare {water jacket}.
air jacket	2.
	syl	air jack+et
	pos	n.
	def	a less common name for {life jacket}.
airless	1.
	syl	air+less
	pron	<1e*lis>
	pos	adj.
	def	lacking fresh air; stuffy or sultry.
airless	2.
	syl	air+less
	pron	<1e*lis>
	pos	adj.
	def	devoid of air.
airlessness	sub
	head	airless
	syl	air+less+ness
	pos	n.
air letter	0.
	syl	air let+ter
	pos	n.
	def	another name for {{aerogram} (sense 1).}
airlift	1.
	syl	air+lift
	pron	<1e*2lift>
	pos	n.
	def	the transportation by air of passengers, troops, cargo, etc., esp. when other routes are blocked.
airlift	2.
	syl	air+lift
	pron	<1e*2lift>
	pos	vb.
	mod	tr.
	def	to transport by an airlift.
airline	1.a.
	syl	air+line
	pron	<1e*2lIn>
	pos	n.
	def	a system or organization that provides scheduled flights for passengers or cargo.
airline	1.b.
	syl	air+line
	pron	<1e*2lIn>
	pos	n.
	usage	as modifier
	exam	1	an airline pilot.
airline	2.
	syl	air+line
	pron	<1e*2lIn>
	pos	n.
	def	a hose or tube carrying air under pressure.
airline	3.
	syl	air+line
	pron	<1e*2lIn>
	pos	n.
	qual	Chiefly U.S.
	def	a beeline.
airliner	0.
	syl	air+lin+er
	pron	<1e*2lIn*>
	pos	n.
	def	a large passenger aircraft.
airlock	1.
	syl	air+lock
	pron	<1e*2lok>
	pos	n.
	def	a bubble in a pipe causing an obstruction or stoppage to the flow.
airlock	2.
	syl	air+lock
	pron	<1e*2lok>
	pos	n.
	def	an airtight chamber with regulated air pressure used to gain access to a space that has air under pressure.
air mail	1.
	syl	air mail
	pos	n.
	def	the system of conveying mail by aircraft.
air mail	2.
	syl	air mail
	pos	n.
	def	mail conveyed by aircraft.
air-mail	infl
	head	air mail
	syl	air-mail.
	pos	adj.
air mail	3.
	syl	air mail
	pos	adj.
	def	of, used for, or concerned with air mail.
air-mail	infl
	head	air mail
	syl	air-mail.
	pos	vb.
air mail	4.
	syl	air mail
	pos	vb.
	mod	tr.
	def	to send by air mail.
airmen	infl
	head	airman
	syl	air+men.
	pos	n.
	mod	pl.
airman	0.
	syl	air+man
	pron	<1e*m*n>
	pos	n.
	def	an aviator, esp. one serving in the armed forces.
airwoman	sub
	head	airman
	syl	air+2wom:an
	pos	n.
	mod	fem.
air marshal	1.
	syl	air mar+shal
	pos	n.
	def	a senior Royal Air Force officer of equivalent rank to a vice admiral in the Royal Navy.
air marshal	2.
	syl	air mar+shal
	pos	n.
	def	a Royal Australian Air Force officer of the highest rank.
air mass	0.
	syl	air mass
	pos	n.
	def	a large body of air having characteristics of temperature, moisture, and pressure that are approximately uniform horizontally.
air mile	0.
	syl	air mile
	pos	n.
	def	another name for {{nautical mile} (sense 1).}
air-minded	0.
	syl	air-mind:ed
	pos	adj.
	def	interested in or promoting aviation or aircraft.
air-mindedness	sub
	head	air-minded
	syl	air-mind:ed+ness
	pos	n.
Air Officer	0.
	syl	Air Of+fic+er
	pos	n.
	def	an officer in the Royal Air Force above the rank of Group Captain.
airplane	0.
	syl	air+plane
	pron	<1e*2plAn>
	pos	n.
	def	the U.S. name for {aeroplane}.
air plant	0.
	syl	air plant
	pos	n.
	def	another name for {epiphyte}.
air pocket	1.
	syl	air pock+et
	pos	n.
	def	a localized region of low air density or a descending air current, causing an aircraft to suffer an abrupt decrease in height.
air pocket	2.
	syl	air pock+et
	pos	n.
	def	any pocket of air that prevents the flow of a liquid or gas, as in a pipe.
airport	0.
	syl	air+port
	pron	<1e*2pc:t>
	pos	n.
	def	a landing and taking-off area for civil aircraft, usually with surfaced runways and aircraft maintenance and passenger facilities.
air power	0.
	syl	air pow+er
	pos	n.
	def	the strength of a nation's air force.
air pump	0.
	syl	air pump
	pos	n.
	def	a device for pumping air in or out of something.
air raid	0.a.
	syl	air raid
	pos	n.
	def	an attack by hostile aircraft or missiles.
air raid	0.b.
	syl	air raid
	pos	n.
	usage	as modifier
	exam	1	an air-raid shelter.
air-raid warden	0.
	syl	air-raid ward+en
	pos	n.
	def	a member of a civil defence organization responsible for enforcing regulations, etc., during an air attack.
air rifle	0.
	syl	air ri+fle
	pos	n.
	def	a rifle discharged by compressed air.
airs	0.
	syl	airs
	pron	<e*z>
	pos	n.
	mod	pl.
	def	affected manners intended to impress others (esp. in the phrases {give oneself airs, put on airs) }.
air sac	1.
	syl	air sac
	pos	n.
	def	any of the membranous air-filled extensions of the lungs of birds, which increase the efficiency of gaseous exchange in the lungs.
air sac	2.
	syl	air sac
	pos	n.
	def	any of the thin-walled extensions of the tracheae of insects having a similar function.
air scoop	0.
	syl	air scoop
	pos	n.
	def	a device fitted to the surface of an aircraft to provide air pressure or ventilation from the airflow.
Air Scout	0.
	syl	Air Scout
	pos	n.
	def	a scout belonging to a scout troop that specializes in flying, gliding, etc. See {Scout}.
airscrew	0.
	syl	air+screw
	pron	<1e*2skru:>
	pos	n.
	qual	Brit.
	def	an aircraft propeller.
air-sea rescue	0.
	syl	air-sea res+cue
	pos	n.
	def	an air rescue at sea.
air shaft	0.
	syl	air shaft
	pos	n.
	def	a shaft for ventilation, esp. in a mine or tunnel.
airship	0.
	syl	air+ship
	pron	<1e*2Sip>
	pos	n.
	def	a lighter-than-air self-propelled craft. Also called: {dirigible}.
airsick	0.
	syl	air+sick
	pron	<1e*2sik>
	pos	adj.
	def	sick or nauseated from travelling in an aircraft.
airsickness	sub
	head	airsick
	syl	air+2sick+ness
	pos	n.
air sock	0.
	syl	air sock
	pos	n.
	def	another name for {windsock}.
airspace	0.
	syl	air+space
	pron	<1e*2spAs>
	pos	n.
	def	the atmosphere above the earth or part of the earth, esp. the atmosphere above a country deemed to be under its jurisdiction.
airspeed	0.
	syl	air+speed
	pron	<1e*2spEd>
	pos	n.
	def	the speed of an aircraft relative to the air in which it moves. Compare {groundspeed}.
air spray	0.
	syl	air spray
	pos	n.
	def	another name for {{aerosol} (sense 3).}
air spring	0.
	syl	air spring
	pos	n.
	qual	Mechanical engineering.
	def	an enclosed pocket of air used to absorb shock or sudden fluctuations of load.
air station	0.
	syl	air sta+tion
	pos	n.
	def	an airfield, usually smaller than an airport but having facilities for the maintenance of aircraft.
airstream	1.
	syl	air+stream
	pron	<1e*2strEm>
	pos	n.
	def	a wind, esp. at a high altitude.
airstream	2.
	syl	air+stream
	pron	<1e*2strEm>
	pos	n.
	def	a current of moving air.
airstrip	0.
	syl	air+strip
	pron	<1e*2strip>
	pos	n.
	def	a cleared area for the landing and taking off of aircraft; runway. Also called: {landing strip}.
airt	ety	C14: from Scots Gaelic aird point of the compass, height
airth	alt
	head	airt
	or	airt
	syl	airth
	pron	<e*T>
	pos	n.
airt	0.
	or	airth
	syl	airt
	pron	<e*t>
	pos	n.
	qual	Scot.
	def	a direction or point of the compass, esp. the direction of the wind.
air terminal	0.
	syl	air ter+mi+nal
	pos	n.
	qual	Brit.
	def	a building in a city from which air passengers are taken by road or rail to an airport.
airtight	1.
	syl	air+tight
	pron	<1e*2tIt>
	pos	adj.
	def	not permitting the passage of air either in or out.
airtight	2.
	syl	air+tight
	pron	<1e*2tIt>
	pos	adj.
	def	having no weak points; invulnerable.
	exam	1	an airtight argument.
air-to-air	0.
	syl	air-to-air
	pos	adj.
	def	operating between aircraft in flight.
air traffic	1.
	syl	air traf+fic
	pos	n.
	def	the organized movement of aircraft within a given space.
air traffic	2.
	syl	air traf+fic
	pos	n.
	def	the passengers, cargo, or mail carried by aircraft.
air-traffic control	0.
	syl	air-traf:fic con+trol
	pos	n.
	def	an organization that determines the altitude, speed, and direction at which planes fly in a given area, giving instructions to pilots by radio.
air turbine	0.
	syl	air tur+bine
	pos	n.
	def	a small turbine driven by compressed air, esp. one used as a starter for engines.
air valve	1.
	syl	air valve
	pos	n.
	def	a device for controlling the flow of air in a pipe.
air valve	2.
	syl	air valve
	pos	n.
	def	a valve for exhausting air from a fluid system, esp. from a central-heating installation. See also {bleed valve}.
air vesicavity	alt
	head	air vesicle
	or	air vesicle
	syl	air ves:i+cav+i:ty
	pos	n.
air vesicle	1.
	or	air vesicavity
	syl	air ves:i+cle
	pos	n.
	def	a large air-filled intercellular space in some aquatic plants.
air vesicle	2.
	or	air vesicavity
	syl	air ves:i+cle
	pos	n.
	def	a large intercellular space in a leaf into which a stoma opens.
air vice-marshal	1.
	syl	air vice-mar:shal
	pos	n.
	def	a senior Royal Air Force officer of equivalent rank to a rear admiral in the Royal Navy.
air vice-marshal	2.
	syl	air vice-mar:shal
	pos	n.
	def	a Royal Australian Air Force officer of the second highest rank.
airwaves	0.
	syl	air+waves
	pron	<1e*2wAvz>
	pos	n.
	mod	pl.
	qual	Informal.
	def	radio waves used in radio and television broadcasting.
airway	1.
	syl	air+way
	pron	<1e*2wA>
	pos	n.
	def	an air route, esp. one that is fully equipped with emergency landing fields, navigational aids, etc.
airway	2.
	syl	air+way
	pron	<1e*2wA>
	pos	n.
	def	a passage for ventilation, esp. in a mine.
airworthy	0.
	syl	air+wor:thy
	pron	<1e*2wR:@di>
	pos	adj.
	usage	of an aircraft
	def	safe to fly.
airier	infl
	head	airy
	syl	air:i+er
	pos	adj.
airiest	infl
	head	airy
	syl	air:i+est.
	pos	adj.
airy	1.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	abounding in fresh air.
airy	2.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	spacious or uncluttered.
airy	3.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	of or relating to air.
airy	4.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	weightless and insubstantial.
	exam	1	an airy gossamer.
airy	5.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	light and graceful in movement.
airy	6.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	buoyant and gay; lively.
airy	7.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	visionary; fanciful.
	exam	1	airy promises;
	exam	2	airy plans.
airy	8.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	having no material substance.
	exam	1	airy spirits.
airy	9.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	high up in the air; lofty.
airy	10.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	def	performed in the air; aerial.
airy	11.
	syl	air:y
	pron	<1e*ri>
	pos	adj.
	qual	Informal.
	def	nonchalant; superficial.
airy-fairy	ety	C19: from Tennyson's poem Lillian (1830), where the central figure is described as @6Airy, fairy Lillian@9
airy-fairy	1.
	syl	air:y-fair:y
	pron	<1e*ri1fe*ri>
	pos	adj.
	qual	Informal.
	def	fanciful and unrealistic.
	exam	1	an airy-fairy scheme.
airy-fairy	2.
	syl	air:y-fair:y
	pron	<1e*ri1fe*ri>
	pos	adj.
	def	delicate to the point of being insubstantial; light.
Ayesha	alt
	head	Aisha
	or	Aisha
	syl	A:ye:sha
	pron	<1a:E2Sa:>
	pos	n.
Aisha	0.
	or	Ayesha
	syl	A:i:sha
	pron	<1a:E2Sa:>
	pos	n.
	def	??613-678 #7a.d., the favourite wife of Mohammed; daughter of Abu Bekr.
aisle	ety	C14 ele (later aile, aisle, through confusion with isle (island)), via Old French from Latin *_ala wing
aisle	1.
	syl	aisle
	pron	<Il>
	pos	n.
	def	a passageway separating seating areas in a theatre, church, etc.; gangway.
aisle	2.
	syl	aisle
	pron	<Il>
	pos	n.
	def	a lateral division in a church flanking the nave or chancel.
(rolling) in the aisles	3.
	head	aisle
	syl	(rolling) in the aisles.
	usage	Informal. of an audience
	def	overcome with laughter.
aisled	sub
	head	aisle
	syl	aisled
	pos	adj.
aisleless	sub
	head	aisle
	syl	aisle+less
	pos	adj.
Aisne	1.
	syl	Aisne
	pron	<An>, French <en>
	pos	n.
	def	a department of NE France, in Picardy region. Capital: Laon. Pop.: 549372 (1975). Area: 7428 sq. km (2897 sq. miles).
Aisne	2.
	syl	Aisne
	pron	<An>, French <en>
	pos	n.
	def	a river in N France, rising in the Argonne Forest and flowing northwest and west to the River Oise: scene of several battles during World War I. Length: 282 km (175 miles).
ait	ety	Old English *_ygett small island, from ieg #7island 
eyot	alt
	head	ait
	or	ait
	syl	eyot
	pos	n.
ait	0.
	or	eyot
	syl	ait
	pron	<At>
	pos	n.
	qual	Brit. dialect.
	def	an islet, esp. in a river.
aitch	ety	C16: a phonetic spelling
aitch	0.
	syl	aitch
	pron	<AC>
	pos	n.
	def	the letter or the sound represented by it.
	exam	1	he drops his aitches.
aitchbone	ety	C15 hach-boon, altered from earlier nache-bone, nage-bone (a nache mistaken for an ache, an aitch; compare #7adder) ; nache buttock, via Old French from Late Latin natica, from Latin natis buttock
aitchbone	1.
	syl	aitch+bone
	pron	<1AC2b*un>
	pos	n.
	def	the rump bone or floor of the pelvis in cattle.
aitchbone	2.
	syl	aitch+bone
	pron	<1AC2b*un>
	pos	n.
	def	a cut of beef from or including the rump bone.
Robert Grant	1.
	head	Aitken
	syl	Rob:ert Grant.
	def	1864-1951, U.S. astronomer who discovered over three thousand double stars.
William Maxwell	2.
	head	Aitken
	syl	Wil:liam Max:well.
	def	See {Beaverbrook}.
Aix-en-Provence	0.
	syl	Aix-en-Pro:vence
	pron	French <eks>, French <*~a> <prc1v*~a:s>
	pos	n.
	def	a city and spa in SE France: the medieval capital of Provence. Pop.: 114014 (1975). Also called: {Aix}.
Aix-la-Chapelle	0.
	syl	Aix-la-Cha:pelle
	pron	French <eks>, French <la> <Sa1pel>
	pos	n.
	def	the French name for {Aachen}.
A'iyina	0.
	syl	A*'i+yi+na
	pron	<1Ajina>
	pos	n.
	def	transliteration of the Modern Greek name for {Aegina}.
AJA	0.
	syl	A.J.A.
	qual	abbrev. for
	def	Australian Journalists' Association.
Ajaccio	0.
	syl	A:jac+cio
	pron	<*1J@tsi2*u>, <-1JA->
	pos	n.
	def	the capital of Corsica, a port on the W coast. Pop.: 44659 (1968).
ajar	ety	C18: altered form of obsolete on char, literally: on the turn; char, from Old English cierran to turn
ajar	H1.0.
	syl	a:jar
	pron	<*1Ja:>
	pos	adj. postpositive; adv. postpositive; adv.
	usage	esp. of a door or window
	def	slightly open.
ajar	ety	C19: altered form of at jar at discord. See #7jar %2
ajar	H2.0.
	syl	a:jar
	pron	<*1Ja:>
	pos	adj.
	usage	postpositive
	def	not in harmony.
Ajax	1.
	syl	A:jax
	pron	<1AJ@ks>
	pos	n.
	qual	Greek myth.
	def	the son of Telamon; a Greek hero of the Trojan War who killed himself in vexation when Achilles' armour was given to Odysseus.
Ajax	2.
	syl	A:jax
	pron	<1AJ@ks>
	pos	n.
	qual	Greek myth.
	def	called a Locrian king, a swift-footed Greek hero of the Trojan War.
AJC	0.
	syl	A.J.C.
	qual	abbrev. for
	def	Australian Jockey Club.
Ajmer	0.
	syl	Aj+mer
	pron	<^J1mi*>
	pos	n.
	def	a city in NW India, in Rajasthan: textile centre. Pop.: 262851 (1971).
Akademi	0.
	syl	A:kad+e:mi
	pron	<*1ka:d*mi>
	pos	n.
	usage	in India
	def	a learned society.
Akan	infl
	or	Akans
	syl	A:kan
	pos	n.
	mod	pl.
Akans	infl
	head	Akan
	or	Akan
	syl	A:kans
	pos	n.
	mod	pl.
Akan	1.
	syl	A:kan
	pron	<1a:ka:n>
	pos	n.
	def	a member of a people of Ghana and the E Ivory Coast.
Akan	2.
	syl	A:kan
	pron	<1a:ka:n>
	pos	n.
	def	the language of this people, having two chief dialects, Fanti and Twi, and belonging to the Kwa branch of the Niger-Congo family.
Akbar	0.
	syl	Ak:bar
	pron	<1@kba:>
	pos	n.
	def	called 1542-1605, Mogul emperor of India (1556-1605), who extended the Mogul empire to include N India.
Akela	ety	C20: after a character in Kipling's The Jungle Book (1894-95), who is the leader of a wolfpack
Akela	0.
	syl	A:ke+la
	pron	<a:1kAl*>
	pos	n.
	qual	Brit.
	def	the adult leader of a pack of Cub Scouts. U.S. equivalent: {Den Mother}.
akene	0.
	syl	a:kene
	pron	<*1kEn>
	pos	n.
	def	a variant spelling of {achene}.
Akhaia	0.
	syl	A:kha:*"i:a
	pron	<2aka1ia>
	pos	n.
	def	transliteration of the modern Greek name for {Achaea}.
akhara	0.
	syl	a:kha+ra
	pron	<*1ka:ra:>
	pos	n.
	usage	in India
	def	a gymnasium.
Akhenaton	alt
	head	Akhenaten
	or	Akhenaten
	syl	Ak:he:na:ton
	pron	<2@k*1na:tN>
	pos	n.
Akhenaten	0.
	or	Akhenaton
	syl	Ak:he:na:ten
	pron	<2@k*1na:tN>
	pos	n.
	def	original name died ??1358 #7b.c., king of Egypt, of the 18th dynasty; he moved his capital from Thebes to Tell El Amarna and introduced the cult of Aten.
Anna	infl
	head	Akhmatova
	syl	An:na
	pron	<1ann*>
	pos	n.
Akhmatova	0.
	syl	Akh:ma:to:va
	pron	Russian <ax1mat*v*>
	pos	n.
	def	pseudo?!nym of 1889-1966, Russian poetess: noted for her concise and intensely personal lyrics.
Akihito	0.
	syl	Ak:i:hi:to
	pron	<2@ki1hEt*u>
	pos	n.
	def	born 1933, crown prince of Japan.
akimbo	ety	C15: in kenebowe, literally: in keen bow, that is, in a sharp curve
akimbo	0.
	syl	a:kim+bo
	pron	<*1kimb*u>
	pos	adj. postpositive; adv.
	def	with hands on hips and elbows projecting outwards.
akin	1.
	syl	a:kin
	pron	<*1kin>
	pos	adj.
	usage	postpositive
	def	related by blood; of the same kin.
akin	2.
	syl	a:kin
	pron	<*1kin>
	pos	adj.
	usage	postpositive; often foll. by to
	def	having similar characteristics, properties, etc.
Accad	alt
	head	Akkad
	or	Akkad
	syl	Ac+cad
	pron	<1@k@d>
	pos	n.
Akkad	1.
	or	Accad
	syl	Ak+kad
	pron	<1@k@d>
	pos	n.
	def	a city on the Euphrates in N Babylonia, the centre of a major empire and civilization (2360-2180 #7b.c.) . Ancient name: {Agade}.
Akkad	2.
	or	Accad
	syl	Ak+kad
	pron	<1@k@d>
	pos	n.
	def	an ancient region lying north of Babylon, from which the Akkadian language and culture is named.
Accadian	alt
	head	Akkadian
	or	Akkadian
	syl	Ac+ca+di:an
	pron	<*1k@di*n>, <*1kA->
	pos	n.
Akkadian	1.
	or	Accadian
	syl	Ak+ka+di:an
	pron	<*1k@di*n>, <*1kA->
	pos	n.
	def	a member of an ancient Semitic people who lived in central Mesopotamia in the second millennium #7b.c.
Akkadian	2.
	or	Accadian
	syl	Ak+ka+di:an
	pron	<*1k@di*n>, <*1kA->
	pos	n.
	def	the extinct language of this people, belonging to the E Semitic subfamily of the Afro-Asiatic family.
Akkadian	3.
	or	Accadian
	syl	Ak+ka+di:an
	pron	<*1k@di*n>, <*1kA->
	pos	adj.
	def	of or relating to this people or their language.
Akkerman	0.
	syl	Ak+ker+man
	pron	Russian <akir1man>
	pos	n.
	def	the former name (until 1946) of {Byelgorod-Dnestrovski}.
Akmolinsk	0.
	syl	Ak+mo+linsk
	pron	Russian <ak1mclinsk>
	pos	n.
	def	the former name (until 1961) of {Tselinograd}.
Akron	0.
	syl	Ak+ron
	pron	<1@kr*n>
	pos	n.
	def	a city in NE Ohio. Pop.: 261520 (1973 est.).
Axum	alt
	head	Aksum
	or	Aksum
	syl	Ax:um
	pron	<1a:ksum>
	pos	n.
Aksum	0.
	or	Axum
	syl	Ak+sum
	pron	<1a:ksum>
	pos	n.
	def	an ancient town in N Ethiopia, in Tigr*'e province: capital of the Aksumite Empire (1st to 6th centuries #7a.d.) #7. According to tradition, the Ark of the Covenant was brought here from Jerusalem.
Aktyubinsk	0.
	syl	Ak+tyu+binsk
	pron	Russian <ak1tju:binsk>
	pos	n.
	def	an industrial city in the Soviet Union, in the Kazakh SSR. Pop.: 175000 (1975 est.).
Akure	0.
	syl	A:ku+re
	pron	<*1ku:rA>
	pos	n.
	def	a city in SW Nigeria, capital of Ondo state: agricultural trade centre. Pop.: 71106 (1963).
akvavit	0.
	syl	ak+va+vit
	pron	<1a:kva:2vEt>
	pos	n.
	def	a variant spelling of {aquavit}.
Al	0.
	syl	Al
	usage	the chemical symbol for
	def	aluminium.
AL	0.
	syl	AL
	usage	international car registration for
	def	Albania.
al	0.
	syl	al.
	qual	abbrev. for
	def	alcohol alcoholic.
AL	alt
	or	AL
	syl	AL
AL	0.
	or	AL
	syl	A.L.
	qual	abbrev. for
	def	Anglo-Latin.
-al	ety	from Latin -*_alis 
-al	H1.0.
	syl	-al
	usage	suffix forming adjectives.
	def	of; related to; connected with.
	exam	1	functional;
	exam	2	sectional;
	exam	3	tonal.
-al	ety	via Old French -aille, -ail, from Latin -*_alia, neuter plural used as substantive, from -*_alis -#7al %1
-al	H2.0.
	syl	-al
	usage	suffix forming nouns.
	def	the act or process of doing what is indicated by the verb stem.
	exam	1	rebuttal;
	exam	2	recital;
	exam	3	renewal.
-al	ety	shortened from #7aldehyde 
-al	H3.0.
	syl	-al
	exam	1	suffix forming nouns.
-al	H3.1.
	syl	-al
	def	indicating an aliphatic aldehyde containing six or more carbon atoms.
	exam	1	hexanal.
-al	H3.2.
	syl	-al
	usage	not used systematically
	def	indicating any aldehyde.
	exam	1	salicylal.
-al	H3.3.
	syl	-al
	def	indicating a pharmaceutical product.
	exam	1	phenobarbital.
alae	infl
	head	ala
	syl	a:lae
	pron	<1AlE>
	pos	n.
	mod	pl.
ala	1.
	syl	a:la
	pron	<1Al*>
	pos	n.
	qual	Zoology.
	def	a wing or flat winglike process or structure, such as a part of some bones and cartilages.
ala	2.
	syl	a:la
	pron	<1Al*>
	pos	n.
	qual	Botany.
	def	a winglike part, such as one of the wings of a sycamore seed or one of the flat petals of a sweet pea flower.
a la	ety	C17: from French, short for *`a la mode de in the style of
a la	1.
	syl	*`a la
	pron	<a:> <la:>, <@> <l*>, French <a> <la>
	pos	prep.
	def	in the manner or style of.
a la	2.
	syl	*`a la
	pron	<a:> <la:>, <@> <l*>, French <a> <la>
	pos	prep.
	def	as prepared in (a particular place) or by or for (a particular person).
Ala	0.
	syl	Ala.
	qual	abbrev. for
	def	Alabama.
Alabama	1.
	syl	Al:a+bam:a
	pron	<2@l*1b@m*>
	pos	n.
	def	a state of the southeastern U.S., on the Gulf of Mexico: consists of coastal and W lowlands crossed by the Tombigbee, Black Warrior, and Alabama Rivers, with parts of the Tennessee Valley and Cumberland Plateau in the north; noted for producing cotton and white marble. Capital: Montgomery. Pop.: 3444165 (1970). Area: 131333 sq. km (50708 sq. miles). Abbrevs.: {Ala}. or (with zip code) {AL}
Alabama	2.
	syl	Al:a+bam:a
	pron	<2@l*1b@m*>
	pos	n.
	def	a river in Alabama, flowing southwest to the Mobile and Tensaw Rivers. Length: 507 km (315 miles).
Alabamian	sub
	head	Alabama
	syl	Al:a+1bam+i:an
	pos	adj.
alabaster	ety	C14: from Old French alabastre, from Latin alabaster, from Greek alabastros 
alabaster	1.
	syl	al:a+bas+ter
	pron	<1@l*2ba:st*>, <-2b@st*>
	pos	n.
	def	a fine-grained usually white, opaque, or translucent variety of gypsum used for statues, vases, etc.
alabaster	2.
	syl	al:a+bas+ter
	pron	<1@l*2ba:st*>, <-2b@st*>
	pos	n.
	def	a variety of hard semitranslucent calcite, often banded like marble.
alabaster	3.
	syl	al:a+bas+ter
	pron	<1@l*2ba:st*>, <-2b@st*>
	pos	adj.
	def	of or resembling alabaster.
alabastrine	sub
	head	alabaster
	syl	al:a+1bas+trine
	pos	adj.
a la carte	ety	C19: from French, literally: accord?!ing to the card
a la carte	1.
	syl	*`a la carte
	pron	<a:> <la:> <1ka:t>, <@> <l*>, French <a> <la> <1kart>
	pos	adj. adv.
	usage	of a menu or a section of a menu
	def	having dishes listed separately and individually priced. Compare {table d'h*^ote}.
a la carte	2.
	syl	*`a la carte
	pron	<a:> <la:> <1ka:t>, <@> <l*>, French <a> <la> <1kart>
	pos	adj. adv.
	usage	of a dish
	def	offered on such a menu.
alack	ety	C15: from a ah&!+ lack loss, #7lack 
alackaday	alt
	head	alack
	or	alack
	syl	a:lack:a+day
	pron	<*1l@k*2dA>
	pos	interj.
alack	0.
	or	alackaday
	syl	a:lack
	pron	<*1l@k>
	pos	interj.
	def	an archaic or poetic word for {alas}.
alacrity	ety	C15: from Latin alacrit*_as, from alacer lively
alacrity	0.
	syl	a:lac+ri:ty
	pron	<*1l@kriti>
	pos	n.
	def	liveliness or briskness.
alacritous	sub
	head	alacrity
	syl	a:1lac+ri+tous
	pos	adj.
Ala Dagh	alt
	head	Ala Davg
	or	Ala Davg
	syl	A:la Dagh
	pron	Turkish <a1la> <da:>
	pos	n.
Ala Davg	1.
	or	Ala Dagh
	syl	A:la Da*vg
	pron	Turkish <a1la> <da:>
	pos	n.
	def	the E part of the Taurus Mountains, in SE Turkey, rising over 3600 m (12000 ft.).
Ala Davg	2.
	or	Ala Dagh
	syl	A:la Da*vg
	pron	Turkish <a1la> <da:>
	pos	n.
	def	a mountain range in E Turkey, rising over 3300 m (11000 ft.).
Ala Davg	3.
	or	Ala Dagh
	syl	A:la Da*vg
	pron	Turkish <a1la> <da:>
	pos	n.
	def	a mountain range in NE Turkey, rising over 3000 m (10000 ft.).
Alagoz	alt
	head	Alagez
	or	Alagez
	syl	A:la+g*"oz
	pron	<2ala1g@oz>
	pos	n.
Alagez	0.
	or	Alagoz
	syl	A:la+gez
	pron	<2ala1g@oz>
	pos	n.
	def	the Turkish name for {Aragats}.
Alagoas	0.
	syl	A:la+go+as
	pron	Portuguese <2ala1goas>
	pos	n.
	def	a state in NE Brazil, on the Atlantic coast. Capital: Macei*'o. Pop.: 1588109 (1970). Area: 30776 sq. km (11031 sq. miles).
Alai	0.
	syl	A:lai
	pron	<a:1lI>
	pos	n.
	def	a mountain range in the S Soviet Union, in the SW Kirghiz SSR, running from the Tien Shan range in China into the Tadzhik SSR. Average height: 4800 m (16000 ft.), rising over 5850 m (19500 ft.).
Alain-Fournier	0.
	syl	A:lain-Four:nier
	pron	French <al?~e> <fur1njA>
	pos	n.
	def	pen name of 1886-1914, French novelist; author of (1913; translated as 1959).
a la king	0.
	syl	*`a la king
	pron	<a:> <la:> <1kiG>, <@> <l*>
	pos	adj.
	usage	usually postpositive
	def	cooked in a cream sauce with mushrooms and green peppers.
alameda	0.
	syl	al:a+me:da
	pron	<2@l*1mAd*>
	pos	n.
	qual	Chiefly southwestern U.S.
	def	a public walk or promenade lined with trees, often poplars.
Alamein	0.
	syl	Al:a+mein
	pron	<1@l*2mAn>
	pos	n.
	def	see {El Alamein}.
the	infl
	head	Alamo
	syl	the.
	pos	n.
Alamo	0.
	syl	Al:a+mo
	pron	<1@l*2m*u>
	pos	n.
	def	a mission in San Antonio, Texas, the site of a siege and massacre in 1836 by Mexican forces under Santa Anna of a handful of American rebels fighting for Texan independence from Mexico.
a la mode	ety	C17: from French: according to the fashion
a la mode	1.
	syl	*`a la mode
	pron	<a:> <la:> <1m*ud>, <@> <l*>, French <a> <la> <1mcd>
	pos	adj.
	def	fashionable in style, design, etc.
a la mode	2.
	syl	*`a la mode
	pron	<a:> <la:> <1m*ud>, <@> <l*>, French <a> <la> <1mcd>
	pos	adj.
	usage	of meats
	def	braised with vegetables in wine.
a la mode	3.
	syl	*`a la mode
	pron	<a:> <la:> <1m*ud>, <@> <l*>, French <a> <la> <1mcd>
	pos	adj.
	usage	Chiefly U.S. of desserts
	def	served with ice cream.
alamode	0.
	syl	a:la+mode
	pron	<1@l*2m*ud>
	pos	n.
	def	a soft light silk used for shawls and dresses, esp. in the 19th century. See also {surah}.
st Viscount	infl
	head	Alanbrooke
	syl	1st Viscount
	pos	n.
Alanbrooke	0.
	syl	Al:an:brooke
	pron	<1@l*n2bruk>
	pos	n.
	def	title of 1883-1963, British field marshal; chief of Imperial General Staff (1941-46).
Aland Islands	0.
	syl	*%A:land Is+lands
	pron	<1a:l*nd>, <1c:l*nd>, Swedish <1o:land>
	pos	n.
	mod	pl.
	def	a group of over 6000 islands under Finnish administration, in the Gulf of Bothnia. Capital: Mariehamn. Pop.: 21500 (1968). Finnish name: {Ahvenanmaa}.
alanine	ety	C19: from German Alanin, from #7al (#7dehyde) #7+ -an- (euphonic infix)+ -in -#7ine %2
alanine	0.
	syl	al:a+nine
	pron	<1@l*2nEn>, <-2nIn>
	pos	n.
	def	a sweet-tasting aliphatic amino acid that occurs in many proteins and has several isomeric forms; aminoproprionic acid. Formula: CH\3CH(NH\2)COOH.
alannah	ety	from Irish Gailic a leanbh 
alannah	0.
	syl	a:lan+nah
	pron	<*1l@n*>
	pos	interj.
	qual	Irish.
	def	my child: used as a term of address or endearment.
alap	0.
	syl	a:lap
	pron	<*1la:p>
	pos	n.
	def	Indian vocal music without words.
alar	ety	C19: from Latin *_ala a wing
alar	0.
	syl	a:lar
	pron	<1Al*>
	pos	adj.
	def	relating to, resembling, or having wings or alae.
Pedro Antonio de	infl
	head	Alarc'on
	syl	Pe:dro An:to:nio de
	pron	<1pADro> <an1tonjo> <DA>
	pos	n.
Alarc'on	0.
	syl	A:lar:c*'on
	pron	Spanish <2alar1kon>
	pos	n.
	def	1833-91, Spanish novelist and short-story writer, noted for his humorous sketches of rural life, esp. in (1874).
Alaric	0.
	syl	Al:a:ric
	pron	<1@l*rik>
	pos	n.
	def	??370-410 #7a.d., king of the Visigoths, who served under the Roman emperor Theodosius I but later invaded Greece and Italy, capturing Rome in 410.
alarm	ety	C14: from Old French alarme, from Old Italian all'arme to arms; see #7arm %2
alarm	1.
	syl	a:larm
	pron	<*1la:m>
	pos	vb.
	mod	tr.
	def	to fill with apprehension, anxiety, or fear.
alarm	2.
	syl	a:larm
	pron	<*1la:m>
	pos	vb.
	mod	tr.
	def	to warn about danger; alert.
alarm	3.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	def	fear or terror aroused by awareness of danger; fright.
alarm	4.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	def	apprehension or uneasiness.
	exam	1	the idea of failing filled him with alarm.
alarm	5.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	def	a noise, signal, etc., warning of danger.
alarm	6.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	def	any device that transmits such a warning.
	exam	1	a burglar alarm.
alarm	7.a.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	def	the device in an alarm clock that triggers off the bell or buzzer.
alarm	7.b.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	def	short for {alarm clock}.
alarm	8.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	qual	Archaic.
	def	a call to arms.
alarm	9.
	syl	a:larm
	pron	<*1la:m>
	pos	n.
	mod	tr.
	qual	Fencing.
	def	a warning or challenge made by stamping the front foot.
alarming	sub
	head	alarm
	syl	a:1larm+ing
	pos	adj.
alarmingly	sub
	head	alarm
	syl	a:1larm+ing+ly
	pos	adv.
alarm clock	0.
	syl	a:larm clock
	pos	n.
	def	a clock with a mechanism that sounds at a set time: used esp. for waking a person up.
alarmist	1.
	syl	a:larm+ist
	pron	<*1la:mist>
	pos	n.
	def	a person who alarms or attempts to alarm others needlessly or without due grounds.
alarmist	2.
	syl	a:larm+ist
	pron	<*1la:mist>
	pos	n.
	def	a person who is easily alarmed.
alarmist	3.
	syl	a:larm+ist
	pron	<*1la:mist>
	pos	adj.
	def	characteristic of an alarmist.
alarmism	sub
	head	alarmist
	syl	a:1larm+ism
	pos	n.
alarum	ety	C15: variant of #7alarm 
alarum	1.
	syl	a:lar+um
	pron	<*1l@r*m>, <-1la:r->, <-1le*r->
	pos	n.
	qual	Archaic.
	def	an alarm, esp. a call to arms.
alarum	2.
	syl	a:lar+um
	pron	<*1l@r*m>, <-1la:r->, <-1le*r->
	pos	n.
	usage	used as a stage direction, esp. in Elizabethan drama
	def	a loud disturbance or conflict (esp. in the phrase {alarums and excursions}) .
alary	ety	C17: from Latin *_al*_arius, from *_ala wing
alary	0.
	syl	a:lar:y
	pron	<1Al*ri>, <1@->
	pos	adj.
	def	of, relating to, or shaped like wings.
alas	ety	C13: from Old French ha las&! oh wretched&!; las from Latin lassus weary
alas	0.
	syl	a:las
	pron	<*1l@s>
	pos	interj.
	def	an exclamation of grief, compassion, or alarm.
Alas	0.
	syl	Alas.
	qual	abbrev. for
	def	Alaska.
Alaska	1.
	syl	A:las+ka
	pron	<*1l@sk*>
	pos	n.
	def	the largest state of the U.S., in the extreme northwest of North America: the aboriginal inhabitants are Eskimos; the earliest White settlements were made by the Russians. It is mostly mountainous and volcanic, rising over 6000 m (20000 ft.), with the Yukon basin in the central region; large areas are covered by tundra; it has important mineral resources (chiefly coal, oil, and natural gas). Capital: Willow South. Pop.: 302173 (1970). Area: 1518859 sq. km (586432 sq. miles). Abbrevs.: {Alas}. or (with zip code) {AK}
Gulf of	2.
	head	Alaska
	syl	Gulf of.
	def	the N part of the Pacific, between the Alaska Peninsula and the Alexander Archipelago.
Alaskan	sub
	head	Alaska
	syl	A:1las+kan
	pos	adj. n.
Alaska Highway	0.
	syl	A:las+ka High+way
	pos	n.
	def	a road extending from Dawson Creek, British Columbia, to Fairbanks, Alaska: built by the U.S. Army (1942). Length: 2452 km (1523 miles). Also called: {Alcan Highway}.
Alaska Peninsula	0.
	syl	A:las+ka Pen+in+su+la
	pos	n.
	def	an extension of the mainland of SW Alaska between the Pacific and the Bering Sea, ending in the Aleutian Islands. Length: about 644 km (400 miles).
Alaska Range	0.
	syl	A:las+ka Range
	pos	n.
	def	a mountain range in S central Alaska. Highest peak: Mount McKinley, 6090 m (20300 ft.).
alate	ety	C17: from Latin *_al*_atus, from *_ala wing
alate	0.
	syl	a:late
	pron	<1AlAt>
	pos	adj.
	def	having wings or winglike extensions.
alb	ety	Old English albe, from Medieval Latin alba (vestis) white (clothing)
alb	0.
	syl	alb
	pron	<@lb>
	pos	n.
	qual	Christianity.
	def	a long white linen vestment with sleeves worn by priests and others.
Alb	0.
	syl	Alb.
	qual	abbrev. for
	def	Albania(n).
Alba	0.
	syl	Al:ba
	pron	Spanish <1al$Ba>
	pos	n.
	def	see (Duke of) {Alva}.
Albacete	0.
	syl	Al+ba+ce:te
	pron	Spanish <2al$Ba1TAtA>
	pos	n.
	def	a city in SE Spain. Pop.: 93233 (1970).
albacore	ety	C16: from Portuguese albacor, from Arabic al-bakrah, from al the+ bakr young camel
albacore	0.
	syl	al+ba+core
	pron	<1@lb*2kc:>
	pos	n.
	def	a tunny, occurring mainly in warm regions of the Atlantic and Pacific. It has very long pectoral fins and is a valued food fish. Also called: {long-fin tunny}.
Alba Longa	0.
	syl	Al:ba Lon+ga
	pron	<1@lb*> <1loGg*>
	pos	n.
	def	a city of ancient Latium, southeast of modern Rome: the legendary birthplace of Romulus and Remus.
Albania	0.
	syl	Al+ba+ni:a
	pron	<@l1bAni*>
	pos	n.
	def	a republic in SE Europe, on the Balkan Peninsula: became independent in 1912 after more than four centuries of Turkish rule; established as a republic (1946) under Communist rule. It is generally mountainous, rising over 2700 m (9000 ft.), with extensive forests. Language: Albanian. Currency: lek. Capital: Tirana. Pop.: 2322600 (1973). Area: 28749 sq. km (11100 sq. miles). Official name: {Socialist People's Republic of Albania}.
Albanian	1.
	syl	Al+ba+ni:an
	pron	<@l1bAni*n>
	pos	n.
	def	the official language of Albania: of uncertain relationship within the Indo-European family, but thought to be related to ancient Illyrian.
Albanian	2.a.
	syl	Al+ba+ni:an
	pron	<@l1bAni*n>
	pos	n.
	def	a native, citizen, or inhabitant of Albania.
Albanian	2.b.
	syl	Al+ba+ni:an
	pron	<@l1bAni*n>
	pos	n.
	def	a native speaker of Albanian.
Albanian	3.
	syl	Al+ba+ni:an
	pron	<@l1bAni*n>
	pos	adj.
	def	of or relating to Albania, its people, or their language.
Albany	1.
	syl	Al+ba+ny
	pron	<1c:lb*ni>
	pos	n.
	def	a city in E New York State, on the Hudson River: the state capital. Pop.: 111373 (1973 est.).
Albany	2.
	syl	Al+ba+ny
	pron	<1c:lb*ni>
	pos	n.
	def	a river in central Canada, flowing east and northeast to James Bay. Length: 982 km (610 miles).
albata	ety	C19: from Latin, literally: clothed in white, from albus white
albata	0.
	syl	al+ba+ta
	pron	<@l1bAt*>
	pos	n.
	def	a variety of German silver consisting of nickel, copper, and zinc.
albatross	ety	C17: from Portuguese alcatraz pelican, from Arabic al-ghatt*_as, from al the+ ghatt*_as white-tailed sea eagle; influenced by Latin albus white
albatross	1.
	syl	al+ba+tross
	pron	<1@lb*2tros>
	pos	n.
	def	any large oceanic bird of the genera and family of cool southern oceans: order (petrels). They have long narrow wings and are noted for a powerful gliding flight. See also {wandering albatross}.
albatross	2.
	syl	al+ba+tross
	pron	<1@lb*2tros>
	pos	n.
	qual	Golf.
	def	a score of three strokes under par for a hole.
albedo	ety	C19: from Church Latin: whiteness, from Latin albus white
albedo	0.
	syl	al+be+do
	pron	<@l1bEd*u>
	pos	n.
	def	the ratio of the intensity of light reflected from an object, such as a planet, to that of the light it receives from the sun.
albeit	ety	C14 al be it, that is, although it be (that)
albeit	0.
	syl	al+be+it
	pron	<c:l1bEit>
	pos	conj.
	def	even though.
Albemarle Sound	0.
	syl	Al+be+marle Sound
	pron	<1@lb*2ma:l>
	pos	n.
	def	an inlet of the Atlantic in NE North Carolina. Length: about 96 km (60 miles).
Isaac	infl
	head	Alb'eniz
	syl	I:sa:ac
	pron	<2isa1ak>
	pos	n.
Alb'eniz	0.
	syl	Al:b*'e:niz
	pron	Spanish <al1$BAniT>
	pos	n.
	def	1860-1909, Spanish composer; noted for piano pieces inspired by folk music, such as the suite
Alberich	0.
	syl	Al:ber:ich
	pron	German <1alb*ri*,c>
	pos	n.
	usage	in medieval German legend
	def	the king of the dwarfs and guardian of the treasures of the Nibelungs.
albert	ety	C19: named after Prince A#7lbert 
albert	1.
	syl	al+bert
	pron	<1@lb*t>
	pos	n.
	def	a kind of watch chain usually attached to a waistcoat.
albert	2.
	syl	al+bert
	pron	<1@lb*t>
	pos	n.
	qual	Brit.
	def	a standard size of notepaper, 6#M3@8#800022 inches.
Lake	infl
	head	Albert
	syl	Lake.
	pos	n.
Albert	H1.0.
	syl	Al+bert
	pron	<1@lb*t>
	pos	n.
	def	a lake in E Africa, between Za*"ire and Uganda in the Great Rift Valley, 660 m (2200 ft.) above sea level: a source of the Nile, fed by the Victoria Nile, which leaves as the Albert Nile. Area: 5345 sq. km (2064 sq. miles). Official name: {Lake Mobutu}.
Prince	infl
	head	Albert
	syl	Prince.
	pos	n.
Albert	H2.0.
	syl	Al:bert
	pron	<1@lb*t>
	pos	n.
	def	full name 1819-61, Prince Consort of Queen Victoria of England.
Albert I	1.
	syl	Al:bert I
	pos	n.
	usage	c.
	def	1255-1308, king of Germany (1298-1308).
Albert I	2.
	syl	Al:bert I
	pos	n.
	def	1875-1934, king of the Belgians (1909-34).
Albert I	3.
	syl	Al:bert I
	pos	n.
	def	called 1100-70. German military leader: first margrave of Brandenburg.
Alberta	0.
	syl	Al+ber+ta
	pron	<@l1bR:t*>
	pos	n.
	def	a province of W Canada: mostly prairie, with the Rocky Mountains in the southwest. Capital: Edmonton. Pop.: 1838037 (1976). Area: 661188 sq. km (255285 sq. miles). Abbrev.: {Alta}.
Albert Edward	0.
	syl	Al+bert Ed+ward
	pos	n.
	def	a mountain in SE New Guinea, in the Owen Stanley Range. Height: 3993 m (13100 ft.).
Leon Battista	infl
	head	Alberti
	syl	Le:on Bat:tis:ta
	pron	<lA1cn> <bat1ti:sta>
	pos	n.
Alberti	0.
	syl	Al:ber:ti
	pron	Italian <al1berti>
	pos	n.
	def	1404-72, Italian Renaissance architect, painter, writer, and musician; among his architectural designs are the fa*,cades of Sta. Maria Novella at Florence and S. Francesco at Rimini.
albertite	ety	C19: named after Albert county, New Brunswick, Canada, where it is mined
albertite	0.
	syl	al+bert+ite
	pron	<1@lb*2tIt>
	pos	n.
	def	a black solid variety of bitumen that has a conchoidal fracture and occurs in veins in oil-bearing strata.
Saint	infl
	head	Albertus Magnus
	syl	Saint.
	pos	n.
Albertus Magnus	0.
	syl	Al:ber:tus Mag:nus
	pron	<@l1bR:t*s> <1m@gn*s>
	pos	n.
	def	original name ??1193-1280, German scholastic philosopher; teacher of Thomas Aquinas and commentator on Aristotle. Feast day: Nov. 15.
albescent	ety	C19: from Latin alb*_escere to grow white, from albus white
albescent	0.
	syl	al+bes+cent
	pron	<@l1besNt>
	pos	adj.
	def	shading into, growing, or becoming white.
albescence	sub
	head	albescent
	syl	al+1bes+cence
	pos	n.
Albi	0.
	syl	Al:bi
	pron	French <al1bi>
	pos	n.
	def	a town in S France: connected with the Albigensian heresy and the crusade against it. Pop.: 49456 (1975).
Albigenses	ety	from Medieval Latin: inhabitants of Albi, from Albiga A#7lbi 
Albigenses	0.
	syl	Al+bi+gen+ses
	pron	<2@lbi1JensEz>
	pos	n.
	mod	pl.
	def	members of a Manichean sect that flourished in S France from the 11th to the 13th century.
Albigensian	sub
	head	Albigenses
	syl	Al+bi+1gen+si:an
	pos	adj.
Albigensianism	sub
	head	Albigenses
	syl	Al+bi+1gen+si+an+ism
	pos	n.
albino	ety	C18: via Portuguese from Spanish, from albo white, from Latin albus 
albinos	infl
	head	albino
	syl	al+bi+nos.
	pos	n.
	mod	pl.
albino	1.
	syl	al+bi+no
	pron	<@l1bEn*u>
	pos	n.
	def	a person with congenital absence of pigmentation in the skin, eyes, and hair.
albino	2.
	syl	al+bi+no
	pron	<@l1bEn*u>
	pos	n.
	def	any animal or plant that is deficient in pigment.
albinic	sub
	head	albino
	or	albinistic
	syl	al+bin+ic
	pron	<@l1binik>
	pos	adj.
albinistic	sub
	head	albino
	or	albinic
	syl	al+bin+1is+tic
	pos	adj.
albinotic	sub
	head	albino
	syl	al+bi+not+ic
	pron	<2@lbi1notik>
	pos	adj.
Tomaso	infl
	head	Albinoni
	syl	To:ma:so
	pron	<to1ma:zo>
	pos	n.
Albinoni	0.
	syl	Al:bi:no:ni
	pron	Italian <2albi1no:ni>
	pos	n.
	def	1671-1750, Italian composer and violinist. He wrote concertos and over 50 operas.
Albinus	0.
	syl	Al:bi:nus
	pron	<@l1bEn*s>
	pos	n.
	def	another name for {Alcuin}.
Albion	ety	C13: from Latin, of Celtic origin
Albion	0.
	syl	Al+bi+on
	pron	<1@lbi*n>
	pos	n.
	qual	Archaic or poetic.
	def	Britain or England.
albite	ety	C19: from Latin albus white
albite	0.
	syl	al+bite
	pron	<1@lbIt>
	pos	n.
	def	a white, bluish-green, or reddish-grey widely occurring feldspar mineral of the plagioclase series consisting of an aluminium silicate of sodium. It is used in the manufacture of glass and ceramics and as a gemstone. Formula: NaAlSi\3O\8.
albitic	sub
	head	albite
	syl	al+bit+ic
	pron	<@l1bitik>
	pos	adj.
Alboin	0.
	syl	Al:boin
	pron	<1@lbcin>, <-b*uin>
	pos	n.
	def	died 573 #7a.d., king of the Lombards (565-73); conqueror of N Italy.
Alborg	0.
	syl	*%Al+borg
	pron	Danish <1clbcr>
	pos	n.
	def	a variant spelling of {Aalborg}.
album	ety	C17: from Latin: blank tablet, from albus white
album	1.
	syl	al+bum
	pron	<1@lb*m>
	pos	n.
	def	a book or binder consisting of blank pages, pockets, or envelopes for keeping photographs, stamps, autographs, drawings, poems, etc.
album	2.
	syl	al+bum
	pron	<1@lb*m>
	pos	n.
	def	a booklike holder containing sleeves for gramophone records.
album	3.
	syl	al+bum
	pron	<1@lb*m>
	pos	n.
	def	one or more long-playing records released as a single item.
album	4.
	syl	al+bum
	pron	<1@lb*m>
	pos	n.
	qual	Chiefly Brit.
	def	an anthology, usually large and illustrated.
albumen	ety	C16: from Latin: white of an egg, from albus white
albumen	1.
	syl	al+bu+men
	pron	<1@lbjumin>, <-men>
	pos	n.
	def	the white of an egg; the nutritive and protective gelatinous substance, mostly an albumin, that surrounds the yolk.
albumen	2.
	syl	al+bu+men
	pron	<1@lbjumin>, <-men>
	pos	n.
	def	a rare name for {endo?!sperm}.
albumen	3.
	syl	al+bu+men
	pron	<1@lbjumin>, <-men>
	pos	n.
	def	a variant spelling of {albumin}.
albumenise	alt
	head	albumenize
	or	albumenize
	syl	al+bu+me:nise
	pron	<@l1bju:mi2nIz>
	pos	vb.
	mod	tr.
albumenize	0.
	or	albumenise
	syl	al+bu+me:nize
	pron	<@l1bju:mi2nIz>
	pos	vb.
	mod	tr.
	def	to coat with a solution containing albumen or albumin.
albumin	ety	C19: from #7albumen+ -#7in 
albumen	alt
	head	albumin
	or	albumin
	syl	al+bu+men
	pron	<1@lbjumin>
	pos	n.
albumin	0.
	or	albumen
	syl	al+bu+min
	pron	<1@lbjumin>
	pos	n.
	def	any of a group of simple water-soluble proteins that are coagulated by heat and are found in blood plasma, egg white, etc.
albuminate	0.
	syl	al+bu+mi+nate
	pron	<@l1bju:mi2nAt>
	pos	n.
	qual	Now rare.
	def	any of several substances formed from albumin by the action of acid or alkali.
albuminoid	1.
	syl	al+bu+mi+noid
	pron	<@l1bju:mi2ncid>
	pos	adj.
	def	resembling albumin.
albuminoid	2.
	syl	al+bu+mi+noid
	pron	<@l1bju:mi2ncid>
	pos	n.
	def	another name for {scleroprotein}.
albuminous	0.
	syl	al+bu+mi+nous
	pron	<@l1bju:min*s>
	pos	adj.
	def	of or containing albumin.
albuminuria	0.
	syl	al+bu+mi+nu+ri:a
	pron	<@l2bju:mi1nju*ri*>
	pos	n.
	qual	Pathol.
	def	the presence of albumin in the urine. Also called: {proteinuria}.
albumose	ety	C19: from #7albumin+ -#7ose %2
albumose	0.
	syl	al+bu+mose
	pron	<1@lbju2m*us>, <-2m*uz>
	pos	n.
	def	the U.S. name for {proteose}.
Albuquerque	H1.0.
	syl	Al+bu+quer+que
	pron	<1@lb*2kR:ki>
	pos	n.
	def	a city in central New Mexico, on the Rio Grande. Pop.: 243751 (1970).
Afonso de	infl
	head	Albuquerque
	syl	A:fon:so de
	pron	<*1f?~csu> <d*>
	pos	n.
Albuquerque	H2.0.
	syl	Al:bu:quer:que
	pron	<1@lb*2kR:ki>, Portuguese <2albu1kerk*>, Portuguese <2albu1kerk*>
	pos	n.
	def	1453-1515, Portuguese navigator, who established Portuguese colonies in the East by conquering Goa, Ceylon, Malacca, and Ormuz.
alburnum	ety	C17: from Latin: sapwood, from albus white
alburnum	0.
	syl	al+bur+num
	pron	<@l1bR:n*m>
	pos	n.
	def	a former name for {sapwood}.
Albury	0.
	syl	Al+bu+ry
	pron	<1c:b*ri>, <-bri>
	pos	n.
	def	a city in SE Australia, in S central New South Wales, on the Murray River: commercial centre of an agricultural region. Pop.: 32250 (1975 est.).
Alcaeus	0.
	syl	Al:cae:us
	pron	<@l1si*s>
	pos	n.
	def	7th century #7b.c., Greek lyric poet who wrote hymns, love songs, and political odes.
alcahest	0.
	syl	al+ca+hest
	pron	<1@lk*2hest>
	pos	n.
	def	a variant spelling of {alkahest}.
Alcaic	ety	C17: from Late Latin Alcaicus of A#7lcaeus 
Alcaic	1.
	syl	Al+ca+ic
	pron	<@l1kAik>
	pos	adj.
	def	of or relating to a metre used by the poet Alcaeus, consisting of a strophe of four lines each with four feet.
Alcaic	2.
	syl	Al+ca+ic
	pron	<@l1kAik>
	pos	n.
	mod	usually; pl.
	def	verse written in the Alcaic form.
alcaide	ety	C16: from Spanish, from Arabic al-q*_a'id the captain, commander, from q*_ad to give orders
alcaide	1.
	syl	al+caide
	pron	<@l1kAd>, Spanish <al1kIDA>
	pos	n.
	usage	in Spain and Spanish America
	def	the commander of a fortress or castle.
alcaide	2.
	syl	al+caide
	pron	<@l1kAd>, Spanish <al1kIDA>
	pos	n.
	usage	in Spain and Spanish America
	def	the governor of a prison.
alcalde	ety	C17: from Spanish, from Arabic al-q*_ad*_i the judge, from qad*_a to judge
alcade	alt
	head	alcalde
	or	alcalde
	syl	al+cade
	pron	<@l1kAd>
	pos	n.
alcalde	0.
	or	alcade
	syl	al+cal+de
	pron	<@l1k@ldi>, Spanish <al1kaldA>
	pos	n.
	usage	in Spain and Spanish America
	def	the mayor or chief magistrate in a town.
Alcan Highway	0.
	syl	Al+can High+way
	pron	<1@lk@n>
	pos	n.
	def	another name for the {Alaska Highway}.
Alcatraz	0.
	syl	Al+ca+traz
	pron	<1@lk*2tr@z>
	pos	n.
	def	an island in W California, in San Francisco Bay: a federal prison until 1963.
alcazar	ety	C17: from Spanish, from Arabic al-qasr the castle
alcazar	0.
	syl	al+ca+zar
	pron	<2@lk*1za:>, Spanish <al1kaTar>
	pos	n.
	def	any of various palaces or fortresses built in Spain by the Moors.
Alcazar de San Juan	0.
	syl	Al+ca+zar de San Juan
	pron	<1@lk*2za:>, Spanish <al1kaTar>
	pos	n.
	def	a town in S central Spain: associated with Cervantes and Don Quixote. Pop.: 26963 (1970).
Alcestis	0.
	syl	Al:ces:tis
	pron	<@l1sestis>
	pos	n.
	qual	Greek myth.
	def	the wife of king Admetus of Thessaly. To save his life, she died in his place, but was rescued from Hades by Hercules.
alchemist	0.
	syl	al+che+mist
	pron	<1@lk*mist>
	pos	n.
	def	a person who practises alchemy.
alchemise	alt
	head	alchemize
	or	alchemize
	syl	al+che+mise
	pron	<1@lk*2mIz>
	pos	vb.
	mod	tr.
alchemize	0.
	or	alchemise
	syl	al+che+mize
	pron	<1@lk*2mIz>
	pos	vb.
	mod	tr.
	def	to alter (an element, metal, etc.) by alchemy; transmute.
alchemy	ety	C14 alkamye, via Old French from Medieval Latin alchimia, from Arabic al-k*_imiy*_a', from al the+ k*_imiy*_a' transmutation, from Late Greek kh*_emeia the art of transmutation
alchemies	infl
	head	alchemy
	syl	al+che+mies.
	pos	n.
	mod	pl.
alchemy	1.
	syl	al+che+my
	pron	<1@lk*mi>
	pos	n.
	def	the pseudoscientific predecessor of chemistry that sought a method of transmuting base metals into gold, an elixir to prolong life indefinitely, a panacea or universal remedy, and an alkahest or universal solvent.
alchemy	2.
	syl	al+che+my
	pron	<1@lk*mi>
	pos	n.
	def	a power like that of alchemy.
	exam	1	her beauty had a potent alchemy.
alchemic	sub
	head	alchemy
	syl	al+chem+ic
	pron	<@l1kemik>
	pos	adj.
alchemical	sub
	head	alchemy
	or	alchemistic
	syl	al+1chem:i+cal
	pos	adj.
alchemistic	sub
	head	alchemy
	or	alchemical
	syl	al+chem+1is+tic
	pos	adj.
alcheringa	ety	from a native Australian language, literally: dream-time
alcheringa	0.
	syl	al+che+rin+ga
	pron	<2@lC*1riGg*>
	pos	n.
	usage	in the mythology of Australian Aboriginal peoples
	def	a mythical Golden Age of the past. Also called: {al+che@.ra} (#!@alt#s$$r$$), {dreamtime}.
Alcibiades	0.
	syl	Al:ci:bi:a:des
	pron	<2@lsi1bI*2dEz>
	pos	n.
	def	450-404 #7b.c., Athenian statesman and general in the Peloponnesian war: brilliant, courageous, and unstable, he defected to the Spartans in 415, but returned and led the Athenian victories at Abydos (411) and Cyzicus (410).
Alcibiadean	sub
	head	Alcibiades
	syl	Al+ci+2bi:a+1de:an
	pos	adj.
Alcides	0.
	syl	Al:ci:des
	pron	<@l1sIdEz>
	pos	n.
	def	another name for {{Hercules%1}}.
alcidine	ety	C20: from New Latin Alcidae, from Alca type genus
alcidine	0.
	syl	al+ci+dine
	pron	<1@lsi2dIn>
	pos	adj.
	def	of, relating to, or belonging to the a family of sea birds including the auks, guillemots, puffins, and related forms.
Alcinous	0.
	syl	Al:cin:o:*"us
	pron	<@l1sin*u*s>
	pos	n.
	qual	Odyssey
	usage	in Homer's
	def	a Phaeacian king at whose court the shipwrecked Odysseus told of his wanderings. See also {Nausica*"a}.
Alcman	0.
	syl	Alc:man
	pron	<1@lkm*n>
	pos	n.
	def	7th century #7b.c., Greek lyric poet.
Alcmene	0.
	syl	Alc:me:ne
	pron	<@lk1mEni>
	pos	n.
	qual	Greek myth.
	def	the mother of Hercules by Zeus who visited her in the guise of her husband, Amphitryon.
Alcock	0.
	syl	Al:cock
	pron	<1c:lkok>
	pos	n.
	def	Sir {John Wil@.liam}. 1892-1919, English aviator who with A.W. Brown made the first flight across the Atlantic (1919).
alcohol	ety	C16: via New Latin from Medieval Latin, from Arabic al-kuhl powdered antimony; see #7kohl 
alcohol	1.
	syl	al+co+hol
	pron	<1@lk*2hol>
	pos	n.
	def	a colourless flammable liquid, the active principle of intoxicating drinks, produced by the fermentation of sugars, esp. glucose, and used as a solvent and in the manufacture of organic chemicals. Formula: C\2H\5OH. Also called: {ethanol, ethyl alcohol}.
alcohol	2.
	syl	al+co+hol
	pron	<1@lk*2hol>
	pos	n.
	def	a drink or drinks containing this substance.
alcohol	3.
	syl	al+co+hol
	pron	<1@lk*2hol>
	pos	n.
	qual	Chem.
	def	any one of a class of organic compounds that contain one or more hydroxyl groups bound to carbon atoms that are not part of an aromatic ring. The simplest alcohols have the formula ROH, where R is an alkyl group. Compare {{phenol} (sense 2).} See also {diol, triol}.
alcoholic	1.
	syl	al+co+hol+ic
	pron	<2@lk*1holik>
	pos	n.
	def	a person affected by alcoholism.
alcoholic	2.
	syl	al+co+hol+ic
	pron	<2@lk*1holik>
	pos	adj.
	def	of, relating to, containing, or resulting from alcohol.
alcoholicity	0.
	syl	al+co+hol+ic+i:ty
	pron	<2@lk*ho1lisiti>
	pos	n.
	def	the strength of an alcoholic liquor.
Alcoholics Anonymous	0.
	syl	Al+co+hol+ics A:non:y+mous
	pos	n.
	def	an association of alcoholics who try, esp. by mutual assistance, to overcome alcoholism.
alcoholism	1.
	syl	al+co+hol+ism
	pron	<1@lk*ho2liz*m>
	pos	n.
	def	continual heavy consumption of alcoholic drink.
alcoholism	2.
	syl	al+co+hol+ism
	pron	<1@lk*ho2liz*m>
	pos	n.
	def	a physiological disorder result?!ing from this.
alcoholise	alt
	head	alcoholize
	or	alcoholize
	syl	al+co+hol+ise
	pron	<1@lk*ho2lIz>
	pos	vb.
	mod	tr.
alcoholize	0.
	or	alcoholise
	syl	al+co+hol+ize
	pron	<1@lk*ho2lIz>
	pos	vb.
	mod	tr.
	def	to turn into alcoholic drink, as by fermenting or mixing with alcohol.
alcoholization	sub
	head	alcoholize
	or	alcoholisation
	syl	al+co+2hol:i+1za+tion
	pos	n.
alcoholisation	sub
	head	alcoholize
	or	alcoholization
	syl	al+co+2hol:i+1sa+tion
	pos	n.
alcoholometer	0.
	syl	al+co+hol+om+e:ter
	pron	<2@lk*ho1lomit*>
	pos	n.
	def	an instrument, such as a specially calibrated hydrometer, for determining the percent?!age of alcohol in a liquid.
Alkoran	alt
	head	Alcoran
	or	Alcoran
	syl	Al+ko+ran
	pron	<2@lko1ra:n>
	pos	n.
Alcoran	0.
	or	Alkoran
	syl	Al+co+ran
	pron	<2@lko1ra:n>
	pos	n.
	def	another name for the {Koran}.
Alcoranic	sub
	head	Alcoran
	or	Alkoranic
	syl	Al+co+1ran+ic
	pos	adj.
Alkoranic	sub
	head	Alcoran
	or	Alcoranic
	syl	Al+ko+1ran+ic
	pos	adj.
Louisa May	infl
	head	Alcott
	syl	Lou:i:sa May.
	pos	n.
Alcott	0.
	syl	Al:cott
	pron	<1c:lk*t>
	pos	n.
	def	1832-88, U.S. novelist, noted for her children's books, esp. (1869).
alcove	ety	C17: from French alc*^ove, from Spanish alcoba, from Arabic al-qubbah the vault, arch
alcove	1.
	syl	al+cove
	pron	<1@lk*uv>
	pos	n.
	def	a recess or niche in the wall of a room, as for a bed, books, etc.
alcove	2.
	syl	al+cove
	pron	<1@lk*uv>
	pos	n.
	def	any recessed usually vaulted area, as in a garden wall.
alcove	3.
	syl	al+cove
	pron	<1@lk*uv>
	pos	n.
	def	any covered or secluded spot, such as a summerhouse.
Albinus	alt
	head	Alcuin
	or	Alcuin
	syl	Al:bi:nus
	pos	n.
Alcuin	0.
	or	Albinus
	syl	Al:cuin
	pron	<1@lkwin>
	pos	n.
	def	735-804 #7a.d., English scholar and theologian; friend and adviser of Charlemagne.
Alcyone	H1.1.
	syl	Al:cy:o:ne
	pron	<@l1sI*ni>
	pos	n.
	qual	Greek myth.
	def	the daughter of Aeolus and wife of Ceyx, who drowned herself in grief for her husband's death. She was transformed into a kingfisher. See also {Ceyx}. Also called: {Halcyone}.
Alcyone	H1.2.
	syl	Al:cy:o:ne
	pron	<@l1sI*ni>
	pos	n.
	qual	Greek myth.
	def	one of the Pleiades.
Alcyone	H2.0.
	syl	Al+cy:o+ne
	pron	<@l1sI*ni>
	pos	n.
	def	the brightest star in the Pleiades, located in the constellation Taurus.
Aldm	alt
	head	Ald
	or	Ald
	syl	Aldm.
Ald	0.
	or	Aldm
	syl	Ald.
	qual	abbrev. for
	def	Alderman.
Aldabra	0.
	syl	Al+dab+ra
	pron	<@l1d@br*>
	pos	n.
	def	an island group in the Indian Ocean: part of the British Indian Ocean Territory (1965-76); now adminstratively part of the Seychelles.
Aldan	0.
	syl	Al+dan
	pron	Russian <al1dan>
	pos	n.
	def	a river in the Soviet Union in the SE Yakut ASSR, rising in the {Aldan Mountains} and flowing north and west to the Lena River. Length: about 2700 km (1700 miles).
Aldebaran	ety	C14: via Medieval Latin from Arabic al-dabar*_an the follower (of the Pleiades)
Aldebaran	0.
	syl	Al+deb:a+ran
	pron	<@l1deb*r*n>
	pos	n.
	def	a binary star, one component of which is a red giant, the brightest star in the constellation Taurus. It is situated close to the star cluster Hyades. Visual magnitude: l.06; spectral type: K5; distance: 55 light years.
aldehyde	ety	C19: from New Latin al (cohol) dehyd (rogen*_atum) dehydrogenated alcohol 
aldehyde	1.
	syl	al+de+hyde
	pron	<1@ldi2hId>
	pos	n.
	def	any organic compound containing the group -CHO. Aldehydes are oxidized to carboxylic acids and take part in many addition reactions.
aldehyde	2.
	syl	al+de+hyde
	pron	<1@ldi2hId>
	pos	n.
	usage	modifier
	def	consist?!ing of, containing, or concerned with the group -CHO.
	exam	1	aldehyde group or radical.
aldehydic	sub
	head	aldehyde
	syl	al+de+hyd+ic
	pron	<2@ld*1hidik>
	pos	adj.
al dente	ety	literally: to the tooth
al dente	0.
	syl	al den+te
	pron	Italian. <al 1dentA>
	pos	adj.
	usage	of a pasta dish
	def	cooked so as to be firm when eaten.
alder	ety	Old English alor; related to Old High German elira, Latin alnus 
alder	1.
	syl	al+der
	pron	<1c:ld*>
	pos	n.
	def	any N temperate betulaceous shrub or tree of the genus having toothed leaves and conelike fruits. The bark is used in dyeing and tanning and the wood for bridges, etc. because it resists underwater rot.
alder	2.
	syl	al+der
	pron	<1c:ld*>
	pos	n.
	def	any of several similar trees or shrubs.
alder	xref
	syl	al+der
	pron	<1c:ld*>
	pos	n.
	def	Compare {{elder%2}}.
alder buckthorn	0.
	syl	al+der buck+thorn
	pos	n.
	def	a Eurasian rhamnaceous shrub, with small greenish flowers and black berry-like fruits.
alder fly	0.
	syl	al+der fly
	pos	n.
	def	any of various neuropterous insects of the widely distributed group such as that have large broad-based hind wings, produce aquatic larvae, and occur near water.
alderman	ety	Old English aldormann, from ealdor chief (comparative of eald #7old) #7+ mann #7man 
aldermen	infl
	head	alderman
	syl	al+der+men.
	pos	n.
	mod	pl.
alderman	1.
	syl	al+der+man
	pron	<1c:ld*m*n>
	pos	n.
	usage	in England and Wales until 1974
	def	one of the senior members of a local council, elected by other councillors.
alderman	2.
	syl	al+der+man
	pron	<1c:ld*m*n>
	pos	n.
	usage	in the U.S., Canada, etc.
	def	a member of the governing body of a municipality.
alderman	3.
	syl	al+der+man
	pron	<1c:ld*m*n>
	pos	n.
	qual	History.
	def	a variant spelling of {ealdorman}.
alderman	xref
	syl	al+der+man
	pron	<1c:ld*m*n>
	pos	n.
	def	Abbrevs. (for senses 1, 2): {Ald., Aldm}.
aldermanic	sub
	head	alderman
	syl	al+der+man+ic
	pron	<2c:ld*1m@nik>
	pos	adj.
aldermanry	sub
	head	alderman
	syl	al+der+man+ry
	pos	n.
aldermanship	sub
	head	alderman
	syl	al+der+man+2ship
	pos	n.
Aldermaston	0.
	syl	Al+der+mas+ton
	pron	<1c:ld*2ma:st*n>
	pos	n.
	def	a village in S England, in Berkshire southwest of Reading: site of the Atomic Weapons Research Establishment and starting point of the Aldermaston marches (1958-63), organized by the Campaign for Nuclear Disarmament.
Alderney	0.
	syl	Al+der+ney
	pron	<1c:ld*ni>
	pos	n.
	def	one of the Channel Islands, in the English Channel: separated from the French coast by a dangerous tidal channel (the {Race of Alderney) }. Pop.: 1686 (1971). Area: 8 sq. km (3 sq. miles).
Aldershot	0.
	syl	Al+der+shot
	pron	<1c:ld*2Sot>
	pos	n.
	def	a town in S England, in Hampshire: site of a large military camp. Pop.: 33311 (1971).
Aldine	1.
	syl	Al+dine
	pron	<1c:ldIn>, <-dEn>
	pos	adj.
	def	relating to Aldus Manutius or to his editions of the classics.
Aldine	2.
	syl	Al+dine
	pron	<1c:ldIn>, <-dEn>
	pos	n.
	def	a book printed by the Aldine press.
Aldine	3.
	syl	Al+dine
	pron	<1c:ldIn>, <-dEn>
	pos	n.
	def	any of the several typefaces designed by Aldus Manutius.
Aldis lamp	ety	C20: originally a trademark, after A. C. W. Aldis, its inventor
Aldis lamp	0.
	syl	Al+dis lamp
	pron	<1c:ldis>
	pos	n.
	def	a portable lamp used to transmit Morse code.
aldol	ety	C19: from #7ald (#7ehyde) #7+ -#7ol 
aldol	1.
	syl	al+dol
	pron	<1@ldol>
	pos	n.
	def	a colourless or yellowish oily liquid, miscible with water, used in the manufacture of rubber accelerators, as an organic solvent, in perfume, and as a hypnotic and sedative. Formula: CH\3CHOHCH\2CHO.
aldol	2.
	syl	al+dol
	pron	<1@ldol>
	pos	n.
	def	any organic compound containing the group -CHOHCH\2CHO.
aldol	3.
	syl	al+dol
	pron	<1@ldol>
	pos	n.
	usage	modifier
	def	consisting of, containing, or concerned with the group -CHOHCH\2CHO.
	exam	1	aldol group or radical.
aldose	ety	C20: from #7ald (#7ehyde) #7+ {-#7ose %2}
aldose	0.
	syl	al+dose
	pron	<1@ld*us>, <-d*uz>
	pos	n.
	def	a sugar that contains the aldehyde group or is a hemiacetal.
aldosterone	ety	C20: from #7ald (#7ehyde) #7+ -#7o - #7+ster (#7ol) #7+ -#7one 
aldosterone	0.
	syl	al+dos+te:rone
	pron	<@l1dost*2r*un>
	pos	n.
	def	the principal mineralocorticoid secreted by the adrenal cortex. A synthesized form is used in the treatment of Addison's disease.
aldoxime	0.
	syl	ald+ox+ime
	pron	<@l1doksEm>
	pos	n.
	def	an oxime formed by reaction between hydroxylamine and an aldehyde.
Aldridge-Brownhills	0.
	syl	Al:dridge-Brown:hills
	pron	<1c:ldriJ> <1braun2hilz>
	pos	n.
	def	a town in central England, in N West Midlands: formed by the amalgamation of neighbouring towns in 1966; coalmining. Pop.: 88475 (1971).
aldrin	ety	C20: named after K. Alder (1902-58) German chemist
aldrin	0.
	syl	al+drin
	pron	<1c:ldrin>
	pos	n.
	def	a brown to white poisonous crystalline solid, more than 95 per cent of which consists of the compound C\1\2H\8Cl\6, which is used as an insecticide. Melting pt.: 105?%C.
Aldus Manutius	0.
	syl	Al:dus Ma:nu:ti:us
	pron	<1c:ld*s> <m*1nju:Si*s>
	pos	n.
	def	1450-1515, Italian printer, noted for his fine editions of the classics. He introduced italic type.
ale	ety	Old English alu, ealu; related to Old Norse *"ol, Old Saxon alofat 
ale	1.
	syl	ale
	pron	<Al>
	pos	n.
	def	an alcoholic drink made by fermenting a cereal, esp. barley, originally differing from beer by being unflavoured by hops.
ale	2.
	syl	ale
	pron	<Al>
	pos	n.
	qual	U.S.
	def	such a drink made by the top-fermentation process. Compare {beer}.
ale	3.
	syl	ale
	pron	<Al>
	pos	n.
	qual	Chiefly Brit.
	def	another word for {beer}.
aleatory	ety	C17: from Latin *_ale*_at*_orius, from *_ale*_ator gambler, from *_alea game of chance, dice, of uncertain origin
aleatoric	alt
	head	aleatory
	or	aleatory
	syl	a:le:a+to+ric
	pron	<2Ali*1torik>
	pos	adj.
aleatory	1.
	or	aleatoric
	syl	a:le:a+to+ry
	pron	<1Ali*t*ri>, <-tri>
	pos	adj.
	def	dependent on chance.
aleatory	2.
	or	aleatoric
	syl	a:le:a+to+ry
	pron	<1Ali*t*ri>, <-tri>
	pos	adj.
	usage	esp. of a musical composition
	def	involving elements chosen at random by the performer.
aleck	alt
	head	alec
	or	alec
	syl	al+eck
	pron	<1@lik>
	pos	n.
alec	0.
	or	aleck
	syl	al:ec
	pron	<1@lik>
	pos	n.
	qual	Austral. slang.
	def	a stupid person; silly fool.
alecost	0.
	syl	ale+cost
	pron	<1Al2kost>
	pos	n.
	def	another name for {costmary}.
Alecto	0.
	syl	A:lec:to
	pron	<*1lekt*u>
	pos	n.
	qual	Greek myth.
	def	one of the three Furies; the others are Megaera and Tisiphore.
alee	0.
	syl	a:lee
	pron	<*1lE>
	pos	adv. adj.
	qual	Nautical.
	usage	postpositive
	def	on or towards the lee.
	exam	1	with the helm alee.
alegar	ety	C14: from #7ale+ vinegar 
alegar	0.
	syl	al+e:gar
	pron	<1Alig*>, <1@->
	pos	n.
	def	malt vinegar.
alehouse	0.
	syl	ale+house
	pron	<1Al2haus>
	pos	n.
	def	an archaic or dialect name for {pub}.
Alexander	infl
	head	Alekhine
	syl	Al:ex:an:der.
	pos	n.
Alekhine	0.
	syl	Al:e:khine
	pron	<1@li2kEn>, Russian <al1jexin>
	pos	n.
	def	1892-1946, Russian chess player who lived in France; world champion (1927-35, 1937-46) .
Aleksandropol	0.
	syl	A:le:ksan+dro+pol
	pron	Russian <aliksan1drcp*lj>
	pos	n.
	def	the former name (from 1837 until after the Revolution) of {Leninakan}.
Aleksandrovsk	0.
	syl	A:le:ksan+drovsk
	pron	Russian <ali1ksandr*fsk>
	pos	n.
	def	the former name (until 1921) of {Zaporozhye}.
Mateo	infl
	head	Alem'an
	syl	Ma:te:o
	pron	<ma1tAo>
	pos	n.
Alem'an	0.
	syl	A:le:m*'an
	pron	Spanish <2alA1man>
	pos	n.
	def	1547-??1614, Spanish novelist, author of the picaresque novel (1599).
Alemanni	ety	C18: from Latin, of Germanic origin; related to Gothic alamans a totality of people
Alemanni	0.
	syl	Al:e+man+ni
	pron	<2@l*1ma:ni>
	pos	n.
	def	a West Germanic people who settled in the 4th century #7a.d. between the Rhine, the Main, and the Danube.
Alemannic	ety	C18: from Late Latin Alamannicus, of Germanic origin
Alemannic	1.a.
	syl	Al+e:man+nic
	pron	<2@l*1m@nik>
	pos	n.
	def	the group of High German dialects spoken in Alsace, Switzerland, and SW Germany.
Alemannic	1.b.
	syl	Al+e:man+nic
	pron	<2@l*1m@nik>
	pos	n.
	def	the language of the ancient Alemanni, from which these modern dialects have developed. See also {Old High German}.
Alemannic	2.
	syl	Al+e:man+nic
	pron	<2@l*1m@nik>
	pos	adj.
	def	of or relating to the Alemanni, their speech, or the High German dialects descended from it.
d'	infl
	head	Alembert
	syl	d'
	pron	French <dal?~a1be:r>
	pos	n.
Jean Le Rond	infl
	head	Alembert
	syl	Jean Le Rond
	pron	<Z?~a> <l*> <1r?~o>
	pos	n.
Alembert	0.
	syl	A:lem:bert
	pron	French <dal?~a1be:r>
	pos	n.
	def	1717-83, French mathematician, physicist, and rationalist philosopher, noted for his contribution to Newtonian physics in (1743) and for his collaboration with Diderot in editing the
alembic	ety	C14: from Medieval Latin alembicum, from Arabic al-anb*_iq the still, from Greek ambix cup
alembic	1.
	syl	a:lem+bic
	pron	<*1lembik>
	pos	n.
	def	an obsolete type of retort used for distillation.
alembic	2.
	syl	a:lem+bic
	pron	<*1lembik>
	pos	n.
	def	anything that distils or purifies.
alembicated	0.
	syl	a:lem+bi+cat+ed
	pron	<*1lembi2kAtid>
	pos	adj.
	usage	of a literary style
	def	excessively refined; precious.
alembication	sub
	head	alembicated
	syl	a:2lem+bi+1ca+tion
	pos	n.
Alencon	0.
	syl	A:len+*,con
	pron	French <al?~a1s?~c>
	pos	n.
	def	a town in NW France: early lace-manufacturing centre. Pop.: 34666 (1975).
Alencon lace	0.
	syl	A+len+*,con lace
	pos	n.
	def	an elaborate lace worked on a hexagonal mesh and used as a border, or a machine-made copy of this.
aleph	ety	Hebrew: ox
aleph	0.
	syl	a:leph
	pron	<1a:lif>, Hebrew <1alef>
	pos	n.
	def	the first letter in the Hebrew alphabet (###800023) articulated as a glottal stop and transliterated with a superior period (*.#800024) .
aleph-zero	alt
	head	aleph-null
	or	aleph-null
	syl	a:leph-ze:ro
	pos	n.
aleph-null	0.
	or	aleph-zero
	syl	a:leph-null
	pos	n.
	def	the smallest infinite cardinal number; the cardinal number of the set of positive integers. Symbol: ###800025 \0.
Aleppo	0.
	syl	A:lep+po
	pron	<*1lep*u>
	pos	n.
	def	an ancient city in NW Syria: industrial and commercial centre. Pop.: 639428 (1970). French name: {A@.lep} (a#!l$ep). Arabic name: {Ha+leb} (h$a$:#!l$eb).
Aleppo gall	0.
	syl	A:lep+po gall
	pos	n.
	def	a type of nutgall occurring in oaks in W Asia and E Europe.
alert	ety	C17: from Italian all'erta on the watch, from erta lookout post, from ergere to build up, from Latin *_erigere; see #7erect 
alert	1.
	syl	a:lert
	pron	<*1lR:t>
	pos	adj.
	usage	usually postpositive
	def	vigilantly attentive.
	exam	1	alert to the problems.
alert	2.
	syl	a:lert
	pron	<*1lR:t>
	pos	adj.
	usage	usually postpositive
	def	brisk, nimble, or lively.
alert	3.
	syl	a:lert
	pron	<*1lR:t>
	pos	n.
	usage	usually postpositive
	def	an alarm or warning, esp. a siren warning of an air raid.
alert	4.
	syl	a:lert
	pron	<*1lR:t>
	pos	n.
	usage	usually postpositive
	def	the period during which such a warning remains in effect.
alert	5.a.
	syl	a:lert
	pron	<*1lR:t>
	pos	n.
	usage	usually postpositive
	def	on guard against danger, attack, etc.
alert	5.b.
	syl	a:lert
	pron	<*1lR:t>
	pos	n.
	usage	usually postpositive
	def	watchful; ready.
	exam	1	on the alert for any errors.
alert	6.
	syl	a:lert
	pron	<*1lR:t>
	pos	vb.
	mod	tr.
	usage	usually postpositive
	def	to warn or signal (troops, police, etc.) to prepare for action.
alert	7.
	syl	a:lert
	pron	<*1lR:t>
	pos	vb.
	mod	tr.
	usage	usually postpositive
	def	to warn of danger, an attack, etc.
alertly	sub
	head	alert
	syl	a:1lert+ly
	pos	adv.
alertness	sub
	head	alert
	syl	a:1lert+ness
	pos	n.
-ales	ety	New Latin, from Latin, plural of -*_alis -#7al 
-ales	0.
	syl	-a:les
	usage	suffix forming plural proper nouns.
	def	denoting plants belonging to an order.
	exam	1	Rosales;
	exam	2	Filicales.
Alessandria	0.
	syl	A:les+san+dri:a
	pron	Italian <2alAs1sandrja>
	pos	n.
	def	a town in NW Italy, in Piedmont. Pop.: 103474 (1975 est.).
Aalesund	alt
	head	Alesund
	or	Alesund
	syl	*%Aa:le+sund
	pron	Norwegian <1o:l*2sun>
	pos	n.
Alesund	0.
	or	Aalesund
	syl	*%A:le+sund
	pron	Norwegian <1o:l*2sun>
	pos	n.
	def	a port and market town in W Norway, on an island between Bergen and Trondheim: fishing and sealing fleets. Pop.: 39145 (1970).
alethic	ety	C20: from Greek al*_etheia truth
alethic	0.a.
	syl	a:le:thic
	pron	<*1lETik>
	pos	adj.
	qual	Logic.
	def	of or relating to such philosophical concepts as truth, necessity, possibility, contingency, etc.
alethic	0.b.
	syl	a:le:thic
	pron	<*1lETik>
	pos	adj.
	qual	Logic.
	def	designating the branch of modal logic that deals with the formalization of these concepts.
aleurone	ety	C19: from Greek aleuron flour
aleuron	alt
	head	aleurone
	or	aleurone
	syl	al:eu+ron
	pron	<*1lu*ron>, <-r*n>
	pos	n.
aleurone	0.
	or	aleuron
	syl	al:eu+rone
	pron	<*1lu*r*n>, <-2roun>
	pos	n.
	def	an albuminoid protein that occurs in the form of storage granules in plant cells, esp. in seeds such as maize.
Aleut	ety	from Russian ale*'ut, probably of Chukchi origin
Aleut	1.
	syl	Al+eut
	pron	<@1lu:t>, <1@lE2ut>
	pos	n.
	def	a member of a people inhabiting the Aleutian Islands and SW Alaska, related to the Eskimos.
Aleut	2.
	syl	Al+eut
	pron	<@1lu:t>, <1@lE2ut>
	pos	n.
	def	the language of this people, related to Eskimo.
Aleutian	1.
	syl	A:leu+tian
	pron	<*1lu:S*n>
	pos	adj.
	def	of, denoting, or relating to the Aleutian Islands, the Aleuts, or their language.
Aleutian	2.
	syl	A:leu+tian
	pron	<*1lu:S*n>
	pos	n.
	def	another word for {Aleut}.
Aleutian Islands	0.
	syl	A:leu+tian Is+lands
	pos	n.
	def	a chain of over 150 volcanic islands, extending southwestwards from the Alaska Peninsula between the N Pacific and the Bering Sea.
A level	0.
	syl	A lev+el
	pos	n.
	qual	Brit.
	def	the advanced level of a subject taken for General Certificate of Education ({G.C.E}.) , in schools usually taken two years after O level.
alevin	ety	C19: from French, from Old French alever to rear (young), from Latin lev*_are to raise
alevin	0.
	syl	al+e:vin
	pron	<1@livin>
	pos	n.
	def	a young fish, esp. a young salmon or trout.
alewife	ety	C19: perhaps an alteration (through influence of alewife, that is, a large rotund woman, alluding to the fish's shape) of French alose shad
alewives	infl
	head	alewife
	syl	ale+wives.
	pos	n.
	mod	pl.
alewife	0.
	syl	ale+wife
	pron	<1Al2wIf>
	pos	n.
	def	a North American fish, similar to the herring family (herrings).
Harold (Rupert Leofric George)	infl
	head	Alexander
	syl	Har:old (Rupert Leofric George)
	pos	n.
Alexander	0.
	syl	Al:ex:an:der
	pron	<2@lig1za:nd*>
	pos	n.
	def	Earl Alexander of Tunis. 1891-1969, British field marshal in World War II, who organized the retreat from Dunkirk and commanded the victories of North Africa (1943) and Sicily and Italy (1944-45); governor general of Canada (1946-52); British minister of defence (1952-54).
Alexander I	1.
	syl	Al:ex:an:der I
	pos	n.
	usage	c.
	def	1080-1124, king of Scotland (1107-24), son of Malcolm III.
Alexander I	2.
	syl	Al:ex:an:der I
	pos	n.
	def	1777-1825, tsar of Russia (1801-25), who helped defeat Napoleon and formed the Holy Alliance (1815).
Alexander II	1.
	syl	Al:ex:an:der II
	pos	n.
	def	1198-1249, king of Scotland (1214-49), son of William I.
Alexander II	2.
	syl	Al:ex:an:der II
	pos	n.
	def	1818-81, tsar of Russia (1855-81), son of Nicholas I, who emancipated the serfs (1861). He was assassinated by the Nihilists.
Alexander III	1.
	syl	Al:ex:an:der III
	pos	n.
	def	1241-86, king of Scotland (1249-86), son of Alexander II.
Alexander III	2.
	syl	Al:ex:an:der III
	pos	n.
	def	original name died 1181, pope (1159-81), who excommunicated Barbarossa.
Alexander III	3.
	syl	Al:ex:an:der III
	pos	n.
	def	1845-94, tsar of Russia (1881-94), son of Alexander II.
Alexander VI	0.
	syl	Al:ex:an:der VI
	pos	n.
	def	original name 1431-1503, pope (1492-1503): noted for his extravagance and immorality as well as for his patronage of the arts; father of Cesare and Lucrezia Borgia, with whom he is said to have committed incest.
Alexander Archipelago	0.
	syl	Al+ex+an+der Ar+chi+pel:a+go
	pos	n.
	def	a group of over 1000 islands along the coast of SE Alaska.
Alexander I Island	0.
	syl	Al+ex+an+der I Is+land
	pos	n.
	def	an island of Antarctica, west of Palmer Land, in the Bellingshausen Sea. Length: about 378 km (235 miles).
Saint	infl
	head	Alexander Nevski
	syl	Saint.
	pos	n.
Alexander Nevski	0.
	syl	Al:ex:an:der Nev:ski
	pron	<1nevski>, <1nef->, Russian <1njefskij>
	pos	n.
	def	??1220-63, Russian prince and military leader, who defeated the Swedes at the River Neva (1240) and the Teutonic knights at Lake Peipus (1242).
alexanders	ety	Old English, from Medieval Latin alexandrum, probably (through association in folk etymology with Alexander the Great) changed from Latin holus atrum black vegetable
alexanders	1.
	syl	al+ex+an+ders
	pron	<2@lig1za:nd*z>
	pos	n.
	def	a biennial umbelliferous plant, native to S Europe, with dense umbels of yellow-green flowers and black fruits.
golden alexanders	2.
	head	alexanders
	syl	golden alexanders.
	def	an umbelliferous plant, of North America, having yellow flowers in compound umbels.
Alexander the Great	0.
	syl	Al:ex:an:der the Great
	pos	n.
	def	356-323 #7b.c., king of Macedon, who conquered Greece (336), Egypt (331), and the Persian Empire (328), and founded Alexandria.
Alexandra	0.
	syl	Al:ex:an:dra
	pron	<2@lig1za:ndr*>
	pos	n.
	def	1844-1925, queen consort of Edward VII of England.
Alexandretta	0.
	syl	Al+ex+an+dret+ta
	pron	<2@ligza:n1dreta>
	pos	n.
	def	the former name of {Iskenderun}.
Alexandria	0.
	syl	Al+ex+an+dri:a
	pron	<2@lig1z@ndri*>, <-1za:n->
	pos	n.
	def	the chief port of Egypt, on the Nile Delta: cultural centre of ancient times, founded by Alexander the Great (332 #7b.c.) #7. Pop.: 2259000 (1974 est.). Arabic name: {El Iskandariyah}.
Alexandrian	1.
	syl	Al+ex+an+dri:an
	pron	<2@lig1z@ndri*n>, <-1za:n->
	pos	adj.
	def	of or relating to Alexandria in Egypt.
Alexandrian	2.
	syl	Al+ex+an+dri:an
	pron	<2@lig1z@ndri*n>, <-1za:n->
	pos	adj.
	def	of or relating to Alexander the Great.
Alexandrian	3.
	syl	Al+ex+an+dri:an
	pron	<2@lig1z@ndri*n>, <-1za:n->
	pos	adj.
	def	relating to the Hellenistic philosophical, literary, and scientific ideas that flourished in Alexandria in the last three centuries #7b.c.
Alexandrian	4.
	syl	Al+ex+an+dri:an
	pron	<2@lig1z@ndri*n>, <-1za:n->
	pos	adj.
	usage	of writers, literary works, etc.
	def	erudite and imitative rather than original or creative.
Alexandrian	5.
	syl	Al+ex+an+dri:an
	pron	<2@lig1z@ndri*n>, <-1za:n->
	pos	n.
	def	a native or inhabitant of Alexandria.
Alexandrine	ety	C16: from French alexandrin, from Alexandre title of 15th-century poem written in this metre
Alexandrine	1.
	syl	Al+ex+an+drine
	pron	<2@lig1z@ndrIn>, <-drin>, <-1za:n->
	pos	n.
	qual	Prosody.
	def	a line of verse having six iambic feet, usually with a caesura after the third foot.
Alexandrine	2.
	syl	Al+ex+an+drine
	pron	<2@lig1z@ndrIn>, <-drin>, <-1za:n->
	pos	adj.
	qual	Prosody.
	def	of, characterized by, or written in Alexandrines.
alexandrite	ety	C19: named after A#7lexander I of Russia; see -#7ite %1
alexandrite	0.
	syl	al+ex+an+drite
	pron	<2@lig1z@ndrIt>
	pos	n.
	def	a green variety of chryso?!beryl used as a gemstone.
Alexandro'upolis	0.
	syl	A:le:xan+dro*'u+po+lis
	pron	Greek <2aleksan1Drupclis>
	pos	n.
	def	a port in NE Greece, in W Thrace. Pop.: 22995 (1971). Former name (until the end of World War I): {Ded*'eagach}.
alexia	ety	C19: from New Latin, from #7a -%1#7+ Greek lexis speech; influenced in meaning by Latin legere to read
alexia	0.
	syl	a:lex:i:a
	pron	<*1leksi*>
	pos	n.
	def	a disorder of the central nervous system characterized by impaired ability to read. Nontechnical name: {word blindness}. Compare {aphasia}.
alexin	ety	C19: from German, from Greek alexein to ward off
alexin	0.
	syl	a:lex+in
	pron	<*1leksin>
	pos	n.
	qual	Immunol.
	def	a former word for { {complement} (sense 9).}
alexinic	sub
	head	alexin
	syl	a:lex+in+ic
	pron	<2@lik1sinik>
	pos	adj.
alexipharmic	ety	C17: from Greek alexipharmakon antidote, from alexein to avert+ pharmakon drug
	infl
	head	alexipharmic
	syl	~
	pos	adj.
	qual	Med.
alexipharmic	1.
	syl	a:lex:i+phar+mic
	pron	<*2leksi1fa:mik>
	pos	adj.
	def	acting as an antidote. {~}
alexipharmic	2.
	syl	a:lex:i+phar+mic
	pron	<*2leksi1fa:mik>
	pos	adj.
	def	an antidote.
Alexis Mikhailovich	0.
	syl	A:lex:is Mi:khai:lo:vich
	pron	<*1leksis> <mi1kIl*2viC>
	pos	n.
	def	1629-76, tsar of Russia (1645-76); father of Peter the Great.
Alexius I Comnenus	0.
	syl	A:lex:i:us I Com:ne:nus
	pron	<*1leksi*s> <kom1nEn*s>
	pos	n.
	def	1048-1118, ruler of the Byzantine Empire (1081-1118).
alfalfa	ety	C19: from Spanish, from Arabic al-fasfasah, from al the+ fasfasah 
alfalfa	0.
	syl	al+fal+fa
	pron	<@l1f@lf*>
	pos	n.
	def	a papilionaceous plant, of Europe and Asia, having compound leaves with three leaflets and clusters of small purplish flowers. It is widely cultivated for forage and used as a commercial source of chlorophyll. Also called: {lucerne}.
Al Fatah	0.
	syl	Al Fat+ah
	pron	<@l> <1f@t*>
	pos	n.
	def	See {Fatah}.
Alfieri	0.
	syl	Al:fie:ri
	pron	Italian <al1fje:ri>
	pos	n.
	def	Count {Vit@.to@.rio} (vit#!t@$$:rjo). 1749-1803, Italian dramatist and poet, noted for his classical tragedies and political satires.
alfilaria	ety	via American Spanish from Spanish alfilerillo, from alfiler pin, from Arabic al-khil*_al the thorn
alfileria	alt
	head	alfilaria
	or	alfilaria
	syl	al+fil+e:ri:a
	pron	<2@lfi1le*ri*>
	pos	n.
alfilaria	0.
	or	alfileria
	syl	al+fil:a+ri:a
	pron	<2@lfi1le*ri*>
	pos	n.
	def	a geraniaceous plant, native to Europe, with finely divided leaves and small pink or purplish flowers. It is widely naturalized in North America and is used as fodder. Also called: {pin clover}.
Alfonso XIII	0.
	syl	Al:fon:so XIII
	pron	Spanish <al1fonso>
	pos	n.
	def	1886-1941, king of Spain (1886-1931), who was forced to abdicate on the establishment of the republic in 1931.
alforja	ety	C17: from Spanish, from Arabic al-khurj the saddlebag
alforja	0.
	syl	al+for+ja
	pron	<@l1fc:J*>
	pos	n.
	qual	Southwestern U.S.
	def	a saddlebag made of leather or canvas.
Alfred the Great	0.
	syl	Al:fred the Great
	pron	<1@lfrid>
	pos	n.
	def	849-99, king of Wessex (871-99) and overlord of England, who defeated the Danes and encouraged learning and writing in English.
alfresco	ety	C18: from Italian: in the cool
alfresco	0.
	syl	al+fres+co
	pron	<@l1fresk*u>
	pos	adj. adv.
	def	in the open air.
alg	0.
	syl	alg.
	qual	abbrev. for
	def	algebra algebraic.
Alg	0.
	syl	Alg.
	qual	abbrev. for
	def	Algeria(n).
algae	ety	C16: from Latin, plural of alga seaweed, of uncertain origin
alga	infl
	head	algae
	syl	al:ga
	pron	<1@lg*>
	pos	n.
	mod	sing.
algae	0.
	syl	al+gae
	pron	<1@lJE>
	pos	n.
	mod	pl.
	def	unicellular or multicellular plants, occurring in fresh or salt water or moist ground, that have chlorophyll and other pigments but lack true stems, roots, and leaves. The group includes the seaweeds, diatoms, and spirogyra. See also {thallophyte}.
algal	sub
	head	algae
	syl	al+gal
	pron	<1@lg*l>
	pos	adj.
algarroba	ety	C19: from Spanish, from Arabic al the+ kharr*_ubah #7carob 
algaroba	alt
	head	algarroba
	or	algarroba
	syl	al+ga+ro+ba
	pron	<2@lg*1r*ub*>
	pos	n.
algarroba	1.
	or	algaroba
	syl	al+gar+ro+ba
	pron	<2@lg*1r*ub*>
	pos	n.
	def	another name for {mesquite} or {carob}.
algarroba	2.
	or	algaroba
	syl	al+gar+ro+ba
	pron	<2@lg*1r*ub*>
	pos	n.
	def	the edible pod of these trees.
algebra	ety	C14: from Medieval Latin, from Arabic al-jabr the bone-setting, reunification, mathematical reduction
algebra	1.
	syl	al+ge+bra
	pron	<1@lJibr*>
	pos	n.
	def	a branch of mathematics in which arithmetical operations and relationships are generalized by using symbols to represent members of specified sets of numbers.
algebra	2.
	syl	al+ge+bra
	pron	<1@lJibr*>
	pos	n.
	def	a system of logical notation in which variables represent propositions and symbols represent the relations, such as conjunction or disjunction, between them.
algebraist	sub
	head	algebra
	syl	al+ge+bra+ist
	pron	<2@lJi1brAist>
	pos	n.
algebraical	alt
	head	algebraic
	or	algebraic
	syl	al+ge+bra:i+cal
	pos	adj.
algebraic	1.
	or	algebraical
	syl	al+ge+bra+ic
	pron	<2@lJi1brAik>
	pos	adj.
	def	of or relating to algebra.
	exam	1	an algebraic expression.
algebraic	2.
	or	algebraical
	syl	al+ge+bra+ic
	pron	<2@lJi1brAik>
	pos	adj.
	def	using or relating to finite numbers, operations, or relationships.
algebraically	sub
	head	algebraic
	syl	al+ge+1bra:i+cal+ly
	pos	adv.
algebraic number	1.
	syl	al+ge+bra+ic num+ber
	pos	n.
	def	any positive or negative real number.
algebraic number	2.
	syl	al+ge+bra+ic num+ber
	pos	n.
	def	any number that is a root of a polynomial equation having rational coefficients.
Algeciras	0.
	syl	Al+ge+ci+ras
	pron	<2@lJi1sir*s>, Spanish <2al$xA1Tiras>
	pos	n.
	def	a port and resort in SW Spain, on the Strait of Gibraltar: scene of a conference of the Great Powers in 1906. Pop.: 81662 (1970).
Horatio	infl
	head	Alger
	syl	Ho:ra:ti:o.
	pos	n.
Alger	0.
	syl	Al:ger
	pron	<1@lJ*>
	pos	n.
	def	1834-99, U.S. author of adventure stories for boys, including (1867).
Algeria	0.
	syl	Al+ge+ri:a
	pron	<@l1Ji*ri*>
	pos	n.
	def	a republic in NW Africa, on the Mediterranean: became independent in 1962, after more than a century of French rule; consists chiefly of the N Sahara Desert, with the Atlas Mountains in the north, and contains rich deposits of oil and natural gas. Official language: Arabic; French also widely spoken. Religion: Muslim. Currency: dinar. Capital: Algiers. Pop.: 14431000 (1973 est.). Area: about 2382800 sq. km (920000 sq. miles). French name: {Al+g*'e+rie} (al#fe#!ri).
Algerian	sub
	head	Algeria
	or	Algerine
	syl	Al+1ge+ri:an
	pron	<1@lJ*2rEn>
	pos	adj. n.
Algerine	sub
	head	Algeria
	or	Algerian
	syl	Al+ge+rine
	pron	<1@lJ*2rEn>
	pos	adj. n.
algerine	0.
	syl	al+ge:rine
	pron	<2@lJ*1rEn>
	pos	n.
	def	a soft striped woollen cloth.
-algia	ety	from Greek algos pain
-algia	0.
	syl	-al:gi:a
	pos	n.
	usage	combining form.
	def	denoting pain or a painful condition of the part specified.
	exam	1	neuralgia;
	exam	2	odontalgia.
-algic	sub
	head	-algia
	syl	-al:gic
	pos	adj.
algicide	0.
	syl	al+gi+cide
	pron	<1@lJi2sId>
	pos	n.
	def	any substance that kills algae.
algid	ety	C17: from Latin algidus, from alg*_ere to be cold
algid	0.
	syl	al+gid
	pron	<1@lJid>
	pos	adj.
	qual	Med.
	def	chilly or cold.
algidity	sub
	head	algid
	syl	al+1gid+i:ty
	pos	n.
Algiers	0.
	syl	Al+giers
	pron	<@l1Ji*z>
	pos	n.
	def	the capital of Algeria, an ancient port on the Mediterranean; up to 1830 a centre of piracy. Pop.: 903533 (1966). Arabic name: {Al-Je@.za@.ir} (@!@ald#f$e#!z$a$:$I$$). French name: {Al+ger} (al#!#fe).
algin	0.
	syl	al+gin
	pron	<1@lJin>
	pos	n.
	def	alginic acid or one of its esters or salts, esp. the gelatinous solution obtained as a by-product in the extraction of iodine from seaweed, used in mucilages and for thickening jellies.
alginate	0.
	syl	al+gi+nate
	pron	<1@lJi2nAt>
	pos	n.
	def	a salt or ester of alginic acid.
alginic acid	0.
	syl	al+gin+ic ac:id
	pron	<@l1Jinik>
	pos	n.
	def	a white or yellowish powdery polysaccharide having marked hydrophilic properties. Ex?!tracted from kelp, it is used mainly in the food and textile industries and in cosmetics and pharmaceuticals. Formula: (C\6H\8O\6)\n; molecular wt.: 32000-250000.
algo-	ety	from Greek algos pain
algo-	0.
	syl	al:go-
	usage	combining form.
	def	denoting pain.
	exam	1	algometer;
	exam	2	algophobia.
algoid	0.
	syl	al+goid
	pron	<1@lgcid>
	pos	adj.
	def	resembling or relating to algae.
Algol	ety	C14: from Arabic al gh*_ul the #7ghoul 
Algol	0.
	syl	Al+gol
	pron	<1@lgol>
	pos	n.
	def	the second brightest star in Perseus, the first known eclipsing binary. Visual magnitude: 2.2-3.5; period: 68.8 hours; spectral type (brighter component): B8.
ALGOL	ety	C20: alg- (orithmic) o (riented) l (anguage) 
ALGOL	0.
	syl	ALGOL
	pron	<1@lgol>
	pos	n.
	def	a computer programming language de?!signed for mathematical and scientific purposes, in which algorithms can be expressed unambiguously; a high-level language. Compare {FORTRAN, PL/1, COBOL}.
algolagnia	0.
	syl	al+go+lag+ni:a
	pron	<2@lg*1l@gni*>
	pos	n.
	def	a perversion in which sexual pleasure is gained from the experience or infliction of pain. See also {sadism, masochism}.
algolagnic	sub
	head	algolagnia
	syl	al+go+1lag+nic
	pos	adj.
algolagnist	sub
	head	algolagnia
	syl	al+go+1lag+nist
	pos	n.
algology	0.
	syl	al+gol+o:gy
	pron	<@l1gol*Ji>
	pos	n.
	def	the branch of botany concerned with the study of algae.
algological	sub
	head	algology
	syl	al+go+log:i+cal
	pron	<2@lg*1loJikL>
	pos	adj.
algologically	sub
	head	algology
	syl	al+go+1log:i+cal+ly
	pos	adv.
algologist	sub
	head	algology
	syl	al+1gol:o+gist
	pos	n.
algometer	0.
	syl	al+gom+e:ter
	pron	<@l1gomit*>
	pos	n.
	def	an instrument for measuring sensitivity to pressure ({pressure algometer}) or to pain. &- {al+#!gom+e@.try}
Algonkian	1.
	syl	Al+gon+ki:an
	pron	<@l1goGki*n>
	pos	n. adj.
	def	an obsolete term for {Proterozoic}.
Algonkian	2.
	syl	Al+gon+ki:an
	pron	<@l1goGki*n>
	pos	n. adj.
	def	a variant spelling of {Algonquian}.
Algonkian	alt
	head	Algonquian
	or	Algonquian
	syl	Al+gon+ki:an
	pos	n.
Algonquian	1.
	or	Algonkian
	syl	Al+gon+qui:an
	pron	<@l1goGki*n>, <-kwi->
	pos	n.
	def	a family of North American Indian languages whose speakers ranged over an area stretching from the Atlantic between Newfoundland and Delaware to the Rocky Mountains, including Micmac, Mahican, Ojibwa, Fox, Blackfoot, Cheyenne, and Shawnee.
Algonquians	infl
	head	Algonquian
	or	Algonquian
	syl	Al+gon+qui:ans
	pos	n.
	mod	pl.
Algonquian	infl
	or	Algonquians
	syl	Al+gon+qui:an
	pos	n.
	mod	pl.
Algonquian	2.
	or	Algonkian
	syl	Al+gon+qui:an
	pron	<@l1goGki*n>, <-kwi->
	pos	n.
	def	a member of any of the North American Indian peoples that speak one of these languages.
Algonquian	3.
	or	Algonkian
	syl	Al+gon+qui:an
	pron	<@l1goGki*n>, <-kwi->
	pos	adj.
	def	denoting, belonging to, or relating to this linguistic family or its speakers.
Algonquin	ety	C17: from Canadian French, earlier written as Algoumequin; perhaps related to Micmac algoomaking at the fish-spearing place
Algonkin	alt
	head	Algonquin
	or	Algonquin
	syl	Al+gon+kin
	pron	<@l1goGkin>
	pos	n.
Algonquins	infl
	head	Algonquin
	or	Algonkins
	syl	Al+gon+quins
	pos	n.
	mod	pl.
Algonquin	infl
	or	Algonkin
	syl	Al+gon+quin
	pos	n.
	mod	pl.
Algonkins	infl
	head	Algonquin
	or	Algonquins
	syl	Al+gon+kins
	pos	n.
	mod	pl.
Algonkin	infl
	head	Algonquin
	or	Algonquin
	syl	Al+gon+kin
	pos	n.
	mod	pl.
Algonquin	1.
	or	Algonkin
	syl	Al+gon+quin
	pron	<@l1goGkin>, <-kwin>
	pos	n.
	def	a member of a North American Indian people formerly living along the St. Lawrence and Ottawa Rivers in Canada.
Algonquin	2.
	or	Algonkin
	syl	Al+gon+quin
	pron	<@l1goGkin>, <-kwin>
	pos	n.
	def	the language of this people, a dialect of Ojibwa.
Algonquin	3.
	or	Algonkin
	syl	Al+gon+quin
	pron	<@l1goGkin>, <-kwin>
	pos	n. adj.
	def	a variant spelling of {Algonquian}.
Algonquin Park	0.
	syl	Al+gon+quin Park
	pos	n.
	def	a provincial park in S Canada, in E Ontario, containing over 1200 lakes. Area: 7100 sq. km (2741 sq. miles).
algophobia	0.
	syl	al+go+pho+bi:a
	pron	<2@lg*1f*ubi*>
	pos	n.
	qual	Psychiatry.
	def	an acute fear of experiencing or witnessing bodily pain.
algor	ety	C15: from Latin
algor	0.
	syl	al+gor
	pron	<1@lgc:>
	pos	n.
	qual	Med.
	def	chill.
algorism	ety	C13: from Old French algorisme, from Medieval Latin algorismus, from Arabic al-khuw*_arizmi, from the name of abu-Ja`far Mohammed ibn-M*_usa al-Khuw*_arizmi, ninth-century Persian mathematician
algorism	1.
	syl	al+go+rism
	pron	<1@lg*2riz*m>
	pos	n.
	def	the Arabic or decimal system of counting.
algorism	2.
	syl	al+go+rism
	pron	<1@lg*2riz*m>
	pos	n.
	def	the skill of computation using any system of numerals.
algorism	3.
	syl	al+go+rism
	pron	<1@lg*2riz*m>
	pos	n.
	def	another name for {algorithm}.
algorismic	sub
	head	algorism
	syl	al+go+1ris+mic
	pos	adj.
algorithm	ety	C17: changed from #7algorism, through influence of Greek arithmos number
algorithm	0.
	syl	al+go+rithm
	pron	<1@lg*2ri@d*m>
	pos	n.
	def	any method or procedure of computation, usually involving a series of steps as in long division. Also called: {algorism}.
algorithmic	sub
	head	algorithm
	syl	al+go+1rith+mic
	pos	adj.
algorithmically	sub
	head	algorithm
	syl	al+go+1rith+mi+cal+ly
	pos	adv.
Alhambra	0.
	syl	Al+ham+bra
	pron	<@l1h@mbr*>
	pos	n.
	def	a citadel and palace in Granada built for the Moorish kings during the 13th and 14th centuries: noted for its rich ornamentation.
Alhambresque	sub
	head	Alhambra
	syl	Al+ham+bresque
	pron	<2@lh@m1bresk>
	pos	adj.
Al Hasa	0.
	syl	Al Ha:sa
	pron	<a:l> <1ha:s*>
	pos	n.
	def	a province in E Saudi Arabia, in Nejd on the Persian Gulf: site of the first discovery of oil in Saudi Arabia (near Ad Dammam in 1933). Chief town: Al Hufuf. Pop.: 500000 (1961 est.). Area: 106708 sq. km (41200 sq. miles).
Al Hofuf	alt
	head	Al Hufuf
	or	Al Hufuf
	syl	Al Ho+fuf
	pron	<@l> <hu1fu:f>
Al Hufuf	0.
	or	Al Hofuf
	syl	Al Hu+fuf
	pron	<@l> <hu1fu:f>
	def	a town in E Saudi Arabia: a trading centre with nearby oilfields and oases. Pop.: 100000 (1970 est.).
Ali	1.
	syl	A:li
	pron	<1a:li:>
	pos	n.
	def	??600-661 #7a.d., fourth caliph of Islam (656-61 #7a.d.) #7, considered the first caliph by the Shiites: cousin and son-in-law of Mohammed.
Mehemet	2.
	head	Ali
	syl	Mehemet.
	def	See {Mehemet Ali}.
alias	ety	C16: from Latin ali*_as (adv.) otherwise, at another time, from alius other
alias	1.
	syl	a:li+as
	pron	<1Ali*s>
	pos	adv.
	def	at another time or place known as or named.
	exam	1	Dylan, alias Zimmerman.
aliases	infl
	head	alias
	syl	a:li+as:es.
	pos	n.
	mod	pl.
alias	2.
	syl	a:li+as
	pron	<1Ali*s>
	pos	n.
	def	an assumed name.
alibi	ety	C18: from Latin alib*_i elsewhere, from alius other+ -b*_i as in ub*_i where
alibis	infl
	head	alibi
	syl	al:i+bis.
	pos	n.
	mod	pl.
alibi	1.a.
	syl	al:i+bi
	pron	<1@li2bI>
	pos	n.
	def	a defence by an accused person that he was elsewhere at the time the crime in question was committed.
alibi	1.b.
	syl	al:i+bi
	pron	<1@li2bI>
	pos	n.
	def	the evidence given to prove this.
alibi	2.
	syl	al:i+bi
	pron	<1@li2bI>
	pos	n.
	qual	Informal.
	def	an excuse.
alibi	3.
	syl	al:i+bi
	pron	<1@li2bI>
	pos	vb.
	mod	tr.
	def	to provide with an alibi.
alible	ety	C17: from Latin alibilis nutritious, from alere to nourish
alible	0.
	syl	al+i:ble
	pron	<1@l*bL>
	pos	adj.
	qual	Archaic.
	def	nourishing; nutritive.
Alicante	0.
	syl	Al:i+can+te
	pron	<2@li1k@nti>
	pos	n.
	def	a port in SE Spain: commercial centre. Pop.: 184716 (1970).
Alice-in-Wonderland	ety	C20: alluding to the absurdities of Wonderland in Lewis Carroll's book
Alice-in-Wonderland	0.
	syl	Al:ice-in-Won:der+land
	pos	adj.
	def	fantastic; irrational.
Alice Springs	0.
	syl	Al+ice Springs
	pos	n.
	def	a town in Australia, in the Northern Territory, in the Macdonnell Ranges: capital of the former territory of Central Australia. Pop.: 13400 (1975 est.). Former name (until 1931): {Stuart}.
alicyclic	ety	C19: from German alicyclisch, from #7ali (#7phatic) #7+cyclic 
alicyclic	0.
	syl	al:i+cy+clic
	pron	<2@li1sIklik>, <-1sik->
	pos	adj.
	usage	of an organic compound
	def	having essentially aliphatic properties, in spite of the presence of a ring of carbon atoms.
alidade	ety	C15: from French, from Medieval Latin allidada, from Arabic al-'id*_ada the revolving radius of a circle
alidad	alt
	head	alidade
	or	alidade
	syl	al:i+dad
	pron	<1@li2d@d>
	pos	n.
alidade	1.
	or	alidad
	syl	al:i+dade
	pron	<1@li2dAd>
	pos	n.
	def	a surveying instrument used in plane-tabling for drawing lines of sight on a distant object and taking angular measurements.
alidade	2.
	or	alidad
	syl	al:i+dade
	pron	<1@li2dAd>
	pos	n.
	def	the upper rotatable part of a theodolite, including the telescope and its attachments.
alien	ety	C14: from Latin ali*_enus foreign, from alius other
alien	1.
	syl	al+ien
	pron	<1Alj*n>, <1Ali*n>
	pos	n.
	def	a person owing allegiance to a country other than that in which he lives; foreigner.
alien	2.
	syl	al+ien
	pron	<1Alj*n>, <1Ali*n>
	pos	n.
	def	any being or thing foreign to the the environment in which it now exists.
	exam	1	an alien from another planet.
alien	3.
	syl	al+ien
	pron	<1Alj*n>, <1Ali*n>
	pos	n.
	def	unnaturalized; foreign.
alien	4.
	syl	al+ien
	pron	<1Alj*n>, <1Ali*n>
	pos	n.
	def	having foreign allegiance.
	exam	1	alien territory.
alien	5.
	syl	al+ien
	pron	<1Alj*n>, <1Ali*n>
	pos	n.
	def	unfamiliar; strange.
	exam	1	an alien quality in a work of art.
alien	6.
	syl	al+ien
	pron	<1Alj*n>, <1Ali*n>
	pos	n.
	usage	postpositive and foll. by to
	def	repugnant or opposed (to).
	exam	1	war is alien to his philosophy.
alien	7.
	syl	al+ien
	pron	<1Alj*n>, <1Ali*n>
	pos	vb.
	mod	tr.
	qual	Rare.
	def	to transfer (property, etc.) to another.
alienage	sub
	head	alien
	syl	al+ien+age
	pron	<1Alj*niJ>, <1Ali*->
	pos	n.
alienable	0.
	syl	al+ien+a:ble
	pron	<1Alj*n*bL>, <1Ali*->
	pos	adj.
	usage	Law. of property
	def	transferable to another owner.
alienability	sub
	head	alienable
	syl	al+ien+a:1bil+i:ty
	pos	n.
alienate	1.
	syl	al+ien+ate
	pron	<1Alj*2nAt>, <1Ali*->
	pos	vb.
	mod	tr.
	def	to cause (a friend, sympathizer, etc.) to become indifferent, unfriendly, or hostile; estrange.
alienate	2.
	syl	al+ien+ate
	pron	<1Alj*2nAt>, <1Ali*->
	pos	vb.
	mod	tr.
	def	to turn away; divert.
	exam	1	to alienate the affections of a person.
alienate	3.
	syl	al+ien+ate
	pron	<1Alj*2nAt>, <1Ali*->
	pos	vb.
	mod	tr.
	qual	Law.
	def	to transfer the ownership of (property, title, etc.) to another person.
alienator	sub
	head	alienate
	syl	al+ien:2a+tor
	pos	n.
alienation	1.
	syl	al+ien:a+tion
	pron	<2Alj*1nAS*n>, <2Ali*->
	pos	n.
	def	a turning away; estrange?!ment.
alienation	2.
	syl	al+ien:a+tion
	pron	<2Alj*1nAS*n>, <2Ali*->
	pos	n.
	def	the state of being an outsider or the feeling of being isolated, as from society.
alienation	3.
	syl	al+ien:a+tion
	pron	<2Alj*1nAS*n>, <2Ali*->
	pos	n.
	qual	Psychiatry.
	def	a state in which a person's feelings are inhibited so that eventually both the self and the external world seem unreal.
alienation	4.a.
	syl	al+ien:a+tion
	pron	<2Alj*1nAS*n>, <2Ali*->
	pos	n.
	def	the transfer of property, as by conveyance or will, into the ownership of another.
alienation	4.b.
	syl	al+ien:a+tion
	pron	<2Alj*1nAS*n>, <2Ali*->
	pos	n.
	def	the right of an owner to dispose of his property.
alienee	0.
	syl	al+ien:ee
	pron	<2Alj*1nE>, <2Ali*->
	pos	n.
	qual	Law.
	def	a person to whom a transfer of property is made.
alienism	0.
	syl	al+ien+ism
	pron	<1Alj*2niz*m>, <1Ali*->
	pos	n.
	qual	Obsolete.
	def	the study and treatment of mental illness.
alienist	1.
	syl	al+ien+ist
	pron	<1Alj*nist>, <1Ali*->
	pos	n.
	qual	U.S.
	def	a psychiatrist who specializes in the legal aspects of mental illness.
alienist	2.
	syl	al+ien+ist
	pron	<1Alj*nist>, <1Ali*->
	pos	n.
	qual	Obsolete.
	def	a person who practises alienism.
alienor	0.
	syl	al+ien+or
	pron	<1Alj*n*>, <1Ali*->
	pos	n.
	qual	Law.
	def	a person who transfers property to another.
aliform	ety	C19: from New Latin *_aliformis, from Latin *_ala a wing
aliform	0.
	syl	al:i+form
	pron	<1@li2fc:m>, <1Ali->
	pos	adj.
	def	wing-shaped; alar.
Aligarh	0.
	syl	A:li+garh
	pron	<2a:li1gR:>, <2@li->
	pos	n.
	def	a city in N India, in W Uttar Pradesh, with a famous Muslim university (1920). Pop.: 252314 (1971).
alight	ety	Old English *_al*_ihtan, from #7a -%2#7+ l*_ihtan to make less heavy, from l*_iht #7{light %2}
alight	0.
	syl	a:light
	def	%1@T ($$#!la$It)@T {a@.lights, @T a@.light+ing, @T a@.light+ed@T} {a@.lit}.
alight	1.
	syl	a:light
	usage	usually foll. by from
	def	to step out (of) or get down (from).
	exam	1	to alight from a taxi.
alight	2.
	syl	a:light
	def	to come to rest; settle; land.
	exam	1	a thrush alighted on the wall.
alight	ety	Old English *_al*_iht lit up, from *_al*_ihtan to light up; see #7{light %1}
alight	H2.1.
	syl	a:light
	pron	<*1lIt>
	pos	adj. postpositive; adv.
	def	burning; on fire.
alight	H2.2.
	syl	a:light
	pron	<*1lIt>
	pos	adj. postpositive; adv.
	def	illuminated; lit up.
alighting gear	0.
	syl	a:light+ing gear
	pos	n.
	def	another name for { {undercarriage} (sense 1)}.
align	ety	C17: from Old French aligner, from *`a ligne into line
align	1.
	syl	a:lign
	pron	<*1lIn>
	pos	vb.
	def	to place or become placed in a line.
align	2.
	syl	a:lign
	pron	<*1lIn>
	pos	vb.
	def	to bring (components or parts, such as the wheels of a car) into proper or desirable coordination or relation.
align	3.
	syl	a:lign
	pron	<*1lIn>
	pos	vb.
	mod	tr.
	usage	usually foll. by with
	def	to bring (a person, country, etc.) into agreement or cooperation with the policy, etc. of another person or group.
alignment	1.
	syl	a:lign+ment
	pron	<*1lInm*nt>
	pos	n.
	def	arrangement in a straight line.
alignment	2.
	syl	a:lign+ment
	pron	<*1lInm*nt>
	pos	n.
	def	the line or lines formed in this manner.
alignment	3.
	syl	a:lign+ment
	pron	<*1lInm*nt>
	pos	n.
	def	alliance or union with a party, cause, etc.
alignment	4.
	syl	a:lign+ment
	pron	<*1lInm*nt>
	pos	n.
	def	proper or desirable coordination or relation of components.
alignment	5.
	syl	a:lign+ment
	pron	<*1lInm*nt>
	pos	n.
	def	a ground plan of a railway, motor road, etc.
alignment	6.
	syl	a:lign+ment
	pron	<*1lInm*nt>
	pos	n.
	qual	Archaeol.
	def	an arrangement of one or more ancient rows of standing stones, of uncertain significance.
alike	ety	Old English gel*_ic; see #7{like %1}
alike	1.
	syl	a:like
	pron	<*1lIk>
	pos	adj.
	usage	postpositive
	def	possessing the same or similar characteristics.
	exam	1	they all look alike to me.
alike	2.
	syl	a:like
	pron	<*1lIk>
	pos	adv.
	usage	postpositive
	def	in the same or a similar manner, way, or degree.
	exam	1	they walk alike.
aliment	ety	C15: from Latin alimentum food, from alere to nourish
aliment	1.
	syl	al:i+ment
	pron	<1@lim*nt>
	pos	n.
	def	something that nourishes, supports, or sustains the body or mind.
aliment	2.
	syl	al:i+ment
	pron	<1@lim*nt>
	pos	n.
	qual	Scot. law.
	def	another term for {alimony}.
aliment	3.
	syl	al:i+ment
	pron	<1@li2ment>
	pos	vb.
	mod	tr.
	qual	Obsolete.
	def	to support or sustain.
alimental	sub
	head	aliment
	syl	al:i+1men+tal
	pos	adj.
alimentary	1.
	syl	al:i+men+ta+ry
	pron	<2@li1ment*ri>, <-tri>
	pos	adj.
	def	of or relating to nutrition.
alimentary	2.
	syl	al:i+men+ta+ry
	pron	<2@li1ment*ri>, <-tri>
	pos	adj.
	def	providing sustenance or nourishment.
alimentary	3.
	syl	al:i+men+ta+ry
	pron	<2@li1ment*ri>, <-tri>
	pos	adj.
	qual	Scot. law.
	def	free from the claims of creditors.
	exam	1	an alimentary trust.
alimentary canal	0.
	syl	al:i+men+ta+ry ca+nal
	pos	n.
	def	the tubular passage extending from the mouth to the anus, through which food is passed and digested.
alimentation	1.
	syl	al:i+men+ta+tion
	pron	<2@limen1tAS*n>
	pos	n.
	def	nourishment.
alimentation	2.
	syl	al:i+men+ta+tion
	pron	<2@limen1tAS*n>
	pos	n.
	def	sustenance; support.
alimentative	sub
	head	alimentation
	syl	al:i+1men+ta+tive
	pos	adj.
alimony	ety	C17: from Latin alim*_onia sustenance, from alere to nourish
alimony	0.
	syl	al:i+mo+ny
	pron	<1@lim*ni>
	pos	n.
	qual	Law.
	def	an allowance paid under a court order by one spouse to another when they are separated, either before or after divorce. See also {maintenance}.
aline	0.
	syl	a:line
	pron	<*1lIn>
	pos	vb.
	def	a rare spelling of {align}.
alinement	sub
	head	aline
	syl	a:1line+ment
	pos	n.
aliner	sub
	head	aline
	syl	a:1lin+er
	pos	n.
Ali Pasha	0.
	syl	A:li Pa:sha
	pron	<1a:lE> <1pa:S*>
	pos	n.
	def	called 1741-1822, Turkish pasha and ruler of Albania (1787-1820), who was deposed and assassinated after intriguing against Turkey.
aliped	ety	C19: from Latin *_alip*_es having winged feet, from *_ala wing+-#7ped 
aliped	1.
	syl	al:i+ped
	pron	<1@li2ped>
	pos	adj.
	usage	of bats and similar animals
	def	having the digits connected by a winglike membrane.
aliped	2.
	syl	al:i+ped
	pron	<1@li2ped>
	pos	n.
	def	an aliped animal.
aliphatic	ety	C19: from Greek aleiphat-, aleiphar oil
aliphatic	0.
	syl	al:i+phat+ic
	pron	<2@li1f@tik>
	pos	adj.
	usage	of an organic compound
	def	not aromatic, esp. having an open chain structure, such as alkanes, alkenes, and alkynes.
aliquant	ety	C17: from New Latin, from Latin aliquantus somewhat, a certain quantity of
aliquant	0.
	syl	al:i+quant
	pron	<1@likw*nt>
	pos	adj.
	qual	Maths.
	def	of, signifying, or relating to a quantity or number that is not an exact divisor of a given quantity or number.
	exam	1	5 is an aliquant part of 12.
aliquot	ety	C16: from Latin: several, a few
aliquot	1.
	syl	al:i+quot
	pron	<1@li2kwot>
	pos	adj.
	qual	Maths.
	def	of, signifying, or relating to an exact divisor of a quantity or number.
	exam	1	3 is an aliquot part of 12.
aliquot	2.
	syl	al:i+quot
	pron	<1@li2kwot>
	pos	adj.
	def	consisting of equal quantities.
	exam	1	the sample was divided into five aliquot parts.
aliquot	3.
	syl	al:i+quot
	pron	<1@li2kwot>
	pos	n.
	def	an aliquot part.
alit	0.
	syl	a:lit
	pron	<*1lit>
	pos	vb.
	def	a rare past tense and past participle of {alight%1}.
aliunde	ety	Latin: from elsewhere
aliunde	0.
	syl	a:li:un+de
	pron	<2Ali1^ndi>
	pos	adv. adj.
	def	from a source extrinsic to the matter, document, or instrument under consideration.
	exam	1	evidence aliunde.
alive	ety	Old English on l*_ife in #7life 
alive	1.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive; of people, animals, plants, etc.
	def	living; having life.
alive	2.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive
	def	in existence; active.
	exam	1	they kept hope alive;
	exam	2	the tradition was still alive.
alive	3.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive; immediately postpositive and usually used with a superlative
	def	of those living; now living.
	exam	1	the happiest woman alive.
alive	4.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive
	def	full of life; lively.
	exam	1	she was wonderfully alive for her age.
alive	5.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive; usually foll. by with
	def	animated.
	exam	1	a face alive with emotion.
alive	6.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive; foll. by to
	def	aware (of); sensitive (to).
alive	7.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive; foll. by with
	def	teeming (with).
	exam	1	the mattress was alive with fleas.
alive	8.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	qual	Electronics.
	usage	postpositive
	def	another word for {{live%2} (sense 10).}
alive and kicking	9.
	head	alive
	syl	alive and kicking.
	usage	postpositive; of a person
	def	active and lively.
alive	10.a.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive
	def	hurry up&!
alive	10.b.
	syl	a:live
	pron	<*1lIv>
	pos	adj.
	usage	postpositive
	def	pay attention&!
aliveness	sub
	head	alive
	syl	a:1live+ness
	pos	n.
alizarin	ety	C19: probably from French alizarine, probably from Arabic al-`as*_arah the juice, from `asara to squeeze
alizarin	0.
	syl	a:liz:a+rin
	pron	<*1liz*rin>
	pos	n.
	def	a brownish-yellow powder or orange-red crystalline solid used as a dye and in the manufacture of other dyes. Formula: C\6H\4(CO)\2C\6H\2(OH)\2.
alk	0.
	syl	alk.
	qual	abbrev. for
	def	alkali.
alkahest	ety	C17: apparently coined by Paracelsus on the model of Arabic words
alcahest	alt
	head	alkahest
	or	alkahest
	syl	al+ca+hest
	pron	<1@lk*2hest>
	pos	n.
alkahest	0.
	or	alcahest
	syl	al+ka+hest
	pron	<1@lk*2hest>
	pos	n.
	def	the hypothetical universal solvent sought by alchemists.
alkali	ety	C14: from Medieval Latin, from Arabic al-qili the ashes (of the plant saltwort)
alkalis	infl
	head	alkali
	or	alkalies
	syl	al+ka+lis
	pos	n.
	mod	pl.
alkalies	infl
	head	alkali
	or	alkalis
	syl	al+ka+lies.
	pos	n.
	mod	pl.
alkali	1.
	syl	al+ka+li
	pron	<1@lk*2lI>
	pos	n.
	qual	Chemistry.
	def	a soluble base or a solution of a base.
alkali	2.
	syl	al+ka+li
	pron	<1@lk*2lI>
	pos	n.
	def	a soluble mineral salt that occurs in arid soils and some natural waters.
alkalic	1.
	syl	al+kal+ic
	pron	<@l1k@lik>
	pos	adj.
	usage	of igneous rocks
	def	containing large amounts of alkalis, esp. caustic soda and caustic potash.
alkalic	2.
	syl	al+kal+ic
	pron	<@l1k@lik>
	pos	adj.
	def	another word for {alkaline}.
alkali flat	0.
	syl	al+ka+li flat
	pos	n.
	def	an arid plain encrusted with alkaline salts derived from the streams draining into it.
alkalifies	infl
	head	alkalify
	syl	al+ka+li+fies
	pos	vb.
alkalifying	infl
	head	alkalify
	syl	al+ka+li+fy+ing
	pos	vb.
alkalified	infl
	head	alkalify
	syl	al+ka+li+fied.
	pos	vb.
alkalify	0.
	syl	al+ka+li+fy
	pron	<1@lk*li2fI>, <@l1k@l->
	pos	vb.
	def	to make or become alkaline.
alkali metal	0.
	syl	al+ka+li met+al
	pos	n.
	def	any of the monovalent metals lithium, sodium, potassium, rubidium, caesium, and francium, belong?!ing to group 1A of the periodic table. They are all very reactive and electropositive.
alkalimeter	1.
	syl	al+ka+lim+e:ter
	pron	<2@lk*1limit*>
	pos	n.
	def	an apparatus for determining the concentration of alkalis in solution.
alkalimeter	2.
	syl	al+ka+lim+e:ter
	pron	<2@lk*1limit*>
	pos	n.
	def	an apparatus for determining the quantity of carbon dioxide in carbonates.
alkalimetric	sub
	head	alkalimeter
	syl	al+ka+li+met+ric
	pron	<2@lk*li1metrik>
	pos	adj.
alkalimetry	0.
	syl	al+ka+lim+e:try
	pron	<2@lk*1limitri>
	pos	n.
	def	determination of the amount of alkali or base in a solution, measured by an alkalimeter or by volumetric analysis.
alkaline	0.
	syl	al+ka+line
	pron	<1@lk*2lIn>
	pos	adj.
	def	having the properties of or containing an alkali.
alkaline earth	1.
	syl	al+ka+line earth
	pos	n.
	def	Also called: {alkaline earth metal}. any of the divalent electropositive metals beryllium, magnesium, calcium, strontium, barium, and radium, belonging to group 2A of the periodic table.
alkaline earth	2.
	syl	al+ka+line earth
	pos	n.
	def	an oxide of one of the alkaline earth metals.
alkalinity	1.
	syl	al+ka+lin+i:ty
	pron	<2@lk*1liniti>
	pos	n.
	def	the quality or state of being alkaline.
alkalinity	2.
	syl	al+ka+lin+i:ty
	pron	<2@lk*1liniti>
	pos	n.
	def	the amount of alkali or base in a solution, often expressed in terms of pH.
alkali soil	0.
	syl	al+ka+li soil
	pos	n.
	def	a soil that gives a pH reaction of 8.5 or above, found esp. in dry areas where the soluble salts, esp. of sodium, have not been leached away but have accumulated in the B horizon of the soil profile.
alkalise	alt
	head	alkalize
	or	alkalize
	syl	al+ka+lise
	pron	<1@lk*2lIz>
	pos	vb.
	mod	tr.
alkalize	0.
	or	alkalise
	syl	al+ka+lize
	pron	<1@lk*2lIz>
	pos	vb.
	mod	tr.
	def	to make alkaline.
alkalizable	sub
	head	alkalize
	or	alkalisable
	syl	al+ka+2liz+a:ble
	pos	adj.
alkalisable	sub
	head	alkalize
	or	alkalizable
	syl	al+ka+2lis+a:ble
	pos	adj.
alkaloid	0.
	syl	al+ka+loid
	pron	<1@lk*2lcid>
	pos	n.
	def	any of a group of nitrogenous basic compounds found in plants, typically insoluble in water and physiologically active. Common examples are morphine, strych?!nine, and quinine.
alkalosis	0.
	syl	al+ka+lo+sis
	pron	<2@lk*1l*usis>
	pos	n.
	def	an abnormal increase in alkalinity of the blood and extracellular fluids.
alkane	0.a.
	syl	al+kane
	pron	<1@lkAn>
	pos	n.
	def	any saturated aliphatic hydrocarbon with the general formula C H\2 \+\2.
alkane	0.b.
	syl	al+kane
	pron	<1@lkAn>
	pos	n.
	usage	as modifier; alkane series.
	def	Also called: {paraffin}.
alkanet	ety	C14: from Spanish alcaneta, diminutive of alcana henna, from Medieval Latin alchanna, from Arabic al the+ hinn*_a' henna
alkanet	1.
	syl	al+ka+net
	pron	<1@lk*2net>
	pos	n.
	def	a European boraginaceous plant, the roots of which yield a red dye.
alkanet	2.
	syl	al+ka+net
	pron	<1@lk*2net>
	pos	n.
	def	the dye obtained from this plant. Also called: {anchusin, alkannin}.
alkanet	3.
	syl	al+ka+net
	pron	<1@lk*2net>
	pos	n.
	def	any of certain hairy blue-flowered Old World plants of the boraginaceous genus (or such as of Europe. See also { {bugloss}}.
alkanet	4.
	syl	al+ka+net
	pron	<1@lk*2net>
	pos	n.
	def	another name for {{puccoon} (sense 1).}
alkene	0.a.
	syl	al+kene
	pron	<1@lkEn>
	pos	n.
	def	any unsaturated aliphatic hydrocarbon with the general formula C H\2
alkene	0.b.
	syl	al+kene
	pron	<1@lkEn>
	pos	n.
	usage	as modifier; alkene series.
	def	Also called: {olefine}.
Alkmaar	0.
	syl	Alk+maar
	pron	Dutch <1alkma:r>
	pos	n.
	def	a city in the W Netherlands, in North Holland. Pop.: 60375 (1973 est.).
Alcoran	alt
	head	Alkoran
	or	Alkoran
	syl	Al+co+ran
	pron	<2@lko1ra:n>
	pos	n.
Alkoran	0.
	or	Alcoran
	syl	Al+ko+ran
	pron	<2@lko1ra:n>
	pos	n.
	def	a less common name for the {Koran}.
alkie	alt
	head	alky
	or	alky
	syl	al+kie
	pron	<1@lki>
	pos	n.
alkies	infl
	head	alky
	syl	al:kies.
	pos	n.
	mod	pl.
alky	0.
	or	alkie
	syl	al:ky
	pron	<1@lki>
	pos	n.
	qual	Slang, chiefly U.S. and Austral.
	def	a heavy drinker or alcoholic.
alkyd resin	0.
	syl	al+kyd res+in
	pron	<1@lkid>
	pos	n.
	def	any synthetic resin made from a dicarboxylic acid, such as phthalic acid, and diols or triols: used in paints and adhesives.
alkyl	ety	C19: from German, from Alk (ohol) #7alcohol+ -#7yl 
alkyl	1.
	syl	al+kyl
	pron	<1@lkil>
	pos	n.
	usage	modifier
	def	of, consisting of, or containing the monovalent group C H\2 \+\1.
	exam	1	alkyl group or radical.
alkyl	2.
	syl	al+kyl
	pron	<1@lkil>
	pos	n.
	def	an organometallic compound, such as tetraethyl lead, containing an alkyl group bound to a metal atom.
alkylation	1.
	syl	al+kyl:a+tion
	pron	<2@lki1lAS*n>
	pos	n.
	def	the replacement of a hydrogen atom in an organic compound by an alkyl group.
alkylation	2.
	syl	al+kyl:a+tion
	pron	<2@lki1lAS*n>
	pos	n.
	def	the addition of an alkane hydrocarbon to an alkene in producing high-octane fuels.
alkyne	0.a.
	syl	al+kyne
	pron	<1@lkIn>
	pos	n.
	def	any unsaturated aliphatic hydrocarbon that has a formula of the type C H\2 \-\2.
alkyne	0.b.
	syl	al+kyne
	pron	<1@lkIn>
	pos	n.
	usage	as modifier; alkyne series.
	def	Also called: {acetylene}.
all	ety	Old English eall; related to Old High German al, Old Norse allr, Gothic alls all
all	1.a.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	the whole quantity or amount of; totality of.
	exam	1	all the rice;
	exam	2	all interested parties.
all	1.b.
	syl	all
	pron	<c:l>
	pos	determiner.
	mod	as pronoun; functioning as; sing. pl.
	exam	1	is that all there are??
	exam	2	all of it is nice;
	exam	3	all are welcome.
all	2.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	every one of a class.
	exam	1	all men are mortal.
all	3.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	the greatest possible.
	exam	1	in all earnestness.
all	4.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	any whatever.
	exam	1	to lose all hope of recovery;
	exam	2	beyond all doubt.
above all	5.
	head	all
	syl	above all.
	def	most important.
after all	6.
	head	all
	syl	after all.
	def	in spite of everything.
	exam	1	it's only a game, after all.
all but	7.
	head	all
	syl	all but.
	def	almost; nearly.
	exam	1	all but dead.
all of	8.
	head	all
	syl	all of.
	def	no less or smaller than.
	exam	1	she's all of thirteen years.
all	9.a.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	finished; at an end.
	exam	1	the affair is all over between us.
all	9.b.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	over the whole area (of something); everywhere (in, on, etc.).
	exam	1	all over England.
all	9.c.
	syl	all
	pron	<c:l>
	pos	determiner.
	qual	Informal.
	def	typically; representatively (in the phrase {that's me (you, him, us, them}, {all over) }.
all	9.d.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	unduly effusive towards.
all	9.e.
	syl	all
	pron	<c:l>
	pos	determiner.
	qual	Sports.
	def	in a dominant position over.
all in	10.
	head	all
	syl	all in.
	def	exhausted; tired out.
all	11.a.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	everything considered.
	exam	1	all in all, it was a great success.
all	11.b.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	the object of one's attention or interest.
	exam	1	you are my all in all.
all the	13.
	head	all
	syl	all the.
	usage	foll. by a comparative adjective or adverb
	def	so much (more or less) than otherwise.
	exam	1	we must work all the faster now.
and all	14.
	head	all
	syl	and all.
	qual	Brit. informal.
	def	as well; too.
	exam	1	and you can take that smile off your face and all.
all	15.a.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	and similar or associated things; etcetera.
	exam	1	coffee, tea, and all that will be served in the garden.
all	15.b.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	used as a filler or to make what precedes more vague: in this sense, it often occurs with concessive force.
	exam	1	she was sweet and pretty and all that, but I still didn't like her.
as all that	16.
	head	all
	syl	as all that.
	def	as one might expect or hope.
	exam	1	she's not as pretty as all that, but she has a personality.
all	17.a.
	syl	all
	pron	<c:l>
	pos	determiner.
	usage	in a question
	def	in any way whatsoever or to any extent or degree.
	exam	1	I didn't know that at all.
all	17.b.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	even so; anyway.
	exam	1	I'm surprised you came at all.
be all for	18.
	head	all
	syl	be all for.
	qual	Informal.
	def	be strongly in favour of.
all	19.a.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	in so far as; to the extent that.
	exam	1	for all anyone knows, he was a baron.
all	19.b.
	syl	all
	pron	<c:l>
	pos	determiner.
	def	notwithstanding.
	exam	1	for all my pushing, I still couldn't move it.
for all that	20.
	head	all
	syl	for all that.
	def	in spite of that.
	exam	1	he was a nice man for all that.
in all	21.
	head	all
	syl	in all.
	def	altogether.
	exam	1	there were five of them in all.
all	22.
	syl	all
	pron	<c:l>
	pos	adv.
	usage	in scores of games
	def	apiece; each.
	exam	1	the score at half time was three all.
all	23.
	syl	all
	pron	<c:l>
	pos	n.
	usage	preceded by my, your, his, etc.; one's
	def	complete effort or interest.
	exam	1	to give your all;
	exam	2	you are my all.
all	24.
	syl	all
	pron	<c:l>
	pos	n.
	def	totality or whole.
all-	0.
	syl	all-
	usage	combining form.
	def	variant of {allo-} before a vowel.
alla breve	ety	C19: literally: (according) to the breve
alla breve	1.
	syl	al:la bre+ve
	pron	<1@l*> <1brAvi>, Italian <1alla> <1brA:vA>
	pos	n.
	def	a musical time signature indicating two or four minims to a bar. {~}
alla breve	2.
	syl	al:la bre+ve
	pron	<1@l*> <1brAvi>, Italian <1alla> <1brA:vA>
	pos	n.
	def	twice as fast as normal. Musical symbol: ###800026
Allah	ety	C16: from Arabic, from al the+ Il*_ah god; compare Hebrew el*_oah 
Allah	0.
	syl	Al:lah
	pron	<1@l*>
	pos	n.
	qual	Islam.
	def	the principal Muslim name for God; the one Supreme Being.
Allahabad	0.
	syl	Al+lah:a+bad
	pron	<2@l*h*1b@d>, <-1ba:d>
	pos	n.
	def	a city in N India, in SE Uttar Pradesh at the confluence of the Ganges and Jumna Rivers: Hindu pilgrimage centre. Pop.: 490622 (1971).
all-American	1.
	syl	all-A:mer:i+can
	pos	adj.
	qual	U.S.
	def	representative of the whole of the United States.
all-American	2.
	syl	all-A:mer:i+can
	pos	adj.
	qual	U.S.
	def	composed exclusively of American members.
all-American	3.
	syl	all-A:mer:i+can
	pos	adj.
	qual	U.S.
	usage	of a person
	def	typically American.
Allan-a-Dale	0.
	syl	Al:lan-a-Dale
	pron	<2@l*n*1dAl>
	pos	n.
	usage	in English balladry
	def	a member of Robin Hood's band who saved his sweetheart from an enforced marriage and married her himself.
allanite	ety	C19: named after T. Allan (1777-1833), English mineralogist
allanite	0.
	syl	al+lan+ite
	pron	<1@l*2nIt>
	pos	n.
	def	a rare black or brown mineral consisting of the hydrated silicate of calcium, aluminium, iron, cerium, lanthanum, and other rare earth minerals. It occurs in granites and other igneous rocks. Formula: (Ca,Ce,La,Na)\2(Al,Fe,Be,Mn,Mg)\3(SiO\4)\3(OH).
allantoid	ety	C17: from Greek allantoeid*_es sausage-shaped, from allas sausage+-#7oid 
allantoid	1.
	syl	al+lan+toid
	pron	<*1l@ntcid>
	pos	adj.
	def	relating to or resembling the allantois.
allantoid	2.
	syl	al+lan+toid
	pron	<*1l@ntcid>
	pos	adj.
	qual	Botany.
	def	shaped like a sausage.
allantoid	3.
	syl	al+lan+toid
	pron	<*1l@ntcid>
	pos	n.
	def	another name for {allantois}.
allantoidal	sub
	head	allantoid
	syl	al+lan+toi+dal
	pron	<2@l*n?!1tcidL>
	pos	adj.
allantois	ety	C17: New Latin, irregularly from Greek allantoeid*_es sausage-shaped, #7allantoid 
allantois	0.
	syl	al+lan+to+is
	pron	<2@l*n1t*uis>, <*1l@ntcis>
	pos	n.
	def	a membranous sac growing out of the ventral surface of the hind gut of embryonic reptiles, birds, and mammals. It combines with the chorion to form the mammalian placenta.
allantoic	sub
	head	allantois
	syl	al+lan+to+ic
	pron	<2@l*n1t*uik>
	pos	adj.
alla prima	ety	C19: from Italian: at once
alla prima	0.
	syl	al:la pri+ma
	pron	<1a:la:> <1prEm*>
	pos	adj.
	usage	of a painting
	def	painted with a single layer of paint, in contrast to paintings built up layer by layer.
allargando	ety	Italian, from allargare to make slow or broad
	infl
	head	allargando
	syl	~
	pos	adj. adv.
	qual	Music.
allargando	0.
	syl	al+lar+gan+do
	pron	<2a:la:1g@nd*u>
	pos	adj. adv.
	def	to be slowed down considerably.
all-around	0.
	syl	all-a:round
	pos	adj.
	usage	prenominal
	def	the U.S. equivalent of {all-round}.
allay	ety	Old English *_alecgan to put down, from lecgan to #7{lay %1}
allay	1.
	syl	al+lay
	pron	<*1lAi>
	pos	vb.
	def	to relieve (pain, grief, etc.) or be relieved.
allay	2.
	syl	al+lay
	pron	<*1lAi>
	pos	vb.
	mod	tr.
	def	to reduce (fear, anger, etc.).
All Black	ety	so named because of the players' black strip
All Black	0.
	syl	All Black
	pos	n.
	def	a member of the international Rugby Union football team of New Zealand.
all clear	1.
	syl	all clear
	pos	n.
	def	a signal, usually a siren, indicating that some danger, such as an air raid, is over.
all clear	2.
	syl	all clear
	pos	n.
	def	an indication that obstacles are no longer present; permission to proceed.
	exam	1	he received the all clear on the plan.
allegation	1.
	syl	al+le+ga+tion
	pron	<2@li1gAS*n>
	pos	n.
	def	the act of alleging.
allegation	2.
	syl	al+le+ga+tion
	pron	<2@li1gAS*n>
	pos	n.
	def	an unproved statement or assertion, esp. one in an accusation.
allege	ety	C14 aleggen, ultimately from Latin all*_eg*_are to despatch on a mission, from l*_ex law
allege	1.
	syl	al+lege
	pron	<*1leJ>
	pos	vb.
	mod	tr.
	usage	may take a clause as object
	def	to declare in or as if in a court of law; state without or before proof.
	exam	1	he alleged malpractice.
allege	2.
	syl	al+lege
	pron	<*1leJ>
	pos	vb.
	mod	tr.
	usage	may take a clause as object
	def	to put forward (an argument or plea) for or against an accusation, claim, etc.
allege	3.
	syl	al+lege
	pron	<*1leJ>
	pos	vb.
	mod	tr.
	qual	Archaic.
	usage	may take a clause as object
	def	to cite or quote, as to confirm.
alleged	1.
	syl	al+leged
	pron	<*1leJd>
	pos	adj.
	usage	prenominal
	def	stated or described to be such; presumed.
	exam	1	the alleged murderer.
alleged	2.
	syl	al+leged
	pron	<*1leJd>
	pos	adj.
	usage	prenominal
	def	dubious.
	exam	1	an alleged miracle.
allegedly	sub
	head	alleged
	syl	al+leg+ed+ly
	pron	<*1leJidli>
	pos	adv.
Alleghenies	alt
	head	Allegheny Mountains
	or	Allegheny Mountains
	syl	Al+le+ghe+nies
	pos	n.
	mod	pl.
Allegheny Mountains	0.
	or	Alleghenies
	syl	Al+le+ghe+ny Moun+tains
	pron	<2@li1gAni>
	pos	n.
	mod	pl.
	def	a mountain range in Pennsylvania, Maryland, Virginia, and West Virginia: part of the Appalachian system; rising from 600 m (2000 ft.) to over 1440 m (4800 ft.).
allegiance	ety	C14: from Old French ligeance, from lige #7liege 
allegiance	1.
	syl	al+le+giance
	pron	<*1lEJ*ns>
	pos	n.
	def	loyalty, as of a subject to his sovereign or of a citizen to his country.
allegiance	2.
	syl	al+le+giance
	pron	<*1lEJ*ns>
	pos	n.
	usage	in feudal society
	def	the obligations of a vassal to his liege lord. See also {fealty, {homage} (sense 2).}
allegoric	alt
	head	allegorical
	or	allegorical
	syl	al+le+gor+ic
	pos	adj.
allegorical	0.
	or	allegoric
	syl	al+le+gor:i+cal
	pron	<2@li1gorikL>
	pos	adj.
	def	used in, containing, or characteristic of allegory.
allegorically	sub
	head	allegorical
	syl	al+le+1gor:i+cal+ly
	pos	adv.
allegorise	alt
	head	allegorize
	or	allegorize
	syl	al+le+go+rise
	pron	<1@lig*2rIz>
	pos	vb.
allegorize	1.
	or	allegorise
	syl	al+le+go+rize
	pron	<1@lig*2rIz>
	pos	vb.
	def	to transform (a story, narrative, fable, etc.) into or compose in the form of allegory.
allegorize	2.
	or	allegorise
	syl	al+le+go+rize
	pron	<1@lig*2rIz>
	pos	vb.
	mod	tr.
	def	to interpret allegorically.
allegorization	sub
	head	allegorize
	or	allegorisation
	syl	al+le+2gor:i+1za+tion
	pos	n.
allegorisation	sub
	head	allegorize
	or	allegorization
	syl	al+le+2gor:i+1sa+tion
	pos	n.
allegory	ety	C14: from Old French allegorie, from Latin all*_egoria, from Greek, from all*_egorein to speak figuratively, from allos other+ agoreuein to make a speech in public, from agora a public gathering
allegories	infl
	head	allegory
	syl	al+le+go+ries.
	pos	n.
	mod	pl.
allegory	1.
	syl	al+le+go+ry
	pron	<1@lig*ri>
	pos	n.
	def	a poem, play, picture, etc., in which the apparent meaning of the characters and events is used to symbolize a deeper moral or spiritual meaning.
allegory	2.
	syl	al+le+go+ry
	pron	<1@lig*ri>
	pos	n.
	def	the technique or genre that this represents.
allegory	3.
	syl	al+le+go+ry
	pron	<1@lig*ri>
	pos	n.
	def	use of such symbolism to illustrate truth or a moral.
allegory	4.
	syl	al+le+go+ry
	pron	<1@lig*ri>
	pos	n.
	def	anything used as a symbol or emblem.
allegorist	sub
	head	allegory
	syl	al+le+go+rist
	pos	n.
allegretto	ety	C19: diminutive of #7allegro 
	infl
	head	allegretto
	syl	~
	pos	adj. adv.
	qual	Music.
allegretto	1.
	syl	al+le+gret+to
	pron	<2@li1gret*u>
	pos	adj. adv.
	def	quickly or briskly. {~} {+tos}.
allegretto	2.
	syl	al+le+gret+to
	pron	<2@li1gret*u>
	pos	adj. adv.
	def	a piece or passage to be performed in this manner.
allegro	ety	C17: from Italian: cheerful, from Latin alacer brisk, lively
	infl
	head	allegro
	syl	~
	pos	adj. adv.
	qual	Music.
allegro	1.
	syl	al+le+gro
	pron	<*1lAgr*u>, <-1leg->
	pos	adj. adv.
	def	quickly; in a brisk lively manner.
allegros	infl
	head	allegro
	syl	al+le+gros.
	pos	n.
	mod	pl.
allegro	2.
	syl	al+le+gro
	pron	<*1lAgr*u>, <-1leg->
	pos	n.
	def	a piece or passage to be performed in this manner.
allele	ety	C20: from German Allel, shortened from allelomorph, from Greek all*_el- one another+ morph*_e form
allele	0.
	syl	al+lele
	pron	<*1lEl>
	pos	n.
	def	any of two or more genes that have the same relative position on homologous chromosomes and are responsible for alternative characteristics, such as smooth or wrin?!kled seeds in peas. Also called: {al+le+lo+morph} ($$#!li$:l$$?!@!m@$$:f). See also {multiple alleles}.
allelic	sub
	head	allele
	syl	al+1lel+ic
	pos	adj.
allelism	sub
	head	allele
	syl	al+1lel+ism
	pos	n.
alleluia	ety	C14: via Medieval Latin from Hebrew hallel*_uy*_ah 
alleluia	1.
	syl	al+le+lu:ia
	pron	<2@li1lu:j*>
	pos	interj.
	def	praise the Lord&! Used more commonly in liturgical contexts in place of
alleluia	2.
	syl	al+le+lu:ia
	pron	<2@li1lu:j*>
	pos	n.
	def	a song of praise to God.
allemande	ety	C17: from French danse allemande German dance
allemande	1.
	syl	al+le+mande
	pron	<1@lim@nd>, French <al1m?~a:d>
	pos	n.
	def	the first movement of the classical suite, composed in a moderate tempo in a time signature of four-four.
allemande	2.
	syl	al+le+mande
	pron	<1@lim@nd>, French <al1m?~a:d>
	pos	n.
	def	any of several German dances.
allemande	3.
	syl	al+le+mande
	pron	<1@lim@nd>, French <al1m?~a:d>
	pos	n.
	def	a figure in a quadrille or a square dance.
Bog of	1.
	head	Allen
	syl	Bog of.
	def	a region of peat bogs in central Ireland, west of Dublin. Area: over 10 sq. km (3.75 sq. miles).
Lough	2.
	head	Allen
	syl	Lough.
	def	a lake in Ireland, in county Leitrim.
Ethan	1.
	head	Allen
	syl	E:than.
	def	1738-89, American soldier during the War of Independence who led the Green Mountain Boys of Vermont.
Woody	2.
	head	Allen
	syl	Wood:y.
	def	original name born 1935, U.S. film comedian, screenwriter, and director: his films include (1971), (1973), (1973), and (1977), which he also directed.
Edmund Henry Hynman	infl
	head	Allenby
	syl	Ed:mund Hen:ry Hyn:man
	pos	n.
Allenby	0.
	syl	Al:len:by
	pron	<1@l*nbi>
	pos	n.
	def	1st Viscount Allenby. 1861-1936, British field marshal who commanded British forces in Palestine in World War I; high commissioner in Egypt (1919-25).
Salvador	infl
	head	Allende
	syl	Sal:va:dor
	pron	<2sal$Ba1@dor>
	pos	n.
Allende	0.
	syl	Al:len:de
	pron	Spanish <a1$yAndA>
	pos	n.
	def	1908-73, Chilean Marxist politician; president of Chile from 1970 until 1973, when the army seized power and he was killed.
Allentown	0.
	syl	Al+len+town
	pron	<1@l*n2taun>
	pos	n.
	def	a city in E Pennsylvania, on the Lehigh River. Pop.: 108655 (1973 est.).
Alleppey	0.
	syl	Al+lep+pey
	pron	<1^l*pi>
	pos	n.
	def	a port in S India, in Kerala on the Malabar Coast. Pop.: 160166 (1971).
allergen	0.
	syl	al+ler+gen
	pron	<1@l*2Jen>
	pos	n.
	def	any substance, usually a protein, capable of inducing an allergy.
allergenic	sub
	head	allergen
	syl	al+ler+1gen+ic
	pos	adj.
allergic	1.
	syl	al+ler+gic
	pron	<*1lR:Jik>
	pos	adj.
	def	of, relating to, having, or caused by an allergy.
allergic	2.
	syl	al+ler+gic
	pron	<*1lR:Jik>
	pos	adj.
	qual	Informal.
	usage	postpositive; foll. by to
	def	having an aversion (to).
	exam	1	he's allergic to work.
allergist	0.
	syl	al+ler+gist
	pron	<1@l*Jist>
	pos	n.
	def	a physician skilled in the diagnosis and treatment of diseases or conditions caused by allergy.
allergy	ety	C20: from German Allergie (indicating a changed reaction), from Greek allos other+ ergon activity
allergies	infl
	head	allergy
	syl	al+ler+gies.
	pos	n.
	mod	pl.
allergy	1.
	syl	al+ler+gy
	pron	<1@l*Ji>
	pos	n.
	def	a hypersensitivity to a substance that causes the body to react to any contact with that substance. Hay fever is an allergic reaction to pollen.
allergy	2.
	syl	al+ler+gy
	pron	<1@l*Ji>
	pos	n.
	qual	Informal.
	def	aversion.
	exam	1	he has an allergy to studying.
allethrin	ety	C20: from #7all (#7yl) #7+ (#7pyr) #7ethrin 
allethrin	0.
	syl	al+le+thrin
	pron	<@1leTrin>
	pos	n.
	def	a clear viscous amber-coloured liquid used as an insecticide and synergist. Formula: C\1\9H\2\6O\3; relative density: 1.005.
alleviate	ety	C15: from Late Latin allevi*_are to mitigate, from Latin levis light
alleviate	0.
	syl	al+le+vi+ate
	pron	<*1lEvi2At>
	pos	vb.
	mod	tr.
	def	to make (pain, sorrow, etc.) easier to bear; lessen; relieve.
alleviation	sub
	head	alleviate
	syl	al+2le+vi:1a+tion
	pos	n.
alleviative	sub
	head	alleviate
	syl	al+1le+vi:a+tive
	pos	adj.
alleviator	sub
	head	alleviate
	syl	al+1le+vi:2a+tor
	pos	n.
alley	ety	C14: from Old French alee, from aler to go, ultimately from Latin ambul*_are to walk
alley	H1.1.
	syl	al+ley
	pron	<1@li>
	pos	n.
	def	a narrow lane or passage, esp. one between or behind buildings; back street.
alley	H1.2.
	syl	al+ley
	pron	<1@li>
	pos	n.
	def	See {bowling alley}.
alley	H1.3.
	syl	al+ley
	pron	<1@li>
	pos	n.
	qual	Tennis, chiefly U.S.
	def	the space between the singles and doubles sidelines.
alley	H1.4.
	syl	al+ley
	pron	<1@li>
	pos	n.
	def	a walk in a park or garden, esp. one lined with trees or bushes.
up	5.
	head	alley
	or	down one's alley
	syl	up
	qual	Slang.
	def	suited to one's abilities or interests.
alley	ety	C18: shortened and changed from #7alabaster 
alley	H2.0.
	syl	al+ley
	pron	<1@li>
	pos	n.
	def	a large playing marble.
alley cat	0.
	syl	al+ley cat
	pos	n.
	qual	U.S.
	def	a homeless cat that roams in back streets.
alleyway	0.
	syl	al:ley+way
	pron	<1@li2wA>
	pos	n.
	def	a narrow passage; alley.
all-fired	1.
	syl	all-fired
	pos	adj.
	qual	Slang, chiefly U.S.
	usage	prenominal
	def	excessive; extreme. {~}
all-flying tail	0.
	syl	all-fly:ing tail
	pos	n.
	def	a type of aircraft tailplane in which the whole of the tailplane is moved for control purposes.
All Fools' Day	0.
	syl	All Fools' Day
	pos	n.
	def	another name for {April Fools' Day} (see {April fool) }.
all fours	1.
	syl	all fours
	pos	n.
	def	both the arms and legs of a person or all the legs of a quadruped (esp. in the phrase {on all fours) }.
all fours	2.
	syl	all fours
	pos	n.
	def	another name for {seven-up}.
all hail	ety	C14, literally: all health (to someone)
all hail	0.
	syl	all hail
	pos	interj.
	def	an archaic greeting or salutation.
Allhallows	1.
	syl	All+hal+lows
	pron	<2c:l1h@l*uz>
	pos	n.
	def	a less common term for {All Saints' Day}.
Allhallows Eve	2.
	head	Allhallows
	syl	Allhallows Eve.
	def	a less common name for {Halloween}.
Allhallowtide	0.
	syl	All+hal+low+tide
	pron	<2c:l1h@l*u2tId>
	pos	n.
	def	the season of All Saints' Day (Allhallows).
allheal	0.
	syl	all+heal
	pron	<1c:l2hEl>
	pos	n.
	def	any of several plants reputed to have healing powers, such as selfheal and valerian.
alliaceous	ety	C18: from Latin allium garlic; see -#7aceous 
alliaceous	1.
	syl	al+li:a+ceous
	pron	<2@li1AS*s>
	pos	adj.
	def	of or relating to a genus of liliaceous plants that have a strong onion or garlic smell and often have bulbs. The genus occurs in the N hemi?!sphere and includes onion, garlic, leek, chive, and shallot.
alliaceous	2.
	syl	al+li:a+ceous
	pron	<2@li1AS*s>
	pos	adj.
	def	tasting or smelling like garlic or onions.
alliance	ety	C13: from Old French aliance, from alier to #7ally 
alliance	1.
	syl	al+li+ance
	pron	<*1lI*ns>
	pos	n.
	def	the act of allying or state of being allied; union; confederation.
alliance	2.
	syl	al+li+ance
	pron	<*1lI*ns>
	pos	n.
	def	a formal agreement or pact, esp. a military one, between two or more countries to achieve a particular aim.
alliance	3.
	syl	al+li+ance
	pron	<*1lI*ns>
	pos	n.
	def	the countries involved in such an agreement.
alliance	4.
	syl	al+li+ance
	pron	<*1lI*ns>
	pos	n.
	def	a union between families through marriage.
alliance	5.
	syl	al+li+ance
	pron	<*1lI*ns>
	pos	n.
	def	affinity or correspondence in qualities or characteristics.
alliance	6.
	syl	al+li+ance
	pron	<*1lI*ns>
	pos	n.
	qual	Botany.
	def	a taxonomic category consisting of a group of related families; subclass.
allied	1.
	syl	al+lied
	pron	<*1lId>, <1@lId>
	pos	adj.
	def	joined, as by treaty, agreement, or marriage; united.
allied	2.
	syl	al+lied
	pron	<*1lId>, <1@lId>
	pos	adj.
	def	of the same type or class; related.
Allied	0.
	syl	Al+lied
	pron	<1@lId>
	pos	adj.
	def	of or relating to the Allies.
Allier	1.
	syl	Al+lier
	pron	French <a1ljA>
	pos	n.
	def	a department of central France, in Auvergne region. Capital: Moulins. Pop.: 386489 (1975). Area: 7382 sq. km (2879 sq. miles).
Allier	2.
	syl	Al+lier
	pron	French <a1ljA>
	pos	n.
	def	a river in S central France, rising in the C*'evennes and flowing north to the Loire. Length: over 403 km (250 miles).
allies	0.
	syl	al+lies
	pron	<1@lIz>
	pos	n.
	def	the plural of {ally}.
Allies	1.
	syl	Al+lies
	pron	<1@lIz>
	pos	n.
	mod	pl.
	usage	in World War I
	def	the powers of the Triple Entente (France, Russia, and Britain) together with the nations allied with them.
Allies	2.
	syl	Al+lies
	pron	<1@lIz>
	pos	n.
	mod	pl.
	usage	in World War II
	def	the countries that fought against the Axis and Japan. The main Allied powers were Britain and the Commonwealth countries, the U.S., the Soviet Union, France, and Poland. See also {Axis}.
alligator	ety	C17: from Spanish el lagarto the lizard, from Latin lacerta 
alligator	1.
	syl	al+li+ga+tor
	pron	<1@li2gAt*>
	pos	n.
	def	a large crocodilian, of the southern U.S., having powerful jaws and sharp teeth and differing from the crocodiles in having a shorter and broader snout: family (alligators and caymans).
alligator	2.
	syl	al+li+ga+tor
	pron	<1@li2gAt*>
	pos	n.
	def	a similar but smaller species, occurring in China near the Yangtse River.
alligator	3.
	syl	al+li+ga+tor
	pron	<1@li2gAt*>
	pos	n.
	def	any crocodilian belonging to the family
alligator	4.
	syl	al+li+ga+tor
	pron	<1@li2gAt*>
	pos	n.
	def	any of various tools or machines having adjustable toothed jaws, used for gripping, crushing, or compacting.
alligator pear	0.
	syl	al+li+ga+tor pear
	pos	n.
	def	another name for {avocado}.
alligator pepper	1.
	syl	al+li+ga+tor pep+per
	pos	n.
	qual	Chiefly W. African.
	def	a tropical African zingiberaceous plant, having red or orange spicy seed capsules.
alligator pepper	2.
	syl	al+li+ga+tor pep+per
	pos	n.
	qual	Chiefly W. African.
	def	the capsules or seeds of this plant, used as a spice.
all-important	0.
	syl	all-im:por:tant
	pos	adj.
	def	crucial; vital.
all in	1.
	syl	all in
	pos	adj.
	qual	Slang.
	usage	postpositive
	def	completely exhausted; tired out.
(all-in	infl
	head	all in
	syl	(all-in
	pos	adv. adj.
all in	xref
	syl	all in
	pos	adv. adj.
	exam	1	when prenominal) .
all in	2.a.
	syl	all in
	pos	adv. adj.
	def	with all expenses or costs included in the price.
	exam	1	the flat is twenty pounds a week all in.
all in	2.b.
	syl	all in
	pos	adv. adj.
	usage	prenominal
	exam	1	the all-in price is thirty pounds.
all in	3.
	syl	all in
	pos	adv. adj.
	usage	of wrestling
	def	freestyle.
all-inclusive	0.
	syl	all-in:clu:sive
	pos	adj.
	def	including everything; comprehensive.
alliterate	1.
	syl	al+lit+er+ate
	pron	<*1lit*2rAt>
	pos	vb.
	def	to contain or cause to contain alliteration.
alliterate	2.
	syl	al+lit+er+ate
	pron	<*1lit*2rAt>
	pos	vb.
	mod	intr.
	def	to speak or write using alliteration.
alliteration	ety	C17: from Medieval Latin alliter*_ati*_o (from Latin al- #7al -#7+ litera letter), on the model of obliter*_ati*_o #7obliteration 
alliteration	0.
	syl	al+lit+er:a+tion
	pron	<*2lit*1rAS*n>
	pos	n.
	def	the use of the same consonant ({consonantal alliteration}) or of a vowel, not necessarily the same vowel ({vocalic alliteration) }, at the beginning of each word or each stressed syllable in a line of verse, as in
alliterative	sub
	head	alliteration
	syl	al+1lit+er:a+tive
	pos	adj.
allium	ety	C19: from Latin: garlic
allium	0.
	syl	al+li:um
	pron	<1@li*m>
	pos	n.
	def	any liliaceous plant of the genus such as the onion, garlic, shallot, leek, and chive.
all-night	0.
	syl	all-night
	pos	adj.
	def	open or lasting all night.
	exam	1	an all-night show.
allo-	ety	from Greek allos other, different
Alloa	0.
	syl	Al+lo:a
	pron	<1@l*u*>
	pos	n.
	def	a town in E central Scotland, in Fife region. Pop.: 14110 (1971).
allocate	ety	C17: from Medieval Latin alloc*_are, from Latin loc*_are to place, from locus a place
allocate	1.
	syl	al+lo+cate
	pron	<1@l*2kAt>
	pos	vb.
	mod	tr.
	def	to assign or allot for a particu?!lar purpose.
allocate	2.
	syl	al+lo+cate
	pron	<1@l*2kAt>
	pos	vb.
	mod	tr.
	def	a less common word for { {locate} (sense 2).}
allocatable	sub
	head	allocate
	syl	al+lo+2cat+a:ble
	pos	adj.
allocation	1.
	syl	al+lo+ca+tion
	pron	<2@l*1kAS*n>
	pos	n.
	def	the act of allocating or the state of being allocated.
allocation	2.
	syl	al+lo+ca+tion
	pron	<2@l*1kAS*n>
	pos	n.
	def	a part that is allocated; share.
allocation	3.
	syl	al+lo+ca+tion
	pron	<2@l*1kAS*n>
	pos	n.
	qual	Accounting, Brit.
	def	a system of dividing overhead expenses between the various departments of a business.
allochthonous	0.
	syl	al+loch+tho+nous
	pron	<*1lokT*n*s>
	pos	adj.
	usage	of rocks, deposits, etc.
	def	found in a place other than where they or their constituents were formed. Compare { {autochthonous} (sense 1).}
allocution	ety	C17: from Late Latin alloc*_uti*_o, from Latin alloqu*_i to address, from loqu*_i to speak
allocution	0.
	syl	al+lo+cu+tion
	pron	<2@l*1kju:S*n>
	pos	n.
	qual	Rhetoric.
	def	a formal or authoritative speech or address, esp. one that advises, informs, or exhorts.
allodial	1.
	syl	al+lo+di:al
	pron	<*1l*udi*l>
	pos	adj.
	usage	of land
	def	held as an allodium.
allodial	2.
	syl	al+lo+di:al
	pron	<*1l*udi*l>
	pos	adj.
	usage	of tenure
	def	characterized by or relating to the system of holding land in absolute ownership.
	exam	1	the allodial system.
allodial	3.
	syl	al+lo+di:al
	pron	<*1l*udi*l>
	pos	adj.
	usage	of people
	def	holding an allodium.
allodium	ety	C17: from Medieval Latin, from Old German all*_od (unattested) entire property, from al- #7all+ -*_od property; compare Old High German *_ot, Old English e*_ad property
allod	alt
	head	allodium
	or	allodium
	syl	al+lod
	pron	<1@lod>
	pos	n.
allodia	infl
	head	allodium
	or	allods
	syl	al+lo+di:a
	pron	<-1l*udi*>
	pos	n.
	mod	pl.
allods	infl
	head	allodium
	or	allodia
	syl	al+lods.
	pos	n.
	mod	pl.
allodium	0.
	or	allod
	syl	al+lo+di:um
	pron	<*1l*udi*m>
	pos	n.
	qual	History.
	def	lands held in absolute ownership, free from such obligations as rent or services due to an overlord. Also: {alodium}.
allogamy	0.
	syl	al+log:a+my
	pron	<*1log*mi>
	pos	n.
	def	cross-fertilization in flowering plants.
allogamous	sub
	head	allogamy
	syl	al+1log:a+mous
	pos	adj.
allograph	1.
	syl	al+lo+graph
	pron	<1@l*2gra:f>
	pos	n.
	def	a document written by a person who is not a party to it.
allograph	2.
	syl	al+lo+graph
	pron	<1@l*2gra:f>
	pos	n.
	def	a signature made by one person on behalf of another. Compare {autograph}.
allograph	3.
	syl	al+lo+graph
	pron	<1@l*2gra:f>
	pos	n.
	qual	Linguistics.
	def	any of the written symbols that constitute a single grapheme: m M
allographic	sub
	head	allograph
	syl	al+lo+graph+ic
	pron	<2@l*1gr@fik>
	pos	adj.
allomerism	0.
	syl	al+lom+er+ism
	pron	<*1lom*2riz*m>
	pos	n.
	def	similarity of crystalline structure in substances of different chemical composition.
allomerous	sub
	head	allomerism
	syl	al+1lom+er+ous
	pos	adj.
allometry	1.
	syl	al+lom+e:try
	pron	<*1lomitri>
	pos	n.
	def	the study of the growth of part of an organism in relation to the growth of the entire organism.
allometry	2.
	syl	al+lom+e:try
	pron	<*1lomitri>
	pos	n.
	def	a change in proportion of any of the parts of an organism that occurs during growth.
allometric	sub
	head	allometry
	syl	al+lo+met+ric
	pron	<2@l*1metrik>
	pos	adj.
administrate	0.
	syl	ad+min+is+trate
	pron	<*d1mini2strAt>
	pos	vb.
	def	to manage or
allomorph	1.
	syl	al+lo+morph
	pron	<1@l*2mc:f>
	pos	n.
	qual	Linguistics.
	def	any of the phonological representations of a single morpheme. For example, the final (s) and (z) sounds of and are allomorphs of the English noun-plural morpheme.
allomorph	2.
	syl	al+lo+morph
	pron	<1@l*2mc:f>
	pos	n.
	def	any of two or more different crystalline forms of a chemical compound, such as a mineral.
allomorphic	sub
	head	allomorph
	syl	al+lo+1mor+phic
	pos	adj.
allomorphism	0.
	syl	al+lo+mor+phism
	pron	<2@l*1mc:fiz*m>
	pos	n.
	def	variation in the crystalline form of a chemical compound.
allonym	0.
	syl	al+lo+nym
	pron	<1@l*nim>
	pos	n.
	def	a name, often one of historical signifi?!cance or that of another person, assumed by a person, esp. an author.
allopathist	alt
	head	allopath
	or	allopath
	syl	al+lop:a+thist
	pron	<*1lop*Tist>
	pos	n.
allopath	0.
	or	allopathist
	syl	al+lo+path
	pron	<1@l*2p@T>
	pos	n.
	def	a person who practises or is skilled in allopathy.
allopathy	0.
	syl	al+lop:a+thy
	pron	<*1lop*Ti>
	pos	n.
	def	the usual method of treating disease, by inducing a condition different from the cause of the disease. Compare {homeopathy}.
allopathic	sub
	head	allopathy
	syl	al+lo+path+ic
	pron	<2@l*1p@Tik>
	pos	adj.
allopathically	sub
	head	allopathy
	syl	al+lo+1path:i+cal+ly
	pos	adv.
allopatric	ety	C20: from #7allo -#7+ -patric, from Greek patris native land
allopatric	0.
	syl	al+lo+pat+ric
	pron	<2@l*1p@trik>
	pos	adj.
	usage	of biological speciation or species
	def	taking place or existing in areas that are geographically isolated from one another. Compare {sympatric}.
allopatrically	sub
	head	allopatric
	syl	al+lo+1pat+ri+cal+ly
	pos	adv.
allophane	ety	C19: from Greek allophan*_es appearing differently, from #7allo -#7+ phainesthai to appear
allophane	0.
	syl	al+lo+phane
	pron	<1@l*2fAn>
	pos	n.
	def	a variously coloured amorphous mineral consisting of hydrated aluminium silicate and occurring in cracks in some sedimentary rocks.
allophone	0.
	syl	al+lo+phone
	pron	<1@l*2f*un>
	pos	n.
	def	any of several speech sounds that are regarded as contextual or environmental variants of the same phoneme. In English the aspirated initial (p) in and the unaspirated (p) in are allophones of the phoneme /p/.
allophonic	sub
	head	allophone
	syl	al+lo+phon+ic
	pron	<2@l*1fonik>
	pos	adj.
alloplasm	0.
	syl	al+lo+plasm
	pron	<1@l*2pl@z*m>
	pos	n.
	qual	Biology.
	def	part of the cytoplasm that is specialized to form cilia, flagella, and similar structures.
alloplasmic	sub
	head	alloplasm
	syl	al+lo+1plas+mic
	pos	adj.
allopurinol	ety	C20: from #7allo -#7+purine+ -#7ol 
allopurinol	0.
	syl	al+lo+pu+ri+nol
	pron	<2@l*u1pju*r*2nol>
	pos	n.
	def	a synthetic drug that reduces blood levels of uric acid and is administered orally in the treatment of gout. Formula: C\5H\4N\4O.
allot	ety	C16: from Old French aloter, from lot portion, #7lot 
allots	infl
	head	allot
	syl	al+lots
	pos	vb.
	mod	tr.
allotting	infl
	head	allot
	syl	al+lot+ting
	pos	vb.
	mod	tr.
allotted	infl
	head	allot
	syl	al+lot+ted.
	pos	vb.
	mod	tr.
allot	1.
	syl	al+lot
	pron	<*1lot>
	pos	vb.
	mod	tr.
	def	to assign or distribute (shares, etc.).
allot	2.
	syl	al+lot
	pron	<*1lot>
	pos	vb.
	mod	tr.
	def	to designate for a particular purpose.
	exam	1	money was allotted to cover expenses.
allot	3.
	syl	al+lot
	pron	<*1lot>
	pos	vb.
	mod	tr.
	usage	foll. by to
	def	apportion.
	exam	1	we allotted two hours to the case.
allotment	1.
	syl	al+lot+ment
	pron	<*1lotm*nt>
	pos	n.
	def	the act of allotting; apportionment.
allotment	2.
	syl	al+lot+ment
	pron	<*1lotm*nt>
	pos	n.
	def	a portion or amount allotted.
allotment	3.
	syl	al+lot+ment
	pron	<*1lotm*nt>
	pos	n.
	qual	Brit.
	def	a small piece of usually public land rented by an individual for cultivation.
allotrope	0.
	syl	al+lo+trope
	pron	<1@l*2tr*up>
	pos	n.
	def	any of two or more physical forms in which an element can exist.
	exam	1	diamond and graphite are allo?!tropes of carbon.
allotropism	alt
	head	allotropy
	or	allotropy
	syl	al+lot+ro+pism
	pos	n.
allotropy	0.
	or	allotropism
	syl	al+lot+ro+py
	pron	<*1lotr*pi>
	pos	n.
	def	the existence of an element in two or more physical forms. The most common elements having this property are carbon, sulphur, and phosphorus. &- {al+lo+trop+ic} (@!@al$$#!tr$Ap$Ik) &- {@!al+lo+#!trop@.i+cal+ly}
all'ottava	ety	Italian: at the octave
all'ottava	0.
	syl	all'ot+ta+va
	pron	<@l> <*1ta:v*>
	pos	adj. adv.
	qual	Music.
	def	to be played an octave higher or lower than written. Symbol: 8va
allottee	0.
	syl	al+lot+tee
	pron	<*lot1E>
	pos	n.
	def	a person to whom something is allotted.
all-out	1.
	syl	all-out
	pos	adj.
	qual	Informal.
	def	using one's maximum powers.
	exam	1	an all-out effort.
all out	infl
	head	all-out
	syl	all out.
	pos	adv.
all-out	2.
	syl	all-out
	pos	adv.
	qual	Informal.
	def	to one's maximum effort or capacity.
	exam	1	he went all out on the home stretch.
all-over	0.
	syl	all-o:ver
	pos	adj.
	def	covering the entire surface.
allow	ety	C14: from Old French alouer, from Late Latin allaud*_are to extol, influenced by Medieval Latin alloc*_are to assign, #7allocate 
allow	1.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	tr.
	def	to permit (to do something); let.
allow	2.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	tr.
	def	to set aside.
	exam	1	five hours were allowed to do the job.
allow	3.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	tr.
	def	to let enter or stay.
	exam	1	they don't allow dogs.
allow	4.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	tr.
	def	to acknowl?!edge or concede (a point, claim, etc.).
allow	5.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	tr.
	def	to let have; grant.
	exam	1	he was allowed few visitors.
allow	6.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	intr.
	usage	foll. by for
	def	to take into account.
	exam	1	allow for delays.
allow	7.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	intr.
	usage	often foll. by of
	def	to permit; admit.
	exam	1	a question that allows of only one reply.
allow	8.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	tr.
	qual	U.S. dialect.
	usage	may take a clause as object
	def	to assert; maintain.
allow	9.
	syl	al+low
	pron	<*1lau>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to approve; accept.
allowable	0.
	syl	al+low+a:ble
	pron	<*1lau*bL>
	pos	adj.
	def	permissible; admissible.
allowably	sub
	head	allowable
	syl	al+1low+a:bly
	pos	adv.
allowance	1.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	an amount of something, esp. money or food, given or allotted usually at regular intervals.
allowance	2.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	a discount, as in consideration for something given in part exchange or to increase business; rebate.
allowance	3.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	a portion set aside to compensate for something or to cover special expenses.
allowance	4.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	admission; concession.
allowance	5.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	the act of allowing; sanction; toleration.
allowance	6.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	something allowed.
allowance	7.a.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	to take mitigating circumstances into account in consideration (of).
allowance	7.b.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	n.
	def	to allow (for).
allowance	8.
	syl	al+low+ance
	pron	<*1lau*ns>
	pos	vb.
	mod	tr.
	def	to supply (something) in limited amounts.
Alloway	0.
	syl	Al+lo+way
	pron	<1@l*2wA>
	pos	n.
	def	a village in Scotland, south of Ayr: birthplace of Robert Burns.
allowedly	0.
	syl	al+low+ed+ly
	pron	<*1lauidli>
	pos	adv.
	usage	sentence modifier
	def	by general admission or agreement; admittedly.
alloy	ety	C16: from Old French aloi a mixture, from aloier to combine, from Latin allig*_are, from lig*_are to bind
alloy	1.
	syl	al+loy
	pron	<1@lci>, <*1lci>
	pos	n.
	def	a metallic material, such as steel, brass, or bronze, consisting of a mixture of two or more metals or of metallic elements with nonmetallic elements. Alloys often have physical properties markedly different from those of the pure metals.
alloy	2.
	syl	al+loy
	pron	<1@lci>, <*1lci>
	pos	n.
	def	something that impairs the quality or reduces the value of the thing to which it is added.
alloy	3.
	syl	al+loy
	pron	<*1lci>
	pos	vb.
	mod	tr.
	def	to add (one metal or element to another metal or element) to obtain a substance with a desired property.
alloy	4.
	syl	al+loy
	pron	<*1lci>
	pos	vb.
	mod	tr.
	def	to debase (a pure substance) by mixing with an inferior element.
alloy	5.
	syl	al+loy
	pron	<*1lci>
	pos	vb.
	mod	tr.
	def	to diminish or impair.
alloyed junction	0.
	syl	al+loyed junc+tion
	pos	n.
	def	a semiconductor junction used in some junction transistors and formed by alloying metal contacts, functioning as emitter and collector regions, to a wafer of semiconductor that acts as the base region. Compare {diffused junction}.
all-purpose	0.
	syl	all-pur:pose
	pos	adj.
	def	useful for many things.
	exam	1	an all-purpose gadget.
all right	1.
	syl	all right
	pos	adj. postpositive except in slang use; adv.
	def	adequate; satisfactory.
all right	2.
	syl	all right
	pos	adj. postpositive except in slang use; adv.
	def	unharmed; safe.
all right	3.a.
	syl	all right
	pos	adj. postpositive except in slang use; adv.
	def	acceptable.
	exam	1	an all-right book.
all right	3.b.
	syl	all right
	pos	adj. postpositive except in slang use; adv.
	def	reliable.
	exam	1	an all-right guy.
all right	4.
	syl	all right
	pos	adv.
	def	very well: used to express assent.
all right	5.
	syl	all right
	pos	adv.
	def	satisfactorily; adequately.
	exam	1	the car goes all right.
all right	6.
	syl	all right
	pos	adv.
	def	without doubt.
	exam	1	he's a bad one, all right.
all right	xref
	syl	all right
	pos	adj. postpositive except in slang use; adv.
	def	Also (not standard): {alright}.
all-round	1.
	syl	all-round
	pos	adj.
	def	efficient in all respects, esp. in sport; versatile.
	exam	1	an all-round player.
all-round	2.
	syl	all-round
	pos	adj.
	def	comprehensive; many-sided; not narrow.
	exam	1	an all-round education.
all-rounder	0.
	syl	all-round:er
	pos	n.
	def	a versatile person, esp. in a sport.
All Saints' Day	0.
	syl	All Saints' Day
	pos	n.
	def	a Christian festival celebrated on Nov. 1 to honour all the saints.
allseed	0.
	syl	all+seed
	pron	<1c:l2sEd>
	pos	n.
	def	any of several plants that produce many seeds, such as knotgrass.
all-sorts	0.
	syl	all-sorts
	pos	n.
	mod	pl.
	def	a mixture, esp. a mixture of liquorice sweets.
All Souls' Day	0.
	syl	All Souls' Day
	pos	n.
	qual	R.C. Church.
	def	a day of prayer (Nov. 2) for the dead in purgatory.
allspice	1.
	syl	all+spice
	pron	<1c:l2spIs>
	pos	n.
	def	a tropical American myrtaceous tree, having small white flowers and aromatic berries.
allspice	2.
	syl	all+spice
	pron	<1c:l2spIs>
	pos	n.
	def	the whole or powdered seeds of this berry used as a spice, having a flavour said to resemble a mixture of cinnamon, cloves, and nutmeg.
allspice	xref
	syl	all+spice
	pron	<1c:l2spIs>
	pos	n.
	def	Also called: {pimento}.
all-star	0.
	syl	all-star
	pos	adj.
	usage	prenominal
	def	consisting of star performers.
all-time	0.
	syl	all-time
	pos	adj.
	qual	Informal.
	usage	prenominal
	def	unsurpassed in some respect at a particular time.
	exam	1	an all-time record. #e
all told	0.
	syl	all told
	usage	sentence modifier
	def	taking every one into account; in all.
	exam	1	we were seven all told.
allude	ety	C16: from Latin all*_udere, from l*_udere to sport, from l*_udus a game
allude	0.
	syl	al+lude
	pron	<*1lu:d>
	pos	vb.
	mod	intr.
	usage	foll. by to
	def	to refer indirectly.
	exam	1	he often alluded to his life in the army.
allure	ety	C15: from Old French alurer, from lure bait, #7lure 
allure	1.
	syl	al+lure
	pron	<*1lu*>
	pos	vb.
	mod	tr.
	def	to entice or tempt (someone) to a person or place or to a course of action; attract.
allure	2.
	syl	al+lure
	pron	<*1lu*>
	pos	n.
	def	attractiveness; appeal.
	exam	1	the cottage's allure was its isolation.
allurer	sub
	head	allure
	syl	al+1lur+er
	pos	n.
allurement	sub
	head	allure
	syl	al+1lure+ment
	pos	n.
alluring	0.
	syl	al+lur+ing
	pron	<*1lu*riG>
	pos	adj.
	def	enticing; fascinating; attractive.
alluringly	sub
	head	alluring
	syl	al+1lur+ing+ly
	pos	adv.
allusion	ety	C16: from Late Latin all*_usi*_o, from Latin all*_udere to sport with, #7allude 
allusion	1.
	syl	al+lu+sion
	pron	<*1lu:Z*n>
	pos	n.
	def	the act of alluding.
allusion	2.
	syl	al+lu+sion
	pron	<*1lu:Z*n>
	pos	n.
	def	a passing reference; oblique or obscure mention.
allusive	0.
	syl	al+lu+sive
	pron	<*1lu:siv>
	pos	adj.
	def	containing or full of allusions.
allusively	sub
	head	allusive
	syl	al+1lu+sive+ly
	pos	adv.
allusiveness	sub
	head	allusive
	syl	al+1lu+sive+ness
	pos	n.
alluvial	1.
	syl	al+lu+vi:al
	pron	<*1lu:vi*l>
	pos	adj.
	def	of or relating to alluvium.
alluvial	2.
	syl	al+lu+vi:al
	pron	<*1lu:vi*l>
	pos	n.
	def	another name for {alluvium}.
alluvial	3.
	syl	al+lu+vi:al
	pron	<*1lu:vi*l>
	pos	n.
	qual	Austral.
	def	alluvium containing any heavy mineral, esp. gold.
cone	alt
	head	alluvial fan
	or	alluvial fan
	syl	cone
	pos	n.
alluvial fan	0.
	or	cone
	syl	al+lu+vi:al fan
	pos	n.
	def	a fan-shaped accumulation of silt, sand, gravel, and boulders deposited by fast-flowing mountain rivers when they reach flatter land.
alluvion	ety	C16: from Latin alluvi*_o an overflowing, from luere to wash
alluvion	1.a.
	syl	al+lu+vi:on
	pron	<*1lu:vi*n>
	pos	n.
	def	the wash of the sea or of a river.
alluvion	1.b.
	syl	al+lu+vi:on
	pron	<*1lu:vi*n>
	pos	n.
	def	an overflow or flood.
alluvion	1.c.
	syl	al+lu+vi:on
	pron	<*1lu:vi*n>
	pos	n.
	def	matter deposited as sediment; alluvium.
alluvion	2.
	syl	al+lu+vi:on
	pron	<*1lu:vi*n>
	pos	n.
	qual	Law.
	def	the gradual formation of new land, as by the recession of the sea or deposit of sediment on a riverbed.
alluvium	ety	C17: from Latin; see #7alluvion 
alluviums	infl
	head	alluvium
	or	alluvia
	syl	al+lu+vi:ums
	pron	<-vi*>
	pos	n.
	mod	pl.
alluvia	infl
	head	alluvium
	or	alluviums
	syl	al+lu+vi:a
	pron	<-vi*>
	pos	n.
	mod	pl.
alluvium	0.
	syl	al+lu+vi:um
	pron	<*1lu:vi*m>
	pos	n.
	def	a fine-grained fertile soil consisting of mud, silt, and sand deposited by flowing water on flood plains, in river beds, and in estuaries.
ally	ety	C14: from Old French alier to join, from Latin allig*_are to bind to, from lig*_are to bind
lies	infl
	head	ally
	syl	+lies
	pos	vb.
allying	infl
	head	ally
	syl	al:ly+ing
	pos	vb.
lied	infl
	head	ally
	syl	+lied.
	pos	vb.
ally	1.
	syl	al:ly
	pron	<*1lI>
	pos	vb.
	usage	usually foll. by to or with
	def	to unite or be united, esp. formally, as by treaty, confederation, or marriage.
ally	2.
	syl	al:ly
	pron	<*1lI>
	pos	vb.
	mod	tr.
	usage	usually foll. by to or with; usually passive
	def	to connect or be related, as through being similar or compatible.
allies	infl
	head	ally
	syl	al:lies.
	pos	n.
	mod	pl.
ally	3.
	syl	al:ly
	pron	<1@lI>, <*1lI>
	pos	n.
	usage	usually foll. by to or with
	def	a country, person, or group allied with another.
ally	4.
	syl	al:ly
	pron	<1@lI>, <*1lI>
	pos	n.
	usage	usually foll. by to or with
	def	a plant, animal, substance, etc., closely related to another in characteristics or form.
allyl	ety	C19: from Latin allium garlic+-#7yl ; first distinguished in a compound isolated from garlic
allyl	0.
	syl	al+lyl
	pron	<1@lIl>, <1@lil>
	pos	n.
	usage	modifier
	def	of, consisting of, or containing the monovalent group CH\2:CHCH\2-.
	exam	1	allyl group or radical;
	exam	2	allyl resin.
allyl alcohol	0.
	syl	al+lyl al+co+hol
	pos	n.
	def	a colourless pungent poisonous liquid used in the manufacture of resins, plasticizers, and other organic chemicals. Formula: CH\2:CHCH\2OH; relative density: 0.85; melting pt.: -129?%C; boiling pt.: 96.9?%C.
allyl resin	0.
	syl	al+lyl res+in
	pos	n.
	def	any of several thermosetting synthetic resins made by polymerizing esters of allyl alcohol with a dibasic acid. They are used as adhesives.
allyl sulphide	0.
	syl	al+lyl sul+phide
	pos	n.
	def	a colourless liquid that smells like garlic and is used as a flavouring. Formula: (CH\2:CHCH\2)\2S; relative density: 0.888; boiling pt.: 139?%C.
allyou	0.
	syl	all+you
	pron	<1c:l2ju:>, <1c:2ju>
	pos	pron.
	qual	Caribbean informal.
	usage	used in addressing more than one person
	def	all of you.
Alma-Ata	0.
	syl	Al:ma-A:ta
	pron	Russian <al1ma> <a1ta>
	pos	n.
	def	a city in the S Soviet Union, the capital of the Kazakh SSR. Pop.: 836000 (1975 est.). Former name (until 1927): {Verny}.
Almada	0.
	syl	Al+ma+da
	pron	Portuguese <al1maD*>
	pos	n.
	def	a city in S central Portugal, on the S bank of the Tagus estuary opposite Lisbon: statue of Christ 110 m (360 ft.) high, erected 1959. Pop.: 108150 (1970).
Almad'en	0.
	syl	Al+ma+d*'en
	pron	Spanish <2alma1DAn>
	pos	n.
	def	a town in S Spain: rich cinnabar mines, worked since Roman times. Pop.: 10910 (1970).
Al Madinah	0.
	syl	Al Ma+di+nah
	pron	<2@l> <m@1dEn*>
	pos	n.
	def	the Arabic name for {Medina}.
Almagest	ety	C14: from Old French, from Arabic al-majisti, from al the+ majisti, from Greek megist*_e greatest (treatise)
Almagest	1.
	syl	Al+ma+gest
	pron	<1@lm*2Jest>
	pos	n.
	def	a work on astronomy compiled by Ptolemy in the 2nd century #7a.d. containing a description of the geocentric system of the universe and a star catalogue.
Almagest	2.
	syl	Al+ma+gest
	pron	<1@lm*2Jest>
	pos	n.
	usage	sometimes not cap.
	def	any of various similar medieval treatises on astrology, astronomy, or alchemy.
alma mater	ety	C17: from Latin: bountiful mother
alma mater	0.
	syl	al:ma ma+ter
	pron	<1@lm*> <1ma:t*>, <1mAt*>
	pos	n.
	usage	often caps.
	def	one's school, college, or university.
almanac	ety	C14: from Medieval Latin almanachus, perhaps from Late Greek almenikhiaka 
almanac	0.
	syl	al+ma+nac
	pron	<1c:lm*2n@k>
	pos	n.
	def	a yearly calendar giving statistical information on events and phenomena, such as the phases of the moon, times of sunrise and sunset, tides, anniversaries, etc. Also (archaic): {almanack}.
almandine	ety	C17: from French, from Medieval Latin alaband*_ina, from Alabanda, ancient city of Asia Minor where these stones were cut
almandine	0.
	syl	al+man+dine
	pron	<1@lm*n2din>, <-2dIn>
	pos	n.
	def	a deep violet-red garnet that consists of iron aluminium silicate and is used as a gemstone. Formula: Fe\3Al\2(SiO\4)\3.
Al Mansurah	0.
	syl	Al Man+s*^u+rah
	pron	<2@l> <m@n1su*r*>
	pos	n.
	def	a variant spelling of {El Mansura}.
Al Marj	0.
	syl	Al Marj
	pron	<@l> <1ma:J>
	pos	n.
	def	an ancient town in N Libya: founded in about 550 #7b.c. Pop.: 10645 (1969 est.). Italian name: {Barce}.
Alma-Tadema	0.
	syl	Al:ma-Tad:e:ma
	pron	<1@lm*> <1t@dim*>
	pos	n.
	def	Sir {Law@.rence}. 1836-1912, Dutch-English painter of studies of Greek and Roman life.
Almelo	0.
	syl	Al+me+lo
	pron	Dutch <1alm*lo:>
	pos	n.
	def	a city in the E Netherlands, in Overijssel province. Pop.: 59821 (1973 est.).
almemar	ety	from Hebrew, from Arabic al-minbar the pulpit, platform
almemar	0.
	syl	al+me+mar
	pron	<@l1mEma:>
	pos	n.
	usage	Judaism. in Ashkenazic usage
	def	the raised platform in a synagogue on which the reading desk stands. Also called: {bema, bimah}.
Almer'ia	0.
	syl	Al+me+r*'i:a
	pron	Spanish <2almA1ria>
	pos	n.
	def	a port in S Spain. Pop.: 114510 (1970).
almighty	1.
	syl	al+might:y
	pron	<c:l1mIti>
	pos	adj.
	def	all-powerful; omnipotent.
almightily	sub
	head	almighty
	syl	al+1might:i+ly
	pos	adv.
almightiness	sub
	head	almighty
	syl	al+1might:i+ness
	pos	n.
Almighthe	infl
	head	Almighty
	syl	Al+mighthe.
	pos	n.
Almighty	0.
	syl	Al+might:y
	pron	<c:l1mIti>
	pos	n.
	def	another name for {God}.
Almohade	ety	from Arabic al-muwahhid 
Almohad	alt
	head	Almohade
	or	Almohade
	syl	Al+mo+had
	pron	<1@lm*2h@d>
	pos	n.
Almohades	infl
	head	Almohade
	or	Almohads
	syl	Al+mo+hades
	pos	n.
	mod	pl.
Almohads	infl
	head	Almohade
	or	Almohades
	syl	Al+mo+hads.
	pos	n.
	mod	pl.
Almohade	0.
	or	Almohad
	syl	Al+mo+hade
	pron	<1@lm*2hAd>, <-2hAdE>
	pos	n.
	def	a member of a group of puritanical Muslims, originally Berbers, who arose in S Morocco in the 12th century as a reaction against the corrupt Almoravides and who ruled Spain and all Maghrib from about 1147 to after 1213.
almond	ety	C13: from Old French almande, from Medieval Latin amandula, from Latin amygdala, from Greek amugdal*_e 
almond	1.
	syl	al+mond
	pron	<1a:m*nd>
	pos	n.
	def	a small widely cultivated rosaceous tree, that is native to W Asia and has pink flowers and a green fruit containing an edible nutlike seed.
almond	2.
	syl	al+mond
	pron	<1a:m*nd>
	pos	n.
	def	the oval-shaped nutlike edible seed of this plant, which has a yellowish-brown shell.
almond	3.
	syl	al+mond
	pron	<1a:m*nd>
	pos	n.
	usage	modifier
	def	made of or containing almonds.
	exam	1	almond cake.
almond	4.a.
	syl	al+mond
	pron	<1a:m*nd>
	pos	n.
	def	a pale yellowish-brown colour.
almond	4.b.
	syl	al+mond
	pron	<1a:m*nd>
	pos	as; adj.
	exam	1	almond wallpaper.
almond	5.
	syl	al+mond
	pron	<1a:m*nd>
	pos	n.
	def	Also called: {almond green}.
almond	5.a.
	syl	al+mond
	pron	<1a:m*nd>
	pos	n.
	def	a yellowish-green colour.
almond	5.b.
	syl	al+mond
	pron	<1a:m*nd>
	pos	as; adj.
	exam	1	an almond skirt.
almond	6.
	syl	al+mond
	pron	<1a:m*nd>
	pos	n.
	def	anything shaped like an almond nut.
almond-eyed	0.
	syl	al:mond-eyed
	pos	adj.
	def	having narrow oval eyes.
almoner	ety	C13: from Old French almosnier, from almosne alms, from Vulgar Latin alemosina (unattested), from Late Latin ele*_emosyna; see #7alms 
almoner	1.
	syl	al+mon+er
	pron	<1a:m*n*>
	pos	n.
	qual	Brit.
	def	a trained hospital social worker responsible for the welfare of patients.
almoner	2.
	syl	al+mon+er
	pron	<1a:m*n*>
	pos	n.
	usage	formerly
	def	a person who distributes alms or charity on behalf of a household or institution.
almonry	ety	C15: from Old French almosnerie; see #7almoner, alms 
almonries	infl
	head	almonry
	syl	al+mon+ries.
	pos	n.
	mod	pl.
almonry	0.
	syl	al+mon+ry
	pron	<1a:m*nri>
	pos	n.
	qual	History.
	def	the house of an almoner, usually the place where alms were given.
Almoravide	ety	from Arabic al-mur*_abit*_un the holy ones
Almoravid	alt
	head	Almoravide
	or	Almoravide
	syl	Al+mo+ra+vid
	pron	<@l1mc:r*vid>
	pos	n.
Almoravide	0.
	or	Almoravid
	syl	Al+mo+ra+vide
	pron	<@l1mc:r*2vId>
	pos	n.
	def	a member of a fanatical people of Berber origin and Islamic faith, who founded an empire in N Africa that spread over much of Spain in the 11th century #7a.d.
almost	0.
	syl	al+most
	pron	<1c:lm*ust>
	pos	adv.
	def	little short of being; very nearly.
alms	ety	Old English @almysse, from Late Latin ele*_emosyna, from Greek ele*_emosun*_e pity; see #7eleemosynary 
alms	0.
	syl	alms
	pron	<a:mz>
	pos	n.
	mod	pl.
	def	charitable donations of money or goods to the poor or needy.
almshouse	1.
	syl	alms+house
	pron	<1a:mz2haus>
	pos	n.
	qual	Brit.
	def	a privately supported house offering accommodation to the aged or needy.
almshouse	2.
	syl	alms+house
	pron	<1a:mz2haus>
	pos	n.
	qual	Chiefly Brit.
	def	another name for {poorhouse}.
almswoman	alt
	head	almsman
	or	almsman
	syl	alms+wom:an
	pos	n.
	mod	fem.
almsmen	infl
	head	almsman
	or	almswomen
	syl	alms+men
	pos	n.
	mod	pl.
almswomen	infl
	head	almsman
	or	almsmen
	syl	alms+wom:en.
	pos	n.
	mod	pl.
almsman	0.
	or	almswoman
	syl	alms+man
	pron	<1a:mzm*n>
	pos	n.
	qual	Archaic.
	def	a person who gives or receives alms.
almucantar	ety	C14: from French, from Arabic almukantar*_at sundial
almacantar	alt
	head	almucantar
	or	almucantar
	syl	al+ma+can+tar
	pron	<2@lm*1k@nt*>
	pos	n.
almucantar	1.
	or	almacantar
	syl	al+mu+can+tar
	pron	<2@lm*1k@nt*>
	pos	n.
	def	a circle on the celestial sphere parallel to the horizontal plane.
almucantar	2.
	or	almacantar
	syl	al+mu+can+tar
	pron	<2@lm*1k@nt*>
	pos	n.
	def	an instrument for measuring altitudes.
almuce	ety	C15: from Old French aumusse, from Medieval Latin almucia, of unknown origin
almuce	0.
	syl	al+muce
	pron	<1@lmju:s>
	pos	n.
	def	a fur-lined hood or cape formerly worn by members of certain religious orders, more recently by canons of France.
Alnico	0.
	syl	Al+ni+co
	pron	<1@lni2k*u>
	pos	n.
	qual	Trademark.
	def	an alloy of aluminium, nickel, and cobalt, used to make permanent magnets.
alodia	infl
	head	alodium
	syl	a:lo+di:a
	pron	<-di*>
	pos	n.
	mod	pl.
alodium	0.
	syl	a:lo+di:um
	pron	<*1l*udi*m>
	pos	n.
	def	a variant spelling of {allodium}.
alodial	sub
	head	alodium
	syl	a:1lo+di:al
	pos	adj.
aloe	ety	C14: from Latin alo*_e, from Greek
aloes	infl
	head	aloe
	syl	al:oes.
	pos	n.
	mod	pl.
aloe	1.
	syl	al:oe
	pron	<1@l*u>
	pos	n.
	def	any plant of the liliaceous genus chiefly native to southern Africa, with fleshy spiny-toothed leaves and red or yellow flowers.
American aloe	2.
	head	aloe
	syl	American aloe.
	def	another name for {century plant}.
aloetic	sub
	head	aloe
	syl	al:o+e:tic
	pron	<2@l*u1etik>
	pos	adj.
aloes	1.
	syl	al:oes
	pron	<1@l*uz>
	pos	n.
	mod	functioning as; sing.
	def	Also called: {aloes wood}. another name for {eaglewood}.
bitter aloes	2.
	head	aloes
	syl	bitter aloes.
	def	a bitter purgative drug made from the leaves of several species of aloe.
aloft	ety	C12: from Old Norse *_a lopt in the air; see #7lift, loft 
aloft	1.
	syl	a:loft
	pron	<*1loft>
	pos	adv. adj.
	usage	postpositive
	def	in or into a high or higher place; up above.
aloft	2.
	syl	a:loft
	pron	<*1loft>
	pos	adv. adj.
	qual	Nautical.
	usage	postpositive
	def	in or into the rigging of a vessel.
aloha	0.
	syl	a:lo+ha
	pron	<*1l*u*>, <a:1l*uha:>
	pos	n. interj.
	def	a Hawaiian word for {hello} or {goodbye}.
aloin	ety	C19: from #7aloe+ -#7in 
aloin	0.
	syl	al:o+in
	pron	<1@l*uin>
	pos	n.
	def	a bitter crystalline compound derived from various species of aloe and used medicinally as a laxative.
alone	ety	Old English al one, literally: all (entirely) one
alone	1.
	syl	a:lone
	pron	<*1l*un>
	pos	adj. postpositive; adv.
	def	apart from another or others; solitary.
alone	2.
	syl	a:lone
	pron	<*1l*un>
	pos	adj. postpositive; adv.
	def	without anyone or anything else.
	exam	1	one man alone could lift it.
alone	3.
	syl	a:lone
	pron	<*1l*un>
	pos	adj. postpositive; adv.
	def	without equal; unique.
	exam	1	he stands alone in the field of microbiology.
alone	4.
	syl	a:lone
	pron	<*1l*un>
	pos	adj. postpositive; adv.
	def	to the exclusion of others; only.
	exam	1	she alone believed him.
aleave	5.
	head	alone
	or	let alone
	syl	a:leave
	def	to refrain from annoying or interfering with.
aleave	6.
	head	alone
	or	let well (enough) alone
	syl	a:leave
	def	to be content with the state of things as they are.
let alone	7.
	head	alone
	syl	let alone.
	def	even less.
	exam	1	he can't afford beer, let alone whisky.
along	ety	Old English andlang, from and- against+ lang #7long %1; compare Old Frisian andlinga, Old Saxon antlang #e Usage. See at plus.
along	1.
	syl	a:long
	pron	<*1loG>
	pos	prep.
	def	over or for the length of, esp. in a more or less horizontal plane.
	exam	1	along the road.
along	2.
	syl	a:long
	pron	<*1loG>
	pos	prep.
	def	continuing over the length of some specified thing.
along	3.
	syl	a:long
	pron	<*1loG>
	pos	prep.
	def	in accompaniment; together with some specified person or people.
	exam	1	he says he'd like to come along.
along	4.
	syl	a:long
	pron	<*1loG>
	pos	prep.
	def	forward.
	exam	1	the horse trotted along at a steady pace.
along	5.
	syl	a:long
	pron	<*1loG>
	pos	prep.
	def	to a more advanced state.
	exam	1	he got the work moving along.
along with	6.
	head	along
	syl	along with.
	def	accompanying; together with.
	exam	1	consider the advantages along with the disadvantages.
alongshore	0.
	syl	a:long+shore
	pron	<*2loG1Sc:>
	pos	adv. adj.
	usage	postpositive
	def	close to, by, or along a shore.
alongside	1.
	syl	a:long+side
	pron	<*1loG2sId>
	pos	prep.
	usage	often foll. by of
	def	along the side of; along beside.
	exam	1	alongside the quay.
alongside	2.
	syl	a:long+side
	pron	<*1loG2sId>
	pos	adv.
	def	along the side of some specified thing.
	exam	1	come alongside.
aloof	ety	C16: from #7a -%1#7+ loof, variant of #7luff 
aloof	0.
	syl	a:loof
	pron	<*1lu:f>
	pos	adj.
	def	distant, unsympathetic, or supercilious in manner, attitude, or feeling.
aloofly	sub
	head	aloof
	syl	a:1loof+ly
	pos	adv.
aloofness	sub
	head	aloof
	syl	a:1loof+ness
	pos	n.
alopecia	ety	C14: from Latin, from Greek al*_opekia, originally: mange in foxes, from al*_op*_ex fox
alopecia	0.
	syl	al:o+pe:ci:a
	pron	<2@l*1pESi*>
	pos	n.
	def	loss of hair, esp. on the head; baldness.
Alost	0.
	syl	A:lost
	pron	French <a1lcst>
	pos	n.
	def	a town in central Belgium, in East Flanders province. Pop.: 46659 (1970). Flemish name: {Aalst}.
aloud	1.
	syl	a:loud
	pron	<*1laud>
	pos	adv. adj.
	usage	postpositive
	def	in a normal voice; not in a whisper.
aloud	2.
	syl	a:loud
	pron	<*1laud>
	pos	adv. adj.
	usage	postpositive
	def	in a spoken voice; not silently.
aloud	3.
	syl	a:loud
	pron	<*1laud>
	pos	adv. adj.
	qual	Archaic.
	usage	postpositive
	def	in a loud voice.
alow	0.
	syl	a:low
	pron	<*1l*u>
	pos	adv. adj.
	qual	Nautical.
	usage	postpositive
	def	in or into the lower rigging of a vessel, near the deck.
alp	ety	C14: back formation from Alps 
alp	0.
	syl	alp
	pron	<@lp>
	pos	n.
	def	a high mountain.
alp	xref
	syl	alp
	pron	<@lp>
	pos	n.
	def	See also {Alps}.
ALP	0.
	syl	A.L.P.
	qual	abbrev. for
	def	Australian Labor Party.
alpaca	ety	C18: via Spanish from Aymara allpaca 
alpaca	1.
	syl	al+pac:a
	pron	<@l1p@k*>
	pos	n.
	def	a domesticated cud-chewing artio?!dactyl mammal, closely related to the llama and native to South America: family Its dark shaggy hair is a source of wool and cloth.
alpaca	2.
	syl	al+pac:a
	pron	<@l1p@k*>
	pos	n.
	def	the wool or cloth obtained from this animal.
alpaca	3.
	syl	al+pac:a
	pron	<@l1p@k*>
	pos	n.
	def	a glossy fabric simulating this, used for linings, etc.
alpenglow	ety	partial translation of German Alpengl*"uhen, from Alpen A#7lps+ gl*"uhen to #7glow 
alpenglow	0.
	syl	al:pen+glow
	pron	<1@lp*n2gl*u>
	pos	n.
	def	a reddish light on the summits of snow-covered mountain peaks at sunset or sunrise.
alpenhorn	0.
	syl	al:pen+horn
	pron	<1@lp*n2hc:n>
	pos	n.
	def	another name for {alphorn}.
alpenstock	ety	C19: from German, from Alpen A#7lps+ Stock #7stick 
alpenstock	0.
	syl	al:pen+stock
	pron	<1@lp*n2stok>
	pos	n.
	def	a stout stick with an iron tip used by hikers, mountain climbers, etc.
Alpes-de-Haute-Provence	0.
	syl	Alpes-de-Haute-Pro+vence
	qual	French
	def	alp d$$ ot pr@$#!v*~a$:s) a department of SE France in Provence-C*^ote-d'Azur region. Capital: Digne. Pop.: 115697 (1975). Area: 6988 sq. km (2725 sq. miles). Former name: {Basses-Alpes}.
Alpes Maritimes	0.
	syl	Alpes Ma+ri+times
	qual	French
	def	alp mari#!tim) a department of the SE corner of France in Provence-C*^ote-d'Azur region. Capital: Nice. Pop.: 823731 (1975). Area: 4298 sq. km (1676 sq. miles).
alpestrine	ety	C19: from Medieval Latin alpestris, from Latin Alp*_es the Alps
alpestrine	0.
	syl	al+pes+trine
	pron	<@l1pestrin>
	pos	adj.
	usage	of plants
	def	growing at high altitudes; subalpine.
alpha	ety	via Latin from Greek, of Phoenician origin; related to Hebrew *_aleph, literally: ox
alpha	1.
	syl	al+pha
	pron	<1@lf*>
	pos	n.
	def	the first letter in the Greek alphabet (#GA, #Ga), a vowel transliterated as
alpha	2.
	syl	al+pha
	pron	<1@lf*>
	pos	n.
	qual	Brit.
	def	the highest grade or mark, as in an examination.
alpha	3.a.
	syl	al+pha
	pron	<1@lf*>
	pos	n.
	def	involving or relating to helium nuclei.
	exam	1	an alpha particle.
alpha	3.b.
	syl	al+pha
	pron	<1@lf*>
	pos	n.
	def	relating to one of two or more allotropes or crystal structures of a solid.
	exam	1	alpha iron.
alpha	3.c.
	syl	al+pha
	pron	<1@lf*>
	pos	n.
	def	relating to one of two or more isomeric forms of a chemical compound, esp. one in which a group is attached to the carbon atom to which the principal group is attached.
Alpha	0.
	syl	Al+pha
	pron	<1@lf*>
	pos	n.
	usage	foll. by the genitive case of a specified constellation
	def	usually the brightest star in a constellation.
	exam	1	Alpha Centauri.
alpha and omega	1.
	syl	al+pha and o:me:ga
	pos	n.
	def	the first and last, a phrase used in Revelation 1:8 to signify God's eternity.
alpha and omega	2.
	syl	al+pha and o:me:ga
	pos	n.
	def	the basic reason or meaning; most important part.
alphabet	ety	C15: from Late Latin alphab*_etum, from Greek alphab*_etos, from the first two letters of the Greek alphabet; see #7alpha, beta 
alphabet	1.
	syl	al+pha+bet
	pron	<1@lf*2bet>
	pos	n.
	def	a set of letters or other signs used in a writing system, usually arranged in a fixed order, each letter or sign being used to represent one or sometimes more than one phoneme in the language being transcribed.
alphabet	2.
	syl	al+pha+bet
	pron	<1@lf*2bet>
	pos	n.
	def	any set of symbols or characters, esp. one representing sounds of speech.
alphabet	3.
	syl	al+pha+bet
	pron	<1@lf*2bet>
	pos	n.
	def	basic principles or rudiments, as of a subject.
alphabetic	alt
	head	alphabetical
	or	alphabetical
	syl	al+pha+bet+ic
	pos	adj.
alphabetical	1.
	or	alphabetic
	syl	al+pha+bet:i+cal
	pron	<2@lf*1betikL>
	pos	adj.
	def	in the conventional order of the letters or symbols of an alphabet.
alphabetical	2.
	or	alphabetic
	syl	al+pha+bet:i+cal
	pron	<2@lf*1betikL>
	pos	adj.
	def	of, characterized by, or expressed by an alphabet.
alphabetically	sub
	head	alphabetical
	syl	al+pha+1bet:i+cal+ly
	pos	adv.
alphabetise	alt
	head	alphabetize
	or	alphabetize
	syl	al+pha+bet+ise
	pron	<1@lf*b*2tIz>
	pos	vb.
	mod	tr.
alphabetize	1.
	or	alphabetise
	syl	al+pha+bet+ize
	pron	<1@lf*b*2tIz>
	pos	vb.
	mod	tr.
	def	to arrange in conventional alphabetical order.
alphabetize	2.
	or	alphabetise
	syl	al+pha+bet+ize
	pron	<1@lf*b*2tIz>
	pos	vb.
	mod	tr.
	def	to express by an alphabet.
alphabetization	sub
	head	alphabetize
	or	alphabetisation
	syl	al+pha+bet:i+1za+tion
	pos	n.
alphabetisation	sub
	head	alphabetize
	or	alphabetization
	syl	al+pha+bet:i+1sa+tion
	pos	n.
alphabetizer	sub
	head	alphabetize
	or	alphabetiser
	syl	al+pha+bet+2iz:er
	pos	n.
alphabetiser	sub
	head	alphabetize
	or	alphabetizer
	syl	al+pha+bet+2is+er
	pos	n.
Alpha Centauri	0.
	syl	Al+pha Cen+tau+ri
	pron	<sen1tc:ri>
	pos	n.
	def	a binary star that is the brightest in the constellation Centaurus and is the second nearest star to the sun. Visual magnitude: 0.0 (A), 1.4 (B); spectral type: G4 (A), K1 (B); distance from earth: 4.3 light years. Also called: {Rigil Kent}. See also {Proxima}.
alpha iron	0.
	syl	al+pha i:ron
	pos	n.
	def	a magnetic allotrope of iron that is stable below 910?%C; ferrite.
alphameric	alt
	head	alphanumeric
	or	alphanumeric
	syl	al+pha+mer+ic
	pos	adj.
alphanumeric	0.
	or	alphameric
	syl	al+pha+nu+mer+ic
	pron	<2@lf*nju:1merik>
	pos	adj.
	usage	of a character set, code, or file of data
	def	consisting of alphabetical and numerical symbols.
alphanumerically	sub
	head	alphanumeric
	or	alphamerically
	syl	al+pha+nu+1mer:i+cal+ly
	pos	adv.
alphamerically	sub
	head	alphanumeric
	or	alphanumerically
	syl	al+pha+1mer:i+cal+ly
	pos	adv.
alpha particle	0.
	syl	al+pha par+ti+cle
	pos	n.
	def	a helium nucleus, containing two neutrons and two protons, emitted during some radioactive transforma?!tions.
alpha privative	0.
	syl	al+pha priv:a+tive
	pos	n.
	usage	in Greek grammar
	def	the letter alpha (or before vowels) used as a negative or privative prefix. It appears in English words derived from Greek, as in
alpha ray	0.
	syl	al+pha ray
	pos	n.
	def	ionizing radiation consisting of a stream of alpha particles.
wave	alt
	head	alpha rhythm
	or	alpha rhythm
	syl	wave
	pos	n.
alpha rhythm	0.
	or	wave
	syl	al+pha rhythm
	pos	n.
	qual	Physiol.
	def	the normal bursts of electrical activity from the cerebral cortex of a drowsy or inactive person, occurring at a frequency of 8 to 12 hertz and detectable with an electroencephalograph. See also {brain wave}.
Alpheus	0.
	syl	Al:phe:us
	pron	<@l1fE*s>
	pos	n.
	qual	Greek myth.
	def	a river god, lover of the nymph Arethusa. She changed into a spring to evade him, but he changed into a river and mingled with her.
Alphonsus	0.
	syl	Al+phon+sus
	pron	<@l1fons*s>
	pos	n.
	def	a crater in the SE quadrant of the moon, about 112 kilometres in diameter, in which volcanic activity has been observed.
alphorn	ety	C19: from German Alpenhorn: Alps horn
alpenhorn	alt
	head	alphorn
	or	alphorn
	syl	al:pen+horn
	pos	n.
alphorn	0.
	or	alpenhorn
	syl	alp+horn
	pron	<1@lp2hc:n>
	pos	n.
	qual	Music.
	def	a wind instrument used in the Swiss Alps, consisting of a very long tube of wood or bark with a cornet-like mouthpiece.
alphosis	ety	C19: from New Latin, from Greek alphos leprosy
alphosis	0.
	syl	al+pho+sis
	pron	<@l1f*usis>
	pos	n.
	qual	Pathol.
	def	absence of skin pigmentation, as in albinism.
alpine	1.
	syl	al+pine
	pron	<1@lpIn>
	pos	adj.
	def	of or relating to high mountains.
alpine	2.
	syl	al+pine
	pron	<1@lpIn>
	pos	adj.
	usage	of plants
	def	growing on mountains above the limit for tree growth.
alpine	3.
	syl	al+pine
	pron	<1@lpIn>
	pos	adj.
	def	connected with or used in mountaineering.
alpine	4.
	syl	al+pine
	pron	<1@lpIn>
	pos	adj.
	qual	Skiing.
	def	of or relating to events such as the slalom and downhill.
Alpine	1.
	syl	Al+pine
	pron	<1@lpIn>
	pos	adj.
	def	of or relating to the Alps or their inhabitants.
Alpine	2.
	syl	Al+pine
	pron	<1@lpIn>
	pos	adj.
	qual	Geology.
	def	of or relating to an episode of mountain building in the Tertiary period during which the Alps were formed.
alpinist	0.
	syl	al+pin+ist
	pron	<1@lpinist>
	pos	n.
	def	a mountain climber.
alpinism	sub
	head	alpinist
	syl	al+pin+ism
	pos	n.
Alps	1.
	syl	Alps
	pron	<@lps>
	pos	n.
	mod	pl.
	def	a mountain range in S central Europe, extending over 1000 km (650 miles) from the Mediterranean coast of France and NW Italy through Switzerland, N Italy, and Austria to NW Yugoslavia. Highest peak: Mont Blanc, 4807 m (15771 ft.).
Alps	2.
	syl	Alps
	pron	<@lps>
	pos	n.
	mod	pl.
	def	a range of mountains in the NW quadrant of the moon, which is cut in two by a straight fracture, the {Alpine Valley}.
already	1.
	syl	al+read:y
	pron	<c:l1redi>
	pos	adv.
	def	by or before a stated or implied time.
	exam	1	he is already here.
already	2.
	syl	al+read:y
	pron	<c:l1redi>
	pos	adv.
	def	at a time earlier than expected.
	exam	1	is it ten o'clock already??
alright	0.
	syl	al+right
	pron	<c:l1rIt>
	pos	adv.
	qual	Not standard.
	def	a variant spelling of {all right}.
ALS	0.
	syl	A.L.S.
	qual	abbrev. for
	def	autograph letter signed.
Alsace	0.
	syl	Al+sace
	pron	<@l1s@s>, French <al1zas>
	pos	n.
	def	a region and former province of NE France, between the Vosges mountains and the Rhine: famous for its wines. Area: 8296 sq. km (3203 sq. miles). Ancient name: {Alsatia}. German name: {Elsass}.
Alsace-Lorraine	0.
	syl	Al:sace-Lor:raine
	pos	n.
	def	an area of NE France, comprising the modern regions of Alsace and Lorraine: under German rule 1871-1919 and 1940-44. Area: 14522 sq. km (5607 sq. miles). German name: {Elsass-Lothringen}.
Alsatia	1.
	syl	Al+sa+tia
	pron	<@l1sAS*>
	pos	n.
	def	the ancient name for {Alsace}.
Alsatia	2.
	syl	Al+sa+tia
	pron	<@l1sAS*>
	pos	n.
	def	an area around Whitefriars, London, in the 17th century, which was a sanctuary for criminals and debtors.
Alsatian	1.
	syl	Al+sa+tian
	pron	<@l1sAS*n>
	pos	n.
	def	a large wolflike breed of dog often used as a guard or guide dog and by the police. U.S. name: {German shepherd}.
Alsatian	2.
	syl	Al+sa+tian
	pron	<@l1sAS*n>
	pos	n.
	def	a native or inhabitant of Alsace.
Alsatian	3.
	syl	Al+sa+tian
	pron	<@l1sAS*n>
	pos	n.
	usage	in the 17th century
	def	a criminal or debtor who took refuge in the Whitefriars area of London.
Alsatian	4.
	syl	Al+sa+tian
	pron	<@l1sAS*n>
	pos	adj.
	def	of or relating to Alsace or its inhabitants.
alsike	ety	C19: named after Alsike, Sweden
alsike	0.
	syl	al+sike
	pron	<1@lsIk>, <-sik>, <1c:l->
	pos	n.
	def	a clover, native to Europe and Asia but widely cultivated as a forage crop. It has trifoliate leaves and pink or whitish flowers. Also called: {alsike clover}.
Al Sirat	ety	from Arabic: the road, from Latin via str*_ata paved way
Al Sirat	1.
	syl	Al Si+rat
	pron	<2@l> <si1r@t>
	pos	n.
	qual	Islam.
	def	the correct path of religion.
Al Sirat	2.
	syl	Al Si+rat
	pron	<2@l> <si1r@t>
	pos	n.
	qual	Islam.
	def	the razor-edged bridge by which all who enter paradise must pass.
also	ety	Old English alsw*_a; related to Old High German als*_o, Old Frisian alsa; see #7all, so %1
also	1.
	syl	al:so
	pron	<1c:ls*u>
	pos	adv.
	usage	sentence modifier
	def	in addition; as well; too.
also	2.
	syl	al:so
	pron	<1c:ls*u>
	pos	adv.
	usage	sentence modifier; sentence connector.
	def	besides; moreover.
also-ran	1.
	syl	al:so-ran
	pos	n.
	def	a contestant, horse, etc., failing to finish among the first three in a race.
also-ran	2.
	syl	al:so-ran
	pos	n.
	qual	Informal.
	def	an unsuccessful person; loser or nonentity.
alt	ety	C16: from Proven*,cal, from Latin altus high, deep
alt	1.
	syl	alt
	pron	<@lt>
	pos	adj.
	qual	Music.
	usage	esp. of vocal music
	def	high in pitch.
alt	2.
	syl	alt
	pron	<@lt>
	pos	adj.
	qual	Music.
	def	of or relating to the octave commencing with the G above the top line of the treble staff.
in alt	3.
	head	alt
	syl	in alt.
	qual	Music.
	def	in the octave directly above the treble staff.
alt	1.
	syl	alt.
	qual	abbrev. for:
	def	alternate.
alt	2.
	syl	alt.
	qual	abbrev. for:
	def	altitude.
alt	3.
	syl	alt.
	qual	abbrev. for:
	def	alto.
Alta	0.
	syl	Alta.
	qual	abbrev. for
	def	Alberta.
Altaic	1.
	syl	Al+ta+ic
	pron	<@l1tAik>
	pos	n.
	def	a family of languages of Asia and SE Europe, consisting of the Turkic, Mongolic, and Tungusic branches or subfamilies. See also {Ural-Altaic}.
Altaic	2.
	syl	Al+ta+ic
	pron	<@l1tAik>
	pos	adj.
	def	de?!noting, belonging to, or relating to this linguistic family or its speakers.
Altai Mountains	0.
	syl	Al+tai Moun+tains
	pron	<a:l1tI>
	pos	n.
	mod	pl.
	def	a mountain system of central Asia, in W Mongolia, W China, and the S Soviet Union. Highest peak: Belukha, 4506 m (14783 ft.).
Altair	ety	Arabic, from al the+ t*_a'ir bird
Altair	0.
	syl	Al+tair
	pron	<1@lte*>
	pos	n.
	def	the brightest star in the constellation Aquilla. Visual magnitude: 0.9; spectral type: A5; distance: 15.7 light years.
Altamira	0.
	syl	Al+ta+mi+ra
	pron	Spanish <2alta1mira>
	pos	n.
	def	a cave in N Spain, SW of Santander, noted for Old Stone Age wall drawings.
altar	ety	Old English, from Latin alt*_aria (plural) altar, from altus high
altar	1.
	syl	al+tar
	pron	<1c:lt*>
	pos	n.
	def	a raised place or structure where sacrifices are offered and religious rites performed.
altar	2.
	syl	al+tar
	pron	<1c:lt*>
	pos	n.
	usage	in Christian churches
	def	the communion table.
altar	3.
	syl	al+tar
	pron	<1c:lt*>
	pos	n.
	def	a step in the wall of a dry dock upon which structures supporting a vessel can stand.
lead to the altar	4.
	head	altar
	syl	lead to the altar.
	qual	Informal.
	def	to marry.
altar boy	0.
	syl	al+tar boy
	pos	n.
	qual	R.C. Church, Church of England.
	def	a boy serving as an acolyte.
altarpiece	0.
	syl	al:tar+piece
	pron	<1c:lt*2pEs>
	pos	n.
	def	a work of art set above and behind an altar; a reredos.
altazimuth	ety	C19: from #7alt (#7itude) #7+azimuth 
altazimuth	0.
	syl	alt+az:i+muth
	pron	<@l1t@zim*T>
	pos	n.
	def	an instrument for measuring the altitude and azimuth of a celestial body by the horizontal and vertical rotation of a telescope.
Altdorf	0.
	syl	Alt+dorf
	pron	German <1alt2dcrf>
	pos	n.
	def	a town in central Switzerland, capital of Uri canton: setting of the William Tell legend. Pop: 8647 (1970).
Albrecht	infl
	head	Altdorfer
	syl	Al:brecht
	pron	<1albre*,ct>
	pos	n.
Altdorfer	0.
	syl	Alt:dor:fer
	pron	German <1alt2dcrf*r>
	pos	n.
	def	??1480-??1538, German painter and engraver: one of the earliest landscape painters.
alter	ety	C14: from Old French alterer, from Medieval Latin alter*_are to change, from Latin alter other
alter	1.
	syl	al+ter
	pron	<1c:lt*>
	pos	vb.
	def	to make or become different in some respect; change.
alter	2.
	syl	al+ter
	pron	<1c:lt*>
	pos	vb.
	mod	tr.
	qual	Informal, chiefly U.S.
	def	a euphemistic word for {castrate} or {spay}.
alterable	sub
	head	alter
	syl	al+ter+a:ble
	pos	adj.
alterably	sub
	head	alter
	syl	al+ter+a:bly
	pos	adv.
alterability	sub
	head	alter
	syl	al+ter+a:1bil+i:ty
	pos	n.
alteration	1.
	syl	al+ter:a+tion
	pron	<2c:lt*1rAS*n>
	pos	n.
	def	an adjustment, change, or modification.
alteration	2.
	syl	al+ter:a+tion
	pron	<2c:lt*1rAS*n>
	pos	n.
	def	the act of altering or state of being altered.
alterative	1.
	syl	al+ter:a+tive
	pron	<1c:lt*r*tiv>
	pos	adj.
	def	likely or able to produce alteration.
alterative	2.
	syl	al+ter:a+tive
	pron	<1c:lt*r*tiv>
	pos	adj.
	usage	of a drug
	def	able to restore normal health.
alterative	3.
	syl	al+ter:a+tive
	pron	<1c:lt*r*tiv>
	pos	n.
	def	a drug that restores normal health.
altercate	ety	C16: from Latin alterc*_ar*_i to quarrel with another, from alter other
altercate	0.
	syl	al+ter+cate
	pron	<1c:lt*2kAt>
	pos	vb.
	mod	intr.
	def	to argue, esp. heatedly; dispute.
altercation	0.
	syl	al+ter+ca+tion
	pron	<2c:lt*1kAS*n>
	pos	n.
	def	an angry or heated discussion or quarrel; argument.
altered chord	0.
	syl	al+tered chord
	pos	n.
	qual	Music.
	def	a chord in which one or more notes are chromatically changed by the introduction of accidentals.
alter ego	ety	Latin: other self
alter ego	1.
	syl	al+ter e:go
	pron	<1@lt*r> <1Eg*u>, <1eg*u>
	pos	n.
	def	a second self.
alter ego	2.
	syl	al+ter e:go
	pron	<1@lt*r> <1Eg*u>, <1eg*u>
	pos	n.
	def	a very close and intimate friend.
alternant	ety	C17: from French, from Latin altern*_are to #7alternate 
alternant	0.
	syl	al+ter+nant
	pron	<c:l1tR:n*nt>
	pos	adj.
	def	alternating.
alternate	ety	C16: from Latin altern*_are to do one thing and then another, from alternus one after the other, from alter other
alternate	1.
	syl	al+ter+nate
	pron	<1c:lt*2nAt>
	pos	vb.
	usage	often foll. by with
	def	to occur or cause to occur successively or by turns.
	exam	1	day and night alternate.
alternate	2.
	syl	al+ter+nate
	pron	<1c:lt*2nAt>
	pos	vb.
	mod	intr.
	usage	often foll. by between
	def	to swing repeatedly from one condition, action, etc., to another.
	exam	1	he alternates between success and failure.
alternate	3.
	syl	al+ter+nate
	pron	<1c:lt*2nAt>
	pos	vb.
	mod	tr.
	def	to interchange regularly or in succession.
alternate	4.
	syl	al+ter+nate
	pron	<1c:lt*2nAt>
	pos	vb.
	mod	intr.
	usage	of an electric current, voltage, etc.
	def	to reverse direction or sign at regular intervals, usually sinusoidally, the instantaneous value varying continuously.
alternate	5.
	syl	al+ter+nate
	pron	<1c:lt*2nAt>
	pos	vb.
	mod	intr.
	qual	Theatre.
	usage	often foll. by for
	def	to understudy another actor or actress.
alternate	6.
	syl	al+ter+nate
	pron	<c:l1tR:nit>
	pos	adj.
	def	occurring by turns.
	exam	1	alternate feelings of love and hate.
alternate	7.
	syl	al+ter+nate
	pron	<c:l1tR:nit>
	pos	adj.
	def	every other or second one of a series.
	exam	1	he came to work on alternate days.
alternate	8.
	syl	al+ter+nate
	pron	<c:l1tR:nit>
	pos	adj.
	def	being a second or further choice; alternative.
alternate	9.a.
	syl	al+ter+nate
	pron	<c:l1tR:nit>
	pos	adj.
	usage	of leaves, flowers, etc.
	def	arranged singly at different heights on either side of the stem.
alternate	9.b.
	syl	al+ter+nate
	pron	<c:l1tR:nit>
	pos	adj.
	usage	of parts of a flower
	def	arranged opposite the spaces between other parts. Compare { {opposite} (sense 4)}.
alternate	10.
	syl	al+ter+nate
	pron	<1c:lt*nit>, <c:l1tR:nit>
	pos	n.
	qual	U.S.
	def	a person who substitutes for another in his absence; stand-in.
alternate angles	0.
	syl	al+ter+nate an+gles
	pos	n.
	mod	pl.
	def	two angles at opposite ends and on opposite sides of a transversal cutting two lines.
alternately	0.
	syl	al+ter+nate+ly
	pron	<c:l1tR:nitli>
	pos	adv.
	def	in an alternating sequence or position.
alternating current	0.
	syl	al+ter+nat+ing cur+rent
	pos	n.
	def	a continuous electric current that reverses direction sinusoidally with a frequency independent of the characteristics of the circuit through which it flows. Abbrev.: {a.c}. Compare {direct current}.
alternating-gradient focusing	0.
	syl	al+ter+nat:ing-gra:di:ent fo+cus+ing
	pos	n.
	qual	Physics.
	def	a method of focusing beams of charged particles in high-energy accelerators, in which a series of magnetic or electrostatic lenses alternately converge and diverge the beam, producing a net focusing effect and thus preventing the beam from spreading.
alternation	1.
	syl	al+ter+na+tion
	pron	<2c:lt*1nAS*n>
	pos	n.
	def	successive change from one condition or action to another and back again repeatedly.
alternation	2.
	syl	al+ter+na+tion
	pron	<2c:lt*1nAS*n>
	pos	n.
	qual	Logic.
	def	another name for {{disjunction} (sense 3)}.
alternation of generations	0.
	syl	al+ter+na+tion of gen+er:a+tions
	pos	n.
	def	the production within the life cycle of an organism of alternating asexual and sexual reproductive forms. It occurs in many plants and lower animals. Also called: {metagenesis, heterogenesis, digenesis, xenogenesis}.
alternative	1.
	syl	al+ter+na+tive
	pron	<c:l1tR:n*tiv>
	pos	n.
	def	a possibility of choice, esp. between two things, courses of action, etc.
alternative	2.
	syl	al+ter+na+tive
	pron	<c:l1tR:n*tiv>
	pos	n.
	def	either of such choices.
	exam	1	we took the alternative of walking.
alternative	3.
	syl	al+ter+na+tive
	pron	<c:l1tR:n*tiv>
	pos	adj.
	def	present?!ing a choice, esp. between two possibilities only.
alternative	4.
	syl	al+ter+na+tive
	pron	<c:l1tR:n*tiv>
	pos	adj.
	usage	of two things
	def	mutually exclusive.
alternative	5.
	syl	al+ter+na+tive
	pron	<c:l1tR:n*tiv>
	pos	adj.
	qual	Logic.
	def	another word for { {disjunctive} (sense 3)}.
alternatively	sub
	head	alternative
	syl	al+1ter+na+tive+ly
	pos	adv.
alternativeness	sub
	head	alternative
	syl	al+1ter+na+tive+ness
	pos	n.
alternator	0.
	syl	al+ter+na+tor
	pron	<1c:lt*2nAt*>
	pos	n.
	def	an electrical machine that generates an alternating current.
althaea	ety	C17: from Latin althaea, from Greek althaia marsh mallow (literally: healing plant), from Greek althein to heal
althea	alt
	head	althaea
	or	althaea
	syl	al+the:a
	pron	<@l1TE*>
	pos	n.
	qual	U.S.
althaea	1.
	or	althea
	syl	al+thae:a
	pron	<@l1TE*>
	pos	n.
	def	any Eurasian plant of the malvaceous genus such as the hollyhock, having tall spikes of showy white, yellow, or red flowers.
althaea	2.
	or	althea
	syl	al+thae:a
	pron	<@l1TE*>
	pos	n.
	def	another name for { {rose of Sharon} (sense 2)}.
Althing	0.
	syl	Al+thing
	pron	<1@lTiG>
	pos	n.
	def	the bicameral parliament of Iceland.
althorn	0.
	syl	alt+horn
	pron	<1@lt2hc:n>
	pos	n.
	def	a valved brass musical instrument belonging to the saxhorn or fl*"ugelhorn families.
although	0.
	syl	al+though
	pron	<c:l1D*u>
	pos	conj.
	usage	subordinating
	def	despite the fact that; even though.
	exam	1	although she was ill, she worked hard.
alti-	ety	from Latin altus high
alti-	0.
	syl	al:ti-
	usage	combining form.
	def	indicating height or altitude.
	exam	1	altimeter.
altimeter	0.
	syl	al+tim:e+ter
	pron	<@l1timit*>, <1@lti2mEt*>
	pos	n.
	def	an instrument that indicates height above sea level, esp. one based on an aneroid barometer and fitted to an aircraft.
altimetry	0.
	syl	al+tim+e:try
	pron	<@l1timitri>
	pos	n.
	def	the science of measuring altitudes, as with an altimeter.
altimetrical	sub
	head	altimetry
	syl	al+ti+met+ri+cal
	pron	<2@lti1metrikL>
	pos	adj.
altimetrically	sub
	head	altimetry
	syl	al+ti+1met+ri+cal+ly
	pos	adv.
Altiplano	0.
	syl	Al+ti+pla+no
	pron	Spanish <2alti1plano>
	pos	n.
	def	a plateau of the Andes, covering two thirds of Bolivia and extending into S Peru: contains Lake Titicaca. Height: 3000 m (10000 ft.) to 3900 m (13000 ft.).
altissimo	ety	Italian, literally: highest
altissimo	1.
	syl	al+tis+si+mo
	pron	<@l1tisi2m*u>
	pos	adj.
	usage	of music
	def	very high in pitch.
altissimo	2.
	syl	al+tis+si+mo
	pron	<@l1tisi2m*u>
	pos	adj.
	def	of or relating to the octave commencing on the G lying an octave above the treble clef.
in altissimo	3.
	head	altissimo
	syl	in altissimo.
	def	in the octave commencing an octave above the treble clef.
altitude	ety	C14: from Latin altit*_ud*_o, from altus high, deep
altitude	1.
	syl	al+ti+tude
	pron	<1@lti2tju:d>
	pos	n.
	def	the vertical height of an object above some chosen level, esp. above sea level; elevation.
altitude	2.
	syl	al+ti+tude
	pron	<1@lti2tju:d>
	pos	n.
	qual	Maths.
	def	the perpendicular distance from the base of a figure to the opposite vertex.
altitude	3.
	syl	al+ti+tude
	pron	<1@lti2tju:d>
	pos	n.
	def	Also called: {elevation}. the angular distance of a celestial body from the horizon measured along the vertical circle passing through the body. Compare {{azimuth} (sense 1)}.
altitude	4.
	syl	al+ti+tude
	pron	<1@lti2tju:d>
	pos	n.
	qual	Surveying.
	def	the angle of elevation of a point above the horizontal plane of the observ?!er.
altitude	5.
	syl	al+ti+tude
	pron	<1@lti2tju:d>
	pos	n.
	mod	often; pl.
	def	a high place or region.
altitudinal	sub
	head	altitude
	syl	al+ti+1tu+di+nal
	pos	adj.
alto	ety	C18: from Italian: high, from Latin altus 
altos	infl
	head	alto
	syl	al:tos.
	pos	n.
	mod	pl.
alto	1.
	syl	al:to
	pron	<1@lt*u>
	pos	n.
	def	the lowest female voice, usually having a range approximately from F a fifth below middle C up to D a ninth above it.
alto	2.
	syl	al:to
	pron	<1@lt*u>
	pos	n.
	def	the highest adult male voice; countertenor.
alto	3.
	syl	al:to
	pron	<1@lt*u>
	pos	n.
	def	a singer with such a voice. Compare {contralto}.
alto	4.
	syl	al:to
	pron	<1@lt*u>
	pos	n.
	def	another name for { {viola} %1 (sense 1)}.
alto	5.
	syl	al:to
	pron	<1@lt*u>
	pos	n.
	def	a flute, saxophone, etc., that is the third or fourth highest instrument in its group.
alto	6.
	syl	al:to
	pron	<1@lt*u>
	pos	adj.
	def	denoting a flute, saxophone, etc., that is the third or fourth highest instrument in its group.
alto-	ety	from Latin altus high
alto-	0.
	syl	al:to-
	usage	combining form.
	def	high.
	exam	1	altocumulus;
	exam	2	altostratus.
alto clef	0.
	syl	al:to clef
	pos	n.
	def	the clef that establishes middle C as being on the third line of the staff. Also: {viola clef}. See also {C clef}.
altocumuli	infl
	head	altocumulus
	syl	al:to+cu+mu+li
	pron	<-lI>
	pos	n.
	mod	pl.
altocumulus	0.
	syl	al:to+cu+mu+lus
	pron	<2@lt*u1kju:mjul*s>
	pos	n.
	def	a globular cloud at an intermediate height of about 2400 to 6000 metres (8000 to 20000 feet).
altogether	1.
	syl	al+to+geth+er
	pron	<2c:lt*1geD*>, <1c:lt*2geD*>
	pos	adv.
	def	with everything included.
	exam	1	altogether he owed me sixty pounds.
altogether	2.
	syl	al+to+geth+er
	pron	<2c:lt*1geD*>, <1c:lt*2geD*>
	pos	adv.
	def	completely; utterly; totally.
	exam	1	he was altogether mad.
altogether	3.
	syl	al+to+geth+er
	pron	<2c:lt*1geD*>, <1c:lt*2geD*>
	pos	adv.
	def	on the whole.
	exam	1	altogether it was a very good party.
in the altogether	4.
	head	altogether
	syl	in the altogether.
	qual	Informal.
	def	naked.
alto horn	0.
	syl	al:to horn
	pos	n.
	def	another term for {althorn}.
Altona	0.
	syl	Al+to+na
	pron	<@l1t*un*>, German <1altona>
	pos	n.
	def	a port in N West Germany: part of Hamburg since 1937.
alto-relievo	ety	C18: from Italian
alto-rilievo	alt
	head	alto-relievo
	or	alto-relievo
	syl	al:to-ri:lie:vo
	pron	<2@lt*uri1lEv*u>
	pos	n.
alto-relievos	infl
	head	alto-relievo
	syl	al:to-re:lie:vos.
	pos	n.
	mod	pl.
alto-relievo	0.
	or	alto-rilievo
	syl	al:to-re:lie:vo
	pron	<2@lt*uri1lEv*u>
	pos	n.
	def	another name for {high relief}.
ti	infl
	head	altostratus
	syl	+ti
	pron	<-tI>
	pos	n.
	mod	pl.
altostratus	0.
	syl	al+to+stra+tus
	pron	<2@lt*u1strAt*s>, <-1stra:->
	pos	n.
	def	a layer cloud at an intermediate height of about 2400 to 6000 metres (8000 to 20000 feet).
altricial	ety	C19: from New Latin altrici*_alis, from Latin altrix a nurse, from alere to nourish
altricial	1.
	syl	al+tri+cial
	pron	<@l1triS*l>
	pos	adj.
	usage	of young birds after hatching
	def	naked, blind, and dependent on the parents for food.
altricial	2.
	syl	al+tri+cial
	pron	<@l1triS*l>
	pos	n.
	def	an altricial bird, such as a pigeon.
altricial	xref
	syl	al+tri+cial
	pron	<@l1triS*l>
	pos	adj.
	def	Compare {precocial}.
Altrincham	0.
	syl	Al+trin+cham
	pron	<1c:ltriG*m>
	pos	n.
	def	a residential town in NW England, in Greater Manchester. Pop.: 40752 (1971).
altruism	ety	C19: from French altruisme, from Italian altrui others, from Latin alter*_i, plural of alter other
altruism	0.
	syl	al+tru+ism
	pron	<1@ltru:2iz*m>
	pos	n.
	def	the principle or practice of un?!selfish concern for the welfare of others. Compare {egoism}.
altruist	sub
	head	altruism
	syl	al+tru+ist
	pos	n.
altruistic	sub
	head	altruism
	syl	al+tru+1is+tic
	pos	adj.
altruistically	sub
	head	altruism
	syl	al+tru+1is+ti+cal+ly
	pos	adv.
ALU	0.
	syl	ALU
	qual	Computer technol. abbrev. for
	def	arithmetical and logical unit.
aludel	ety	C16: via Old French from Spanish, from Arabic al-uth*_al the vessel
aludel	0.
	syl	al:u+del
	pron	<1@lju2del>
	pos	n.
	qual	Chem.
	def	a pear-shaped vessel, open at both ends, formerly used with similar vessels for collecting condensates, esp. of subliming mercury.
alula	ety	C18: New Latin: a little wing, from Latin *_ala a wing
alulae	infl
	head	alula
	syl	al:u+lae
	pron	<-lE>
	pos	n.
	mod	pl.
alula	0.
	syl	al:u+la
	pron	<1@ljul*>
	pos	n.
	def	another name for {bastard wing}.
alular	sub
	head	alula
	syl	al:u+lar
	pos	adj.
alum	ety	C14: from Old French, from Latin al*_umen 
alum	1.
	syl	al:um
	pron	<1@l*m>
	pos	n.
	def	Also called: {potash alum}. a colourless soluble hydrated double sulphate of aluminium and potassium used in the manufacture of mordants and pigments, in dressing leather and sizing paper, and in medicine as a styptic and astringent. Formula: KAl(SO\4)\2.12H\2O.
alum	2.
	syl	al:um
	pron	<1@l*m>
	pos	n.
	def	any of a group of isomorphic double sulphates of a monovalent metal or group and a trivalent metal. Formula: XY(SO\4)\2.12H\2O, where X is monovalent and Y is trivalent.
alum	0.
	syl	alum.
	qual	abbrev. for
	def	aluminium.
alumina	ety	C18: from New Latin, plural of Latin al*_umen #7alum 
alumina	0.
	syl	a:lu+mi+na
	pron	<*1lu:min*>
	pos	n.
	def	another name for {aluminium oxide}.
aluminate	0.
	syl	a:lu+mi+nate
	pron	<*1lu:minAt>
	pos	n.
	def	a salt of the ortho or meta acid forms of aluminium hydroxide containing the ions AlO%#-@b\2#800027 or AlO%3@b\3%#-#800028 .
aluminiferous	0.
	syl	a:lu+mi+nif+er+ous
	pron	<*2lu:mi1nif*r*s>
	pos	adj.
	def	containing or yielding aluminium or alumina.
aluminum	alt
	head	aluminium
	or	aluminium
	syl	a:lu+mi+num
	pron	<*1lu:mi?!n*m>
	pos	n.
	qual	U.S.
aluminium	0.
	or	aluminum
	syl	al:u+min+i:um
	pron	<2@lju1mini*m>
	pos	n.
	def	a light malleable ductile silvery-white metallic element that resists corrosion; the third most abundant element in the earth's crust (8.1 per cent), occurring only as a compound, principally in bauxite. It is used, esp. in the form of its alloys, in aircraft parts, kitchen utensils, etc. Symbol: Al; atomic no.: 13; atomic wt.: 26.981; valency: 3; relative density: 2.699; melting pt.: 660.2?%C; boiling pt.: 2467?%C.
aluminium hydroxide	0.
	syl	a:lu+min+i:um hy+drox+ide
	pos	n.
	def	a white crystalline powder derived from bauxite and used in the manufacture of glass and ceramics, aluminium and its salts, and in dyeing. Formula: Al(OH)\3 or Al\2O\3.3H\2O.
aluminium oxide	0.
	syl	a:lu+min+i:um ox+ide
	pos	n.
	def	a white or colourless insoluble powder occurring naturally as corundum and used in the production of aluminium and its compounds, abrasives, glass, and ceramics. Formula: Al\2O\3. #800029 Also called: {alumina}. See also {activated alumina}.
aluminium sulphate	0.
	syl	a:lu+min+i:um sul+phate
	pos	n.
	def	a white crystalline salt used in the paper, textile, and dyeing industries and in the purification of water. Formula: Al\2(SO\4)\3.
aluminise	alt
	head	aluminize
	or	aluminize
	syl	a:lu+mi+nise
	pron	<*1lu:mi2nIz>
	pos	vb.
	mod	tr.
aluminize	0.
	or	aluminise
	syl	a:lu+mi+nize
	pron	<*1lu:mi2nIz>
	pos	vb.
	mod	tr.
	def	to cover with aluminium or aluminium paint.
aluminothermy	0.
	syl	a:lu+mi+no+ther+my
	pron	<*2lu:min*u1TR:mi>
	pos	n.
	def	a process for reducing metallic oxides using finely divided aluminium powder. The mixture of aluminium and oxide is ignited, causing the aluminium to be oxidized and the metal oxide to be reduced to the metal. Also called: {thermite process}.
aluminous	1.
	syl	a:lu+mi+nous
	pron	<*1lu:mi?!n*s>
	pos	adj.
	def	resembling aluminium.
aluminous	2.
	syl	a:lu+mi+nous
	pron	<*1lu:mi?!n*s>
	pos	adj.
	def	another word for {aluminiferous}.
aluminosity	sub
	head	aluminous
	syl	a:lu+mi+nos+i:ty
	pron	<*2lu:mi1nositi>
	pos	n.
alumnus	ety	C17: from Latin: nursling, pupil, foster-son, from alere to nourish
alumna	alt
	head	alumnus
	or	alumnus
	syl	a:lum+na
	pron	<*1l^mn*>
	pos	n.
	mod	fem.
alumni	infl
	head	alumnus
	or	alumnae
	syl	a:lum+ni
	pron	<-nI>
	pos	n.
	mod	pl.
alumnae	infl
	head	alumnus
	or	alumni
	syl	a:lum+nae
	pron	<-nE>
	pos	n.
	mod	pl.
alumnus	0.
	or	alumna
	syl	a:lum+nus
	pron	<*1l^mn*s>
	pos	n.
	qual	Chiefly U.S.
	def	a graduate of a school, college, etc.
alumroot	1.
	syl	al:um+root
	pron	<1@l*m2ru:t>
	pos	n.
	def	any of several North American plants of the saxifragaceous genus having small white, reddish, or green bell-shaped flowers and astringent roots.
alumroot	2.
	syl	al:um+root
	pron	<1@l*m2ru:t>
	pos	n.
	def	the root of such a plant.
Alundum	0.
	syl	A:lun+dum
	pron	<*1l^nd*m>
	pos	n.
	qual	Trademark.
	def	a hard material composed of fused alumina, used as an abrasive and a refractory.
alunite	ety	C19: from French alun alum (from Latin al*_umen) + -#7ite %1
alunite	0.
	syl	al:u+nite
	pron	<1@lju2nIt>
	pos	n.
	def	a white, grey, or reddish mineral consisting of hydrated aluminium sulphate. It occurs in volcanic igneous rocks and is a source of potassium and aluminium compounds. Formula: KAl\3(SO\4)\2(OH)\6.
Alba	alt
	head	Alva
	or	Alva
	syl	Al:ba
	pron	Spanish <1al$Ba>
	pos	n.
Duke of	infl
	head	Alva
	syl	Duke of
	pos	n.
Alva	0.
	or	Alba
	syl	Al:va
	pron	Spanish <1al$Ba>
	pos	n.
	def	title of 1508-82, Spanish general and statesman who suppressed the Protestant revolt in the Netherlands (1567-72) and conquered Portugal (1580).
alveolar	1.
	syl	al+ve:o+lar
	pron	<@l1vi*l*>, <2@lvi1*ul*>
	pos	adj.
	qual	Anatomy.
	def	of, relating to, or resembling an alveolus.
alveolar	2.
	syl	al+ve:o+lar
	pron	<@l1vi*l*>, <2@lvi1*ul*>
	pos	adj.
	def	denoting the part of the jawbone containing the roots of the teeth.
alveolar	3.
	syl	al+ve:o+lar
	pron	<@l1vi*l*>, <2@lvi1*ul*>
	pos	adj.
	usage	of a consonant
	def	articulat?!ed with the tongue in contact with the projecting part of the jawbone immediately behind the upper teeth.
alveolar	4.
	syl	al+ve:o+lar
	pron	<@l1vi*l*>, <2@lvi1*ul*>
	pos	n.
	def	an alveolar consonant, such as the speech sounds written and in English.
alveolate	ety	C19: from Late Latin alveol*_atus forming a channel, hollowed, from Latin: #7alveolus 
alveolate	1.
	syl	al+ve:o+late
	pron	<@l1vi*lit>, <-2lAt>
	pos	adj.
	def	having many alveoli.
alveolate	2.
	syl	al+ve:o+late
	pron	<@l1vi*lit>, <-2lAt>
	pos	adj.
	def	resembling the deep pits of a honeycomb.
alveolation	sub
	head	alveolate
	syl	al+ve:o+1la+tion
	pos	n.
alveolus	ety	C18: from Latin: a little hollow, diminutive of alveus 
alveoli	infl
	head	alveolus
	syl	al+ve:o+li
	pron	<-2lI>
	pos	n.
	mod	pl.
alveolus	1.
	syl	al+ve:o+lus
	pron	<@l1vi*l*s>
	pos	n.
	def	any small pit, cavity, or saclike dilation, such as a honeycomb cell.
alveolus	2.
	syl	al+ve:o+lus
	pron	<@l1vi*l*s>
	pos	n.
	def	any of the sockets in which the roots of the teeth are embedded.
alveolus	3.
	syl	al+ve:o+lus
	pron	<@l1vi*l*s>
	pos	n.
	def	any of the tiny air sacs in the lungs at the end of the bronchioles, through which oxygen is taken into the blood.
alvine	ety	C18: from Latin alvus belly
alvine	0.
	syl	al+vine
	pron	<1@lvin>, <-vIn>
	pos	adj.
	qual	Obsolete.
	def	of or relating to the intestines or belly.
always	ety	C13 alles weiss, from Old English ealne weg, literally: all the way; see #7all, way 
always	1.
	syl	al+ways
	pron	<1c:lwAz>, <-wiz>
	pos	adv.
	def	without exception; on every occasion; every time.
	exam	1	he always arrives on time.
always	2.
	syl	al+ways
	pron	<1c:lwAz>, <-wiz>
	pos	adv.
	def	continually; repeatedly.
always	3.
	syl	al+ways
	pron	<1c:lwAz>, <-wiz>
	pos	adv.
	def	in any case.
	exam	1	you could always take a day off work.
for always	4.
	head	always
	syl	for always.
	qual	Informal.
	def	for ever; without end.
	exam	1	our marriage is for always.
alyssum	ety	C16: from New Latin, from Greek alusson, from alussos (adj.) curing rabies, referring to the ancient belief in the plant's healing properties
alyssum	0.
	syl	a:lys+sum
	pron	<1@lis*m>
	pos	n.
	def	any widely cultivated herbaceous garden plant of the genus having clusters of small yellow or white flowers: family (crucifers). See also {sweet alyssum}.
am	ety	Old English eam; related to Old Norse em, Gothic im, Old High German bim, Latin sum, Greek eimi, Sanskrit asmi 
am	0.
	syl	am
	pron	<@m>, <unstressed> <*m>
	pos	vb.
	qual	I
	usage	used with
	def	a form of the present tense (indicative mood) of {be}.
Am	0.
	syl	Am
	usage	the chemical symbol for
	def	americium.
am	alt
	head	AM
	or	AM
	syl	am
AM	0.
	or	am
	syl	AM
	qual	abbrev. for
	def	amplitude modulation.
Am	0.
	syl	Am.
	qual	abbrev. for
	def	America(n).
am	ety	Latin: before noon Compare p.m.
AM	alt
	head	am
	or	am
	syl	A.M.
am	0.
	or	AM
	syl	a.m.
	qual	abbrev. for
	usage	indicating the time period from midnight to midday
	def	ante meridiem.
AM	1.
	syl	A.M.
	qual	abbrev. for:
	def	associate member.
AM	2.
	syl	A.M.
	qual	abbrev. for:
	def	Albert Medal.
AM	3.
	syl	A.M.
	qual	abbrev. for:
	usage	in the U.S.
	def	Master of Arts.
AMA	0.
	syl	A.M.A.
	qual	abbrev. for
	def	American Medical Association.
amadavat	0.
	syl	am:a+da+vat
	pron	<2@m*d*1v@t>
	pos	n.
	def	another name for {avadavat}.
amadou	ety	C18: from French, from Proven*,cal: lover, from Latin am*_ator, from am*_are to love; so called because it readily ignites
amadou	0.
	syl	am:a+dou
	pron	<1@m*2du:>
	pos	n.
	def	a spongy substance made from certain fungi, such as (or and related species, used as tinder to light fires and in medicine to stop bleeding.
Amagasaki	0.
	syl	A:ma+ga+sa+ki
	pron	<*2ma:g*1sa:ki>
	pos	n.
	def	an industrial city in Japan, in W Honshu, on Osaka Bay. Pop.: 537781 (1974 est.).
amah	ety	C19: from Portuguese ama nurse, wet nurse
amah	0.
	syl	a:mah
	pron	<1a:m*>, <1@m*>
	pos	n.
	usage	in the East, esp. formerly
	def	a nurse or maidservant.
amain	ety	C16: from #7a -%2#7+#7main %1
amain	0.
	syl	a:main
	pron	<*1mAn>
	pos	adv.
	qual	Archaic or poetic.
	def	with great strength, speed, or haste.
Amalekite	0.
	syl	Am:a+lek+ite
	pron	<*1m@l*2kIt>
	pos	n.
	qual	Old Testament.
	def	a member of a nomadic tribe descended from Esau (Genesis 36:12), dwelling in the desert between Sinai and Canaan and hostile to the Israelites: they were defeated by Saul and destroyed by David (I Samuel 15-30).
amalgam	ety	C15: from Medieval Latin amalgama, of obscure origin
amalgam	1.
	syl	a:mal+gam
	pron	<*1m@lg*m>
	pos	n.
	def	an alloy of mercury with another metal, esp. with silver.
	exam	1	dental amalgam.
amalgam	2.
	syl	a:mal+gam
	pron	<*1m@lg*m>
	pos	n.
	def	a rare white metallic mineral that consists of silver and mercury and occurs in deposits of silver and cinnabar.
amalgam	3.
	syl	a:mal+gam
	pron	<*1m@lg*m>
	pos	n.
	def	a blend or combination.
amalgamate	1.
	syl	a:mal+gam+ate
	pron	<*1m@lg*2mAt>
	pos	vb.
	def	to combine or cause to combine; unite.
amalgamate	2.
	syl	a:mal+gam+ate
	pron	<*1m@lg*2mAt>
	pos	vb.
	def	to alloy (a metal) with mercury.
amalgamation	1.
	syl	a:mal+gam:a+tion
	pron	<*2m@lg*1mAS*n>
	pos	n.
	def	the action or process of amalgamating.
amalgamation	2.
	syl	a:mal+gam:a+tion
	pron	<*2m@lg*1mAS*n>
	pos	n.
	def	the state of being amalgamated.
amalgamation	3.
	syl	a:mal+gam:a+tion
	pron	<*2m@lg*1mAS*n>
	pos	n.
	def	a method of extracting precious metals from their ores by treatment with mercury to form an amalgam.
amalgamation	4.
	syl	a:mal+gam:a+tion
	pron	<*2m@lg*1mAS*n>
	pos	n.
	qual	Commerce.
	def	another word for { {merger} (sense 1)}.
Amalthea	0.a.
	syl	A:mal:the:a
	pron	<2@m@l1TE*>
	pos	n.
	qual	Greek myth.
	def	a nymph who brought up the infant Zeus on goat's milk.
Amalthea	0.b.
	syl	A:mal:the:a
	pron	<2@m@l1TE*>
	pos	n.
	qual	Greek myth.
	def	the goat itself. Also: {Amaltheia}.
amanita	ety	C19: from Greek amanitai (plural) a variety of fungus
amanita	0.
	syl	am:a+ni+ta
	pron	<2@m*1nIt*>
	pos	n.
	def	any of various saprophytic agaricaceous fungi constituting the genus having white gills and a broken membranous ring (volva) around the stalk. The genus includes several highly poisonous species, such as death cap, destroying angel, and fly agaric.
amanuensis	ety	C17: from Latin *_amanuensis, from the phrase servus *_a man*_u slave at hand (that is, handwriting)
amanuenses	infl
	head	amanuensis
	syl	a:man:u+en+ses
	pron	<-sEz>
	pos	n.
	mod	pl.
amanuensis	0.
	syl	a:man:u+en+sis
	pron	<*2m@nju1ensis>
	pos	n.
	def	a person employed to take dictation or to copy manuscripts.
Amap'a	0.
	syl	A:ma+p*'a
	pron	Portuguese <2*ma1pa>
	pos	n.
	def	a territory of N Brazil, on the Amazon delta. Capital: Macap*'a. Pop.: 114359 (1970). Area: 143716 sq. km (55489 sq. miles).
amaranth	ety	C17: from Latin amarantus, from Greek amarantos unfading, from #7a -%1#7+ marainein to fade
amaranth	1.
	syl	am:a+ranth
	pron	<1@m*2r@nT>
	pos	n.
	qual	Poetic.
	def	an imaginary flower that never fades.
amaranth	2.
	syl	am:a+ranth
	pron	<1@m*2r@nT>
	pos	n.
	def	any of numerous tropical and temperate plants of the genus having tassel-like heads of small green, red, or purple flowers: family See also {love-lies-bleeding, tumbleweed, {pigweed} (sense 1)}.
amaranthaceous	0.
	syl	am:a+ran+tha+ceous
	pron	<2@m*r@n1TAS*s>
	pos	adj.
	def	of, relating to, or belonging to the (or a family of tropical and temperate herbaceous or shrubby flowering plants that includes the amaranths and cockscomb.
amaranthine	1.
	syl	am:a+ran+thine
	pron	<2@m*1r@nTIn>
	pos	adj.
	def	of a dark reddish-purple colour.
amaranthine	2.
	syl	am:a+ran+thine
	pron	<2@m*1r@nTIn>
	pos	adj.
	def	of or resembling the amaranth.
amarelle	ety	C20: from German, from Medieval Latin am*_arellum, from Latin am*_arus bitter; compare #7morello 
amarelle	0.
	syl	am:a+relle
	pron	<1@m*2rel>
	pos	n.
	def	a variety of sour cherry that has pale red fruit and colourless juice. Compare {morello}.
Amarillo	0.
	syl	Am:a+ril+lo
	pron	<2@m*1ril*u>
	pos	n.
	def	an industrial city in NW Texas. Pop.: 129808 (1973 est.).
amaryllidaceous	0.
	syl	am:a+ryl+li+da+ceous
	pron	<2@m*2rili1dAS*s>
	pos	adj.
	def	of, relating to, or belonging to the a tropical and subtropical family of widely cultivated flowering plants having bulbs and including the amaryllis, snowdrop, narcissus, and daffodil.
amaryllis	ety	C18: from New Latin, from Latin: named after A#7maryllis 
amaryllis	1.
	syl	am:a+ryl+lis
	pron	<2@m*1rilis>
	pos	n.
	def	Also called: {belladonna lily}. an amaryllidaceous plant, native to southern Africa and having large lily-like reddish or white flowers.
amaryllis	2.
	syl	am:a+ryl+lis
	pron	<2@m*1rilis>
	pos	n.
	def	any of several related plants.
Amaryllis	0.
	syl	Am:a+ryl+lis
	pron	<2@m*1rilis>
	pos	n.
	usage	in pastoral poetry
	def	a name for a shepherdess or country girl.
amass	ety	C15: from Old French amasser, from masse #7mass 
amass	1.
	syl	a:mass
	pron	<*1m@s>
	pos	vb.
	mod	tr.
	def	to accumulate or collect (esp. riches, etc.).
amass	2.
	syl	a:mass
	pron	<*1m@s>
	pos	vb.
	def	to gather in a heap; bring together.
amasser	sub
	head	amass
	syl	a:1mass+er
	pos	n.
amateur	ety	C18: from French, from Latin am*_ator lover, from am*_are to love
amateur	1.
	syl	am:a+teur
	pron	<1@m*t*>, <-C*>, <-2tju*> <2@m*1tR:>
	pos	n.
	def	a person who engages in an activity, esp. a sport, as a pastime rather than professionally or for gain.
amateur	2.
	syl	am:a+teur
	pron	<1@m*t*>, <-C*>, <-2tju*> <2@m*1tR:>
	pos	n.
	def	an athlete or sportsman.
amateur	3.
	syl	am:a+teur
	pron	<1@m*t*>, <-C*>, <-2tju*> <2@m*1tR:>
	pos	n.
	def	a person unskilled in or having only a superficial knowledge of a subject or activity.
amateur	4.
	syl	am:a+teur
	pron	<1@m*t*>, <-C*>, <-2tju*> <2@m*1tR:>
	pos	n.
	def	a person who is fond of or admires something.
amateur	5.
	syl	am:a+teur
	pron	<1@m*t*>, <-C*>, <-2tju*> <2@m*1tR:>
	pos	n.
	usage	modifier
	def	consisting of or for amateurs.
	exam	1	an amateur event.
amateur	6.
	syl	am:a+teur
	pron	<1@m*t*>, <-C*>, <-2tju*> <2@m*1tR:>
	pos	adj.
	def	amateurish; not professional or expert.
	exam	1	an amateur approach.
amateurism	sub
	head	amateur
	syl	am:a+teur+ism
	pos	n.
amateurish	0.
	syl	am:a+teur+ish
	pron	<1@m*t*riS>, <-C*r-> <-2Cu*r-> <2@m*1tR:riS>
	pos	adj.
	def	lacking professional skill or expertise.
amateurishly	sub
	head	amateurish
	syl	am:a+teur+ish+ly
	pos	adv.
amateurishness	sub
	head	amateurish
	syl	am:a+teur+ish+ness
	pos	n.
Amati	1.
	syl	A:ma:ti
	pron	Italian <a1ma:ti>
	pos	n.
	def	a family of Italian violin makers, active in Cremona in the 16th and 17th centuries, esp. {Ni@.co@.l*`o} (niko#!l@$), 1596-1684, who taught Guarneri and Stradivari.
Amati	2.
	syl	A:ma:ti
	pron	Italian <a1ma:ti>
	pos	n.
	def	a violin or other stringed instrument made by any member of this family.
amative	ety	C17: from Medieval Latin am*_at*_ivus, from Latin am*_are to love
amative	0.
	syl	am:a+tive
	pron	<1@m*tiv>
	pos	adj.
	def	a rare word for {amorous}.
amatively	sub
	head	amative
	syl	am:a+tive+ly
	pos	adv.
amativeness	sub
	head	amative
	syl	am:a+tive+ness
	pos	n.
amatol	ety	C20: from #7am (#7monium) #7+ (#7trinitro) #7tol (#7uene) 
amatol	0.
	syl	am:a+tol
	pron	<1@m*2tol>
	pos	n.
	def	an explosive mixture of ammonium nitrate and TNT, used in shells and bombs.
amatory	ety	C16: from Latin am*_at*_orius, from am*_are to love
amatorial	alt
	head	amatory
	or	amatory
	syl	am:a+to+ri:al
	pos	adj.
amatory	0.
	or	amatorial
	syl	am:a+to:ry
	pron	<1@m*t*ri>
	pos	adj.
	def	of, relating to, or inciting sexual love or desire.
amaurosis	ety	C17: via New Latin from Greek: darkening, from amauroun to dim, darken
amaurosis	0.
	syl	am:au+ro+sis
	pron	<2@mc:1r*usis>
	pos	n.
	qual	Pathol.
	def	blindness, esp. when occurring without observable damage to the eye.
amaurotic	sub
	head	amaurosis
	syl	am:au+rot+ic
	pron	<2@mc:1rotik>
	pos	adj.
amaut	ety	from Eskimo
amowt	alt
	head	amaut
	or	amaut
	syl	a:mowt
	pron	<*1maut>
	pos	n.
amaut	0.
	or	amowt
	syl	a:maut
	pron	<*1maut>
	pos	n.
	qual	Canadian.
	def	a hood on an Eskimo woman's parka for carrying a child.
amaze	ety	Old English *_amasian; see #7maze 
amaze	1.
	syl	a:maze
	pron	<*1mAz>
	pos	vb.
	mod	tr.
	def	to fill with incredulity or surprise; astonish.
amaze	2.
	syl	a:maze
	pron	<*1mAz>
	pos	vb.
	mod	tr.
	def	an obsolete word for {bewilder}.
amaze	3.
	syl	a:maze
	pron	<*1mAz>
	pos	n.
	mod	tr.
	def	an archaic word for {amazement}.
amazement	1.
	syl	a:maze+ment
	pron	<*1mAzm*nt>
	pos	n.
	def	incredulity or great astonish?!ment; complete wonder or surprise.
amazement	2.
	syl	a:maze+ment
	pron	<*1mAzm*nt>
	pos	n.
	qual	Obsolete.
	def	bewilderment or consternation.
amazing	0.
	syl	a:maz+ing
	pron	<*1mAziG>
	pos	adj.
	def	causing wonder or astonishment.
	exam	1	amazing feats.
amazingly	sub
	head	amazing
	syl	a:1maz+ing+ly
	pos	adv.
amazon	0.
	syl	am:a+zon
	pron	<1@m*zN>
	pos	n.
	def	any of various tropical American parrots of the genus such as (green amazon), having a short tail and mainly green plumage.
Amazon	ety	C14: via Latin from Greek Amaz*_on, of uncertain origin
Amazon	H1.1.
	syl	Am:a+zon
	pron	<1@m*zN>
	pos	n.
	qual	Greek myth.
	def	one of a race of women warriors of Scythia near the Black Sea.
Amazon	H1.2.
	syl	Am:a+zon
	pron	<1@m*zN>
	pos	n.
	def	one of a legendary tribe of female warriors of South America.
Amazon	H1.3.
	syl	Am:a+zon
	pron	<1@m*zN>
	pos	n.
	usage	often not cap.
	def	any tall, strong, or aggressive woman.
Amazonian	sub
	head	Amazon
	syl	Am:a+zo+ni:an
	pron	<2@m*?!1z*uni*n>
	pos	adj.
Amazon	H2.0.
	syl	Am:a+zon
	pron	<1@m*zN>
	pos	n.
	def	a river in South America, rising in the Peruvian Andes and flowing east through N Brazil to the Atlantic: in volume, the largest river in the world; navigable for 3700 km (2300 miles). Length: over 6440 km (4000 miles). Area of basin: over 5827500 sq. km (2250000 sq. miles).
Amazonian	sub
	head	Amazon
	syl	Am:a+zo+ni:an
	pron	<2@m*1z*uni*n>
	pos	adj.
amazon ant	0.
	syl	am:a+zon ant
	pos	n.
	def	any of several small reddish ants of the genus esp. that enslave the young of other ant species.
Amazonas	0.
	syl	A:ma+zo+nas
	pron	<2@m*1z*un*s>
	pos	n.
	def	a state of W Brazil, consisting of the central Amazon basin: vast areas of unexplored tropical rain-forest. Capital: Manaus. Pop.: 955235 (1970). Area: 1542277 sq. km (595474 sq. miles).
amazonite	0.
	syl	am:a+zon+ite
	pron	<1@m*z*2nIt>
	pos	n.
	def	a green variety of microcline used as a gemstone. Formula: KAlSi\3O\8. Also called: {Amazon stone}.
ambage	ety	C14: via Old French from Latin amb*_ages a going around, from ambi- around+ agere to lead
ambages	infl
	head	ambage
	syl	am+bag:es
	pron	<1@mbiJiz>, <@m1bAJEz>
	pos	n.
	mod	pl.
ambage	0.
	syl	am+bage
	pron	<1@mbiJ>
	pos	n.
	qual	Archaic. (often pl.
	def	circuitous, secret, or tortuous paths, ways, thoughts, etc.
ambagious	sub
	head	ambage
	syl	am+ba+gious
	pron	<@m1bAJ*s>
	pos	adj.
Ambala	0.
	syl	Am+ba+la
	pron	<*m1ba:l*>
	pos	n.
	def	a city in N India, in Haryana: site of archaeological remains of a prehistoric Indian civilization. Pop.: 102493 (1971).
ambary	ety	C20: from Hindi amb*_ar*_i 
ambari	alt
	head	ambary
	or	ambary
	syl	am+ba+ri
	pron	<@m1ba:ri>
	pos	n.
ambaries	infl
	head	ambary
	or	ambaris
	syl	am+ba+ries
	pos	n.
	mod	pl.
ambaris	infl
	head	ambary
	or	ambaries
	syl	am+ba+ris.
	pos	n.
	mod	pl.
ambary	1.
	or	ambari
	syl	am+ba+ry
	pron	<@m1ba:ri>
	pos	n.
	def	a tropical Asian malvaceous plant, that yields a fibre similar to jute.
ambary	2.
	or	ambari
	syl	am+ba+ry
	pron	<@m1ba:ri>
	pos	n.
	def	the fibre derived from this plant.
ambary	xref
	or	ambari
	syl	am+ba+ry
	pron	<@m1ba:ri>
	pos	n.
	def	Also called: {kenaf}.
ambassador	ety	C14: from Old French ambassadeur, from Italian ambasciator, from Old Proven*,cal ambaisador, from ambaisa (unattested) mission, errand; see #7embassy 
ambassador	1.
	syl	am+bas+sa+dor
	pron	<@m1b@s*d*>
	pos	n.
	def	short for {ambassador extraordinary and plenipotentiary}; a diplomatic minister of the highest rank, accredited as permanent representative to another country or sovereign.
ambassador extraordinary	2.
	head	ambassador
	syl	ambassador extraordinary.
	def	a diplomatic minister of the highest rank sent on a special mission.
ambassador plenipotentiary	3.
	head	ambassador
	syl	ambassador plenipotentiary.
	def	a diplomatic minister of the first rank with treaty-signing powers.
ambassador-at-large	4.
	head	ambassador
	syl	ambassador-at-large.
	qual	U.S.
	def	an ambassador with special duties who may be sent to more than one government.
ambassador	5.
	syl	am+bas+sa+dor
	pron	<@m1b@s*d*>
	pos	n.
	def	an authorized representative or messenger.
ambassadress	sub
	head	ambassador
	syl	am+1bas+sa+dress
	pos	n.
	mod	fem.
ambassadorial	sub
	head	ambassador
	syl	am+bas+sa+dor+i:al
	pron	<@m2b@s*1dc:ri*l>
	pos	adj.
ambassadorship	sub
	head	ambassador
	syl	am+1bas+sa+dor+2ship
	pos	n.
amber	ety	C14: from Medieval Latin ambra, from Arabic `anbar ambergris
amber	1.a.
	syl	am+ber
	pron	<1@mb*>
	pos	n.
	def	a yellow or yellowish-brown hard translucent fossil resin derived from extinct coniferous trees that occurs in Tertiary deposits and often contains trapped insects. It is used for jewellery, ornaments, etc.
amber	1.b.
	syl	am+ber
	pron	<1@mb*>
	pos	n.
	usage	as modifier
	exam	1	an amber necklace.
amber	2.a.
	syl	am+ber
	pron	<1@mb*>
	pos	n.
	def	a medium to dark brownish-yellow colour, often somewhat orange, similar to that of the resin.
amber	2.b.
	syl	am+ber
	pron	<1@mb*>
	pos	as; adj.
	exam	1	an amber dress.
amber	3.
	syl	am+ber
	pron	<1@mb*>
	pos	n.
	def	an amber traffic light used as a warning between red and green.
ambergris	ety	C15: from Old French ambre gris grey amber
ambergris	0.
	syl	am:ber+gris
	pron	<1@mb*2grEs>, <-gris>
	pos	n.
	def	a waxy substance consisting mainly of cholesterol secreted by the intestinal tract of the sperm whale and often found floating in the sea: used in the manufacture of perfumes.
amberjack	ety	C19: from #7amber +#7jack %1
amberjack	0.
	syl	am:ber+jack
	pron	<1@mb*2J@k>
	pos	n.
	def	any of several large carangid fishes of the genus esp. with golden markings when young, occurring in tropical and subtropical Atlantic waters.
ambroid	alt
	head	amberoid
	or	amberoid
	syl	am+broid
	pos	n.
amberoid	0.
	or	ambroid
	syl	am+ber+oid
	pron	<1@mb*2rcid>
	pos	n.
	def	a synthetic amber made by compressing pieces of amber and other resins together at a high temperature.
ambi-	ety	from Latin: round, on both sides, both, from ambo both; compare #7amphi -
ambi-	0.
	syl	am:bi-
	usage	combining form.
	def	indicating both.
	exam	1	ambidextrous;
	exam	2	am?!bivalence;
	exam	3	ambiversion.
ambidextrous	1.
	syl	am+bi+dex+trous
	pron	<2@mbi1dekstr*s>
	pos	adj.
	def	equally expert with each hand.
ambidextrous	2.
	syl	am+bi+dex+trous
	pron	<2@mbi1dekstr*s>
	pos	adj.
	qual	Informal.
	def	highly skilled or adept.
ambidextrous	3.
	syl	am+bi+dex+trous
	pron	<2@mbi1dekstr*s>
	pos	adj.
	def	underhand?!ed; deceitful.
ambidexterity	sub
	head	ambidextrous
	or	ambidextrousness
	syl	am+bi+dex+ter+i:ty
	pron	<2@mbidek1steriti>
	pos	n.
ambidextrousness	sub
	head	ambidextrous
	or	ambidexterity
	syl	am+bi+1dex+trous+ness
	pos	n.
ambidextrously	sub
	head	ambidextrous
	syl	am+bi+1dex+trous+ly
	pos	adv.
ambience	ety	C19: from French ambiance, from ambiant surrounding; see #7ambient 
ambiance	alt
	head	ambience
	or	ambience
	syl	am+bi+ance
	pron	<1@mbi*ns>, French <*~a1bj*~a:s>
	pos	n.
ambience	0.
	or	ambiance
	syl	am+bi+ence
	pron	<1@mbi*ns>, French <*~a1bj*~a:s>
	pos	n.
	def	the atmosphere of a place.
ambient	ety	C16: from Latin ambi*_ens going round, from amb*_ire, from #7ambi -#7+ *_ire to go
ambient	0.
	syl	am+bi+ent
	pron	<1@mbi*nt>
	pos	adj.
	def	of or relating to the immediate surroundings.
	exam	1	the ambient temperature was 15?%C.
ambiguities	infl
	head	ambiguity
	syl	am+bi+gu+i:ties.
	pos	n.
	mod	pl.
ambiguity	1.
	syl	am+bi+gu+i:ty
	pron	<2@mbi1gju:iti>
	pos	n.
	def	vagueness or uncertainty of meaning.
ambiguity	2.
	syl	am+bi+gu+i:ty
	pron	<2@mbi1gju:iti>
	pos	n.
	def	an instance of this, as in the sentence
ambiguity	3.
	syl	am+bi+gu+i:ty
	pron	<2@mbi1gju:iti>
	pos	n.
	def	an ambiguous phrase, statement, etc.
ambiguous	ety	C16: from Latin ambiguus going here and there, uncertain, from ambigere to go around, from #7ambi -#7+ agere to lead, act
ambiguous	1.
	syl	am+big:u+ous
	pron	<@m1bigju*s>
	pos	adj.
	def	having more than one possible interpretation or meaning.
ambiguous	2.
	syl	am+big:u+ous
	pron	<@m1bigju*s>
	pos	adj.
	def	difficult to understand or classify; obscure.
ambiguously	sub
	head	ambiguous
	syl	am+1big:u+ous+ly
	pos	adv.
ambiguousness	sub
	head	ambiguous
	syl	am+1big:u+ous+ness
	pos	n.
ambit	ety	C16: from Latin ambitus a going round, from amb*_ire to go round, from #7ambi -#7+ *_ire to go
ambit	1.
	syl	am+bit
	pron	<1@mbit>
	pos	n.
	def	scope or extent.
ambit	2.
	syl	am+bit
	pron	<1@mbit>
	pos	n.
	def	limits, boundary, or circumference.
ambition	ety	C14: from Old French, from Latin ambiti*_o a going round (of candidates), a striving to please, from amb*_ire to go round; see #7ambit 
ambition	1.
	syl	am+bi+tion
	pron	<@m1biS*n>
	pos	n.
	def	strong desire for success, achievement, or distinction.
ambition	2.
	syl	am+bi+tion
	pron	<@m1biS*n>
	pos	n.
	def	something so desired; goal; aim.
ambitious	1.
	syl	am+bi+tious
	pron	<@m1biS*s>
	pos	adj.
	def	having a strong desire for success or achievement; wanting power, money, etc.
ambitious	2.
	syl	am+bi+tious
	pron	<@m1biS*s>
	pos	adj.
	def	necessitating extraordinary effort or ability.
	exam	1	an ambitious project.
ambitious	3.
	syl	am+bi+tious
	pron	<@m1biS*s>
	pos	adj.
	usage	often foll. by of
	def	having a great desire (for something or to do something).
ambitiously	sub
	head	ambitious
	syl	am+1bi+tious+ly
	pos	adv.
ambitiousness	sub
	head	ambitious
	syl	am+1bi+tious+ness
	pos	n.
ambivalency	alt
	head	ambivalence
	or	ambivalence
	syl	am+biv:a+len+cy
	pos	n.
ambivalence	0.
	or	ambivalency
	syl	am+biv:a+lence
	pron	<@m1biv*l*ns>
	pos	n.
	def	the simultaneous existence of two opposed and conflicting attitudes, emotions, etc.
ambivalent	sub
	head	ambivalence
	syl	am+1biv:a+lent
	pos	adj.
ambivert	0.
	syl	am+bi+vert
	pron	<1@mbi2vR:t>
	pos	n.
	qual	Psychol.
	def	a person who is intermediate between an extravert and an introvert. &- {am+bi+ver+sion} (@!@ambi#!v$$$:#s$$n)
amble	ety	C14: from Old French ambler, from Latin ambul*_are to walk
amble	1.
	syl	am+ble
	pron	<1@mbL>
	pos	vb.
	mod	intr.
	def	to walk at a leisurely relaxed pace.
amble	2.
	syl	am+ble
	pron	<1@mbL>
	pos	vb.
	mod	intr.
	usage	of a horse
	def	to move slowly, lifting both legs on one side together.
amble	3.
	syl	am+ble
	pron	<1@mbL>
	pos	vb.
	mod	intr.
	def	to ride a horse at an amble or leisurely pace.
amble	4.
	syl	am+ble
	pron	<1@mbL>
	pos	n.
	mod	intr.
	def	a leisurely motion in walking.
amble	5.
	syl	am+ble
	pron	<1@mbL>
	pos	n.
	mod	intr.
	def	a leisurely walk.
amble	6.
	syl	am+ble
	pron	<1@mbL>
	pos	n.
	mod	intr.
	def	the ambling gait of a horse.
ambler	sub
	head	amble
	syl	am+bler
	pos	n.
amblygonite	ety	C16: from Greek amblug*_onios, from amblus blunt+ g*_onia angle; referring to the obtuse angles in its crystals
amblygonite	0.
	syl	am+blyg:o+nite
	pron	<@m1blig*2nIt>
	pos	n.
	def	a white or greyish mineral consisting of lithium aluminium fluophosphate in triclinic crystalline form. It is a source of lithium. Formula: LiAl(PO\4)(F,OH).
amblyopia	ety	C18: New Latin, from Greek amblu*_opia, from amblus dull, dim+ *_ops eye
amblyopia	0.
	syl	am+bly:o+pi:a
	pron	<2@mbli1*upi*>
	pos	n.
	def	impaired vision with no discernible damage to the eye or optic nerve.
amblyopic	sub
	head	amblyopia
	syl	am+bly+op+ic
	pron	<2@mbli1opik>
	pos	adj.
ambo	ety	C17: from Medieval Latin, from Greek amb*_on raised rim, pulpit
ambos	infl
	head	ambo
	syl	am:bos.
	pos	n.
	mod	pl.
ambo	0.
	syl	am:bo
	pron	<1@mb*u>
	pos	n.
	def	either of two raised pulpits from which the gospels and epistles were read in early Christian churches.
amboceptor	ety	C20: from Latin amb*_o both (see #7ambi -)#7+ (#7re) #7ceptor 
amboceptor	0.
	syl	am+bo+cep+tor
	pron	<1@mb*u2sept*>
	pos	n.
	def	an immune body formed in the blood during infection or immunization that serves to link the complement to the antigen.
Amboina	1.
	syl	Am+boi+na
	pron	<@m1bcin*>
	pos	n.
	def	an island in Indonesia, in the Moluccas. Capital: Amboina. Area: 1000 sq. km (386 sq. miles).
Amboina	2.
	syl	Am+boi+na
	pron	<@m1bcin*>
	pos	n.
	def	Also called: {Am@.bon} (#!$a$:mb@$:n). a port in the Moluccas, the capital of Amboina Island.
Amboise	0.
	syl	Am+boise
	pron	French <*~a1bwa:z>
	pos	n.
	def	a town in NW central France, on the River Loire: famous castle, a former royal residence. Pop.: 8000 (1968 est.).
amboina	alt
	head	amboyna
	or	amboyna
	syl	am+boi+na
	pron	<@m1bcin*>
	pos	n.
amboyna	0.
	or	amboina
	syl	am+boy+na
	pron	<@m1bcin*>
	pos	n.
	def	the mottled curly-grained wood of an Indonesian papilionaceous tree, used in making furniture.
ambroid	0.
	syl	am+broid
	pron	<1@mbrcid>
	pos	n.
	def	a variant spelling of {amberoid}.
Saint	infl
	head	Ambrose
	syl	Saint.
	pos	n.
Ambrose	0.
	syl	Am:brose
	pron	<1@mbr*uz>
	pos	n.
	def	??340-397 #7a.d., bishop of Milan; built up the secular power of the early Christian Church; also wrote music and Latin hymns. Feast day: Dec. 7.
Ambrosian	sub
	head	Ambrose
	syl	Am+1bro+si:an
	pos	adj.
ambrosia	ety	C16: via Latin from Greek: immortality, from ambrotos, from #7a -%1#7+ brotos mortal
ambrosia	1.
	syl	am+bro+si:a
	pron	<@m1br*uzi*>
	pos	n.
	qual	Classical myth.
	def	the food of the gods, said to bestow immortality. Compare { {nectar} (sense 2)}.
ambrosia	2.
	syl	am+bro+si:a
	pron	<@m1br*uzi*>
	pos	n.
	def	anything particularly delightful to taste or smell.
ambrosia	3.
	syl	am+bro+si:a
	pron	<@m1br*uzi*>
	pos	n.
	def	another name for {beebread}.
ambrosia	4.
	syl	am+bro+si:a
	pron	<@m1br*uzi*>
	pos	n.
	def	any of various herbaceous plants constituting the genus mostly native to America but widely naturalized: family (composites). The genus includes the ragweeds.
ambrosial	sub
	head	ambrosia
	or	ambrosian
	syl	am+1bro+si:al
	pos	adj.
ambrosian	sub
	head	ambrosia
	or	ambrosial
	syl	am+1bro+si:an
	pos	adj.
ambrosially	sub
	head	ambrosia
	syl	am+1bro+si+al+ly
	pos	adv.
ambrosia beetle	0.
	syl	am+bro+si:a bee+tle
	pos	n.
	def	any of various small beetles of the genera etc., that bore tunnels into solid wood, feeding on fungi growing in the tunnels: family (bark beetles).
ambrotype	ety	C19: from Greek ambrotos immortal+-#7type ; see #7ambrosia 
ambrotype	0.
	syl	am+bro+type
	pron	<1@mbr*u2tIp>
	pos	n.
	qual	Photog.
	def	an early type of glass negative that could be made to appear as a positive by backing it with black varnish or paper.
ambry	ety	C14: from Old French almarie, from Medieval Latin alm*_arium, from Latin arm*_arium chest for storage, from arma arms
aumbry	alt
	head	ambry
	or	ambry
	syl	aum+bry
	pron	<1c:mbri>
	pos	n.
ambries	infl
	head	ambry
	syl	am+bries.
	pos	n.
	mod	pl.
ambry	1.
	or	aumbry
	syl	am+bry
	pron	<1@mbri>
	pos	n.
	def	a recessed cupboard in the wall of a church near the altar, used to store sacred vessels, etc.
ambry	2.
	or	aumbry
	syl	am+bry
	pron	<1@mbri>
	pos	n.
	qual	Obsolete.
	def	a small cupboard or other storage space.
ambsace	ety	C13: from Old French ambes as, both aces; as from Latin: unit
amesace	alt
	head	ambsace
	or	ambsace
	syl	ames+ace
	pron	<1Amz2As>, <1@mz->
	pos	n.
ambsace	1.
	or	amesace
	syl	ambs+ace
	pron	<1Amz2As>, <1@mz->
	pos	n.
	def	double ace, the lowest throw at dice.
ambsace	2.
	or	amesace
	syl	ambs+ace
	pron	<1Amz2As>, <1@mz->
	pos	n.
	def	bad luck.
ambulacrum	ety	C19: from Latin: avenue, from ambul*_are to walk
ambulacra	infl
	head	ambulacrum
	syl	am+bu+lac+ra
	pron	<-r*>
	pos	n.
	mod	pl.
ambulacrum	0.
	syl	am+bu+lac+rum
	pron	<2@mbju1lAkr*m>
	pos	n.
	def	any of five radial bands on the ventral surface of echinoderms, such as the starfish and sea urchin, on which the tube feet are situated.
ambulacral	sub
	head	ambulacrum
	syl	am+bu+1lac+ral
	pos	adj.
ambulance	ety	C19: from French, based on (h*^opital) ambulant mobile or field (hospital), from Latin ambul*_are to walk
ambulance	0.
	syl	am+bu+lance
	pron	<1@mbjul*ns>
	pos	n.
	def	a motor vehicle designed to carry sick or injured people.
ambulance chaser	0.
	syl	am+bu+lance chas+er
	pos	n.
	qual	U.S. slang.
	def	a lawyer who seeks to encourage and profit from the lawsuits of accident victims.
ambulance chasing	sub
	head	ambulance chaser
	syl	am+bu+lance chas+ing
	pos	n.
ambulant	1.
	syl	am+bu+lant
	pron	<1@mbjul*nt>
	pos	adj.
	def	moving about from place to place.
ambulant	2.
	syl	am+bu+lant
	pron	<1@mbjul*nt>
	pos	adj.
	qual	Med.
	def	another word for { {ambulatory} (sense 3)}.
ambulate	ety	C17: from Latin ambul*_are to walk, #7amble 
ambulate	0.
	syl	am+bu+late
	pron	<1@mbju2lAt>
	pos	vb.
	mod	intr.
	def	to wander about or move from one place to another.
ambulation	sub
	head	ambulate
	syl	am+bu+1la+tion
	pos	n.
ambulatory	1.
	syl	am+bu+la+to:ry
	pron	<2@mbju1lAt*ri>
	pos	adj.
	def	of, relating to, or de?!signed for walking.
ambulatory	2.
	syl	am+bu+la+to:ry
	pron	<2@mbju1lAt*ri>
	pos	adj.
	def	changing position; not fixed.
ambulatory	3.
	syl	am+bu+la+to:ry
	pron	<2@mbju1lAt*ri>
	pos	adj.
	def	Also: {ambulant}. able to walk.
ambulatory	4.
	syl	am+bu+la+to:ry
	pron	<2@mbju1lAt*ri>
	pos	adj.
	usage	Law. esp. of a will
	def	capable of being altered or revoked. {~} {@.ries}.
ambulatory	5.a.
	syl	am+bu+la+to:ry
	pron	<2@mbju1lAt*ri>
	pos	adj.
	def	an aisle running around the east end of a church, esp. one that passes behind the sanctuary.
ambulatory	5.b.
	syl	am+bu+la+to:ry
	pron	<2@mbju1lAt*ri>
	pos	adj.
	def	a place for walking, such as an aisle or a cloister.
ambuscade	ety	C16: from French embuscade, from Old Italian imboscata, probably of Germanic origin; compare #7ambush 
ambuscade	1.
	syl	am+bus+cade
	pron	<2@mb*1skAd>
	pos	n.
	def	an ambush.
ambuscade	2.
	syl	am+bus+cade
	pron	<2@mb*1skAd>
	pos	vb.
	def	to ambush or lie in ambush.
ambush	ety	C14: from Old French embuschier to position in ambush, from em- #7im -#7+ -buschier, from busche piece of firewood, probably of Germanic origin; see #7bush %1
ambush	1.
	syl	am+bush
	pron	<1@mbuS>
	pos	n.
	def	the act of waiting in a concealed position in order to launch a surprise attack.
ambush	2.
	syl	am+bush
	pron	<1@mbuS>
	pos	n.
	def	a surprise attack from such a position.
ambush	3.
	syl	am+bush
	pron	<1@mbuS>
	pos	n.
	def	the concealed position from which such an attack is launched.
ambush	4.
	syl	am+bush
	pron	<1@mbuS>
	pos	n.
	def	the person or persons waiting to launch such an attack. {~}
ambush	5.
	syl	am+bush
	pron	<1@mbuS>
	pos	n.
	def	to lie in wait (for).
ambush	6.
	syl	am+bush
	pron	<1@mbuS>
	pos	n.
	mod	tr.
	def	to attack suddenly from a concealed position.
AMDG	ety	Latin: to the greater glory of God
AMDG	0.
	syl	A.M.D.G.
	qual	abbrev. for
	def	ad majorem Dei gloriam (the Jesuit motto).
amebae	infl
	head	ameba
	or	amebas
	syl	a:me+bae
	pron	<-bE>
	pos	n.
	mod	pl.
amebas	infl
	head	ameba
	or	amebae
	syl	a:me+bas.
	pos	n.
	mod	pl.
ameba	0.
	syl	a:me+ba
	pron	<*1mEb*>
	pos	n.
	def	the usual U.S. spelling of {amoeba}. &- {a@.#!me+bic}
ameer	1.
	syl	a:meer
	pron	<*1mi*>
	pos	n.
	def	a variant spelling of {emir}.
ameer	2.
	syl	a:meer
	pron	<*1mi*>
	pos	n.
	usage	formerly
	def	the ruler of Afghanistan; amir.
ameliorate	ety	C18: from #7meliorate, influenced by French am*'eliorer to improve, from Old French ameillorer to make better, from meillor better, from Latin melior 
ameliorate	0.
	syl	a:me+lio+rate
	pron	<*1mElj*2rAt>
	pos	vb.
	def	to make or become better; improve.
ameliorable	sub
	head	ameliorate
	syl	a:me+lio+ra:ble
	pron	<*1mElj*r*bL>
	pos	adj.
ameliorant	sub
	head	ameliorate
	syl	a:1me+lio+rant
	pos	n.
amelioration	1.
	syl	a:me+lio+ra+tion
	pron	<*2mElj*1rAS*n>
	pos	n.
	def	the act or an instance of ameliorating or the state of being ameliorated.
amelioration	2.
	syl	a:me+lio+ra+tion
	pron	<*2mElj*1rAS*n>
	pos	n.
	def	something that ameliorates; an improvement.
amelioration	3.
	syl	a:me+lio+ra+tion
	pron	<*2mElj*1rAS*n>
	pos	n.
	def	Also called: {elevation}. (of the meaning of a word) a change from pejorative to neutral or positively pleasant. The word has achieved its modern meaning by amelioration from the earlier sense
amen	ety	C13: via Late Latin via Greek from Hebrew *_am*_en certainly
amen	1.
	syl	a:men
	pron	<2A1men>, <2a:1men>
	pos	interj.
	def	So be it&! A term used at the end of a prayer or religious statement.
amen	2.
	syl	a:men
	pron	<2A1men>, <2a:1men>
	pos	n.
	def	the use of the word as at the end of a prayer.
say amen to	3.
	head	amen
	syl	say amen to.
	def	to give assent to.
Amon	infl
	head	Amen
	or	Amun
	syl	A:mon
	pron	<1a:m*n>
	pos	n.
Amun	infl
	head	Amen
	or	Amon
	syl	A:m*_un
	pron	<1a:m*n>
	pos	n.
Amen	0.
	syl	A:men
	pron	<1a:m*n>
	pos	n.
	qual	Egyptian myth.
	def	a local Theban god, having a ram's head and symbolizing life and fertility, identified by the Egyptians with the national deity Amen-Ra.
amenable	ety	C16: from Anglo-French, from Old French amener to lead up, from Latin min*_are to drive (cattle), from min*_ar*_i to threaten
amenable	1.
	syl	a:me+na:ble
	pron	<*1mEn*bL>
	pos	adj.
	def	open or susceptible to suggestion; likely to listen, cooperate, etc.
amenable	2.
	syl	a:me+na:ble
	pron	<*1mEn*bL>
	pos	adj.
	def	accountable for behaviour to some authority; answerable.
amenable	3.
	syl	a:me+na:ble
	pron	<*1mEn*bL>
	pos	adj.
	def	capable of being or liable to be tested, judged, etc.
amenability	sub
	head	amenable
	or	amenableness
	syl	a:2me+na:1bil+i:ty
	pos	n.
amenableness	sub
	head	amenable
	or	amenability
	syl	a:1me+na:ble+ness
	pos	n.
amenably	sub
	head	amenable
	syl	a:1me+na:bly
	pos	adv.
the	infl
	head	amen corner
	syl	the.
	pos	n.
amen corner	0.
	syl	a:men cor+ner
	pos	n.
	qual	U.S.
	def	the part of a church, usually to one side of the pulpit, occupied by people who lead the responsive amens during the service.
amend	ety	C13: from Old French amender, from Latin *_emend*_are to #7emend 
amend	1.
	syl	a:mend
	pron	<*1mend>
	pos	vb.
	mod	tr.
	def	to improve; change for the better.
amend	2.
	syl	a:mend
	pron	<*1mend>
	pos	vb.
	mod	tr.
	def	to remove faults from; correct.
amend	3.
	syl	a:mend
	pron	<*1mend>
	pos	vb.
	mod	tr.
	def	to alter or revise (legislation, a constitution, etc.) by formal procedure.
amendable	sub
	head	amend
	syl	a:1mend+a:ble
	pos	adj.
amender	sub
	head	amend
	syl	a:1mend+er
	pos	n.
amendatory	0.
	syl	a:mend:a+to:ry
	pron	<*1mend*t*ri>, <-tri>
	pos	adj.
	qual	U.S.
	def	serving to amend; corrective.
amendment	1.
	syl	a:mend+ment
	pron	<*1mendm*nt>
	pos	n.
	def	the act of amending; correction.
amendment	2.
	syl	a:mend+ment
	pron	<*1mendm*nt>
	pos	n.
	def	an addition, alteration, or improvement to a motion, document, etc.
amends	ety	C13: from Old French amendes fines, from amende compensation, from amender to #7emend 
amends	0.
	syl	a:mends
	pron	<*1mendz>
	pos	n.
	def	recompense or compensation given or gained for some injury, insult, etc..
	exam	1	to make amends.
Amenhotpe III	alt
	head	Amenhotep III
	or	Amenhotep III
	syl	A:men:hot:pe III
	pron	<2@men1hotpi>
	pos	n.
Amenhotep III	0.
	or	Amenhotpe III
	syl	A:men:ho:tep III
	pron	<2@men1h*utep>
	pos	n.
	def	Greek name ??1411-??1375 #7b.c., Egyptian pharaoh who expanded Egypt's influence by peaceful diplomacy and erected many famous buildings.
Amenhotpe IV	alt
	head	Amenhotep IV
	or	Amenhotep IV
	syl	Am:en:hot:pe IV
	pos	n.
Amenhotep IV	0.
	or	Amenhotpe IV
	syl	Am:en:ho:tep IV
	pos	n.
	def	the original name of {Akhenaten}.
amenity	ety	C14: from Latin amoenit*_as pleasantness, from amoenus agreeable
amenities	infl
	head	amenity
	syl	a:men+i:ties.
	pos	n.
	mod	pl.
amenity	1.
	syl	a:men+i:ty
	pron	<*1mEniti>
	pos	n.
	mod	often; pl.
	def	a useful or pleasant facility or service.
	exam	1	a swimming pool was just one of the amenities.
amenity	2.
	syl	a:men+i:ty
	pron	<*1mEniti>
	pos	n.
	def	the fact or condition of being pleasant or agreeable.
amenity	3.
	syl	a:men+i:ty
	pron	<*1mEniti>
	pos	n.
	mod	usually; pl.
	def	a social courtesy or pleasantry.
amenorrhoea	ety	C19: from #7a -%1#7+meno -#7+ -#7rrhea 
Amen-Ra	0.
	syl	A:men-Ra
	pron	<2a:m*n1ra:>
	pos	n.
	qual	Egyptian myth.
	def	the sun-god; the principle deity during the period of Theban hegemony.
a mensa et thoro	ety	Latin: from table and bed
a mensa et thoro	0.
	syl	a men+sa et tho+ro
	pron	<A> <1mens*> <et> <1Tc:r*u>
	pos	adj.
	qual	Law.
	def	denoting or relating to a form of divorce in which the parties remain married but do not cohabit: abolished in England in 1857.
ament	ety	C18: from Latin *_amentum strap, thong
ament	H1.0.
	syl	am+ent
	pron	<1@m*nt>, <1Am*nt>
	pos	n.
	def	another name for {catkin}. Also called: {amentum}.
amentaceous	sub
	head	ament
	syl	am+en+1ta+ceous
	pos	adj.
amentiferous	sub
	head	ament
	syl	am+en+1tif+er+ous
	pos	adj.
ament	ety	C19: from Latin *_ament-, *_amens without mind; see #7amentia 
ament	H2.0.
	syl	a:ment
	pron	<@1ment>, <1Am*nt>
	pos	n.
	qual	Psychiatry.
	def	a mentally deficient person.
amentia	ety	C14: from Latin: insanity, from *_am*_ens mad, from m*_ens mind
amentia	0.
	syl	a:men+tia
	pron	<*1menS*>
	pos	n.
	def	severe mental deficiency, usually congenital. Compare {dementia}.
Amer	0.
	syl	Amer.
	qual	abbrev. for
	def	America(n).
amerce	ety	C14: from Anglo-French amercier, from Old French *`a merci at the mercy (because the fine was arbitrarily fixed); see #7mercy 
amerce	1.
	syl	a:merce
	pron	<*1mR:s>
	pos	vb.
	mod	tr.
	qual	Obsolete.; Law.
	def	to punish by a fine.
amerce	2.
	syl	a:merce
	pron	<*1mR:s>
	pos	vb.
	mod	tr.
	qual	Obsolete.
	def	to punish with any arbitrary penalty.
amerceable	sub
	head	amerce
	syl	a:1merce+a:ble
	pos	adj.
amercement	sub
	head	amerce
	syl	a:1merce+ment
	pos	n.
amercer	sub
	head	amerce
	syl	a:1merc+er
	pos	n.
America	ety	C16: from Americus, Latin form of Amerigo; see V#7espucci 
America	1.
	syl	A:mer:i+ca
	pron	<*1merik*>
	pos	n.
	def	short for the {United States of America}.
America	2.
	syl	A:mer:i+ca
	pron	<*1merik*>
	pos	n.
	def	Also called: {the Americas}. the American continent, including North, South, and Central America.
American	1.
	syl	A:mer:i+can
	pron	<*1merik*n>
	pos	adj.
	def	of or relating to the United States of America, its inhabitants, or their form of English.
American	2.
	syl	A:mer:i+can
	pron	<*1merik*n>
	pos	adj.
	def	of or relating to the American continent.
American	3.
	syl	A:mer:i+can
	pron	<*1merik*n>
	pos	adj.
	qual	Rare.
	def	of or relating to the American Indians.
American	4.
	syl	A:mer:i+can
	pron	<*1merik*n>
	pos	n.
	def	a native or citizen of the U.S.
American	5.
	syl	A:mer:i+can
	pron	<*1merik*n>
	pos	n.
	def	a native or inhabitant of any country of North, Central, or South America.
American	6.
	syl	A:mer:i+can
	pron	<*1merik*n>
	pos	n.
	def	the English language as spoken or written in the United States.
Americana	0.
	syl	A:mer:i+ca+na
	pron	<*2meri1ka:n*>
	pos	n.
	def	objects, such as books, documents, relics, etc., relating to America, esp. in the form of a collection.
American aloe	0.
	syl	A:mer:i+can al:oe
	pos	n.
	def	another name for {century plant}.
American Beauty	0.
	syl	A:mer:i+can Beau+ty
	pos	n.
	def	a variety of hybrid perennial rose bearing large long-stemmed purplish-red flowers.
American chameleon	0.
	syl	A:mer:i+can cha+me:le:on
	pos	n.
	def	another name for {anole}.
American cheese	0.
	syl	A:mer:i+can cheese
	pos	n.
	def	a type of smooth hard white or yellow cheese similar to a mild Cheddar.
American cloth	0.
	syl	A:mer:i+can cloth
	pos	n.
	def	a glazed or waterproofed cotton cloth.
American eagle	0.
	syl	A:mer:i+can ea:gle
	pos	n.
	def	another name for {bald eagle}, esp. when depicted as the national emblem of the U.S.
American Expeditionary Forces	0.
	syl	A:mer:i+can Ex+pe+di+tion+ar:y Forc:es
	pos	n.
	mod	pl.
	def	the troops sent to Europe by the U.S. during World War I.
American Federation of Labor	0.
	syl	A:mer:i+can Fed+er:a+tion of La+bor
	pos	n.
	def	the first permanent national labour movement in America, founded in 1886. It amalgamated with the Congress of Industrial Organizations in 1955. See also {AFL-CIO}.
American football	1.
	syl	A:mer:i+can foot+ball
	pos	n.
	def	a team game similar to rugby, with 11 players on each side. Forward passing is allowed and planned strategies and formations for play are decided during the course of the game.
American football	2.
	syl	A:mer:i+can foot+ball
	pos	n.
	def	the oval-shaped inflated ball used in this game.
American Indian	1.
	syl	A:mer:i+can In+di:an
	pos	n.
	def	Also called: {Indian, Red Indian, Amerindian}. a member of any of the indigenous peoples of North, Central, or South America, having Mongoloid affinities, notably straight black hair and a yellow to brown skin. {~}
American Indian	2.
	syl	A:mer:i+can In+di:an
	pos	n.
	def	of or relating to any of these peoples, their languages, or their cultures.
American Indian Movement	0.
	syl	A:mer:i+can In+di:an Move+ment
	pos	n.
	def	a militant movement or grouping of American Indians, organized in 1968 to combat discrimination, injustice, etc. Abbrev.: {AIM}.
Americanism	1.
	syl	A:mer:i+can+ism
	pron	<*1merik*2niz*m>
	pos	n.
	def	a custom, linguistic usage, or other feature peculiar to or characteristic of the United States, its people, or their culture.
Americanism	2.
	syl	A:mer:i+can+ism
	pron	<*1merik*2niz*m>
	pos	n.
	def	loyalty to the United States, its people, customs, etc.
Americanist	0.
	syl	A:mer:i+can+ist
	pron	<*1merik*nist>
	pos	n.
	def	a person who studies some aspect of America, such as its history or languages.
Americanise	alt
	head	Americanize
	or	Americanize
	syl	A:mer:i+can+ise
	pron	<*1merik*2nIz>
	pos	vb.
Americanize	0.
	or	Americanise
	syl	A:mer:i+can+ize
	pron	<*1merik*2nIz>
	pos	vb.
	def	to make or become American in outlook, attitudes, etc.
Americanization	sub
	head	Americanize
	or	Americanisation
	syl	A:2mer:i+can:i+1za+tion
	pos	n.
Americanisation	sub
	head	Americanize
	or	Americanization
	syl	A:2mer:i+can:i+1sa+tion
	pos	n.
Americanizer	sub
	head	Americanize
	or	Americaniser
	syl	A:1mer:i+can+2iz+er
	pos	n.
Americaniser	sub
	head	Americanize
	or	Americanizer
	syl	A:1mer:i+can+2is+er
	pos	n.
American plan	0.
	syl	A:mer:i+can plan
	pos	n.
	qual	U.S.
	def	a hotel rate in which the charge includes meals. Compare {European plan}.
American Revolution	0.
	syl	A:mer:i+can Rev:o+lu+tion
	pos	n.
	def	the usual U.S. term for {War of American Independence}.
American Samoa	0.
	syl	A:mer:i+can Sa+mo:a
	pos	n.
	def	the part of Samoa administered by the U.S. Capital: Pago Pago. Pop.: 27769 (1970). Area: 197 sq. km (76 sq. miles).
American Standard Version	0.
	syl	A:mer:i+can Stand+ard Ver+sion
	pos	n.
	def	a revised version of the Authorized (King James) Version of the Bible, published by a committee of American scholars in 1901.
American trypanosomiasis	0.
	syl	A:mer:i+can tryp:a+no+so+mi:a+sis
	pos	n.
	qual	Pathol.
	def	another name for {Chagas' disease}.
America's Cup	0.
	syl	A:mer:i+ca's Cup
	pos	n.
	def	an international yachting trophy, first won by the schooner in 1851 and since then held as a challenge trophy by the New York Yacht Club.
americium	0.
	syl	am+er:i+ci:um
	pron	<2@m*1risi*m>
	pos	n.
	def	a white metallic transuranic element artificially produced from plutonium. It is used as an alpha-particle source. Symbol: Am; atomic no.: 95; half-life of most stable isotope, %2%4%3Am: 7.4#M10%3 years; valency: 3,4,5, or 6; relative density: 13.67; melting pt.: 995?%C; boiling pt.: 2607?%C (est.).
Amerigo Vespucci	0.
	syl	A:mer:i:go Ve:spuc:ci
	pron	Italian <2amA1rEgo> <vAs1putCi>
	pos	n.
	def	See {Vespucci}.
Amerindic	sub
	head	Amerindian
	syl	Am+er+1in+dic
	pos	adj.
Amersfoort	0.
	syl	A:mers+foort
	pron	Dutch <1a:m*rs2fo:rt>
	pos	n.
	def	a town in the central Netherlands, in E Utrecht province. Pop.: 79876 (1973 est.).
amesace	0.
	syl	ames+ace
	pron	<1Amz1As>, <1@mz->
	pos	n.
	def	a variant spelling of {ambsace}.
amethyst	ety	C13: from Old French amatiste, from Latin amethystus, from Greek amethustos, literally: not drunken, from #7a -%1#7+ methuein to make drunk; referring to the belief that the stone could prevent intoxication
amethyst	1.
	syl	am+e:thyst
	pron	<1@miTist>
	pos	n.
	def	a purple or violet transparent variety of quartz used as a gemstone. Formula: SiO\2.
amethyst	2.
	syl	am+e:thyst
	pron	<1@miTist>
	pos	n.
	def	a purple variety of sapphire; oriental amethyst.
amethyst	3.
	syl	am+e:thyst
	pron	<1@miTist>
	pos	n.
	def	the purple colour of amethyst.
amethystine	sub
	head	amethyst
	syl	am+e:thys+tine
	pron	<2@mi1TistIn>
	pos	adj.
ametropia	ety	C19: New Latin, from Greek ametros unmeasured (from #7a -%1#7+ metron measure)+ *_ops eye
ametropia	0.
	syl	am+e:tro+pi:a
	pron	<2@mi1tr*upi*>
	pos	n.
	def	loss of ability to focus images on the retina, caused by an imperfection in the refractive function of the eye.
Amfortas	0.
	syl	Am:for:tas
	pron	<@m1fc:t*s>
	pos	n.
	usage	in medieval legend
	def	the leader of the knights of the Holy Grail.
Amhara	1.
	syl	Am+ha+ra
	pron	<@m1ha:r*>
	pos	n.
	def	a province of NW Ethiopia: formerly a kingdom. Capital: Goudar. Area: 197448 sq. km (76235 sq. miles).
Amhara	2.
	syl	Am+ha+ra
	pron	<@m1ha:r*>
	pos	n.
	def	an inhabitant of the former kingdom of Amhara.
Amharic	1.
	syl	Am+har+ic
	pron	<@m1h@rik>
	pos	n.
	def	the official language of Ethiopia, belonging to the SE Semitic subfamily of the Afro-Asiatic family.
Amharic	2.
	syl	Am+har+ic
	pron	<@m1h@rik>
	pos	adj.
	def	denoting or relating to this language.
Jeffrey	infl
	head	Amherst
	syl	Jef:frey
	pos	n.
Amherst	0.
	syl	Am:herst
	pron	<1@mhR:st>
	pos	n.
	def	1st Baron Amherst. 1717-97, British general who defeated the French in Canada (1758-60): governor general of British North America (1761-63).
ami	0.
	syl	a:mi
	pron	French. <a1mi>
	pos	n.
	def	a male friend.
amiable	ety	C14: from Old French, from Late Latin am*_ic*_abilis #7amicable 
amiable	0.
	syl	a:mi+a:ble
	pron	<1Ami*bL>
	pos	adj.
	def	having or displaying a pleasant or agreeable nature; friendly.
amiability	sub
	head	amiable
	or	amiableness
	syl	a:mi+a:1bil+i:ty
	pos	n.
amiableness	sub
	head	amiable
	or	amiability
	syl	a:mi+a:ble+ness
	pos	n.
amianthus	ety	C17: from Latin amiantus, from Greek amiantos unsullied, from #7a -%1#7+ miainein to pollute
amianthus	0.
	syl	am:i+an+thus
	pron	<2@mi1@nT*s>
	pos	n.
	def	any of the fine silky varieties of asbestos.
amianthine	sub
	head	amianthus
	syl	am:i+1an+thine
	pos	adj.
amianthoid	sub
	head	amianthus
	or	amianthoidal
	syl	am:i+1an+thoid
	pos	adj.
amianthoidal	sub
	head	amianthus
	or	amianthoid
	syl	am:i+an+1thoid+al
	pos	adj.
amicable	ety	C15: from Late Latin am*_ic*_abilis, from Latin am*_icus friend; related to am*_are to love
amicable	0.
	syl	am:i+ca:ble
	pron	<1@mik*bL>
	pos	adj.
	def	characterized by friendliness.
	exam	1	an amicable agreement.
amicability	sub
	head	amicable
	or	amicableness
	syl	am:i+ca:1bil+i:ty
	pos	n.
amicableness	sub
	head	amicable
	or	amicability
	syl	am:i+ca:ble+ness
	pos	n.
amicably	sub
	head	amicable
	syl	am:i+ca:bly
	pos	adv.
amice	ety	C15: from Old French amis, plural of amit, or from Medieval Latin amicia, both from Latin amictus cloak, from amic*_ire to clothe, from am- #7ambi -#7+ iacere to throw
amice	H1.0.
	syl	am+ice
	pron	<1@mis>
	pos	n.
	qual	Christianity.
	def	a rectangular piece of white linen worn by priests around the neck and shoulders under the alb or, formerly, on the head.
amice	H2.0.
	syl	am+ice
	pron	<1@mis>
	pos	n.
	def	another word for {almuce}.
AMICE	0.
	syl	A.M.I.C.E.
	qual	abbrev. for
	def	Associate Member of the Institution of Civil Engineers.
AMIChemE	0.
	syl	A.M.I.Chem.E.
	qual	abbrev. for
	def	Associate Member of the Institution of Chemical Engineers.
amicus curiae	ety	Latin, literally: friend of the court
amici curiae	infl
	head	amicus curiae
	syl	a:mi+ci cu+ri:ae
	pron	<@1mEkI>
	pos	n.
	mod	pl.
amicus curiae	0.
	syl	a:mi+cus cu+ri:ae
	pron	<@1mEkus> <1kju*ri2E>
	pos	n.
	qual	Law.
	def	a person not directly engaged in a case who advises the court.
amid	ety	Old English on middan in the middle; see #7mid %1
amidst	alt
	head	amid
	or	amid
	syl	a:midst
	pos	prep.
amid	0.
	or	amidst
	syl	a:mid
	pron	<*1mid>
	pos	prep.
	def	in the middle of; among.
amide	ety	C19: from #7am (#7monia) #7+ -#7ide 
amide	1.
	syl	am+ide
	pron	<1@mId>
	pos	n.
	def	any organic compound containing the group -CONH\2.
amide	2.
	syl	am+ide
	pron	<1@mId>
	pos	n.
	usage	modifier
	def	consisting of, containing, or concerned with the group -CONH\2.
	exam	1	amide group or radical.
amide	3.
	syl	am+ide
	pron	<1@mId>
	pos	n.
	def	an inorganic compound having the general formula M(NH\2) , where M is a metal atom.
amidic	sub
	head	amide
	syl	a:1mid+ic
	pron	<*1midik>
	pos	adj.
amido-	ety	from #7amide 
amido-	0.
	syl	a:mi:do-
	usage	combining form.
	def	(in chemistry) indicating the presence of an amide group.
Amidol	0.
	syl	Am:i+dol
	pron	<1@midol>
	pos	n.
	qual	Trademark.
	def	a grey to colourless soluble crystalline solid that is used as a photographic developer; 2,4-diaminophenol dihydrochloride. Formula: C\6H\3(NH\2)\2(OH).2HCl.
amidships	0.
	syl	a:mid+ships
	pron	<*1midSips>
	pos	adv. adj.
	qual	Nautical.
	usage	postpositive
	def	at, near, or towards the centre of a vessel.
amie	0.
	syl	a:mie
	pron	French. <a1mi>
	pos	n.
	def	a female friend.
AMIEE	0.
	syl	A.M.I.E.E.
	qual	abbrev. for
	usage	in Britain
	def	Associate Member of the Institution of Electrical Engineers.
Amiens	0.
	syl	Am:i+ens
	pron	<1@mi*nz>, French <a1mj*~e>
	pos	n.
	def	a city in N France: its Gothic cathedral is the largest church in France. Pop.: 135992 (1975).
amigo	ety	Spanish, from Latin amicus 
amigos	infl
	head	amigo
	syl	a:mi+gos.
	pos	n.
	mod	pl.
amigo	0.
	syl	a:mi+go
	pron	<@1mEg*u>, <*->
	pos	n.
	def	a friend; comrade.
AMIMechE	0.
	syl	A.M.I.Mech.E.
	qual	abbrev. for
	usage	in Britain
	def	Associate Member of the Institution of Mechanical Engineers.
Lake	infl
	head	Amin
	syl	Lake.
	pos	n.
Amin	H1.0.
	syl	A:min
	pron	<@1mEn>, <a:->
	pos	n.
	def	the official name for (Lake) {Edward}.
Idi	infl
	head	Amin
	syl	I:di
	pron	<1idE>
	pos	n.
Amin	H2.0.
	syl	A:min
	pron	<@1mEn>, <a:->
	pos	n.
	def	born 1925, Ugandan soldier; dictator and head of state since 1971.
amine	ety	C19: from #7am (#7monium) #7+ -#7ine %2
amine	0.
	syl	a:mine
	pron	<*1mEn>, <1@min>
	pos	n.
	def	an organic base formed by replacing one or more of the hydrogen atoms of ammonia by organic groups.
-amine	0.
	syl	-a:mine
	pos	n.
	usage	combining form.
	def	indicating an amine.
	exam	1	histamine;
	exam	2	methylamine.
amino	0.
	syl	a:mi+no
	pron	<*1mIn*u>, <-1mE->
	pos	n.
	usage	modifier
	def	of, consisting of, or containing the group of atoms -NH\2.
	exam	1	amino group or radical;
	exam	2	amino acid.
amino-	ety	from #7amine 
amino-	0.
	syl	a:mi:no-
	usage	combining form.
	def	indicating the presence of an amino group.
	exam	1	aminobenzoic acid.
amino acid	0.
	syl	a:mi+no ac:id
	pos	n.
	def	any of a group of organic compounds containing one or more amino groups, -NH\2, and one or more carboxyl groups, -COOH. They are the component molecules of proteins.
aminobenzoic acid	0.
	syl	a:mi+no+ben+zo+ic ac:id
	pron	<*2mIn*uben1z*uik>, <-2mE->
	pos	n.
	def	a derivative of benzoic acid existing in three isomeric forms, the form being used in the manufacture of dyes and sunburn preventatives. Formula: NH\2C\6H\4COOH.
aminophenol	0.
	syl	a:mi+no+phe:nol
	pron	<*2mIn*u1fEnol>, <-2mE->
	pos	n.
	qual	Chem.
	def	any of three isomeric forms that are white soluble crystalline solids, used as a dye intermediate (meta- and ortho-), in dyeing hair, fur, and textiles (ortho- and para-), and as a photographic developer (para-). Formula: C\6H\4NH\2OH.
aminopyrine	0.
	syl	a:mi+no+py+rine
	pron	<*2mIn*u1pIrEn>, <-2mE->
	pos	n.
	def	a crystalline compound used to reduce pain and fever. Formula: C\1\3H\1\7N\3O.
amino resin	0.
	syl	a:mi+no res+in
	pos	n.
	def	any thermosetting synthetic resin formed by copolymerization of amines with aldehydes. Amino resins are used as adhesives and as coatings for paper and textiles. See also {urea-formaldehyde resin, melamine}.
amir	ety	C19: from Arabic, variant of #7emir 
amir	1.
	syl	a:mir
	pron	<*1mi*>
	pos	n.
	def	a variant spelling of {emir}.
amir	2.
	syl	a:mir
	pron	<*1mi*>
	pos	n.
	usage	formerly
	def	the ruler of Afghanistan; ameer.
amirate	sub
	head	amir
	syl	a:1mir+ate
	pos	adj.
Kingsley	infl
	head	Amis
	syl	King:sley.
	pos	n.
Amis	0.
	syl	A:mis
	pron	<1Amis>
	pos	n.
	def	born 1922, English novelist and poet, noted esp. for his satirical novel (1954).
Amish	ety	C19: from German Amisch, after Jakob Amman, 17th-century Swiss Mennonite bishop
Amish	1.
	syl	A:mish
	pron	<1a:miS>, <1@->
	pos	adj.
	def	of or relating to a U.S. Mennonite sect that traces its origin to Jakob Amman.
Amish	2.
	syl	A:mish
	pron	<1a:miS>, <1@->
	pos	n.
	def	the Amish people.
amiss	ety	C13 a mis, from mis wrong; see #7miss %1
amiss	1.
	syl	a:miss
	pron	<*1mis>
	pos	adv.
	def	in an incorrect, inappropriate, or defective manner.
take amiss	2.
	head	amiss
	syl	take amiss.
	def	to feel offended by.
amiss	3.
	syl	a:miss
	pron	<*1mis>
	pos	adj.
	usage	postpositive
	def	wrong, incorrect, or faulty.
amitosis	0.
	syl	am:i+to+sis
	pron	<2@mi1t*usis>
	pos	n.
	def	an unusual form of cell division in which the nucleus and cytoplasm divide by constriction without the formation of chromosomes; direct cell division.
amitotic	sub
	head	amitosis
	syl	am:i+tot+ic
	pron	<2@mi1totik>
	pos	adj.
amitotically	sub
	head	amitosis
	syl	am:i+1tot:i+cal+ly
	pos	adv.
amity	ety	C15: from Old French amit*'e, from Medieval Latin am*_icit*_as friendship, from Latin am*_icus friend
amities	infl
	head	amity
	syl	am+i:ties.
	pos	n.
	mod	pl.
amity	0.
	syl	am+i:ty
	pron	<1@miti>
	pos	n.
	def	friendship; cordiality.
Amman	0.
	syl	Am+man
	pron	<*1ma:n>
	pos	n.
	def	the capital of Jordan, northeast of the Dead Sea: ancient capital of the Ammonites, rebuilt by Ptolemy in the 3rd century #7b.c. Pop.: 598000 (1974 est.). Ancient names: {Rabbath Ammon, Philadelphia}.
ammeter	ety	C19: #7am (#7pere) #7+ -#7meter 
ammeter	0.
	syl	am+me:ter
	pron	<1@m2mEt*>
	pos	n.
	def	an instrument for measuring an electric current in amperes.
ammine	ety	C19: from #7amm (#7onia) #7+ -#7ine %2
ammine	0.
	syl	am+mine
	pron	<1@mEn>, <*1mEn>
	pos	n.
	def	a compound that has molecules containing one or more ammonia molecules bound to another molecule, group, or atom by coordinate bonds. Also called: {ammoniate, ammonate}.
ammo	0.
	syl	am:mo
	pron	<1@m*u>
	pos	n.
	qual	Informal.
	def	short for {ammunition}.
ammocoete	ety	C19: from New Latin ammocoete*_es, literally: that lie in sand, from Greek ammos sand+ koit*_e bed, from keisthai to lie
ammocoete	0.
	syl	am+mo+coete
	pron	<1@m*2sEt>
	pos	n.
	def	the larva of primitive jawless vertebrates, such as the lamprey, that lives buried in mud and feeds on microorganisms.
Ammon	H1.0.
	syl	Am:mon
	pron	<1@m*n>
	pos	n.
	qual	Old Testament.
	def	the ancestor of the Ammonites.
Ammon	H2.0.
	syl	Am:mon
	pron	<1@m*n>
	pos	n.
	qual	Myth.
	def	the classical name of the Egyptian god Amen, identified by the Greeks with Zeus and by the Romans with Jupiter.
ammonal	ety	C20: from #7ammon (#7ium) #7+al (#7uminium) 
ammonal	0.
	syl	am+mo+nal
	pron	<1@m*nL>
	pos	n.
	def	an explosive made by mixing TNT, ammonium nitrate, and aluminium powder.
ammonate	0.
	syl	am+mo+nate
	pron	<1@m*2nAt>
	pos	n.
	def	another name for {ammine}.
ammonia	ety	C18: from New Latin, from Latin (sal) amm*_oniacus (sal) #7ammoniac 
ammonia	1.
	syl	am+mo+ni:a
	pron	<*1m*uni*>, <-nj*>
	pos	n.
	def	a colourless pungent highly soluble gas mainly used in the manufacture of fertilizers, nitric acid, and other nitrogenous compounds and as a refrigerant and solvent. Formula: NH\3.
ammonia	2.
	syl	am+mo+ni:a
	pron	<*1m*uni*>, <-nj*>
	pos	n.
	def	short for {aqueous ammonia}.
ammoniac	H1.0.
	syl	am+mo+ni+ac
	pron	<*1m*uni2@k>
	pos	adj.
	def	a variant of {ammoniacal}.
ammoniac	ety	C14: from Latin amm*_oniacum, from Greek amm*_oniakos belonging to Ammon (apparently the gum resin was extracted from plants found in Libya near the temple of Ammon)
ammoniac	H2.0.
	syl	am+mo+ni+ac
	pron	<*1m*uni2@k>
	pos	n.
	def	a strong-smelling gum resin obtained from the stems of the N Asian umbelliferous plant and formerly used as an expectorant, stimulant, perfume, and in porcelain cement. Also called: {gum ammoniac}.
ammoniacal	0.
	syl	am+mo+ni:a+cal
	pron	<2@m*1nI*kL>
	pos	adj.
	def	of, containing, using, or resembling ammonia. Also: {ammoniac}.
ammonia solution	0.
	syl	am+mo+ni:a so+lu+tion
	pos	n.
	def	another name for {ammonium hydroxide}.
ammoniate	1.
	syl	am+mo+ni+ate
	pron	<*1m*uni2At>
	pos	vb.
	def	to unite or treat with ammonia.
ammoniate	2.
	syl	am+mo+ni+ate
	pron	<*1m*uni2At>
	pos	n.
	def	another name for {ammine}.
ammoniation	sub
	head	ammoniate
	syl	am+2mo+ni:1a+tion
	pos	n.
ammonic	0.
	syl	am+mon+ic
	pron	<*1monik>, <*1m*unik>
	pos	adj.
	def	of or concerned with ammonia or ammonium compounds.
ammonical	sub
	head	ammonic
	syl	am+1mon:i+cal
	pos	adj.
ammonifies	infl
	head	ammonify
	syl	am+mon:i+fies
	pos	vb.
ammonifying	infl
	head	ammonify
	syl	am+mon:i+fy+ing
	pos	vb.
ammonified	infl
	head	ammonify
	syl	am+mon:i+fied.
	pos	vb.
ammonify	0.
	syl	am+mon:i+fy
	pron	<*1moni2fI>, <*1m*uni->
	pos	vb.
	def	to treat or impregnate with ammonia or a compound of ammonia.
ammonification	sub
	head	ammonify
	syl	am+2mon:i+fi+1ca+tion
	pos	n.
ammonite	ety	C18: from New Latin Amm*_on*_it*_es, from Medieval Latin corn*_u Amm*_onis, literally: horn of Ammon
ammonite	H1.1.
	syl	am+mo+nite
	pron	<1@m*2nIt>
	pos	n.
	def	any extinct marine cephalopod mollusc of the order which were common in Mesozoic times and had a coiled partitioned shell. Their closest modern relative is the pearly nautilus.
ammonite	H1.2.
	syl	am+mo+nite
	pron	<1@m*2nIt>
	pos	n.
	def	the shell of any of these animals, commonly occurring as a fossil.
ammonitic	sub
	head	ammonite
	syl	am+mo+nit+ic
	pron	<2@m*1nitik>
	pos	adj.
ammonite	ety	C20: from #7ammo (#7nium) #7+ni (#7tra) #7te 
ammonite	H2.1.
	syl	am+mo+nite
	pron	<1@m*2nIt>
	pos	n.
	def	an explosive consisting mainly of ammonium nitrate with smaller amounts of other sub?!stances, such as TNT.
ammonite	H2.2.
	syl	am+mo+nite
	pron	<1@m*2nIt>
	pos	n.
	def	a nitrogenous fertilizer made from animal wastes.
Ammonites	0.
	syl	Am+mo+nites
	pron	<1@m*2nIts>
	pos	n.
	mod	pl.
	qual	Old Testament.
	def	a nomadic tribe living east of the Jordan: a persistent enemy of the Israelites.
ammonium	0.
	syl	am+mo+ni:um
	pron	<*1m*uni*m>, <-nj*m>
	pos	n.
	usage	modifier
	def	of, consisting of, or containing the monovalent group NH\4- or the ion NH%+@b\4#800030 .
	exam	1	ammonium compounds.
ammonium carbamate	0.
	syl	am+mo+ni:um car+ba+mate
	pos	n.
	def	a white soluble crystalline compound produced by reaction between dry ammonia and carbon dioxide and used as a nitrogen fertilizer. Formula: (NH\4)CO\2NH\2.
ammonium carbonate	1.
	syl	am+mo+ni:um car+bon+ate
	pos	n.
	def	an unstable pungent soluble white powder that is a double salt of ammonium bicarbonate and ammonium carbamate: used in the manufacture of baking powder, smelling salts, and ammonium compounds. Formula: (NH\4)HCO\3.(NH\4)CO\2NH\2.
ammonium carbonate	2.
	syl	am+mo+ni:um car+bon+ate
	pos	n.
	def	an unstable substance that is produced by treating this compound with ammonia. Formula: (NH\4)\2CO\3.
ammonium chloride	0.
	syl	am+mo+ni:um chlo+ride
	pos	n.
	def	a white soluble crystalline solid used chiefly as an electrolyte in dry batteries and as a mordant and soldering flux. Formula: NH\4Cl. Also called: {sal ammoniac}.
ammonium hydroxide	0.
	syl	am+mo+ni:um hy+drox+ide
	pos	n.
	def	a colourless pungent solution of ammonia and water, containing ammonium and hydroxyl ions and used in the manufacture of rayon, rubber, and plastics, in photography, in pharmaceuticals, and as a household cleans?!er. Formula: NH\4OH. Also called: {ammonia solution, aqua ammoniae}.
ammonium nitrate	0.
	syl	am+mo+ni:um ni+trate
	pos	n.
	def	a colourless highly soluble crystalline solid used mainly as a fertilizer and in explosives and pyrotechnics. Formula: NH\4NO\3.
ammonium sulphate	0.
	syl	am+mo+ni:um sul+phate
	pos	n.
	def	a white soluble crystalline solid used mainly as a fertilizer and in water purification. Formula: (NH\4)\2SO\4.
ammunition	ety	C17: from obsolete French amunition, by mistaken division from earlier la munition; see #7munition 
ammunition	1.
	syl	am+mu+ni+tion
	pron	<2@mju1niS*n>
	pos	n.
	def	any projectiles, such as bullets, rockets, etc., that can be discharged from a weapon.
ammunition	2.
	syl	am+mu+ni+tion
	pron	<2@mju1niS*n>
	pos	n.
	def	bombs, missiles, chemicals, biological agents, nuclear materi?!als, etc., capable of use as weapons.
ammunition	3.
	syl	am+mu+ni+tion
	pron	<2@mju1niS*n>
	pos	n.
	def	any means of defence or attack, as in an argument.
amnesia	ety	C19: via New Latin from Greek: forgetfulness, probably from amn*_estia oblivion; see #7amnesty 
amnesia	0.
	syl	am+ne+si:a
	pron	<@m1nEzi*>
	pos	n.
	def	partial or total loss of memory.
amnesiac	sub
	head	amnesia
	or	amnesic
	syl	am+ne+si+ac
	pron	<@m1nEzi?!2@k>
	pos	adj. n.
amnesic	sub
	head	amnesia
	or	amnesiac
	syl	am+ne+sic
	pron	<@m1nEsik>, <-zik>
	pos	adj. n.
amnesty	ety	C16: from Latin amn*_estia, from Greek: oblivion, from amn*_estos forgetting, from #7a -%1#7+ -mn*_estos, from mnasthai to remember
amnesties	infl
	head	amnesty
	syl	am+nes+ties.
	pos	n.
	mod	pl.
amnesty	1.
	syl	am+nes+ty
	pron	<1@mnisti>
	pos	n.
	def	a general pardon, esp. for offences against a government.
amnesty	2.
	syl	am+nes+ty
	pron	<1@mnisti>
	pos	n.
	def	a period during which a law is suspended to allow offenders to admit their crime without fear of prosecution.
amnesty	3.
	syl	am+nes+ty
	pron	<1@mnisti>
	pos	n.
	qual	Law.
	def	a pardon granted by the Crown and effected by statute, effective for a limited period of time.
amnesties	infl
	head	amnesty
	syl	am+nes+ties
	pos	vb.
amnestying	infl
	head	amnesty
	syl	am+nes+ty+ing
	pos	vb.
amnestied	infl
	head	amnesty
	syl	am+nes+tied.
	pos	vb.
amnesty	4.
	syl	am+nes+ty
	pron	<1@mnisti>
	pos	vb.
	mod	tr.
	def	to overlook or forget (an offence).
amniocenteses	infl
	head	amniocentesis
	syl	am+ni:o+cen+te:ses
	pron	<-sEz>
	pos	n.
	mod	pl.
amniocentesis	0.
	syl	am+ni:o+cen+te:sis
	pron	<2@mni*usen1tEsis>
	pos	n.
	def	removal of some amniotic fluid for therapeutic or diagnostic purposes.
amnion	ety	C17: via New Latin from Greek: a little lamb, from amnos a lamb
amnions	infl
	head	amnion
	or	amnia
	syl	am+ni+ons
	pron	<-ni*>
	pos	n.
	mod	pl.
amnia	infl
	head	amnion
	or	amnions
	syl	am+ni:a
	pron	<-ni*>
	pos	n.
	mod	pl.
amnion	0.
	syl	am+ni+on
	pron	<1@mni*n>
	pos	n.
	def	the innermost of two membranes (see also {chorion}) enclosing an embryonic reptile, bird, or mammal.
amniotic	sub
	head	amnion
	syl	am+ni+ot+ic
	pron	<2@mni?!1otik>
	pos	adj.
amoeba	ety	C19: from New Latin, from Greek amoib*_e change, from ameibein to change, exchange
ameba	alt
	head	amoeba
	or	amoeba
	syl	a:me:ba
	pron	<*1mEb*>
	pos	n.
	qual	U.S.
amoebae	infl
	head	amoeba
	or	amoebas
	syl	a:moe+bae
	pron	<-bE>
	pos	n.
	mod	pl.
amoebas	infl
	head	amoeba
	or	amoebae
	syl	a:moe+bas.
	pos	n.
	mod	pl.
amoeba	0.
	or	ameba
	syl	a:moe+ba
	pron	<*1mEb*>
	pos	n.
	def	any protozoan of the order esp. any of the genus able to change shape because of the movements of cell processes (pseudopodia): class They live in fresh water or soil or as parasites in man and animals.
amoebic	sub
	head	amoeba
	or	amebic
	syl	a:1moe+bic
	pos	adj.
amebic	sub
	head	amoeba
	or	amoebic
	syl	a:1me:bic
	pos	adj.
	qual	U.S.
amoebean	alt
	head	amoebaean
	or	amoebaean
	syl	am+oe:be:an
	pron	<2@mi1bE*n>
	pos	adj.
amoebaean	0.
	or	amoebean
	syl	am+oe:bae:an
	pron	<2@mi1bE*n>
	pos	adj.
	qual	Prosody.
	def	of or relating to lines of verse dialogue that answer each other alternately.
amoebiases	infl
	head	amoebiasis
	syl	am+oe:bi:a+ses
	pron	<-2sEz>
	pos	n.
	mod	pl.
amoebiasis	0.
	syl	am+oe:bi:a+sis
	pron	<2@mi1bI*sis>
	pos	n.
	def	infection, esp. of the intestines, caused by the parasitic amoeba
amoebic dysentery	0.
	syl	a:moe+bic dys+en+ter:y
	pos	n.
	def	inflammation of the intestines caused by the parasitic amoeba
amebocyte	alt
	head	amoebocyte
	or	amoebocyte
	syl	a:me:bo+cyte
	pron	<*1mEb*2sIt>
	pos	n.
	qual	U.S.
amoebocyte	0.
	or	amebocyte
	syl	a:moe+bo+cyte
	pron	<*1mEb*2sIt>
	pos	n.
	def	any amoeboid cell found in the blood and body fluids. Some kinds, such as the phagocytic white blood cell, can engulf foreign particles.
ameboid	alt
	head	amoeboid
	or	amoeboid
	syl	a:me:boid
	pron	<*1mEbcid>
	pos	adj.
	qual	U.S.
amoeboid	0.
	or	ameboid
	syl	a:moe+boid
	pron	<*1mEbcid>
	pos	adj.
	def	of, related to, or resembling amoebae.
amok	0.
	syl	a:mok
	pron	<*1m^k>, <*1mok>
	pos	n. adv.
	def	a variant spelling of {amuck}.
Amon	0.
	syl	A:mon
	pron	<1a:m*n>
	pos	n.
	qual	Egyptian myth.
	def	a variant spelling of {Amen}.
among	ety	Old English amang, contracted from on gemang in the group of, from #7on+ gemang crowd; see #7mingle, mongrel #e Usage. See at between.
amongst	alt
	head	among
	or	among
	syl	a:mongst
	pos	prep.
among	1.
	or	amongst
	syl	a:mong
	pron	<*1m^G>
	pos	prep.
	def	in the midst of.
	exam	1	he lived among the Indians.
among	2.
	or	amongst
	syl	a:mong
	pron	<*1m^G>
	pos	prep.
	def	to each of.
	exam	1	divide the reward among yourselves.
among	3.
	or	amongst
	syl	a:mong
	pron	<*1m^G>
	pos	prep.
	def	in the group, class, or number of.
	exam	1	ranked among the greatest writers.
among	4.
	or	amongst
	syl	a:mong
	pron	<*1m^G>
	pos	prep.
	def	taken out of (a group).
	exam	1	he is only one among many.
among	5.
	or	amongst
	syl	a:mong
	pron	<*1m^G>
	pos	prep.
	def	with one another within a group; by the joint action of.
	exam	1	a lot of gossip among the women employees;
	exam	2	decide it among yourselves.
amontillado	ety	C19: from Spanish vino amontillado wine of Montilla, town in Spain
amontillado	0.
	syl	a:mon+til+la+do
	pron	<*2monti1la:d*u>
	pos	n.
	def	a medium dry Spanish sherry, not as pale in colour as a fino.
amoral	1.
	syl	a:mor+al
	pron	<@1mor*l>, <A->
	pos	adj.
	def	having no moral quality; non-moral.
amoral	2.
	syl	a:mor+al
	pron	<@1mor*l>, <A->
	pos	adj.
	def	without moral standards or principles.
amorality	sub
	head	amoral
	syl	a:mo+ral+i:ty
	pron	<2@mo1r@liti>, <1Amo->
	pos	n. n.
amorally	sub
	head	amoral
	syl	a:1mor+al+ly
amoretto	ety	C16: from Italian, diminutive of Amore Cupid, from Latin Amor Love
amorino	alt
	head	amoretto
	or	amoretto
	syl	a:mo+ri+no
	pron	<2@mc:1rEn*u>
	pos	n.
amoretti	infl
	head	amoretto
	or	amorini
	syl	a:mo+ret+ti
	pron	<-1reti>
	pos	n.
	mod	pl.
amorini	infl
	head	amoretto
	or	amoretti
	syl	a:mo+ri+ni
	pron	<-1rEni>
	pos	n.
	mod	pl.
amoretto	0.
	or	amorino
	syl	a:mo+ret+to
	pron	<2@m*1ret*u>
	pos	n.
	usage	esp. in painting
	def	a small chubby naked boy representing a cupid. Also called: {putto}.
amorist	0.
	syl	am:o+rist
	pron	<1@m*rist>
	pos	n.
	def	a lover or a writer about love.
amoroso	ety	from Italian and Spanish: #7amorous 
amoroso	1.
	syl	am:o+ro+so
	pron	<2@m*1r*us*u>
	pos	adj. adv.
	qual	Music.
	def	lovingly. {~}
amoroso	2.
	syl	am:o+ro+so
	pron	<2@m*1r*us*u>
	pos	adj. adv.
	def	a rich sweetened sherry of a dark colour.
amorous	ety	C14: from Old French, from Medieval Latin am*_or*_osus, from Latin amor love
amorous	1.
	syl	am:o+rous
	pron	<1@m*r*s>
	pos	adj.
	def	inclined towards or displaying love or desire.
amorous	2.
	syl	am:o+rous
	pron	<1@m*r*s>
	pos	adj.
	def	in love.
amorous	3.
	syl	am:o+rous
	pron	<1@m*r*s>
	pos	adj.
	def	of or relating to love.
amorously	sub
	head	amorous
	syl	am:o+rous+ly
	pos	adv.
amorousness	sub
	head	amorous
	syl	am:o+rous+ness
	pos	n.
amor patriae	0.
	syl	a:mor pa+tri:ae
	pron	Latin. <1@mc:> <1p@tri2E>
	pos	n.
	def	love of one's country; patriotism.
amorphous	ety	C18: from New Latin, from Greek amorphos shapeless, from #7a -%1#7+ morph*_e shape
amorphous	1.
	syl	a:mor+phous
	pron	<*1mc:f*s>
	pos	adj.
	def	lacking a definite shape; formless.
amorphous	2.
	syl	a:mor+phous
	pron	<*1mc:f*s>
	pos	adj.
	def	of no recognizable character or type.
amorphous	3.
	syl	a:mor+phous
	pron	<*1mc:f*s>
	pos	adj.
	usage	of chemicals, rocks, etc.
	def	not having a crystalline structure.
amorphism	sub
	head	amorphous
	syl	a:1mor+phism
	pos	n.
amorphously	sub
	head	amorphous
	syl	a:1mor+phous+ly
	pos	adv.
amorphousness	sub
	head	amorphous
	syl	a:1mor+phous+ness
	pos	n.
amortisation	alt
	head	amortization
	or	amortization
	syl	a:mor+ti+sa+tion
	pron	<*2mc:tI1zAS*n>
	pos	n.
amortization	1.a.
	or	amortisation
	syl	a:mor+ti+za+tion
	pron	<*2mc:tI1zAS*n>
	pos	n.
	def	the process of amortizing a debt.
amortization	1.b.
	or	amortisation
	syl	a:mor+ti+za+tion
	pron	<*2mc:tI1zAS*n>
	pos	n.
	def	the money devoted to amortizing a debt.
amortization	2.
	or	amortisation
	syl	a:mor+ti+za+tion
	pron	<*2mc:tI1zAS*n>
	pos	n.
	usage	in computing the redemption yield on a bond purchased at a premium
	def	the amount that is subtracted from the annual yield. { Compare {accumulation} (sense 3b)}.
amortizement	sub
	head	amortization
	or	amortisement
	syl	a:mor+tize+ment
	pron	<*1mc:tizm*nt>
	pos	n.
amortisement	sub
	head	amortization
	or	amortizement
	syl	a:mor+tise+ment
	pron	<*1mc:tizm*nt>
	pos	n.
amortize	ety	C14: from Medieval Latin admortiz*_are, from Old French amortir to reduce to the point of death, ultimately from Latin ad to+ mors death
amortise	alt
	head	amortize
	or	amortize
	syl	a:mor+tise
	pron	<*1mc:tIz>
	pos	vb.
	mod	tr.
amortize	1.
	or	amortise
	syl	a:mor+tize
	pron	<*1mc:tIz>
	pos	vb.
	mod	tr.
	qual	Finance.
	def	to liquidate (a debt, mortgage, etc.) by instalment payments or by periodic transfers to a sinking fund.
amortize	2.
	or	amortise
	syl	a:mor+tize
	pron	<*1mc:tIz>
	pos	vb.
	mod	tr.
	def	to write off (a wasting asset) by annual transfers to a sinking fund.
amortize	3.
	or	amortise
	syl	a:mor+tize
	pron	<*1mc:tIz>
	pos	vb.
	mod	tr.
	usage	Property law. formerly
	def	to transfer (lands, etc.) in mortmain.
amortizable	sub
	head	amortize
	or	amortisable
	syl	a:1mor+tiz+a:ble
	pos	adj.
amortisable	sub
	head	amortize
	or	amortizable
	syl	a:1mor+tis+a:ble
	pos	adj.
Amos	1.
	syl	A:mos
	pron	<1Amos>
	pos	n.
	qual	Old Testament.
	def	a Hebrew prophet of the 8th century #7b.c.
Amos	2.
	syl	A:mos
	pron	<1Amos>
	pos	n.
	qual	Old Testament.
	def	the book containing his oracles.
amount	ety	C13: from Old French amonter to go up, from amont upwards, from a to +mont mountain (from Latin m*_ons) 
amount	1.
	syl	a:mount
	pron	<*1maunt>
	pos	n.
	def	extent; quantity; supply.
amount	2.
	syl	a:mount
	pron	<*1maunt>
	pos	n.
	def	the total of two or more quantities; sum.
amount	3.
	syl	a:mount
	pron	<*1maunt>
	pos	n.
	def	the full value, effect, or significance of something.
amount	4.
	syl	a:mount
	pron	<*1maunt>
	pos	n.
	def	a principal sum plus the interest on it, as in a loan.
amount	5.
	syl	a:mount
	pron	<*1maunt>
	pos	vb.
	mod	intr.
	usage	usually foll. by to
	def	to be equal or add up in effect, meaning, or quantity.
amour	ety	C13: from Old French, from Latin amor love
amour	0.
	syl	a:mour
	pron	<*1mu*>
	pos	n.
	def	a love affair, esp. a secret or illicit one.
amour-propre	0.
	syl	a:mour-pro:pre
	pron	French. <amu:r1prcpr>
	pos	n.
	def	self-respect.
amowt	0.
	syl	a:mowt
	pron	<*1maut>
	pos	n.
	def	a variant spelling of {amaut}.
Amoy	1.
	syl	A:moy
	pron	<*1mci>
	pos	n.
	def	a port in SE China, in Fukien province on {Amoy Island}, at the mouth of the Chiu-lung River opposite Taiwan: one of the first treaty ports opened to European trade (1842). Pop.: 224300 (1953). Modern Chinese name: {Hsia-men}.
Amoy	2.
	syl	A:moy
	pron	<*1mci>
	pos	n.
	def	the dialect of Chinese spoken in Amoy, Taiwan, and elsewhere: a Min dialect.
amp	1.
	syl	amp.
	qual	abbrev. for:
	def	amperage.
amp	2.
	syl	amp.
	qual	abbrev. for:
	def	ampere.
AMP	0.
	syl	AMP
	qual	abbrev. for
	def	adenosine monophosphate.
ampelopsis	ety	C19: from New Latin, from Greek ampelos grapevine
ampelopsis	0.
	syl	am+pe+lop+sis
	pron	<2@mpi1lopsis>
	pos	n.
	def	any woody vine of the vitaceous genus of tropical and subtropical Asia and America.
amperage	0.
	syl	am+per+age
	pron	<1@mp*riJ>
	pos	n.
	def	the strength of an electric current measured in amperes, esp. the rated current of an electrical component or device.
ampere	ety	C19: named after A. M. A#7mp*`ere 
ampere	1.
	syl	am+pere
	pron	<1@mpe*>
	pos	n.
	def	the basic SI unit of electric current; the constant current that, when maintained in two parallel conductors of infinite length and negligible cross section placed 1 metre apart in a vacuum, produces a force of 2#M10%#-%7 newton per metre between them. 1 ampere is equivalent to 1 coulomb per second.
ampere	2.
	syl	am+pere
	pron	<1@mpe*>
	pos	n.
	def	a former unit of electric current ({international ampere}) ; the current that, when passed through a solution of silver nitrate, deposits silver at the rate of 0.001118 gram per second. 1 international ampere equals 0.999835 ampere.
ampere	xref
	syl	am+pere
	pron	<1@mpe*>
	pos	n.
	def	Abbrev.: {amp}. Symbol: A
Andr'e Marie	infl
	head	Ampere
	syl	An:dr*'e Ma:rie
	pron	<*~a1drA> <ma1ri>
	pos	n.
Ampere	0.
	syl	Am:p*`ere
	pron	<1@mpe*>, French <*~a1pe:r>
	pos	n.
	def	1775-1836, French physicist and mathematician, who made major discoveries in the fields of magnetism and electricity.
ampere-hour	0.
	syl	am:pere-hour
	pos	n.
	def	a practical unit of quantity of electricity; the quantity that flows in one hour through a conductor carrying a current of one ampere. 1 ampere-hour is equivalent to 3600 coulombs.
ampere-turn	0.
	syl	am:pere-turn
	pos	n.
	def	a unit of magnetomotive force; the magnetomotive force produced by a current of 1 ampere passing through one complete turn of a coil. 1 ampere-turn is equivalent to 4#Gr/10 or 1.257 gilberts.
ampersand	ety	C19: shortened from and per se and, that is, the symbol ?&#800033 by itself (represents) and 
ampersand	0.
	syl	am+per+sand
	pron	<1@mp*2s@nd>
	pos	n.
	def	the character (?&#800031) , meaning
amphetamine	ety	C20: from #7a (#7lpha) #7+m (#7ethyl) #7+ph (#7enyl) #7+et (#7hyl) #7+amine 
amphetamine	0.
	syl	am+phet:a+mine
	pron	<@m1fet*2mEn>, <-min>
	pos	n.
	def	a synthetic colourless volatile liquid used medicinally, mainly for its stimulant action on the central nervous system, although it also stimulates the sympathetic nervous system. It can have unpleasant or dangerous side effects and drug dependence can occur; 1-phenyl-2-aminopropane. Formula: C\6H\5CH\2CH(NH\2)CH\3.
amphi-	ety	from Greek
amphi-	0.
	syl	am:phi-
	exam	1	prefix of nouns and adjectives.
amphi-	1.
	syl	am:phi-
	def	on both sides; at both ends; of both kinds.
	exam	1	amphipod;
	exam	2	amphitrichous;
	exam	3	amphibi?!ous.
amphi-	2.
	syl	am:phi-
	def	around.
	exam	1	amphibole.
amphiarthrosis	ety	C19: from #7amphi -#7+ Greek arthr*_osis articulation, from arthron a joint
amphiarthroses	infl
	head	amphiarthrosis
	syl	am+phi+ar+thro+ses
	pron	<-sEz>
	pos	n.
	mod	pl.
amphiarthrosis	0.
	syl	am+phi+ar+thro+sis
	pron	<2@mfia:1Tr*usis>
	pos	n.
	qual	Anatomy.
	def	a type of articulation permitting only slight movement, as between the vertebrae of the backbone.
amphiaster	ety	C19: from #7amphi -+New Latin aster; see #7aster 
amphiaster	0.
	syl	am+phi+as+ter
	pron	<1@mfi2@st*>
	pos	n.
	qual	Cytology.
	def	the structure that occurs in a cell undergoing mitosis, consisting of a spindle with an aster at each end.
amphibian	1.
	syl	am+phib+i:an
	pron	<@m1fibi*n>
	pos	n.
	def	any cold-blooded vertebrates of the class typically living on land but breeding in water. Their aquatic larvae (tadpoles) undergo metamorphosis into the adult form. The class includes the newts and salamanders, frogs and toads, and caecilians.
amphibian	2.
	syl	am+phib+i:an
	pron	<@m1fibi*n>
	pos	n.
	def	a type of aircraft able to land and take off from both water and land.
amphibian	3.
	syl	am+phib+i:an
	pron	<@m1fibi*n>
	pos	n.
	def	any vehicle able to travel on both water and land.
amphibian	4.
	syl	am+phib+i:an
	pron	<@m1fibi*n>
	pos	adj.
	def	another word for {amphibious}.
amphibian	5.
	syl	am+phib+i:an
	pron	<@m1fibi*n>
	pos	adj.
	def	of, relating to, or belonging to the class
amphibiotic	0.
	syl	am+phi+bi+ot+ic
	pron	<2@mfibI1otik>
	pos	adj.
	def	having an aquatic larval form and a terrestrial adult form, as amphibians.
amphibious	ety	C17: from Greek amphibios, literally: having a double life, from #7amphi -#7+ bios life
amphibious	1.
	syl	am+phib:i+ous
	pron	<@m1fibi*s>
	pos	adj.
	def	able to live both on land and in the water, as frogs, toads, etc.
amphibious	2.
	syl	am+phib:i+ous
	pron	<@m1fibi*s>
	pos	adj.
	def	designed for operation on or from both water and land.
amphibious	3.
	syl	am+phib:i+ous
	pron	<@m1fibi*s>
	pos	adj.
	def	relating to military forces and equipment organized for operations launched from the sea against an enemy shore.
amphibious	4.
	syl	am+phib:i+ous
	pron	<@m1fibi*s>
	pos	adj.
	def	having a dual or mixed nature.
amphibiously	sub
	head	amphibious
	syl	am+1phib:i+ous+ly
	pos	adv.
amphibiousness	sub
	head	amphibious
	syl	am+1phib:i+ous+ness
	pos	n.
amphiblastula	0.
	syl	am+phi+blas+tu+la
	pron	<2@mfi1bl@stjul*>
	pos	n.
	def	the free-swimming larva of certain sponges, which consists of a hollow spherical mass of cells some of which have flagella.
amphibole	ety	C17: from French, from Greek amphibolos uncertain; so called from the large number of varieties in the group
amphibole	0.
	syl	am+phi+bole
	pron	<1@mfi2b*ul>
	pos	n.
	def	any of a large group of minerals consisting of the silicates of calcium, iron, magnesium, sodium, and aluminium, usually in the form of long slender dark-coloured crystals. Members of the group, including hornblende, actinolite, and tremolite, are common constituents of igneous rocks.
amphibolite	0.
	syl	am+phib:o+lite
	pron	<@m1fib*2lIt>
	pos	n.
	def	a metamorphic rock consisting mainly of amphibole and plagioclase.
amphibology	ety	C14: from Late Latin amphibologia, ultimately from Greek amphibolos ambiguous; see #7amphibole, -#7logy 
amphiboly	alt
	head	amphibology
	or	amphibology
	syl	am+phib:o+ly
	pron	<@m1fib*li>
	pos	n.
amphibologies	infl
	head	amphibology
	or	amphibolies
	syl	am+phi+bol+o:gies
	pos	n.
	mod	pl.
amphibolies	infl
	head	amphibology
	or	amphibologies
	syl	am+phi+bolies.
	pos	n.
	mod	pl.
amphibology	0.
	or	amphiboly
	syl	am+phi+bol+o:gy
	pron	<2@mfi1bol*Ji>
	pos	n.
	def	ambiguity of expression, esp. when due to a grammatical construction, as in
amphibolic	sub
	head	amphibology
	or	amphibolous
	syl	am+phi+1bol+ic
	pron	<@m1fib*l*s>
	pos	adj.
amphibolous	sub
	head	amphibology
	or	amphibolic
	syl	am+phib:o+lous
	pron	<@m1fib*l*s>
	pos	adj.
amphibological	sub
	head	amphibology
	syl	am+phib:o+log:i+cal
	pron	<@m2fib*1loJikL>
	pos	adj.
amphibologically	sub
	head	amphibology
	syl	am+2phib:o+1log:i+cal+ly
	pos	adv.
amphibrach	ety	C16: from Latin, from Greek amphibrakhus, literally: both ends being short, from #7amphi -#7+ brakhus short
amphibrach	0.
	syl	am+phi+brach
	pron	<1@mfi2br@k>
	pos	n.
	qual	Prosody.
	def	a metrical foot consist?!ing of a long syllable between two short syllables (*u *_ *u ). Compare {cretic}.
amphibrachic	sub
	head	amphibrach
	syl	am+phi+1brach+ic
	pos	adj.
amphichromatic	alt
	head	amphichroic
	or	amphichroic
	syl	am+phi+chro+mat+ic
	pron	<2@mfikr*u1m@tik>
	pos	adj.
amphichroic	0.
	or	amphichromatic
	syl	am+phi+chro+ic
	pron	<2@mfi1kr*uik>
	pos	adj.
	def	producing two colours, one on reacting with an acid, the other on reacting with a base.
amphicoelous	ety	C19: from #7amphi -#7+ Greek koilos hollow
amphicoelous	0.
	syl	am+phi+coe+lous
	pron	<2@mfi1sEl*s>
	pos	adj.
	usage	of the vertebrae of most fishes and some amphibians
	def	concave at the anterior and posterior ends.
amphictyon	ety	C16: back formation from amphictyons, from Greek amphiktiones neighbours, from #7amphi -#7+ ktizein to found
amphictyon	0.
	syl	am+phic+ty+on
	pron	<@m1fikti*n>
	pos	n.
	def	a delegate to an amphictyonic council.
amphictyonies	infl
	head	amphictyony
	syl	am+phic+ty:o+nies.
	pos	n.
	mod	pl.
amphictyony	0.
	syl	am+phic+ty:o+ny
	pron	<@m1fikti*ni>
	pos	n.
	usage	in ancient Greece
	def	a religious association of states for the maintenance of temples and the cults connected with them.
amphictyonic	sub
	head	amphictyony
	syl	am+phic+ty+on+ic
	pron	<@m2fikti1onik>
	pos	adj.
amphidiploid	0.
	syl	am+phi+dip+loid
	pron	<2@mfi1diplcid>
	pos	n.
	def	a hybrid plant in which the chromosome number is the sum of the chromosome numbers of both parental species.
amphigory	ety	C19: from French amphigouri, of unknown origin
amphigouri	alt
	head	amphigory
	or	amphigory
	syl	am+phi+gou+ri
	pron	<1@mfi2gu*ri>
	pos	n.
amphigories	infl
	head	amphigory
	or	amphigoris
	syl	am+phi+go+ries
	pos	n.
	mod	pl.
amphigoris	infl
	head	amphigory
	or	amphigories
	syl	am+phi+go+ris.
	pos	n.
	mod	pl.
amphigory	0.
	or	amphigouri
	syl	am+phi+go+ry
	pron	<1@mfig*ri>
	pos	n.
	def	a piece of nonsensical writing in verse or, less commonly, prose.
amphigoric	sub
	head	amphigory
	syl	am+phi+gor+ic
	pron	<2@mfi1gorik>
	pos	adj.
amphimacer	ety	C16: from Latin amphimacrus, from Greek amphimakros both ends being long, from #7amphi -#7+ makros long
amphimacer	0.
	syl	am+phim:a+cer
	pron	<@m1fim*s*>
	pos	n.
	qual	Prosody.
	def	another word for {cretic}.
amphimixis	ety	C19: from #7amphi -#7+ Greek mixis a blending, from mignunai to mingle &- am+phi+mic+tic (@!@amf$I#!m$Ikt$Ik) adj.
amphimixes	infl
	head	amphimixis
	syl	am+phi+mix:es
	pron	<-1miksEz>
	pos	n.
	mod	pl.
amphimixis	0.
	syl	am+phi+mix+is
	pron	<2@mfi1miksis>
	pos	n.
	def	true sexual reproduction, esp. the fusion of gametes from two organisms. Compare {apomixis}.
amphioxus	ety	C19: from New Latin: both ends being sharp, from #7amphi -#7+ Greek oxus sharp
amphioxi	infl
	head	amphioxus
	or	amphioxuses
	syl	am+phi+ox:i
	pron	<-1oksI>
	pos	n.
	mod	pl.
amphioxuses	infl
	head	amphioxus
	or	amphioxi
	syl	am+phi+ox+us:es.
	pos	n.
	mod	pl.
amphioxus	0.
	syl	am+phi+ox+us
	pron	<2@mfi1oks*s>
	pos	n.
	def	another name for the {lancelet}.
amphipod	1.
	syl	am+phi+pod
	pron	<1@mfi2pod>
	pos	n.
	def	any marine or freshwater crustacean of the order such as the sand hoppers, in which the body is laterally compressed: subclass
amphipod	2.
	syl	am+phi+pod
	pron	<1@mfi2pod>
	pos	adj.
	def	of, relating to, or belonging to the
amphiprostyle	0.
	syl	am+phip+ro+style
	pron	<@m1fipr*2stIl>, <2@mfi1pr*ustIl>
	pos	adj.
	usage	esp. of a classical temple
	def	having a set of columns at both ends but not at the sides.
amphiprostylar	sub
	head	amphiprostyle
	syl	am+2phip+ro+1sty+lar
	pos	adj.
amphiprotic	0.
	syl	am+phi+pro+tic
	pron	<2@mfi1pr*utik>
	pos	adj.
	def	another word for {amphoteric}.
amphisbaena	ety	C16: via Latin from Greek amphisbaina, from amphis both ways+ bainein to go
amphisbaenae	infl
	head	amphisbaena
	or	amphisbaenas
	syl	am+phis+bae+nae
	pron	<-nE>
	pos	n.
	mod	pl.
amphisbaenas	infl
	head	amphisbaena
	or	amphisbaenae
	syl	am+phis+bae+nas.
	pos	n.
	mod	pl.
amphisbaena	1.
	syl	am+phis+bae+na
	pron	<2@mfis1bEn*>
	pos	n.
	def	any worm lizard of the genus
amphisbaena	2.
	syl	am+phis+bae+na
	pron	<2@mfis1bEn*>
	pos	n.
	qual	Classical myth.
	def	a poisonous serpent having a head at each end and able to move forwards or backwards.
amphisbaenic	sub
	head	amphisbaena
	syl	am+phis+1bae+nic
	pos	adj.
amphistylar	0.
	syl	am+phi+sty+lar
	pron	<2@mfi1stIl*>
	pos	adj.
	usage	esp. of a classical temple
	def	having a set of columns at both ends or at both sides.
amphitheater	alt
	head	amphitheatre
	or	amphitheatre
	syl	am+phi+the:a+ter
	pron	<1@mfi2Ti*t*>
	pos	n.
	qual	U.S.
amphitheatre	1.
	or	amphitheater
	syl	am+phi+the:a+tre
	pron	<1@mfi2Ti*t*>
	pos	n.
	def	a building, usually circular or oval, in which tiers of seats rise from a central open arena, as in those of ancient Rome.
amphitheatre	2.
	or	amphitheater
	syl	am+phi+the:a+tre
	pron	<1@mfi2Ti*t*>
	pos	n.
	def	a place where contests are held; arena.
amphitheatre	3.
	or	amphitheater
	syl	am+phi+the:a+tre
	pron	<1@mfi2Ti*t*>
	pos	n.
	def	any level circular area of ground surrounded by higher ground.
amphitheatre	4.a.
	or	amphitheater
	syl	am+phi+the:a+tre
	pron	<1@mfi2Ti*t*>
	pos	n.
	def	the first tier of seats in the gallery of a theatre.
amphitheatre	4.b.
	or	amphitheater
	syl	am+phi+the:a+tre
	pron	<1@mfi2Ti*t*>
	pos	n.
	def	any similarly designated seating area in a theatre.
amphitheatre	5.
	or	amphitheater
	syl	am+phi+the:a+tre
	pron	<1@mfi2Ti*t*>
	pos	n.
	def	a lecture room in which seats are tiered away from a central area.
amphitheatric	sub
	head	amphitheatre
	or	amphitheatrical
	syl	am+phi+the:at+ric
	pron	<2@mfiTi1@trik>
	pos	adj.
amphitheatrical	sub
	head	amphitheatre
	or	amphitheatric
	syl	am+phi+the:1at+ri+cal
	pos	adj.
amphitheatrically	sub
	head	amphitheatre
	syl	am+phi+the:1at+ri+cal+ly
	pos	adv.
amphithecium	ety	C19: from New Latin, from #7amphi -#7+ Greek th*_ekion a little case, from th*_ek*_e case
amphithecia	infl
	head	amphithecium
	syl	am+phi+the:ci:a
	pron	<-si*>
	pos	n.
	mod	pl.
amphithecium	0.
	syl	am+phi+the:ci:um
	pron	<2@mfi1TEsi*m>
	pos	n.
	def	the outer layer of cells of the embryo of mosses and liverworts that develops into the outer parts of the spore-bearing capsule.
amphitricha	ety	C20: from #7amphi -#7+ -tricha, from Greek thrix hair
amphitricha	0.
	syl	am+phit+ri+cha
	pron	<@m1fitrik*>
	pos	n.
	def	bacteria that have flagella at both ends.
amphitrichous	sub
	head	amphitricha
	syl	am+1phit+ri+chous
	pos	adj.
Amphitrite	0.
	syl	Am:phi:tri:te
	pron	<2@mfi1trIti>
	pos	n.
	qual	Greek myth.
	def	a sea goddess, wife of Poseidon and mother of Triton.
amphitropous	0.
	syl	am+phit+ro+pous
	pron	<@m1fitr*p*s>
	pos	adj.
	usage	of a plant ovule
	def	partially inverted so that the base and the micropyle at the apex are the same distance from the funicle.
Amphitryon	0.
	syl	Am:phit:ry:on
	pron	<@m1fitri*n>
	pos	n.
	qual	Greek myth.
	def	the grandson of Perseus and husband of Alcmene.
amphora	ety	C17: from Latin, from Greek amphoreus, from #7amphi -#7+ phoreus bearer, from pherein to bear
amphorae	infl
	head	amphora
	or	amphoras
	syl	am+pho+rae
	pron	<-f*2rE>
	pos	n.
	mod	pl.
amphoras	infl
	head	amphora
	or	amphorae
	syl	am+pho+ras.
	pos	n.
	mod	pl.
amphora	0.
	syl	am+pho+ra
	pron	<1@mf*r*>
	pos	n.
	def	an ancient Greek or Roman two-handled narrow-necked jar for oil, wine, etc.
amphoteric	ety	C19: from Greek amphoteros each of two (from amph*_o both)+-#7ic 
amphoteric	0.
	syl	am+pho+ter+ic
	pron	<2@mf*1terik>
	pos	adj.
	qual	Chem.
	def	able to function as either a base or an acid. Also: {amphiprotic}.
ample	ety	C15: from Old French, from Latin amplus spacious
ample	1.
	syl	am+ple
	pron	<1@mpL>
	pos	adj.
	def	more than sufficient; abundant.
	exam	1	an ample helping.
ample	2.
	syl	am+ple
	pron	<1@mpL>
	pos	adj.
	def	large in size, extent, or amount.
	exam	1	of ample proportions.
ampleness	sub
	head	ample
	syl	am+ple+ness
	pos	n.
amplexicaul	ety	C18: from New Latin amplexicaulis, from Latin amplect*_i to embrace+ caulis stalk
amplexicaul	0.
	syl	am+plex:i+caul
	pron	<@m1pleksi2kc:l>
	pos	adj.
	usage	of some sessile leaves, stipules, etc.
	def	having an enlarged base that encircles the stem.
amplification	1.
	syl	am+pli+fi+ca+tion
	pron	<2@mplifi1kAS*n>
	pos	n.
	def	the act or result of amplifying.
amplification	2.
	syl	am+pli+fi+ca+tion
	pron	<2@mplifi1kAS*n>
	pos	n.
	def	material added to a statement, story, etc., in order to expand or clarify it.
amplification	3.
	syl	am+pli+fi+ca+tion
	pron	<2@mplifi1kAS*n>
	pos	n.
	def	a statement, story, etc., with such additional material.
amplification	4.a.
	syl	am+pli+fi+ca+tion
	pron	<2@mplifi1kAS*n>
	pos	n.
	def	the increase in strength of an electrical signal or sound by means of an amplifier.
	4.b.
	head	amplification
	syl	{
	def	another word for {gain%1} (sense 13)}.
amplifier	1.
	syl	am+pli+fi+er
	pron	<1@mpli2fI*>
	pos	n.
	def	an electronic device used to increase the strength of the current or voltage signal fed into it.
amplifier	2.
	syl	am+pli+fi+er
	pron	<1@mpli2fI*>
	pos	n.
	def	such a device used for the amplification of sound in a radio, record player, etc.
amplifier	3.
	syl	am+pli+fi+er
	pron	<1@mpli2fI*>
	pos	n.
	qual	Photog.
	def	an additional lens for altering the focal length of a camera lens.
amplifier	4.
	syl	am+pli+fi+er
	pron	<1@mpli2fI*>
	pos	n.
	def	a person or thing that amplifies.
amplify	ety	C15: from Old French amplifier, ultimately from Latin amplific*_are to enlarge, from amplus spacious+ facere to make
amplifies	infl
	head	amplify
	syl	am+pli+fies
	pos	vb.
amplifying	infl
	head	amplify
	syl	am+pli+fy+ing
	pos	vb.
amplified	infl
	head	amplify
	syl	am+pli+fied.
	pos	vb.
amplify	1.
	syl	am+pli+fy
	pron	<1@mpli2fI>
	pos	vb.
	mod	tr.
	def	to increase in size, extent, effect, etc., as by the addition of extra material; augment; enlarge; expand.
amplify	2.
	syl	am+pli+fy
	pron	<1@mpli2fI>
	pos	vb.
	qual	Electronics.
	def	to produce amplification of (electrical signals, sound, etc.); increase the amplitude of (signals, etc.).
amplify	3.
	syl	am+pli+fy
	pron	<1@mpli2fI>
	pos	vb.
	mod	tr.
	qual	U.S.
	def	to exaggerate.
amplify	4.
	syl	am+pli+fy
	pron	<1@mpli2fI>
	pos	vb.
	mod	intr.
	def	to expand or enlarge a speech, narrative, etc.
amplifiable	sub
	head	amplify
	syl	am+pli+2fi+a:ble
	pos	adj.
amplitude	ety	C16: from Latin amplit*_ud*_o breadth, from amplus spacious
amplitude	1.
	syl	am+pli+tude
	pron	<1@mpli2tju:d>
	pos	n.
	def	greatness of extent; magnitude.
amplitude	2.
	syl	am+pli+tude
	pron	<1@mpli2tju:d>
	pos	n.
	def	abundance or copiousness.
amplitude	3.
	syl	am+pli+tude
	pron	<1@mpli2tju:d>
	pos	n.
	def	breadth or scope, as of the mind.
amplitude	4.
	syl	am+pli+tude
	pron	<1@mpli2tju:d>
	pos	n.
	def	the maximum displacement from the zero or mean position of a periodic motion or curve.
amplitude	5.
	syl	am+pli+tude
	pron	<1@mpli2tju:d>
	pos	n.
	qual	Astronomy.
	def	the angular distance along the horizon measured from true east or west to the point of intersection of the vertical circle passing through a celestial body.
amplitude	6.
	syl	am+pli+tude
	pron	<1@mpli2tju:d>
	pos	n.
	def	Also called: {argument}. (of a complex number) the angle that the vector representing the complex number makes with the positive horizontal axis.
amplitude modulation	1.
	syl	am+pli+tude mod:u+la+tion
	pos	n.
	def	one of the principal methods of transmitting audio, visual, or other types of information using radio waves, the relevant signal being superimposed onto a radio-frequency carrier wave. The frequency of the carrier wave remains unchanged but its amplitude is varied in accord?!ance with the amplitude of the input signal. Abbrev.: {AM, am}. Compare {frequency modulation}.
amplitude modulation	2.
	syl	am+pli+tude mod:u+la+tion
	pos	n.
	def	a wave that has undergone this process.
amply	0.
	syl	am+ply
	pron	<1@mpli>
	pos	adv.
	def	more than sufficiently; fully; generously.
	exam	1	he was amply rewarded.
ampule	alt
	head	ampoule
	or	ampoule
	syl	am+pule
	pos	n.
	qual	U.S.
ampoule	0.
	or	ampule
	syl	am+poule
	pron	<1@mpu:l>, <-pju:l>
	pos	n.
	qual	Med.
	def	a small glass vessel in which liquids for injection are hermetically sealed.
ampulla	ety	C16: from Latin, diminutive of #7amphora  &- am+pul+la+ceous (@!@amp$u#!le$I#s$$s) or @!am+pul+#!la+ceal adj. &- am+pul+lar (@am#!p$ul$$) or am+pul+lar@.y (@am?!#!p$ul$$r$I) adj.
ampullae	infl
	head	ampulla
	syl	am+pul+lae
	pron	<-1pulE>
	pos	n.
	mod	pl.
ampulla	1.
	syl	am+pul+la
	pron	<@m1pul*>
	pos	n.
	qual	Anatomy.
	def	the dilated end part of certain ducts or canals, such as the end of a uterine tube.
ampulla	2.a.
	syl	am+pul+la
	pron	<@m1pul*>
	pos	n.
	def	a vessel for containing the wine and water used at the Eucharist.
ampulla	2.b.
	syl	am+pul+la
	pron	<@m1pul*>
	pos	n.
	def	a small flask for containing consecrated oil.
ampulla	3.
	syl	am+pul+la
	pron	<@m1pul*>
	pos	n.
	def	a Roman two-handled bottle for oil, wine, or perfume.
amputate	ety	C17: from Latin amput*_are, from am- around+ put*_are to trim, prune
amputate	0.
	syl	am+pu+tate
	pron	<1@mpju2tAt>
	pos	vb.
	qual	Surgery.
	def	to remove (all or part of a limb, esp. an arm or leg).
amputation	sub
	head	amputate
	syl	am+pu+1ta+tion
	pos	n.
amputee	0.
	syl	am+pu+tee
	pron	<2@mpju1tE>
	pos	n.
	def	a person who has had a limb amputated.
Amravati	0.
	syl	Am+ra+va+ti
	pron	<@m1ra:v*ti>
	pos	n.
	def	a town in central India, in NE Maharashtra: cotton centre. Pop.: 193636 (1971). Former name: {Am+rao+ti} (#!@am@!r$a$:$$t$I, #!^m-).
amrita	ety	from Sanskrit amrta immortal, from a- without+ mrta death
amreeta	alt
	head	amrita
	or	amrita
	syl	am+ree+ta
	pron	<@m1rEt*>
	pos	n.
amrita	1.
	or	amreeta
	syl	am+ri+ta
	pron	<@m1rEt*>
	pos	n.
	qual	Hindu myth.
	def	the ambrosia of the gods that bestows immortality.
amrita	2.
	or	amreeta
	syl	am+ri+ta
	pron	<@m1rEt*>
	pos	n.
	qual	Hindu myth.
	def	the immortality it confers.
Amritsar	0.
	syl	Am+rit+sar
	pron	<@m1rits*>
	pos	n.
	def	a city in India, in NW Punjab: centre of the Sikh religion; site of a massacre in 1919 of unarmed supporters of Indian self-government by British troops. Pop.: 407628 (1971).
Amsterdam	0.
	syl	Am+ster+dam
	pron	<2@mst*1d@m>, Dutch <2amst*r1dam>
	pos	n.
	def	the commercial capital of the Netherlands, a major industrial centre and port on the IJsselmeer, connected with the North Sea by canal: built on about 100 islands within a network of canals. Pop.: 764 382 (1974 est.).
amt	0.
	syl	amt.
	qual	abbrev. for
	def	amount.
amu	0.
	syl	amu
	qual	abbrev. for
	def	atomic mass unit.
amuck	ety	C17: from Malay amoq furious assault
amok	alt
	head	amuck
	or	amuck
	syl	a:mok
	pos	n.
amuck	1.
	or	amok
	syl	a:muck
	pron	<*1m^k>
	pos	n.
	def	a state of murderous frenzy, originally observed among Malays.
run amuck	2.
	head	amuck
	syl	run amuck.
	def	to run about with or as if with a frenzied desire to kill.
Amu Darya	0.
	syl	A:mu Dar+ya
	pron	Russian <a1mu> <dar1ja>
	pos	n.
	def	a river in central Asia, rising in the Pamirs and flowing northwest through the Hindu Kush and across Turkmenistan and Uzbekistan to its delta in the Aral Sea: forms much of the boundary between Afghani?!stan and the Soviet Union. Length: 2400 km (1500 miles). Ancient name: {Oxus}.
amulet	ety	C17: from Latin amul*_etum, of unknown origin
amulet	0.
	syl	am:u+let
	pron	<1@mjulit>
	pos	n.
	def	a trinket or piece of jewellery worn as a protection against evil; charm.
Amun	0.
	syl	A:m*_un
	pron	<1a:m*n>
	pos	n.
	qual	Egyptian myth.
	def	a variant spelling of {Amen}.
Roald	infl
	head	Amundsen
	syl	Ro:ald
	pron	<1rcald>
	pos	n.
Amundsen	0.
	syl	A:mund:sen
	pron	Norwegian <1a:muns*n>
	pos	n.
	def	1872-1928, Norwegian explorer and navigator, who was the first man to reach the South Pole (1911).
Amundsen Sea	0.
	syl	A:mund:sen Sea
	pron	<1a:munds*n>
	pos	n.
	def	a part of the South Pacific Ocean, in Antarctica off Byrd Land.
Amur	0.
	syl	A:mur
	pron	<*1mu*>
	pos	n.
	def	a river in NE Asia, rising in N Mongolia as the Argun and flowing southeast, then northeast to the Sea of Okhotsk: forms the boundary between Manchuria and the Soviet Union. Length: about 4350 km (2700 miles).
amuse	ety	C15: from Old French amuser to cause to be idle, from muser to #7muse 
amuse	1.
	syl	a:muse
	pron	<*1mju:z>
	pos	vb.
	mod	tr.
	def	to keep pleasantly occupied; entertain; divert.
amuse	2.
	syl	a:muse
	pron	<*1mju:z>
	pos	vb.
	mod	tr.
	def	to cause to laugh or smile.
amusement	1.
	syl	a:muse+ment
	pron	<*1mju:zm*nt>
	pos	n.
	def	something that amuses, such as a game or other pastime.
amusement	2.
	syl	a:muse+ment
	pron	<*1mju:zm*nt>
	pos	n.
	def	a mechanical device used for entertainment, as at a fair.
amusement	3.
	syl	a:muse+ment
	pron	<*1mju:zm*nt>
	pos	n.
	def	the act of amusing or the state or quality of being amused.
amusement arcade	0.
	syl	a:muse+ment ar+cade
	pos	n.
	qual	Brit.
	def	a covered area having coin-operated game machines.
amusement park	0.
	syl	a:muse+ment park
	pos	n.
	def	an open-air entertainment area consist?!ing of stalls, side shows, etc.
amusing	0.
	syl	a:mus+ing
	pron	<*1mju:ziG>
	pos	adj.
	def	mildly entertaining; pleasantly diverting; causing a smile or laugh.
amusingly	sub
	head	amusing
	syl	a:1mus+ing+ly
	pos	adv.
amygdala	ety	C16: from Medieval Latin: #7almond 
amygdalae	infl
	head	amygdala
	syl	a:myg+da+lae
	pron	<-2lE>
	pos	n.
	mod	pl.
amygdala	0.
	syl	a:myg+da+la
	pron	<*1migd*l*>
	pos	n.
	qual	Anatomy.
	def	an almond-shaped part, such as a tonsil.
amygdalate	0.
	syl	a:myg+da+late
	pron	<*1migd*lit>, <-2lAt>
	pos	adj.
	def	relating to, having, or bearing almonds.
amygdale	ety	C19: from Greek: #7almond 
amygdale	0.
	syl	a:myg+dale
	pron	<*1migdAl>
	pos	n.
	def	an oval vesicle in a volcanic rock, formed from a bubble of escaping gas, that has become filled with a light-coloured mineral, such as quartz. Also called: {amygdule}.
amygdalin	0.
	syl	a:myg+da+lin
	pron	<*1migd*lin>
	pos	n.
	def	a white soluble bitter-tasting crystalline glycoside extracted from bitter almonds and used as an expectorant. Formula: C\6H\5CHCNOC\1\2H\2\1O\1\0.
amygdaline	1.
	syl	a:myg+da+line
	pron	<*1migd*lin>, <-2lIn>
	pos	adj.
	qual	Anatomy.
	def	of or relating to a tonsil.
amygdaline	2.
	syl	a:myg+da+line
	pron	<*1migd*lin>, <-2lIn>
	pos	adj.
	def	of or resembling almonds.
amygdaloid	1.
	syl	a:myg+da+loid
	pron	<*1migd*2lcid>
	pos	n.
	def	a volcanic igneous rock containing amygdales.
amygdaloid	2.
	syl	a:myg+da+loid
	pron	<*1migd*2lcid>
	pos	adj.
	def	having the shape of an almond.
amygdaloid	3.
	syl	a:myg+da+loid
	pron	<*1migd*2lcid>
	pos	adj.
	def	a less common form of { {amygdaloidal} (sense 1)}.
amygdaloidal	1.
	syl	a:myg+da+loi+dal
	pron	<*2migd*1lcidL>
	pos	adj.
	usage	of a volcanic rock
	def	containing amygdales.
amygdaloidal	2.
	syl	a:myg+da+loi+dal
	pron	<*2migd*1lcidL>
	pos	adj.
	def	a less common form of {amygdaloid} (sense 2).
amyl	ety	C19: from Latin: #7amylum 
amyl	0.
	syl	am:yl
	pron	<1@mil>
	pos	n.
	usage	modifier; no longer in technical usage
	def	of, consisting of, or containing any of eight isomeric forms of the monovalent group C\5H\1\1-.
	exam	1	amyl group or radical.
amylaceous	0.
	syl	am:y+la+ceous
	pron	<2@mi1lAS*s>
	pos	adj.
	def	of or resembling starch.
amyl acetate	0.
	syl	am:yl ac+e:tate
	pos	n.
	def	another name (no longer in technical usage) for {pentyl acetate}.
amyl alcohol	0.
	syl	am:yl al+co+hol
	pos	n.
	def	a colourless flammable liquid existing in eight isomeric forms that is used as a solvent and in the manufacture of organic compounds and pharmaceuticals. Formula: C\5H\1\1OH.
amylase	0.
	syl	am+yl+ase
	pron	<1@mi2lAz>
	pos	n.
	def	any of several enzymes that hydrolyse starch and glycogen to simple sugars, such as glucose. They are present in saliva.
amylene	0.
	syl	am+yl+ene
	pron	<1@mi2lEn>
	pos	n.
	def	another name (no longer in technical usage) for {pentene}.
amyl nitrite	0.
	syl	am:yl ni+trite
	pos	n.
	def	a yellowish unstable volatile fragrant liquid used in medicine as a vasodilator and in perfumes. Formula: (CH\3)\2CHCH\2CH\2NO\2.
amylo-	ety	from Latin: #7amylum 
amyloid	1.
	syl	am:y+loid
	pron	<1@mi2lcid>
	pos	n.
	qual	Pathol.
	def	a complex protein resembling starch, deposited in tissues in some degenerative diseases.
amyloid	2.
	syl	am:y+loid
	pron	<1@mi2lcid>
	pos	n.
	def	any substance resembling starch.
amyloid	3.
	syl	am:y+loid
	pron	<1@mi2lcid>
	pos	adj.
	def	starch?!like.
amylolysis	0.
	syl	am:y+lol:y+sis
	pron	<2@mi1lolisis>
	pos	n.
	def	the conversion of starch into sugar.
amylopectin	0.
	syl	am:y+lo+pec+tin
	pron	<2@mil*u1pektin>
	pos	n.
	def	the major component of starch (about 80 per cent), consisting of branched chains of glucose units. It is insoluble and gives a red-brown colour with iodine. Compare {amylose}.
amylopsin	ety	C19: from #7amylo (#7lysis) #7+ (#7pe) #7psin 
amylopsin	0.
	syl	am:y+lop+sin
	pron	<2@mi1lopsin>
	pos	n.
	def	an enzyme of the pancreatic juice that converts starch into sugar; pancreatic amylase.
amylose	0.
	syl	am+yl+ose
	pron	<1@mi2l*uz>, <-l*us>
	pos	n.
	def	the minor component (about 20 per cent) of starch, consisting of long unbranched chains of glucose units. It is soluble in water and gives an intense blue colour with iodine. Compare {amylopectin}.
amylum	ety	Latin, from Greek amulon fine meal, starch, from amulos not ground at the mill, from #7a -%1#7+ mul*_e mill
amylum	0.
	syl	am:y+lum
	pron	<1@mil*m>
	pos	n.
	def	another name for { {starch} (sense 1)}.
amyotonia	0.
	syl	a:my:o+to+ni:a
	pron	<2AmI*1t*uni*>
	pos	n.
	def	another name for {myotonia}.
Amytal	0.
	syl	Am:y+tal
	pron	<1@mi2t@l>
	pos	n.
	qual	Trademark.
	def	a crystalline compound used as a sedative and hypnotic; amobarbital.
an	ety	Old English *_an #7one 
an	H1.0.
	syl	an
	pron	<@n>, <unstressed> <*n>, <unstressed> <*n>
	pos	determiner.
	usage	article
	def	a form of {a%1}, used before an initial vowel and sometimes before an initial
an'	alt
	head	an
	or	an
	syl	an'
	pron	<@n>, <unstressed> <*n>, <unstressed> <*n>
	pos	conj.
an	H2.0.
	or	an'
	syl	an
	pron	<@n>, <unstressed> <*n>, <unstressed> <*n>
	pos	conj.
	usage	subordinating
	def	an obsolete word for {if}. See {and} (sense 9).
An	0.
	syl	An
	usage	the chemical symbol for
	def	actinon.
An	0.
	syl	An
	pron	<a:n>
	pos	n.
	qual	Myth.
	def	the Sumerian sky god. Babylonian counterpart: {Anu}.
an	ety	Latin: in the year
an	0.
	syl	an.
	qual	abbrev. for
	def	anno.
AN	0.
	syl	A.N.
	qual	abbrev. for
	def	Anglo-Norman.
an-	ety	from Greek
-an	ety	from Latin -*_anus, suffix of adjectives
-ean	infl
	head	-an
	or	-ian
	syl	-e:an
	pos	suffix.
-ian	infl
	head	-an
	or	-ean
	syl	-i:an
	pos	suffix.
-an	1.
	syl	-an
	pos	suffix.
	usage	forming adjectives and nouns
	def	belonging to or relating to; a person belonging to or coming from.
	exam	1	European.
-an	2.
	syl	-an
	pos	suffix.
	usage	forming adjectives and nouns
	def	typical of or resembling; a person typical of.
	exam	1	Elizabethan.
-an	3.
	syl	-an
	pos	suffix.
	usage	forming adjectives and nouns
	def	adhering to or following; an adherent of.
	exam	1	Christian.
-an	4.
	syl	-an
	pos	suffix.
	usage	forming nouns
	def	a person who specializes or is expert in.
	exam	1	dietician;
	exam	2	phonetician.
ana	ety	C16: via Medieval Latin from Greek: of every one similarly
ana	H1.0.
	syl	a:na
	pron	<1An*>, <1a:n*>
	pos	adv.
	usage	Pharmacol. of ingredients in a prescription
	def	in equal quantities. Abbrev.: {aa}.
ana	ety	C18: independent use of -#7ana 
ana	H2.1.
	syl	an:a
	pron	<1a:n*>
	pos	n.
	def	a collection of reminiscences, sketches, etc., of or about a person or place.
ana	H2.2.
	syl	an:a
	pron	<1a:n*>
	pos	n.
	def	an item of or for such a collection.
ana-	ety	from Greek ana 
ana-	1.
	syl	an:a-
	usage	before a vowel
	def	up; upwards.
	exam	1	anadromous.
ana-	2.
	syl	an:a-
	usage	before a vowel
	def	again.
	exam	1	anagram.
ana-	3.
	syl	an:a-
	usage	before a vowel
	def	back; backwards.
	exam	1	anatropous.
-ana	ety	New Latin, from Latin -*_ana, literally: matters relating to, neuter plural of -*_anus; see -#7an 
-iana	alt
	head	-ana
	or	-ana
	syl	-i:a:na
-ana	0.
	or	-iana
	syl	-a:na
	usage	suffix forming nouns.
	def	denoting a collection of items, esp. anecdotes or bibliographical items, on a certain individual or place.
	exam	1	Shakespeariana;
	exam	2	Americana.
anabaena	ety	New Latin, from Greek anabainein to shoot up, go up, from #7ana -#7+ bainein to go; so called because they rise to the surface at intervals
anabaenas	infl
	head	anabaena
	syl	an:a+bae+nas.
	pos	n.
	mod	pl.
anabaena	0.
	syl	an:a+bae+na
	pron	<2@n*1bEn*>
	pos	n.
	def	any freshwater alga of the genus sometimes occurring in drinking water, giving it a fishy taste and smell.
anabantid	1.
	syl	an:a+ban+tid
	pron	<2@n*1b@ntid>
	pos	n.
	def	any of various spiny-finned fishes constituting the family and including the fighting fish, climbing perch, and gourami. See also {labyrinth fish}.
anabantid	2.
	syl	an:a+ban+tid
	pron	<2@n*1b@ntid>
	pos	adj.
	def	of, relating to, or belonging to the family
Anabaptist	ety	C16: from Ecclesiastical Latin anabaptista, from anabapt*_iz*_are to baptize again, from Late Greek anabaptizein; see #7ana -, #7baptize 
Anabaptist	1.
	syl	An:a+bap+tist
	pron	<2@n*1b@ptist>
	pos	n.
	def	a member of any of various 16th-century Protestant movements that rejected infant baptism, insisted that adults be rebaptized, and sought to establish Christian communism.
Anabaptist	2.
	syl	An:a+bap+tist
	pron	<2@n*1b@ptist>
	pos	n.
	def	a member of a later Protestant sect holding the same doctrines, esp. with regard to baptism.
Anabaptist	3.
	syl	An:a+bap+tist
	pron	<2@n*1b@ptist>
	pos	adj.
	def	of or relating to these movements or sects or their doctrines.
Anabaptism	sub
	head	Anabaptist
	syl	An:a+1bap+tism
	pos	n.
anabas	ety	C19: from New Latin, from Greek anabainein to go up; see #7anabaena 
anabas	0.
	syl	an:a+bas
	pron	<1@n*2b@s>
	pos	n.
	def	any of several labyrinth fishes of the genus esp. the climbing fish.
anabasis	ety	C18: from Greek: a going up, ascent, from anabainein to go up; see #7anabaena 
anabases	infl
	head	anabasis
	syl	a:nab:a+ses
	pron	<-2sEz>
	pos	n.
	mod	pl.
anabasis	1.
	syl	a:nab:a+sis
	pron	<*1n@b*sis>
	pos	n.
	def	the march of Cyrus the Younger and his Greek mercenaries from Sardis to Cunaxa in Babylonia in 401 #7b.c., described by Xenophon in his Compare {katabasis}.
anabasis	2.
	syl	a:nab:a+sis
	pron	<*1n@b*sis>
	pos	n.
	def	any military expedition, esp. one from the coast to the interior.
anabatic	ety	C19: from Greek anabatikos relating to ascents, from anabainein to go up; see #7anabasis 
anabatic	0.
	syl	an:a+bat+ic
	pron	<2@n*1b@tik>
	pos	adj.
	usage	Meteorol. of air currents
	def	rising upwards, esp. up slopes. Compare {katabatic}.
anabiosis	ety	C19: via New Latin from Greek, from anabioein to come back to life, from #7ana -#7+ bios life
anabiosis	0.
	syl	an:a+bi:o+sis
	pron	<2@n*bI1*usis>
	pos	n.
	def	a return to life after apparent death; resuscitation.
anabiotic	sub
	head	anabiosis
	syl	an:a+bi+ot+ic
	pron	<2@n*bI1otik>
	pos	adj.
anableps	ety	New Latin, literally: one who looks up, from Greek, from anablepein to look up
anableps	infl
	syl	an:a+bleps.
	pos	n.
	mod	pl.
anableps	0.
	syl	an:a+bleps
	pron	<1@n*2bleps>
	pos	n.
	def	any of various cyprinodont fishes constituting the genus which includes the four-eyed fishes.
anabolic steroid	0.
	syl	an:a+bol+ic ster+oid
	pron	<2@n*1bolik>
	pos	n.
	def	any of a group of synthetic steroid hormones (androgens) used to stimulate muscle and bone growth for athletic or therapeutic purposes.
anabolism	ety	C19: from #7ana -#7+ (#7meta) #7bolism 
anabolism	0.
	syl	a:nab:o+lism
	pron	<*1n@b*2liz*m>
	pos	n.
	def	a metabolic process in which complex molecules are synthesized from simpler ones with the storage of energy; constructive metabolism. Compare {catabo?!lism}.
anabolic	sub
	head	anabolism
	syl	an:a+bol+ic
	pron	<2@n*?!1bolik>
	pos	adj.
anabolite	0.
	syl	a:nab:o+lite
	pron	<*1n@b*2lIt>
	pos	n.
	def	a product of anabolism.
anabolitic	sub
	head	anabolite
	syl	a:nab:o+lit+ic
	pron	<*2n@b*1litik>
	pos	adj.
anabranch	ety	C19: from ana (stomosing) branch 
anabranch	0.
	syl	a:na+branch
	pron	<1a:n*2bra:nC>
	pos	n.
	def	a stream that leaves a river and enters it again further downstream.
anacardiaceous	ety	C19: from New Latin Anacardi*_aceae, from #7ana -#7+ Greek kardia heart; so called from the shape of the top of the fruit stem
anacardiaceous	0.
	syl	an:a+car+di:a+ceous
	pron	<2@n*2ka:di1AS*s>
	pos	adj.
	def	of, relating to, or belonging to the a chiefly tropical family of trees and shrubs many of which have edible drupes. The family includes the cashew, mango, pistachio, and sumach.
anachorism	ety	C19: from #7ana -#7+ kh*_oros place
anachorism	0.
	syl	a:nach:o+rism
	pron	<*1n@k*2riz*m>
	pos	n.
	def	a geographical misplacement; something located in an incongruous position. Compare {anachronism}.
anachronic	ety	C19: see #7anachronism  &- @!an@.a+#!chron@.i+cal+ly adv.
anachronical	alt
	head	anachronic
	or	anachronic
	syl	an:a+chron:i+cal
	pos	adj.
anachronic	0.
	or	anachronical
	syl	an:a+chron+ic
	pron	<2@n*1kronik>
	pos	adj.
	def	out of chronological order or out of date.
anachronism	ety	C17: from Latin ana?!chronismus, from Greek anakhronismos a mistake in chronology, from anakhronizein to err in a time reference, from #7ana -#7+ khronos time
anachronism	1.
	syl	a:nach+ro+nism
	pron	<*1n@kr*2niz*m>
	pos	n.
	def	the representation of an event, person, or thing in a historical context in which it could not have occurred or existed.
anachronism	2.
	syl	a:nach+ro+nism
	pron	<*1n@kr*2niz*m>
	pos	n.
	def	a person or thing that belongs or seems to belong to another time.
anachronistic	sub
	head	anachronism
	syl	a:2nach+ro+1nis+tic
	pos	adj.
anachronistically	sub
	head	anachronism
	syl	a:2nach+ro+1nis+ti+cal+ly
	pos	adv.
anaclinal	ety	C19: see #7ana -#7, -#7cline 
anaclinal	0.
	syl	an:a+cli+nal
	pron	<2@n*1klInL>
	pos	adj.
	usage	of valleys and similar formations
	def	progressing in a direction opposite to the dip of the surrounding rock strata.
anaclitic	ety	C20: from Greek anaklitos for leaning upon; see #7ana -#7, -#7cline 
anaclitic	0.
	syl	an:a+clit+ic
	pron	<2@n*1klitik>
	pos	adj.
	qual	Psychoanal.
	def	of or relating to relationships that are characterized by the strong dependence of one person on others or another.
anaclisis	sub
	head	anaclitic
	syl	an:a+cli+sis
	pron	<2@n*1klI?!sis>
	pos	n.
anacoluthia	0.
	syl	an:a+co+lu+thi:a
	pron	<2@n*k*1lu:Ti*>
	pos	n.
	qual	Rhetoric.
	def	lack of grammatical sequence, esp. within a single sentence.
anacoluthic	sub
	head	anacoluthia
	syl	an:a+co+1lu+thic
	pos	adj.
anacoluthon	ety	C18: from Late Latin, from Greek anakolouthon, from anakolouthos not consistent, from #7an -#7+ akolouthos following
anacolutha	infl
	head	anacoluthon
	syl	an:a+co+lu+tha
	pron	<-T*>
	pos	n.
	mod	pl.
anacoluthon	0.
	syl	an:a+co+lu+thon
	pron	<2@n*k*1lu:Ton>
	pos	n.
	qual	Rhetoric.
	def	a construction that involves the change from one grammatical sequence to another within a single sentence; an example of anacoluthia.
anaconda	ety	C18: probably changed from Sinhalese henakanday*_a whip snake, from hena lightning+ kanda stem; originally referring to a snake of Sri Lanka
anaconda	0.
	syl	an:a+con+da
	pron	<2@n*1kond*>
	pos	n.
	def	a very large nonvenomous arboreal and semiaquatic snake, of tropical South America, which kills its prey by constriction: family (boas).
anacoustic	0.
	syl	an:a+cous+tic
	pron	<2@n*1ku:stik>
	pos	adj.
	def	unable to support the propagation of sound; soundless.
Anacreon	0.
	syl	A:nac:re:on
	pron	<*1n@kri2on>, <-*n>
	pos	n.
	def	??572-??488 #7b.c., Greek lyric poet, noted for his short songs celebrating love and wine.
Anacreontic	1.
	syl	A:nac+re:on+tic
	pron	<*2n@kri1ontik>
	pos	adj.
	usage	sometimes not cap.
	def	in the manner of Anacreon.
Anacreontic	2.
	syl	A:nac+re:on+tic
	pron	<*2n@kri1ontik>
	pos	adj.
	usage	sometimes not cap.; of verse
	def	in praise of love or wine; amatory or convivial.
Anacreontic	3.
	syl	A:nac+re:on+tic
	pron	<*2n@kri1ontik>
	pos	n.
	usage	sometimes not cap.
	def	an Anacreontic poem.
Anacreontically	sub
	head	Anacreontic
	syl	A:2nac+re:1on+ti+cal+ly
	pos	adv.
anacrusis	ety	C19: from Greek anakrousis prelude, from anakrouein to strike up, from #7ana -#7+ krouein to strike
anacruses	infl
	head	anacrusis
	syl	an:a+cru+ses
	pron	<-sEz>
	pos	n.
	mod	pl.
anacrusis	1.
	syl	an:a+cru+sis
	pron	<2@n*1kru:sis>
	pos	n.
	qual	Prosody.
	def	one or more unstressed syllables at the beginning of a line of verse.
anacrusis	2.a.
	syl	an:a+cru+sis
	pron	<2@n*1kru:sis>
	pos	n.
	def	an unstressed note or group of notes immediately preceding the strong first beat of the first bar.
anacrusis	2.b.
	syl	an:a+cru+sis
	pron	<2@n*1kru:sis>
	pos	n.
	def	another word for {upbeat}.
anacrustic	sub
	head	anacrusis
	syl	an:a+crus+tic
	pron	<2@n*1kr^stik>
	pos	adj.
anadem	ety	C17: from Latin anad*_ema wreath, from Greek anad*_ema, from anadein to wreathe, from #7ana -#7+ dein to bind
anadem	0.
	syl	an:a+dem
	pron	<1@n*2dem>
	pos	n.
	qual	Poetic.
	def	a garland for the head.
anadiplosis	ety	C16: via Latin from Greek: repetition, from anadiploun to double back, from #7ana -+ diploun to double
anadiplosis	0.
	syl	an:a+di+plo+sis
	pron	<2@n*di1pl*usis>
	pos	n.
	qual	Rhetoric.
	def	repetition of the words or phrase at the end of one sentence, line, or clause at the beginning of the next.
anadromous	ety	C18: from Greek anadromos running upwards, from #7ana -#7+ dromos a running
anadromous	0.
	syl	a:nad+ro+mous
	pron	<*1n@dr*m*s>
	pos	adj.
	usage	of fishes such as the salmon
	def	migrating up rivers from the sea in order to breed. Compare {catadromous}.
Anadyr	1.
	syl	A:na+dyr
	pron	Russian <a1nadirj>
	pos	n.
	def	a town in the Soviet Union, in NE Siberia at the mouth of the Anadyr River. Pop.: 7703 (1970).
Anadyr	2.
	syl	A:na+dyr
	pron	Russian <a1nadirj>
	pos	n.
	def	a mountain range in the Soviet Union, in NE Siberia, rising over 1500 m (5000 ft.).
Anadyr	3.
	syl	A:na+dyr
	pron	Russian <a1nadirj>
	pos	n.
	def	a river in the Soviet Union, rising in mountains on the Arctic Circle, south of the Anadyr Range, and flowing east to the Gulf of Anadyr. Length: 725 km (450 miles).
Gulf of	4.
	head	Anadyr
	syl	Gulf of.
	def	an inlet of the Bering Sea, off the coast of the NE Soviet Union.
anaemia	ety	C19: from New Latin, from Greek anaimia lack of blood, from #7an -#7+haima blood
anemia	alt
	head	anaemia
	or	anaemia
	syl	a:ne:mi:a
	pron	<*1nEmi*>
	pos	n.
	qual	U.S.
anaemia	1.
	or	anemia
	syl	a:nae:mi:a
	pron	<*1nEmi*>
	pos	n.
	def	a deficiency in the number of red blood cells or in their haemoglobin content, resulting in pallor, shortness of breath, and lack of energy.
anaemia	2.
	or	anemia
	syl	a:nae:mi:a
	pron	<*1nEmi*>
	pos	n.
	def	lack of vitality or vigour.
anaemia	3.
	or	anemia
	syl	a:nae:mi:a
	pron	<*1nEmi*>
	pos	n.
	def	pallid complexion.
anemic	alt
	head	anaemic
	or	anaemic
	syl	a:ne:mic
	pron	<*1nEmik>
	pos	adj.
	qual	U.S.
anaemic	1.
	or	anemic
	syl	a:nae:mic
	pron	<*1nEmik>
	pos	adj.
	def	relating to or suffering from anaemia.
anaemic	2.
	or	anemic
	syl	a:nae:mic
	pron	<*1nEmik>
	pos	adj.
	def	pale and sickly looking; lacking vitality.
anaerobium	alt
	head	anaerobe
	or	anaerobe
	syl	an+aer:o+bi:um
	pron	<2@ne*1r*ubi*m>
	pos	n.
anaerobes	infl
	head	anaerobe
	or	anaerobia
	syl	an+aer+obes
	pron	<-1*ubi*>
	pos	n.
	mod	pl.
anaerobia	infl
	head	anaerobe
	or	anaerobes
	syl	an+aer+o+bi:a
	pron	<-1*ubi*>
	pos	n.
	mod	pl.
anaerobe	0.
	or	anaerobium
	syl	an+aer+obe
	pron	<@n1e*r*ub>
	pos	n.
	def	an organism that does not require free oxygen or air for respiration. Compare {aerobe}.
anaerobic	1.
	syl	an+aer:o+bic
	pron	<2@ne*1r*ubik>
	pos	adj.
	usage	of an organism or process
	def	requiring the absence of or not dependent on the presence of free oxygen or air.
anaerobic	2.
	syl	an+aer:o+bic
	pron	<2@ne*1r*ubik>
	pos	adj.
	def	of or relating to anaerobes.
anaerobic	xref
	syl	an+aer:o+bic
	pron	<2@ne*1r*ubik>
	pos	adj.
	def	Compare {aerobic}.
anaerobically	sub
	head	anaerobic
	syl	an+aer:1o+bi+cal+ly
	pos	adv.
anaesthesia	ety	C19: from New Latin, from Greek anaisth*_esia absence of sensation, from #7an -#7+ aisth*_esis feeling
anesthesia	alt
	head	anaesthesia
	or	anaesthesia
	syl	an+es+the+si:a
	pron	<2@nis1TEzi*>
	pos	n.
	qual	U.S.
anaesthesia	1.
	or	anesthesia
	syl	an+aes+the+si:a
	pron	<2@nis1TEzi*>
	pos	n.
	def	local or general loss of bodily sensation, esp. of touch, as the result of nerve damage or other abnormality.
anaesthesia	2.
	or	anesthesia
	syl	an+aes+the+si:a
	pron	<2@nis1TEzi*>
	pos	n.
	def	loss of sensation, esp. of pain, induced by drugs: called {general anaesthesia} when consciousness is lost and {local anaesthesia} when only a specific area of the body is involved.
anaesthesia	3.
	or	anesthesia
	syl	an+aes+the+si:a
	pron	<2@nis1TEzi*>
	pos	n.
	def	a general dullness or lack of feeling.
anesthesiology	alt
	head	anaesthesiology
	or	anaesthesiology
	syl	an+es+the+si+ol+o:gy
	pron	<2@nis?!2TEzi1ol*Ji>
	pos	n.
	qual	U.S.
anaesthesiology	0.
	or	anesthesiology
	syl	an+aes+the+si+ol+o:gy
	pron	<2@nis?!2TEzi1ol*Ji>
	pos	n.
	def	the U.S. name for {anaesthetics}.
anesthetic	alt
	head	anaesthetic
	or	anaesthetic
	syl	an+es+thet+ic
	pron	<2@nis1Tetik>
	pos	n.
	qual	U.S.
anaesthetic	1.
	or	anesthetic
	syl	an+aes+thet+ic
	pron	<2@nis1Tetik>
	pos	n.
	def	a substance that causes anaesthesia.
anaesthetic	2.
	or	anesthetic
	syl	an+aes+thet+ic
	pron	<2@nis1Tetik>
	pos	adj.
	def	causing or characterized by anaesthesia.
anaesthetics	0.
	syl	an+aes+thet+ics
	pron	<2@nis1Tetiks>
	pos	n.
	mod	functioning as; sing.
	def	the science, study, and practice of anaesthesia and its application. U.S. name: {anesthesiology}.
anaesthetist	1.
	syl	a:naes+the+tist
	pron	<*1nEsT*tist>
	pos	n.
	qual	Brit.
	def	a qualified doctor specializing in the administration of anaesthetics. U.S. name: {anesthesiologist}.
anaesthetist	2.
	syl	a:naes+the+tist
	pron	<*1nEsT*tist>
	pos	n.
	qual	U.S.
	def	a person qualified to administer anaesthesia, often a nurse or someone other than a physician. Compare {anesthesiologist}.
anaesthetise	infl
	head	anaesthetize
	or	anesthetize
	syl	a:naes+the+tise
	pron	<*1nEsT*2tIz>
	pos	vb.
	mod	tr.
anesthetize	infl
	head	anaesthetize
	or	anaesthetise
	syl	a:nes+the+tize
	pron	<*1nEsT*2tIz>
	pos	vb.
	mod	tr.
	qual	U.S.
anaesthetize	0.
	syl	a:naes+the+tize
	pron	<*1nEsT*2tIz>
	pos	vb.
	mod	tr.
	def	to render insensible to pain by administering an anaesthetic.
anaesthetization	sub
	head	anaesthetize
	syl	a:2naes+the+ti+1za+tion
	pos	n.
anaesthetisation	sub
	head	anaesthetize
	or	anesthetization
	syl	a:2naes+the+ti+1sa+tion
	pos	n.
anesthetization	sub
	head	anaesthetize
	or	anaesthetisation
	syl	a:2nes+the+ti+1za+tion
	pos	n.
	qual	U.S.
anaglyph	ety	C17: from Greek anagluph*_e carved in low relief, from #7ana -#7+ gluph*_e carving, from gluphein to carve &- @!an@.a+#!glyph+ic, @!an@.a+#!glyph@.i+cal or an@.a+glyp+tic (@!@an$$#!gl$Ipt$Ik), @!an@.a+#!glyp+ti+cal adj.
anaglyph	1.
	syl	an:a+glyph
	pron	<1@n*2glif>
	pos	n.
	qual	Photog.
	def	a stereoscopic picture consisting of two images of the same object, taken from slightly different angles, in two complementary colours, usually red and cyan (green-blue). When viewed through spectacles having one red and one cyan lens, the images merge to produce a stereoscopic sensation.
anaglyph	2.
	syl	an:a+glyph
	pron	<1@n*2glif>
	pos	n.
	def	anything cut to stand in low relief, such as a cameo.
anaglyphy	sub
	head	anaglyph
	syl	a:nag+ly+phy
	pron	<*1n@gl*fi>, <1@n*?!2glifi>
	pos	n.
anaglypta	ety	C19: originally a trademark, from Greek ana?!gluptos; see #7anaglyph 
anaglypta	0.
	syl	an:a+glyp+ta
	pron	<2@n*1glipt*>
	pos	n.
	def	a type of thick embossed wallpaper.
anagnorisis	ety	from Greek: recognition
anagnorises	infl
	head	anagnorisis
	syl	an+ag+nor:i+ses
	pron	<-2sEz>
	pos	n.
	mod	pl.
anagnorisis	0.
	syl	an+ag+nor:i+sis
	pron	<2@n*g1norisis>
	pos	n.
	usage	in Greek tragedy
	def	the recognition or discovery by the protagonist of the identity of some character or the nature of his own predica?!ment, which leads to the resolution of the plot; denouement.
anagoge	ety	C18: via Late Latin from Greek anag*_og*_e a lifting up, from anagein, from #7ana -#7+ agein to lead
anagogy	alt
	head	anagoge
	or	anagoge
	syl	an:a+go+gy
	pron	<1@n*2goJi>
	pos	n.
anagoge	1.
	or	anagogy
	syl	an:a+go+ge
	pron	<1@n*2goJi>
	pos	n.
	def	allegorical or spiritual interpretation, esp. of sacred works such as the Bible.
anagoge	2.
	or	anagogy
	syl	an:a+go+ge
	pron	<1@n*2goJi>
	pos	n.
	qual	Christianity.
	def	allegorical interpretation of the Old Testament as typifying or foreshadowing subjects in the New Testament.
anagogic	sub
	head	anagoge
	or	anagogical
	syl	an:a+gog+ic
	pron	<2@n*1goJik>
	pos	adj.
anagogical	sub
	head	anagoge
	or	anagogic
	syl	an:a+1gog:i+cal
	pos	adj.
anagogically	sub
	head	anagoge
	syl	an:a+1gog:i+cal+ly
	pos	adv.
anagram	ety	C16: from New Latin anagramma, shortened from Greek anagramma?!tismos, from anagrammatizein to transpose letters, from #7ana -#7+ gramma a letter
anagram	0.
	syl	an:a+gram
	pron	<1@n*2gr@m>
	pos	n.
	def	a word or phrase the letters of which can be rearranged into another word or phrase.
anagrammatic	sub
	head	anagram
	or	anagrammatical
	syl	an:a+gram+mat+ic
	pron	<2@n*gr*1m@tik>
	pos	adj.
anagrammatical	sub
	head	anagram
	or	anagrammatic
	syl	an:a+gram+1mat:i+cal
	pos	adj.
anagrammatically	sub
	head	anagram
	syl	an:a+gram+1mat:i+cal+ly
	pos	adv.
anagrammatise	alt
	head	anagrammatize
	or	anagrammatize
	syl	an:a+gram+ma+tise
	pron	<2@n*1gr@m*2tIz>
	pos	vb.
anagrammatize	0.
	or	anagrammatise
	syl	an:a+gram+ma+tize
	pron	<2@n*1gr@m*2tIz>
	pos	vb.
	def	to arrange into an anagram.
anagrammatism	sub
	head	anagrammatize
	syl	an:a+1gram+ma+2tism
	pos	n.
anagrammatist	sub
	head	anagrammatize
	syl	an:a+1gram+ma+tist
	pos	n.
Anaheim	0.
	syl	An:a+heim
	pron	<1@n*2hIm>
	pos	n.
	def	a city in SW California: site of Disneyland. Pop.: 186842 (1973 est.).
anak kuching	ety	from Malay: small cat
anak kuching	0.
	syl	a:nak ku+ching
	pron	<1ana> <1ku:CiG>
	pos	n.
	def	the Malaysian name for the {chevrotain}.
anal	ety	C18: from New Latin *_an*_alis; see #7anus 
anal	1.
	syl	a:nal
	pron	<1AnL>
	pos	adj.
	def	of, relating to, or near the anus.
anal	2.a.
	syl	a:nal
	pron	<1AnL>
	pos	adj.
	def	relating to a stage of psychosexual development during which the child's interest is concentrated on the anal region and excremental functions.
anal	2.b.
	syl	a:nal
	pron	<1AnL>
	pos	adj.
	def	designating personality traits in the adult, such as orderliness, meanness, stubbornness, etc., due to fixation at the anal stage of development. Compare { {oral} (sense 7)}.
anally	sub
	head	anal
	syl	a:nal+ly
	pos	adv.
anal	1.
	syl	anal.
	qual	abbrev. for:
	def	analogous.
anal	2.
	syl	anal.
	qual	abbrev. for:
	def	analogy.
anal	3.
	syl	anal.
	qual	abbrev. for:
	def	analysis.
anal	4.
	syl	anal.
	qual	abbrev. for:
	def	analytic.
anal canal	0.
	syl	a:nal ca+nal
	pos	n.
	def	the terminal part of the rectum forming the passage to the anus.
analcite	ety	C19: from Greek analkimos@T weak@T (from@T #7an -#7+ alkimos@T strong,@T from@T alk*_e strength)+-#7ite %1
analcime	alt
	head	analcite
	or	analcite
	syl	a:nal+cime
	pron	<@1n@lsim>, <-sIm>, <-sEm>
	pos	n.
analcite	0.
	or	analcime
	syl	a:nal+cite
	pron	<@1n@lsIt> <1@nL2sIt>, <-sit>
	pos	n.
	def	a white, grey, or colourless zeolite mineral consisting of hydrated sodium aluminium silicate in cubic crystalline form. Formula: NaAlSi\2O\6.H\2O.
analects	ety	C17: via Latin from Greek analekta, from analegein to collect up, from legein to gather
analecta	alt
	head	analects
	or	analects
	syl	an:a+lec+ta
	pron	<2@n*1lekt*>
	pos	n.
	mod	pl.
analects	0.
	or	analecta
	syl	an:a+lects
	pron	<1@n*2lekts>
	pos	n.
	mod	pl.
	def	selected literary passages from one or more works.
analectic	sub
	head	analects
	syl	an:a+1lec+tic
	pos	adj.
analemma	ety	C17: from Latin: sundial, pedestal of sundial, from Greek anal*_emma pedestal, from analambanein to support
analemmas	infl
	head	analemma
	or	analemmata
	syl	an:a+lem+mas
	pron	<-m*t*>
	pos	n.
	mod	pl.
analemmata	infl
	head	analemma
	or	analemmas
	syl	an:a+lem+ma+ta
	pron	<-m*t*>
	pos	n.
	mod	pl.
analemma	0.
	syl	an:a+lem+ma
	pron	<2@n*1lem*>
	pos	n.
	def	a graduated scale shaped like a figure eight that indicates the daily declination of the sun.
analemmatic	sub
	head	analemma
	syl	an:a+lem+mat+ic
	pron	<2@n*le1m@tik>
	pos	adj.
analeptic	ety	C17: from New Latin anal*_epticus, from Greek anal*_eptikos stimulat?!ing, from analambanein to take up; see #7analemma 
analeptic	1.
	syl	an:a+lep+tic
	pron	<2@n%@1leptik>
	pos	adj.
	usage	of a drug, etc.
	def	restorative or invigorating.
analeptic	2.
	syl	an:a+lep+tic
	pron	<2@n%@1leptik>
	pos	n.
	def	a restorative remedy or drug.
anal fin	0.
	syl	a:nal fin
	pos	n.
	def	a median ventral unpaired fin, situated between the anus and the tail fin in fishes, that helps to maintain stable equilibrium.
analgesia	ety	C18: via New Latin from Greek: insensibility, from #7an -#7+ alg*_esis sense of pain
analgia	alt
	head	analgesia
	or	analgesia
	syl	an+al+gi:a
	pron	<@n1@lJi*>
	pos	n.
analgesia	0.
	or	analgia
	syl	an+al+ge:si:a
	pron	<2@nL1JEzi*>, <-si*>
	pos	n.
	def	inability to feel pain.
analgesic	1.
	syl	an+al:ge+sic
	pron	<2@nL1JEzik>, <-sik>
	pos	adj.
	def	of or causing analgesia.
analgesic	2.
	syl	an+al:ge+sic
	pron	<2@nL1JEzik>, <-sik>
	pos	n.
	def	a substance that produces analgesia.
anal intercourse	0.
	syl	a:nal in:ter+course
	pos	n.
	def	a form of sexual intercourse in which the penis is inserted into the anus rather than the vagina.
analog computer	0.
	syl	an:a+log com+put+er
	pos	n.
	def	a mechanical, electrical, or electronic computer that performs arithmetical operations by using some variable physical quantity, such as voltage, to represent numbers. It is used in monitoring systems, simulation processes, etc., but is less accurate than a digital computer.
analog-digital converter	0.
	syl	an:a:log-dig:it:al con+vert+er
	pos	n.
	def	a device converting the output of an analog computer into its digital representation so that it can be fed into a digital computing system. Abbrev.: {A.D.C}.
analogise	alt
	head	analogize
	or	analogize
	syl	a:nal:o+gise
	pron	<*1n@l*2JIz>
	pos	vb.
analogize	1.
	or	analogise
	syl	a:nal:o+gize
	pron	<*1n@l*2JIz>
	pos	vb.
	mod	intr.
	def	to make use of analogy, as in argument; draw comparisons.
analogize	2.
	or	analogise
	syl	a:nal:o+gize
	pron	<*1n@l*2JIz>
	pos	vb.
	mod	tr.
	def	to make analogous or reveal analogy in.
analogous	ety	C17: from Latin analogus, from Greek analogos proportionate, from #7ana -#7+ logos speech, ratio
analogous	1.
	syl	a:nal:o+gous
	pron	<*1n@l*g*s>
	pos	adj.
	def	similar or corresponding in some respect.
analogous	2.
	syl	a:nal:o+gous
	pron	<*1n@l*g*s>
	pos	adj.
	usage	Biology. of organs and parts
	def	having the same function but different evolutionary origin.
	exam	1	the paddle of a whale and the fin of a fish are analogous.
analogous	3.
	syl	a:nal:o+gous
	pron	<*1n@l*g*s>
	pos	adj.
	qual	Linguistics.
	def	formed by analogy.
	exam	1	an analogous plural.
analogously	sub
	head	analogous
	syl	a:1nal:o+gous+ly
	pos	adv.
analogousness	sub
	head	analogous
	syl	a:1nal:o+gous+ness
	pos	n.
analog	alt
	head	analogue
	or	analogue
	syl	an:a+log
	pron	<1@n%*!log>
	pos	n.
	qual	U.S. (sometimes
analogue	1.
	or	analog
	syl	an:a+logue
	pron	<1@n%*!log>
	pos	n.
	def	something analogous to something else.
analogue	2.
	or	analog
	syl	an:a+logue
	pron	<1@n%*!log>
	pos	n.
	qual	Biology.
	def	an analogous part or organ.
analogy	ety	C16: from Greek analogia ratio, correspondence, from analogos #7analogous 
analogies	infl
	head	analogy
	syl	a:nal+o:gies.
	pos	n.
	mod	pl.
analogy	1.
	syl	a:nal+o:gy
	pron	<*1n@l*Ji>
	pos	n.
	def	agreement or similarity, esp. in a certain limited number of features or details.
analogy	2.
	syl	a:nal+o:gy
	pron	<*1n@l*Ji>
	pos	n.
	def	a comparison made to show such a similarity.
	exam	1	to draw an analogy between an atom and the solar system.
analogy	3.
	syl	a:nal+o:gy
	pron	<*1n@l*Ji>
	pos	n.
	qual	Biology.
	def	the relationship between analogous organs or parts.
analogy	4.
	syl	a:nal+o:gy
	pron	<*1n@l*Ji>
	pos	n.
	qual	Logic, maths.
	def	a form of reasoning in which a similarity between two or more things is inferred from a known similarity between them in other respects.
analogy	5.
	syl	a:nal+o:gy
	pron	<*1n@l*Ji>
	pos	n.
	qual	Linguistics.
	def	imitation of existing models or regular patterns in the formation of words, inflections, etc..
	exam	1	a child may use @6sheeps@9 as the plural of @6sheep@9 by analogy with @6dog,@9 @6dogs,@9 @6cat,@9 @6cats,@9 etc.
analogical	sub
	head	analogy
	or	analogic
	syl	an:a+log:i+cal
	pron	<2@n*1loJikL>
	pos	adj.
analogic	sub
	head	analogy
	or	analogical
	syl	2an:a+1log+ic
	pos	adj.
analphabetic	ety	C20: from Greek analphab*_etos; see #7an -#7, alphabet 
analphabetic	1.
	syl	an+al+pha+bet+ic
	pron	<2@n@lf*1betik>, <@n2@l->
	pos	adj.
	def	not in alpha?!betic order.
analphabetic	2.
	syl	an+al+pha+bet+ic
	pron	<2@n@lf*1betik>, <@n2@l->
	pos	n. adj.
	def	a less common word for {illiterate}.
analphabetically	sub
	head	analphabetic
	syl	an+al+pha+1bet:i+cal+ly
	pos	adv.
analysand	ety	C20: from #7analyse+ - and, on the model of multiplicand 
analysand	0.
	syl	a:nal:y+sand
	pron	<*1n@li2s@nd>
	pos	n.
	def	any person who is undergoing psychoanalysis.
analyse	ety	C17: back formation from #7analysis 
analyze	alt
	head	analyse
	or	analyse
	syl	an:a+lyze
	pron	<1@n%*!lIz>
	pos	vb.
	qual	U.S.
analyse	1.
	or	analyze
	syl	an:a+lyse
	pron	<1@n%*!lIz>
	pos	vb.
	mod	tr.
	def	to examine in detail in order to discover meaning, essential features, etc.
analyse	2.
	or	analyze
	syl	an:a+lyse
	pron	<1@n%*!lIz>
	pos	vb.
	mod	tr.
	def	to break down into components or essential features.
	exam	1	to analyse a financial structure.
analyse	3.
	or	analyze
	syl	an:a+lyse
	pron	<1@n%*!lIz>
	pos	vb.
	mod	tr.
	def	to make a mathematical, chemical, grammatical, etc., analysis of.
analyse	4.
	or	analyze
	syl	an:a+lyse
	pron	<1@n%*!lIz>
	pos	vb.
	def	another word for {psychoanalyse}.
analysable	sub
	head	analyse
	or	analyzable
	syl	an:a+1lys+a:ble
	pos	adj.
analyzable	sub
	head	analyse
	or	analysable
	syl	an:a+1lyz+a:ble
	pos	adj.
	qual	U.S.
analysation	sub
	head	analyse
	or	analyzation
	syl	an:a+ly+1sa+tion
	pos	n.
analyzation	sub
	head	analyse
	or	analysation
	syl	an:a+ly+1za+tion
	pos	n.
	qual	U.S.
analyser	sub
	head	analyse
	or	analyzer
	syl	an:a+2lys+er
	pos	n.
analyzer	sub
	head	analyse
	or	analyser
	syl	an:a+2lyz+er
	pos	n.
	qual	U.S.
analysis	ety	C16: from New Latin, from Greek analusis, literally: a dissolving, from analuein, from #7ana -#7+ luein to loosen
analyses	infl
	head	analysis
	syl	a:nal:y+ses
	pron	<-2sEz>
	pos	n.
	mod	pl.
analysis	1.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	def	the division of a physical or abstract whole into its constituent parts to examine or determine their relationship or value. Compare { {synthesis} (sense 1)}.
analysis	2.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	def	a statement of the results of this.
analysis	3.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	def	short for {psychoanalysis}.
analysis	4.a.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	def	the decomposition of a substance into its elements, radicals, or other constituents in order to determine the kinds of constituents present ({qualitative analysis}) or the amount of each constituent ({quantitative analysis) }.
analysis	4.b.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	def	the result obtained by such a determination.
analysis	5.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	qual	Linguistics.
	def	the use of word order together with word function to express syntactic relations in a language, as opposed to the use of inflections. Compare { {synthesis} (sense 4)}.
analysis	6.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	qual	Maths.
	def	the branch of mathematics principally concerned with the methods and concepts of algebra and calculus.
analysis	7.
	syl	a:nal:y+sis
	pron	<*1n@lisis>
	pos	n.
	usage	Philosophy. in the writings of Kant
	def	the separation of a concept from another that contains it. Compare {{synthesis} (sense 6)}.
final	infl
	head	analysis
	or	ultimate analysis
	syl	final
ultimate analysis	infl
	head	analysis
	or	final
	syl	ultimate analysis.
analysin the last	8.
	head	analysis
	syl	a:nal:y+sin the last
	def	after everything has been given due consideration.
analysis of variance	0.
	syl	a:nal:y+sis of var:i+ance
	pos	n.
	qual	Statistics.
	def	a technique for analys?!ing the total variation of a set of observations as measured by the variance of the observations multiplied by their number.
analysis situs	0.
	syl	a:nal:y+sis si+tus
	pos	n.
	def	a former name for { {topology} (sense 2)}.
analyst	1.
	syl	an:a+lyst
	pron	<1@n*list>
	pos	n.
	def	a person who analyses or is skilled in analysis.
analyst	2.
	syl	an:a+lyst
	pron	<1@n*list>
	pos	n.
	def	short for {psychoanalyst}.
analytic	ety	C16: via Late Latin from Greek analutikos from analuein to dissolve, break down; see #7analysis  &- @!an@.a+#!lyt@.i+cal+ly adv.
analytical	alt
	head	analytic
	or	analytic
	syl	an:a+lyt:i+cal
	pos	adj.
analytic	1.
	or	analytical
	syl	an:a+lyt+ic
	pron	<2@n*1litik>
	pos	adj.
	def	relating to analysis.
analytic	2.
	or	analytical
	syl	an:a+lyt+ic
	pron	<2@n*1litik>
	pos	adj.
	def	capable of or given to analysing.
	exam	1	an analytic mind.
analytic	3.
	or	analytical
	syl	an:a+lyt+ic
	pron	<2@n*1litik>
	pos	adj.
	def	Also: {isolating}. denoting languages, such as Chinese, whose morphology is characterized by analysis. Compare { {synthetic} (sense 3)}, { {agglutinative} (sense 2)}, {polysynthetic}.
analytic	4.
	or	analytical
	syl	an:a+lyt+ic
	pron	<2@n*1litik>
	pos	adj.
	usage	Logic. of a proposition
	def	necessarily true by reference to meaning alone, being independent of fact or experience, as in Compare {{synthetic} (sense 4)}, {a priori}.
analytic	5.
	or	analytical
	syl	an:a+lyt+ic
	pron	<2@n*1litik>
	pos	adj.
	def	Also called: {regular, holomorphic}. (of a function of a complex variable) having a derivative at each point of its domain.
analytical geometry	0.
	syl	an:a+lyt:i+cal ge+om+e:try
	pos	n.
	def	the branch of geometry that uses algebraic notation and analysis to locate a geometric point in terms of a coordinate system; coordinate geometry.
analytic psychology	0.
	syl	an:a+lyt+ic psy+chol+o:gy
	pos	n.
	def	a school of psychoanalysis found?!ed by Jung as a result of disagreements with Freud. See also {archetype, collective unconscious}.
Anam	0.
	syl	A:nam
	pron	<@1n@m>, <1@n@m>
	pos	n.
	def	a variant spelling of {Annam}.
Anambra	0.
	syl	A:nam+bra
	pron	<*1n@mbr*>
	pos	n.
	def	a state of S Nigeria, formed in 1976 from part of East-Central State. Capital: Enugu. Pop.: 2469000 (1976 est.). Area: 21189 sq. km (8179 sq. miles).
anamnesis	ety	C17: via New Latin from Greek, from anamimn*_eskein to recall, from mimn*_eskein to call to mind
anamneses	infl
	head	anamnesis
	syl	an+am+ne+ses
	pron	<-sEz>
	pos	n.
	mod	pl.
anamnesis	1.
	syl	an+am+ne+sis
	pron	<2@n@m1nEsis>
	pos	n.
	def	the ability to recall past events; recollection.
anamnesis	2.
	syl	an+am+ne+sis
	pron	<2@n@m1nEsis>
	pos	n.
	def	the case history of a patient.
anamnestic	sub
	head	anamnesis
	syl	an+am+nes+tic
	pron	<2@n@m1nestik>
	pos	adj.
anamnestically	sub
	head	anamnesis
	syl	an+am+1nes+ti+cal+ly
	pos	adv.
anamorphic	0.
	syl	an:a+mor+phic
	pron	<2@n*1mc:fik>
	pos	adj.
	def	of, relating to, or caused by anamorphosis or anamorphism.
anamorphism	0.
	syl	an:a+mor+phism
	pron	<2@n*1mc:fiz*m>
	pos	n.
	def	metamorphism of a rock in which complex minerals are formed from simpler ones.
anamorphoscope	0.
	syl	an:a+mor+pho+scope
	pron	<2@n*1mc:f*2sk*up>
	pos	n.
	def	an optical device, such as a cylindrical lens, for correcting an image that has been distorted by anamorphosis.
anamorphosis	ety	C18: from Greek, from anamorphoun to transform, from morph*_e form, shape
anamorphoses	infl
	head	anamorphosis
	syl	an:a+mor+pho+ses
	pron	<-2sEz>
	pos	n.
	mod	pl.
anamorphosis	1.a.
	syl	an:a+mor+pho+sis
	pron	<2@n*1mc:f*sis>, <-mc:1f*usis>
	pos	n.
	def	an image or drawing distorted in such a way that it becomes recognizable only when viewed in a specified manner or through a special device.
anamorphosis	1.b.
	syl	an:a+mor+pho+sis
	pron	<2@n*1mc:f*sis>, <-mc:1f*usis>
	pos	n.
	def	the process by which such images or drawings are produced.
anamorphosis	2.
	syl	an:a+mor+pho+sis
	pron	<2@n*1mc:f*sis>, <-mc:1f*usis>
	pos	n.
	def	the evolution of one type of organism from another by a series of gradual changes.
anandrous	ety	C19: from Greek anandros, lacking males, from #7an -#7+ an*_er man
anandrous	0.
	syl	an+an+drous
	pron	<@n1@ndr*s>
	pos	adj.
	usage	of flowers
	def	having no stamens.
Ananias	1.
	syl	An:a:ni:as
	pron	<2@n*1nI*s>
	pos	n.
	qual	New Testament.
	def	a Jewish Christian of Jerusalem who was struck dead for lying (Acts 5).
Ananias	2.
	syl	An:a:ni:as
	pron	<2@n*1nI*s>
	pos	n.
	def	a liar.
ananthous	ety	C19: from Greek ananth*_es, from #7an -#7+ anthos flower
ananthous	0.
	syl	an+an+thous
	pron	<@n1@nT*s>
	pos	adj.
	usage	of higher plants
	def	having no flowers.
anapaest	ety	C17: via Latin from Greek anapaistos reversed, (that is, a dactyl reversed), from anapaiein, from ana- back+ paiein to strike &- @!an@.a+#!paes+tic or @!an@.a+#!pes+tic adj.
anapest	alt
	head	anapaest
	or	anapaest
	syl	an:a+pest
	pron	<1@n*pest>, <-2pEst>
	pos	n.
anapaest	0.
	or	anapest
	syl	an:a+paest
	pron	<1@n*pest>, <-2pEst>
	pos	n.
	qual	Prosody.
	def	a metrical foot of three syllables, the first two short, the last long (*u *u *_ ).
anaphase	ety	C19: from #7ana -#7+phase 
anaphase	1.
	syl	an:a+phase
	pron	<1@n*2fAz>
	pos	n.
	def	the third stage of mitosis, during which the chromatids separate and migrate towards opposite ends of the spindle. See also {prophase, metaphase, telophase}.
anaphase	2.
	syl	an:a+phase
	pron	<1@n*2fAz>
	pos	n.
	def	the corresponding stage of the first division of meiosis.
anaphora	ety	C16: via Latin from Greek: repetition, from anapherein, from #7ana -+ pherein to bear
anaphora	1.
	syl	a:naph:o+ra
	pron	<*1n@f*r*>
	pos	n.
	qual	Rhetoric.
	def	the repetition of a word or phrase at the beginning of successive clauses.
anaphora	2.
	syl	a:naph:o+ra
	pron	<*1n@f*r*>
	pos	n.
	qual	Grammar.
	def	the use of a word such as a pronoun to avoid repetition of a word or words, as for example in
anaphoral	sub
	head	anaphora
	or	anaphoric
	syl	a:1naph:o+ral
	pron	<2@n*1forik>
	pos	adj.
anaphoric	sub
	head	anaphora
	or	anaphoral
	syl	an:a+pho:r+ic
	pron	<2@n*1forik>
	pos	adj.
anaphorically	sub
	head	anaphora
	syl	2an:a+1phor:i+cal+ly
	pos	adv.
anaphrodisiac	1.
	syl	an+aph+ro+dis+i:ac
	pron	<2@n@fr*1dizi2@k>
	pos	adj.
	def	tending to lessen sexual desire.
anaphrodisiac	2.
	syl	an+aph+ro+dis+i:ac
	pron	<2@n@fr*1dizi2@k>
	pos	n.
	def	an anaphrodisiac drug.
anaphrodisia	sub
	head	anaphrodisiac
	syl	an+aph+ro+1dis:i:a
	pos	n.
anaphylaxis	ety	C20: from #7ana -#7+ (#7pro) #7phylaxis  &- @!an@.a+phy+#!lac+tic adj.
anaphylaxis	0.
	syl	an:a+phy+lax+is
	pron	<2@n*fi1l@ksis>
	pos	n.
	def	extreme sensitivity to an injected antigen, esp. a protein, following a previous injection.
anaphylactically	sub
	head	anaphylaxis
	syl	an:a+phy+1lac+ti+cal+ly
	pos	adv.
anaplasia	0.
	syl	an:a+pla+si:a
	pron	<2@n*1plAsi*>
	pos	n.
	def	reversion of plant or animal cells to a simpler less differentiated form.
anaplastic	1.
	syl	an:a+plas+tic
	pron	<2@n*1pl@stik>
	pos	adj.
	def	of or relating to anaplasia.
anaplastic	2.
	syl	an:a+plas+tic
	pron	<2@n*1pl@stik>
	pos	adj.
	def	relating to plastic surgery.
anaplasty	0.
	syl	an:a+plas+ty
	pron	<1@n*2pl@sti>
	pos	n.
	qual	Surgery.
	def	another name for {plastic surgery}.
anaptyxis	ety	C19: via New Latin from Greek anaptuxis, from anaptussein to unfold, from #7ana -#7+ ptussein to fold
anaptyxes	infl
	head	anaptyxis
	syl	an+ap+tyx:es
	pron	<-1tiksEz>
	pos	n.
	mod	pl.
anaptyxis	0.
	syl	an+ap+tyx+is
	pron	<2@n@p1tiksis>
	pos	n.
	def	the insertion of a short vowel between consonants in order to make a word more easily pronounceable.
anaptyctic	sub
	head	anaptyxis
	or	anaptyctical
	syl	an+ap+tyc+tic
	pron	<2@n@p1tiktik>
	pos	adj.
anaptyctical	sub
	head	anaptyxis
	or	anaptyctic
	syl	an+ap+1tyc+ti+cal
	pos	adj.
Anapurna	0.
	syl	A:na+pur+na
	pron	<2@n*1pu*n*>
	pos	n.
	def	a variant spelling of {Annapurna}.
anarch	0.
	syl	an+arch
	pron	<1@na:k>
	pos	n.
	qual	Archaic.
	def	an instigator or personification of anarchy.
anarchism	1.
	syl	an+ar+chism
	pron	<1@n*2kiz*m>
	pos	n.
	qual	Political theory.
	def	a doctrine advocating the abolition of government.
anarchism	2.
	syl	an+ar+chism
	pron	<1@n*2kiz*m>
	pos	n.
	def	the principles or practice of anarchists.
anarchist	1.
	syl	an+ar+chist
	pron	<1@n*kist>
	pos	n.
	def	a person who advocates the abolition of government and a social system based on voluntary cooperation.
anarchist	2.
	syl	an+ar+chist
	pron	<1@n*kist>
	pos	n.
	def	a person who causes disorder or upheaval.
anarchistic	sub
	head	anarchist
	syl	an+ar+1chis+tic
	pos	adj.
anarchy	ety	C16: from Medieval Latin anarchia, from Greek anarkhia, from anarkhos without a ruler, from #7an -#7+ arkh- leader, from arkhein to rule
anarchy	1.
	syl	an+ar+chy
	pron	<1@n*ki>
	pos	n.
	def	general lawlessness and disorder, esp. when thought to result from an absence or failure of government.
anarchy	2.
	syl	an+ar+chy
	pron	<1@n*ki>
	pos	n.
	def	the absence or lack of government.
anarchy	3.
	syl	an+ar+chy
	pron	<1@n*ki>
	pos	n.
	def	the absence of any guiding or uniting principle; disorder; chaos.
anarchy	4.
	syl	an+ar+chy
	pron	<1@n*ki>
	pos	n.
	def	the theory or practice of political anarchism.
anarchic	sub
	head	anarchy
	or	anarchical
	syl	an+ar+chic
	pron	<@n1a:kik>
	pos	adj.
anarchical	sub
	head	anarchy
	or	anarchic
	syl	an+1ar+chi+cal
	pos	adj.
anarchically	sub
	head	anarchy
	syl	an+1ar+chi+cal+ly
	pos	adv.
anarthria	ety	C19: New Latin, from Greek anarthros lacking vigour, from #7an -+ arthros joint
anarthria	0.
	syl	an+ar+thri:a
	pron	<@n1a:Tri*>
	pos	n.
	qual	Pathol.
	def	loss of the ability to speak coherently.
anarthrous	ety	C19: from Greek anarthros, from #7an -#7+ arthros joint, definite article &- an+#!ar+throus+ly adv.
anarthrous	1.
	syl	an+ar+throus
	pron	<@n1a:Tr*s>
	pos	adj.
	usage	of a noun
	def	used without an article.
anarthrous	2.
	syl	an+ar+throus
	pron	<@n1a:Tr*s>
	pos	adj.
	def	having no joints or articulated limbs.
anarthrousness	sub
	head	anarthrous
	syl	an+1ar+throus+ness
	pos	n.
anasarca	ety	C14: from New Latin, from #7ana - (puffed up)#7+ Greek sarx flesh
anasarca	0.
	syl	an:a+sar+ca
	pron	<2@n*1sa:k*>
	pos	n.
	qual	Pathol.
	def	a generalized accumulation of serous fluid within the subcutaneous connective tissue, resulting in oedema.
anasarcous	sub
	head	anasarca
	syl	an:a+1sar+cous
	pos	adj.
Grand Duchess	infl
	head	Anastasia
	syl	Grand Duchess.
	pos	n.
Anastasia	0.
	syl	An:a:sta:si:a
	pron	<2@n*1sta:zi*>, <-1stA->
	pos	n.
	def	1901-?!??1918, daughter of Tsar Nicholas II, believed to have been executed by the Bolsheviks in 1918, although several women subsequently claimed to be her.
anastigmat	0.
	syl	an+as+tig+mat
	pron	<@1n@stig2m@t>, <2@n*1stigm@t>
	pos	n.
	def	a lens or system of lenses designed to be free of astigmatism.
anastigmatic	0.
	syl	an+as+tig+mat+ic
	pron	<2@n*stig1m@tik>
	pos	adj.
	usage	of a lens or optical device
	def	not astigmatic. Also: {stigmatic}.
anastomose	0.
	syl	a:nas+to+mose
	pron	<*1n@st*2m*uz>
	pos	vb.
	def	to join (two parts of a blood vessel, etc.) by anastomosis.
anastomosis	ety	C16: via New Latin from Greek: opening, from anastomoun to equip with a mouth, from stoma mouth
anastomoses	infl
	head	anastomosis
	syl	a:nas+to+mo+ses
	pron	<-sEz>
	pos	n.
	mod	pl.
anastomosis	1.
	syl	a:nas+to+mo+sis
	pron	<*2n@st*1m*usis>
	pos	n.
	def	a natural connection between two tubular structures, such as blood vessels.
anastomosis	2.
	syl	a:nas+to+mo+sis
	pron	<*2n@st*1m*usis>
	pos	n.
	def	the surgical union of two hollow organs or parts that are normally separate.
anastomotic	sub
	head	anastomosis
	syl	a:nas+to+mot+ic
	pron	<*2n@st*1motik>
	pos	adj.
anastrophe	ety	C16: from Greek, from anastrephein to invert
anastrophe	0.
	syl	a:nas+tro+phe
	pron	<*1n@str*fi>
	pos	n.
	qual	Rhetoric.
	def	{another term for {inversion} (sense 3)}.
anat	1.
	syl	anat.
	qual	abbrev. for:
	def	anatomical.
anat	2.
	syl	anat.
	qual	abbrev. for:
	def	anatomy.
anatase	ety	C19: from French, from Greek anatasis an extending (referring to the length of the crystals), from anateinein to stretch out
anatase	0.
	syl	an:a+tase
	pron	<1@n*2tAz>
	pos	n.
	def	a rare blue or black mineral that consists of titanium oxide in tetragonal crystalline form and occurs in veins in igneous rocks. Formula: TiO\2. Also called: {octahedrite}.
anathema	ety	C16: via Church Latin from Greek: something accursed, dedicated (to evil), from anatithenai to dedicate, from #7ana -#7+ tithenai to set
anathemas	infl
	head	anathema
	syl	a:nath+e:mas.
	pos	n.
	mod	pl.
anathema	1.
	syl	a:nath+e:ma
	pron	<*1n@T*m*>
	pos	n.
	def	a detested person or thing.
	exam	1	he is anathema to me.
anathema	2.
	syl	a:nath+e:ma
	pron	<*1n@T*m*>
	pos	n.
	def	a formal ecclesiastical curse of excommunication or a formal denunciation of a doctrine.
anathema	3.
	syl	a:nath+e:ma
	pron	<*1n@T*m*>
	pos	n.
	def	the person or thing so cursed.
anathema	4.
	syl	a:nath+e:ma
	pron	<*1n@T*m*>
	pos	n.
	def	a strong curse; imprecation.
anathematise	alt
	head	anathematize
	or	anathematize
	syl	a:nath+e:ma+tise
	pron	<*1n@Tim*2tIz>
	pos	vb.
anathematize	0.
	or	anathematise
	syl	a:nath+e:ma+tize
	pron	<*1n@Tim*2tIz>
	pos	vb.
	def	to pronounce an anathema (upon a person, etc.); curse.
anathematization	sub
	head	anathematize
	or	anathematisation
	syl	a:2nath+e:ma+ti+1za+tion
	pos	n.
anathematisation	sub
	head	anathematize
	or	anathematization
	syl	a:2nath+e:ma+ti+1sa+tion
	pos	n.
Anatolia	0.
	syl	An:a+to+li:a
	pron	<2@n*1t*uli*>
	pos	n.
	def	the Asian part of Turkey, occupying the peninsula between the Black Sea, the Mediterranean, and the Aegean: consists of a plateau, largely mountainous, with salt lakes in the interior. Historical name: {Asia Minor}.
Anatolian	1.
	syl	An:a+to+li:an
	pron	<2@n*1t*uli*n>
	pos	adj.
	def	of or relating to Anatolia or its inhabitants.
Anatolian	2.
	syl	An:a+to+li:an
	pron	<2@n*1t*uli*n>
	pos	adj.
	def	denoting, belonging to, or relating to an ancient family of languages related to the Indo-European family and including Hittite.
Anatolian	3.
	syl	An:a+to+li:an
	pron	<2@n*1t*uli*n>
	pos	n.
	def	this family of languages, some?!times regarded as a branch of Indo-European.
Anatolian	4.
	syl	An:a+to+li:an
	pron	<2@n*1t*uli*n>
	pos	n.
	def	a native or inhabitant of Anatolia.
anatomical	0.
	syl	an:a+tom:i+cal
	pron	<2@n*1tomikL>
	pos	adj.
	def	of or relating to anatomy.
anatomically	sub
	head	anatomical
	syl	an:a+1tom:i+cal+ly
	pos	adv.
anatomical snuffbox	0.
	syl	an:a+tom:i+cal snuff+box
	pos	n.
	def	the triangular depression on the back of the hand between the thumb and the index finger.
anatomist	0.
	syl	a:nat:o+mist
	pron	<*1n@t*mist>
	pos	n.
	def	an expert in anatomy.
anatomise	alt
	head	anatomize
	or	anatomize
	syl	a:nat:o+mise
	pron	<*1n@t*2mIz>
	pos	vb.
	mod	tr.
anatomize	1.
	or	anatomise
	syl	a:nat:o+mize
	pron	<*1n@t*2mIz>
	pos	vb.
	mod	tr.
	def	to dissect (an animal or plant).
anatomize	2.
	or	anatomise
	syl	a:nat:o+mize
	pron	<*1n@t*2mIz>
	pos	vb.
	mod	tr.
	def	to examine in minute detail.
anatomization	sub
	head	anatomize
	or	anatomisation
	syl	a:2nat:o+mi+1za+tion
	pos	n.
anatomisation	sub
	head	anatomize
	or	anatomization
	syl	a:2nat:o+mi+1sa+tion
	pos	n.
anatomizer	sub
	head	anatomize
	or	anatomiser
	syl	a:1nat:o+2miz+er
	pos	n.
anatomiser	sub
	head	anatomize
	or	anatomizer
	syl	a:1nat:o+2mis+er
	pos	n.
anatomy	ety	C14: from Latin anatomia, from Greek anatom*_e, from anatemnein to cut up, from #7ana -#7+ temnein to cut
anatomies	infl
	head	anatomy
	syl	a:nat:o+mies.
	pos	n.
	mod	pl.
anatomy	1.
	syl	a:nat:o+my
	pron	<*1n@t*mi>
	pos	n.
	def	the science concerned with the physical structure of animals and plants.
anatomy	2.
	syl	a:nat:o+my
	pron	<*1n@t*mi>
	pos	n.
	def	the physical structure of an animal or plant or any of its parts.
anatomy	3.
	syl	a:nat:o+my
	pron	<*1n@t*mi>
	pos	n.
	def	a book or treatise on this subject.
anatomy	4.
	syl	a:nat:o+my
	pron	<*1n@t*mi>
	pos	n.
	def	dissection of an animal or plant.
anatomy	5.
	syl	a:nat:o+my
	pron	<*1n@t*mi>
	pos	n.
	def	any detailed analysis.
	exam	1	the anatomy of a crime.
anatomy	6.
	syl	a:nat:o+my
	pron	<*1n@t*mi>
	pos	n.
	qual	Informal.
	def	the human body.
anatropous	ety	C19: from #7ana - (inverted)+-#7tropous 
anatropous	0.
	syl	a:nat+ro+pous
	pron	<*1n@tr*p*s>
	pos	adj.
	usage	of a plant ovule
	def	inverted during development by a bending of the stalk (funicle) attaching it to the carpel wall. Compare {orthotropous}.
anattos	infl
	head	anatto
	syl	a:nat+tos.
	pos	n.
	mod	pl.
anatto	0.
	syl	a:nat+to
	pron	<*1n@t*u>
	pos	n.
	def	a variant spelling of {annatto}.
Anaxagoras	0.
	syl	An:ax:ag:o:ras
	pron	<2@n@k1s@g*r*s>
	pos	n.
	def	??500-428 #7b.c., Greek phi?!losopher who maintained that all things were composed of minute particles arranged by an eternal intelligence.
Anaximander	0.
	syl	A:nax:i:man:der
	pron	<*2n@ksi1m@nd*>
	pos	n.
	def	611-547 #7b.c., Greek philosopher, astronomer, and mathematician who believed the first principle of the world to be the Infinite.
Anaximenes	0.
	syl	An:ax:im:e:nes
	pron	<2@n@k1sim*2nEz>
	pos	n.
	def	6th century #7b.c., Greek philosopher who believed air to be the primary substance.
anbury	ety	C16: of uncertain origin
anburies	infl
	head	anbury
	syl	an+bur:ies.
	pos	n.
	mod	pl.
anbury	1.
	syl	an+bur:y
	pron	<1@nb*ri>
	pos	n.
	def	a soft spongy tumour occurring in horses and oxen.
anbury	2.
	syl	an+bur:y
	pron	<1@nb*ri>
	pos	n.
	def	a disease of cruciferous plants, esp. root crops, in which the roots are clubbed.
-ance	ety	via Old French from Latin -antia; see -#7ancy 
-ancy	alt
	head	-ance
	or	-ance
	syl	-an:cy
-ance	0.
	or	-ancy
	syl	-ance
	usage	suffix forming nouns.
	def	indicating an action, state or condition, or quality.
	exam	1	utterance;
	exam	2	hindrance;
	exam	3	resemblance.
ancestor	ety	C13: from Old French ancestre, from Late Latin antec*_essor one who goes before, from Latin antec*_edere; see #7antecede 
ancestor	1.
	syl	an+ces+tor
	pron	<1@nsest*>
	pos	n.
	mod	often; pl.
	def	a person from whom another is directly descended, esp. someone more distant than a grandparent; forefather.
ancestor	2.
	syl	an+ces+tor
	pron	<1@nsest*>
	pos	n.
	def	an early type of animal or plant from which a later, usually dissimilar, type has evolved.
ancestor	3.
	syl	an+ces+tor
	pron	<1@nsest*>
	pos	n.
	def	a person or thing regarded as a forerunner of a later person or thing.
	exam	1	the ancestor of the modern camera.
ancestress	sub
	head	ancestor
	syl	an+ces+tress
	pos	n.
	mod	fem.
ancestral	0.
	syl	an+ces+tral
	pron	<@n1sestr*l>
	pos	adj.
	def	of, inherited from, or derived from ancestors.
ancestrally	sub
	head	ancestral
	syl	an+1ces+tral+ly
	pos	adv.
ancestries	infl
	head	ancestry
	syl	an+ces+tries.
	pos	n.
	mod	pl.
ancestry	1.
	syl	an+ces+try
	pron	<1@nsestri>
	pos	n.
	def	lineage or descent, esp. when ancient, noble, or distinguished.
ancestry	2.
	syl	an+ces+try
	pron	<1@nsestri>
	pos	n.
	def	ancestors collectively.
Anchises	0.
	syl	An:chi:ses
	pron	<@n1kIsEz>
	pos	n.
	qual	Classical myth.
	def	a Trojan prince and father of Aeneas. In the he is rescued by his son at the fall of Troy and dies in Sicily.
anchor	ety	Old English ancor, from Latin ancora, from Greek ankura; related to Greek ankos bend; compare Latin uncus bent, hooked
anchor	1.
	syl	an+chor
	pron	<1@Gk*>
	pos	n.
	def	any of several devices, usually of steel, attached to a vessel by a cable and dropped overboard so as to grip the bottom and restrict the vessel's movement.
anchor	2.
	syl	an+chor
	pron	<1@Gk*>
	pos	n.
	def	an object used to hold something else firmly in place.
	exam	1	the rock provided an anchor for the rope.
anchor	3.
	syl	an+chor
	pron	<1@Gk*>
	pos	n.
	def	a source of stability or security.
	exam	1	religion was his anchor.
anchor	4.
	syl	an+chor
	pron	<1@Gk*>
	pos	n.
	def	a metal cramp, bolt, or similar fitting, esp. one used to make a connection to masonry.
anchor	5.a.
	syl	an+chor
	pron	<1@Gk*>
	pos	n.
	def	the rear person in a tug-of-war team.
anchor	5.b.
	syl	an+chor
	pron	<1@Gk*>
	pos	n.
	def	short for {anchor man}.
at anchor	6.
	head	anchor
	syl	at anchor.
	usage	of a vessel
	def	anchored.
ancome to	infl
	head	anchor
	or	drop anchor
	syl	an+come to
drop anchor	infl
	head	anchor
	or	ancome to
	syl	drop anchor.
ancast	7.
	head	anchor
	syl	an+cast
	def	to anchor a vessel.
weigh anchor	8.
	head	anchor
	syl	weigh anchor.
	def	to haul in an anchor.
ride at anchor	9.
	head	anchor
	syl	ride at anchor.
	def	to be anchored.
drag anchor	10.
	head	anchor
	syl	drag anchor.
	usage	of a vessel
	def	to be subjected to such strain, esp. by wind or waves, as to cause the anchor to lose hold on the bottom.
anchor	11.
	syl	an+chor
	pron	<1@Gk*>
	pos	vb.
	def	to use an anchor to hold (a vessel) in one place.
anchor	12.
	syl	an+chor
	pron	<1@Gk*>
	pos	vb.
	def	to fasten or be fastened securely; fix or become fixed firmly.
anchorage	1.
	syl	an+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	the act of anchoring.
anchorage	2.
	syl	an+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	any place where a vessel is anchored.
anchorage	3.
	syl	an+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	a place designated for vessels to anchor.
anchorage	4.
	syl	an+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	a fee imposed for anchoring.
anchorage	5.
	syl	an+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	anything used as an anchor.
anchorage	6.
	syl	an+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	a source of security or strength.
anchorage	7.
	syl	an+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	something that supplies a secure hold for something else.
Anchorage	0.
	syl	An+chor+age
	pron	<1@Gk*riJ>
	pos	n.
	def	the largest city in Alaska, a port in the south, at the head of Cook Inlet. Pop.: 48029 (1970).
anchorite	ety	C15: from Medieval Latin anchor*_ita, from Late Latin anach*_or*_eta, from Greek ana?!kh*_or*_et*_es, from anakh*_orein to retire, withdraw, from kh*_ora a space
anchorite	0.
	syl	an+cho+rite
	pron	<1@Gk*2rIt>
	pos	n.
	def	a person who lives in seclusion, esp. a religious recluse; hermit.
anchoress	sub
	head	anchorite
	syl	an+cho+ress
	pos	n.
	mod	fem.
anchor man	1.
	syl	an+chor man
	pos	n.
	qual	Sport.
	def	the last person in a team to compete, esp. in a relay race.
anchor man	2.
	syl	an+chor man
	pos	n.
	usage	in broadcasting
	def	a person in a central studio who links up and maintains contact with various outside camera units, reporters, etc.
anchor ring	0.
	syl	an+chor ring
	pos	n.
	def	a ring made from an iron bar of circular cross-section.
anchoveta	ety	C20: Spanish, diminutive of anchova #7anchovy 
anchoveta	0.
	syl	an+cho+vet:a
	pron	<2@nC*1vet*>
	pos	n.
	def	a small anchovy, of the American Pacific, used as bait by tuna fishermen.
anchovy	ety	C16: from Spanish anchova, perhaps ultimately from Greek aphu*_e small fish
anchovies	infl
	head	anchovy
	or	anchovy
	syl	an+cho+vies
	pos	n.
	mod	pl.
anchovy	infl
	or	anchovies
	syl	an+cho+vy.
	pos	n.
	mod	pl.
anchovy	0.
	syl	an+cho+vy
	pron	<1@nC*vi>
	pos	n.
	def	any of various small marine food fishes of the genus and related genera, esp. of S Europe: family (herrings). They have a salty taste and are often canned or made into a paste or essence.
anchovy pear	0.
	syl	an+cho+vy pear
	pos	n.
	def	a West Indian tree, bearing edible fruit that taste like the mango: family
anchusa	ety	C18: from Latin
anchusa	0.
	syl	an+chu+sa
	pron	<@G1kju:s*>
	pos	n.
	def	any Eurasian plant of the boragi?!naceous genus having rough hairy stems and leaves and blue flowers. {See also {alkanet} (sense 3)}, {{bugloss}}.
anchusin	0.
	syl	an+chu+sin
	pron	<@G1kju:sin>
	pos	n.
	def	another name {for {alkanet} (sense 2)}.
anchylose	0.
	syl	an+chy+lose
	pron	<1@Gki2l*uz>
	pos	vb.
	def	a variant spelling of {ankylose}.
anchylosis	sub
	head	anchylose
	syl	an+chy+1lo+sis
	pos	n.
anchylotic	sub
	head	anchylose
	syl	an+chy+lot+ic
	pron	<2@Gki1lotik>
	pos	adj.
ancien r'egime	ety	literally: old regime
anciens r'egimes	infl
	head	ancien r'egime
	syl	an+ciens r*'e+gimes
	pron	<*~asj*~e> <rA1Zim>
	pos	n.
	mod	pl.
ancien r'egime	1.
	syl	an+cien r*'e+gime
	pron	French. <*~asj*~e> <rA1Zim>
	pos	n.
	def	the political and social system of France before the Revolution of 1789.
ancien r'egime	2.
	syl	an+cien r*'e+gime
	pron	French. <*~asj*~e> <rA1Zim>
	pos	n.
	def	a former or outdated regime.
ancient	ety	C14: from Old French ancien, from Vulgar Latin anteanus (unattested), from Latin ante before
ancient	H1.1.
	syl	an+cient
	pron	<1AnS*nt>
	pos	adj.
	def	dating from very long ago.
	exam	1	ancient ruins.
ancient	H1.2.
	syl	an+cient
	pron	<1AnS*nt>
	pos	adj.
	def	very old; aged.
ancient	H1.3.
	syl	an+cient
	pron	<1AnS*nt>
	pos	adj.
	def	of the far past, esp. before the collapse of the Western Roman Empire (476 #7a.d.) #7. Compare {medieval, modern}.
ancient	H1.4.
	syl	an+cient
	pron	<1AnS*nt>
	pos	adj.
	qual	Law.
	def	having existed since before the time of legal memory.
ancient light	5.
	head	ancient
	syl	ancient light.
	def	a right to the access of light through a window, recognized at law when it has been enjoyed for 20 years or more without interruption.
ancient	H1.6.
	syl	an+cient
	pron	<1AnS*nt>
	pos	n.
	mod	often; pl.
	def	a member of a civilized nation in the ancient world, esp. a Greek, Roman, or Hebrew.
ancient	H1.7.
	syl	an+cient
	pron	<1AnS*nt>
	pos	n.
	mod	often; pl.
	def	one of the classical authors of Greek or Roman antiquity.
ancient	H1.8.
	syl	an+cient
	pron	<1AnS*nt>
	pos	n.
	qual	Archaic.
	def	an old man.
ancientness	sub
	head	ancient
	syl	an+cient+ness
	pos	n.
ancient	ety	C16: changed from #7ensign through the influence of #7ancient %1
ancient	H2.1.
	syl	an+cient
	pron	<1AnS*nt>
	pos	n.
	qual	Archaic.
	def	a flag or other banner; standard.
ancient	H2.2.
	syl	an+cient
	pron	<1AnS*nt>
	pos	n.
	qual	Archaic.
	def	a standard-bearer; ensign.
Ancient Greek	0.
	syl	An+cient Greek
	pos	n.
	def	the Greek language from the earliest records to about 300 #7b.c., the chief dialect areas of which were Aeolic, Arcadic, Doric, and Ionic (including Attic). Compare {Koine, Late Greek, Medieval Greek}.
ancient history	1.
	syl	an+cient his+to+ry
	pos	n.
	def	the history of the {ancient world}, from the earliest known civilizations to the collapse of the Western Roman Empire in 476 #7a.d. #7.
ancient history	2.
	syl	an+cient his+to+ry
	pos	n.
	qual	Informal.
	def	a recent event or fact sufficiently familiar to have lost its pertinence.
anciently	0.
	syl	an+cient+ly
	pron	<1AnS*ntli>
	pos	adv.
	def	in ancient times.
Ancient of Days	0.
	syl	An+cient of Days
	pos	n.
	qual	Old Testament.
	def	God (Daniel 7:9).
ancillary	ety	C17: from Latin ancill*_aris concerning maidservants, from ancilla, diminutive of anc*_ula female servant
ancillary	1.
	syl	an+cil+lar:y
	pron	<@n1sil*ri>
	pos	adj.
	def	subsidiary.
ancillary	2.
	syl	an+cil+lar:y
	pron	<@n1sil*ri>
	pos	adj.
	def	auxiliary; supplementary.
	exam	1	ancillary services.
ancillaries	infl
	head	ancillary
	syl	an+cil+lar:ies.
	pos	n.
	mod	pl.
ancillary	3.
	syl	an+cil+lar:y
	pron	<@n1sil*ri>
	pos	n.
	def	a subsidiary or auxiliary thing or person.
	exam	1	the company has an ancillary abroad.
ancipital	ety	C18: from Latin anceps two-headed
ancipitous	alt
	head	ancipital
	or	ancipital
	syl	an+cip:i+tous
	pron	<@n1sipit*s>
	pos	adj.
ancipital	0.
	or	ancipitous
	syl	an+cip:i+tal
	pron	<@n1sipitL>
	pos	adj.
	qual	Biology.
	def	flattened and having two edges.
	exam	1	ancipital stems.
Ancohuma	0.
	syl	An+co+hu+ma
	pron	<2@Gk*u1u:m*>
	pos	n.
	def	one of the two peaks of (Mount) {Sorata}.
ancon	ety	C18: from Greek ank*_on a bend
ancone	alt
	head	ancon
	or	ancon
	syl	an+cone
	pron	<1@Gk*un>
	pos	n.
ancones	infl
	head	ancon
	syl	an+con:es
	pron	<@G1k*unEz>
	pos	n.
	mod	pl.
ancon	1.
	or	ancone
	syl	an+con
	pron	<1@Gkon>
	pos	n.
	qual	Architect.
	def	a projecting bracket or console support?!ing a cornice.
ancon	2.
	or	ancone
	syl	an+con
	pron	<1@Gkon>
	pos	n.
	def	a former technical name for {elbow}.
anconal	sub
	head	ancon
	or	anconeal
	syl	an+co+nal
	pron	<@G1k*unL>
	pos	adj.
anconeal	sub
	head	ancon
	or	anconal
	syl	an+co+ne:al
	pron	<@G1k*uni*l>
	pos	adj.
Ancona	0.
	syl	An+co+na
	pron	Italian <aG1ko:na>
	pos	n.
	def	a port in Central Italy, on the Adriatic, capital of the Marches region: founded by Greeks from Syracuse in about 390 #7b.c. Pop.: 107213 (1975 est.).
-ancy	0.
	syl	-an:cy
	usage	suffix forming nouns.
	def	variant of {-ance}, indicating condition or quality.
	exam	1	expectancy, poignancy.
ancylostomiasis	ety	from New Latin, from Ancylostoma genus of hookworms, from Greek ankulos hooked, crooked+ stoma mouth
ankylostomiasis	infl
	head	ancylostomiasis
	or	anchylostomiasis
	syl	an+ky+los+to+mi:a+sis
	pos	n.
anchylostomiasis	infl
	head	ancylostomiasis
	or	ankylostomiasis
	syl	an+chy+los+to+mi:a+sis
	pos	n.
ancylostomiasis	0.
	syl	an+cy+los+to+mi:a+sis
	pron	<2@nsi2lost*1mI*sis>
	pos	n.
	def	infestation of the human intestine with blood-sucking hookworms, causing progressive anaemia. Also called: {hookworm disease}.
and	ety	Old English and; related to Old Frisian anda, Old Saxon ande, Old High German anti, Sanskrit atha #e Usage. See at to.
and	1.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	usage	coordinating
	def	along with; in addition to.
	exam	1	boys and girls.
and	2.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	usage	coordinating
	def	as a consequence.
	exam	1	he fell down and cut his knee.
and	3.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	usage	coordinating
	def	afterwards.
	exam	1	we pay the man and go through that door.
and	5.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	usage	coordinating
	def	plus.
	exam	1	two and two equals four.
and	6.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	usage	coordinating
	def	used to join identical words or phrases to give emphasis or indicate repetition or continuity.
	exam	1	better and better;
	exam	2	we ran and ran;
	exam	3	it rained and rained.
and	7.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	usage	coordinating
	def	used to join two identical words or phrases to express a contrast between instances of what is named.
	exam	1	there are jobs and jobs.
and	8.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	qual	Informal.
	usage	coordinating
	def	used in place of in infinitives after verbs such as and
and	9.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	conj.
	usage	coordinating
	def	an obsolete word for {if}.
	exam	1	and it please you.
and	10.
	syl	and
	pron	<@nd>, <unstressed> <*nd>, <*n>
	pos	n.
	mod	usually; pl.
	usage	coordinating
	def	an additional matter or problem (esp. in the phrase
And	0.
	syl	And.
	usage	international car registration for
	def	Andorra.
-and	ety	from Latin gerundives ending in -andus, -endus 
-end	alt
	head	-and
	or	-and
	syl	-end
-and	0.
	or	-end
	syl	-and
	usage	suffix forming nouns.
	def	indicating a person or thing that is to be dealt with in a specified way.
	exam	1	analysand;
	exam	2	dividend;
	exam	3	multiplicand.
Andalusia	0.
	syl	An+da+lu+si:a
	pron	<2@nd*1lu:zi*>
	pos	n.
	def	a region of S Spain, on the Mediterranean and the Atlantic, with the Sierra Morena in the north, the Sierra Nevada in the southeast, and the Guadalquivir River flowing over fertile lands between them; a centre of Moorish civilization. Area: about 87280 sq. km (33700 sq. miles). Spanish name: {An+da+lu+c*'i@.a} (@!andalu#!#Ggia).
andalusite	0.
	syl	an+da+lu+site
	pron	<2@nd*1lu:sIt>
	pos	n.
	def	a grey, pink, or brown hard mineral consisting of aluminium silicate in orthorhombic crystalline form. It occurs in metamorphic rocks and is used as a refractory and as a gemstone. Formula: Al\2SiO\5.
Andaman and Nicobar Islands	0.
	syl	An+da+man and Nic:o+bar Is+lands
	pron	<1@nd*m*n> <1nik*u2ba:>
	pos	n.
	mod	pl.
	def	a territory of India, in the E Bay of Bengal, consisting of two groups of over 200 islands. Capital: Port Blair. Pop.: 115133 (1971). Area: 8140 sq. km (3143 sq. miles).
Andaman Islands	0.
	syl	An+da+man Is+lands
	pos	n.
	mod	pl.
	def	a group of islands in the E Bay of Bengal, part of the Indian territory of the Andaman and Nicobar Islands. Area: 6475 sq. km (2500 sq. miles).
Andaman Sea	0.
	syl	An+da+man Sea
	pos	n.
	def	part of the Bay of Bengal, between the Andaman and Nicobar Islands and the Malay Peninsula.
andante	ety	C18: from Italian, from andare to walk, from Latin ambul*_are 
	infl
	head	andante
	syl	~
	pos	adj. adv.
	qual	Music.
andante	1.
	syl	an+dan+te
	pron	<@n1d@nti>
	pos	adj. adv.
	def	at a moderately slow tempo; walking pace.
andante	2.
	syl	an+dan+te
	pron	<@n1d@nti>
	pos	n.
	def	a passage or piece to be performed in this manner.
andantino	ety	C19: diminutive of #7andante 
	infl
	head	andantino
	syl	~
	pos	adj. adv.
	qual	Music.
andantino	1.
	syl	an+dan+ti+no
	pron	<2@nd@n1tEn*u>
	pos	adj. adv.
	def	slightly faster, or slightly slower, than andante.
andantinos	infl
	head	andantino
	syl	an+dan+ti+nos.
	pos	n.
	mod	pl.
andantino	2.
	syl	an+dan+ti+no
	pron	<2@nd@n1tEn*u>
	pos	n.
	def	a passage or piece to be performed in this manner.
AND circuit	ety	C20: so named because the action performed on electrical signals is similar to the operation of the conjunction and in logical constructions
gate	alt
	head	AND circuit
	or	AND circuit
	syl	gate
	pron	<@nd>
	pos	n.
AND circuit	0.
	or	gate
	syl	AND cir+cuit
	pron	<@nd>
	pos	n.
	qual	Computer technol.
	def	a logic circuit having two or more input wires and one output wire that has a high-voltage output signal if and only if all input signals are at a high voltage simultaneously: used extensively as a basic circuit in computers. Compare {OR circuit, NOR circuit}.
Andean	0.
	syl	An+de:an
	pron	<@n1dE*n>, <1@ndi*n>
	pos	adj.
	def	of, relating to, or resembling the Andes.
Anderlecht	0.
	syl	An+der+lecht
	pron	Flemish <1and*rle$xt>
	pos	n.
	def	a town in central Belgium, a suburb of Brussels. Pop.: 103796 (1970).
Hans Christian	infl
	head	Andersen
	syl	Hans Chris:tian.
	pos	n.
Andersen	0.
	syl	An:der:sen
	pron	<1@nd*sN>
	pos	n.
	def	1805-75, Danish author of fairy tales, including and
Andersen Nexo	0.
	syl	An:der:sen Nex:*"o
	pos	n.
	def	See (Martin Andersen) {Nex*"o}.
Anderson	H1.0.
	syl	An+der+son
	pron	<1@nd*sN>
	pos	n.
	def	a river in N Canada, in the Northwest Territories, rising in lakes north of Great Bear Lake and flowing west and north to the Beaufort Sea. Length: about 580 km (360 miles).
Carl David	1.
	head	Anderson
	syl	Carl Da:vid.
	def	born 1905, U.S. physicist, who discovered the positron in cosmic rays (1932): Nobel prize for physics 1936.
Elizabeth Garrett	2.
	head	Anderson
	syl	E:liz:a:beth Gar:rett.
	def	1836-1917, English physician and feminist: a campaigner for the admission of women to the professions.
Marian	3.
	head	Anderson
	syl	Mar:i:an.
	def	born 1902, U.S. contralto, the first Negro permanent member of the Metropolitan Opera Company, New York.
Adolf	infl
	head	Anderssen
	syl	A:dolf
	pron	<1a:dclf>
	pos	n.
Anderssen	0.
	syl	An:ders:sen
	pron	<1@nd*sN>
	pos	n.
	def	1818-79, German chess player: noted for the incisiveness of his combination play.
Andes	0.
	syl	An+des
	pron	<1@ndEz>
	pos	n.
	def	a major mountain system of South America, extending for about 7250 km (4500 miles) along the entire W coast, with several parallel ranges or cordilleras and many volcanic peaks: rich in minerals, including gold, silver, copper, iron ore, and nitrates. Average height: 3900 m (13000 ft.). Highest peak: Aconcagua, 6850 m (22835 ft.).
andesine	ety	C19: from the A#7ndes (where it is found)+-#7ine %1
andesine	0.
	syl	an+de:sine
	pron	<1@ndi2zEn>, <-zin>
	pos	n.
	def	a rare feldspar mineral of the plagioclase series consisting of an aluminium silicate of sodium and calcium. Formula: NaAlSi\3O\8.CaAl\2Si\2O\8.
andesite	ety	C19: from A#7ndes +-#7ite %1
andesite	0.
	syl	an+de:site
	pron	<1@ndi2zIt>
	pos	n.
	def	a fine-grained grey volcanic rock consisting of plagioclase feldspar, esp. andesine, amphibole, and pyroxene.
Andhra Pradesh	0.
	syl	An+dhra Pra+desh
	pron	<1@ndr*> <pra:1deS>
	pos	n.
	def	a state of SE India, on the Bay of Bengal: formed in 1953 from parts of Madras and Hyderabad states. Capital: Hyderabad. Pop.: 43502708 (1971). Area: about 274540 sq. km (106000 sq. miles).
andiron	ety	C14: from Old French andier, of unknown origin; influenced by #7iron 
andiron	0.
	syl	and+i:ron
	pron	<1@nd2I*n>
	pos	n.
	def	either of a pair of decorative metal stands in a hearth for supporting logs.
Andizhan	0.
	syl	An+di+zhan
	pron	Russian <andi1Zan>
	pos	n.
	def	a city in the SW Soviet Union, in the E Uzbek SSR. Pop.: 215000 (1975 est.).
andor	0.
	syl	and/or
	pos	conj.
	usage	coordinating
	def	used to join terms when either one or the other or both is indicated.
	exam	1	passports and/or other means of identification.#e
Andorra	0.
	syl	An+dor+ra
	pron	<@n1dc:r*>
	pos	n.
	def	a mountainous coprincipality in SW Europe, between France and Spain: according to tradition, given independence by Charlemagne in the 9th century for helping to fight the Moors; under the joint sovereignty of the president of France and the Spanish bishop of Urgel since 1278. Languages: Catalan, French, and Spanish. Religion: Roman Catholic. Currency: French franc and Spanish peseta. Capital: Andorra la Vella. Pop.: 20550 (1971). Area: 453 sq. km (175 sq. miles). Official name: {Valleys of Andorra}.
Andorran	sub
	head	Andorra
	syl	An+1dor+ran
	pos	adj. n.
Andorra La Vella	0.
	syl	An+dor+ra La Ve+lla
	pron	Spanish <an1dorra>, Spanish <la> <1bA$ya>
	pos	n.
	def	the capital of Andorra, situated in the west of the principality. Pop.: 2000 (1971). French name: {An+dorre la Vieille} (*~ad@$r la #!vj$ej).
andradite	ety	C19: named after J. B. d' Andrada e Silva (1763-1838), Brazilian mineralogist; see -#7ite %1
andradite	0.
	syl	an+dra+dite
	pron	<1@ndr*2dIt>
	pos	n.
	def	a yellow, green, or brownish-black garnet that consists of calcium iron silicate and is used as a gemstone. Formula: Ca\3Fe\2(SiO\4)\3.
Andr'assy	0.
	syl	An:dr*'as:sy
	pron	<@n1dr@si>, Hungarian <1cndra:Si>
	pos	n.
	def	Count {Gyu@.la} (#!djul@$). 1823-90, Hungarian statesman; the first prime minister of Hungary under the Dual Monarchy of Austria-Hungary (1867).
John	infl
	head	Andr'e
	syl	John.
	pos	n.
Andr'e	0.
	syl	An:dr*'e
	pron	<1a:ndrA>, <1@ndri>
	pos	n.
	def	1751-80, British major who was hanged as a spy for conspiring with Benedict Arnold during the War of American Independence.
Andrea del Sarto	0.
	syl	An:dre:a del Sar:to
	pron	Italian <an1dre:a>, Italian <del> <1sarto>
	pos	n.
	def	See {Sarto}.
Andreanof Islands	0.
	syl	An+dre:a+nof Is+lands
	pron	<2@ndri1a:nof>
	pos	n.
	mod	pl.
	def	a group of islands in the central Aleutian Islands, Alaska. Area: 3710 sq. km (1432 sq. miles).
Giulio	infl
	head	Andreotti
	syl	Giu:lio
	pron	<1Ju:ljo>
	pos	n.
Andreotti	0.
	syl	An:dre:ot:ti
	pron	Italian <andrA1ctti>
	pos	n.
	def	born 1919, Italian statesman; prime minister of Italy (1972-73; since 1976).
Andrew	0.
	syl	An:drew
	pron	<1@ndru:>
	pos	n.
	qual	New Testament.
	def	one of the twelve apostles of Jesus; the brother of Peter; patron saint of Scotland. Feast day: Nov. 30.
Lancelot	infl
	head	Andrewes
	syl	Lanc:e:lot.
	pos	n.
Andrewes	0.
	syl	An:drewes
	pron	<1@ndru:z>
	pos	n.
	def	1555-1626, English bishop and theologian.
Thomas	infl
	head	Andrews
	syl	Thom:as.
	pos	n.
Andrews	0.
	syl	An:drews
	pron	<1@ndru:z>
	pos	n.
	def	1813-85, Irish physical chemist, noted for his work on the liquefaction of gases.
Ivo	infl
	head	Andri'c
	syl	I:vo
	pron	<1i:vc>
	pos	n.
Andri'c	0.
	syl	An:dri*'c
	pron	Serbo-Croat <1andriC>
	pos	n.
	def	1892-1975, Yugoslav novelist; author of (1945): Nobel prize for literature 1961.
andro-	ety	from Greek an*_er (genitive andros) man
andro-	1.
	syl	an:dro-
	usage	before a vowel
	def	male; masculine.
	exam	1	androsterone.
andro-	2.
	syl	an:dro-
	usage	before a vowel; in botany
	def	stamen or anther.
	exam	1	androecium.
Androclus	alt
	head	Androcles
	or	Androcles
	syl	An:dro:clus
	pron	<1@ndr*kl*s>
	pos	n.
Androcles	0.
	or	Androclus
	syl	An:dro:cles
	pron	<1@ndr*2klEz>
	pos	n.
	usage	in Roman legend
	def	a slave whose life was spared in the arena by a lion from whose paw he had once extracted a thorn.
androclinium	ety	C19: New Latin, from #7andro -#7+ -clinium, from Greek klin*_e slope; see #7clino -
androclinia	infl
	head	androclinium
	syl	an+dro+clin:i:a
	pron	<-1klini*>
	pos	n.
	mod	pl.
androclinium	0.
	syl	an+dro+clin+i:um
	pron	<2@ndr*1klini*m>
	pos	n.
	def	another name for {clinandrium}.
androecium	ety	C19: from New Latin, from #7andro -#7+ Greek oikion a little house
androecia	infl
	head	androecium
	syl	an+droe+ci:a
	pron	<-si*>
	pos	n.
	mod	pl.
androecium	0.
	syl	an+droe+ci:um
	pron	<@n1drEsi*m>
	pos	n.
	def	the stamens of a flowering plant collectively.
androecial	sub
	head	androecium
	syl	an+1droe+ci:al
	pos	adj.
androgen	0.
	syl	an+dro+gen
	pron	<1@ndr*J*n>
	pos	n.
	def	any of several steroids, produced as hormones by the testes or made synthetically, that promote development of male sexual organs and male secondary sexual characteristics.
androgenic	sub
	head	androgen
	syl	an+dro+gen+ic
	pron	<2@ndr*1Jenik>
	pos	adj.
androgenous	0.
	syl	an+drog+e:nous
	pron	<@n1droJin*s>
	pos	adj.
	qual	Biology.
	def	producing only male offspring.
androgyne	ety	C17: from Old French, via Latin from Greek androgunos, from an*_er man+ gun*_e woman
androgyne	0.
	syl	an+dro+gyne
	pron	<1@ndr*2JIn>
	pos	n.
	def	another word for {hermaphrodite}.
androgynous	1.
	syl	an+drog:y+nous
	pron	<@n1droJin*s>
	pos	adj.
	qual	Botany.
	def	having male and female flowers in the same inflorescence, as plantain.
androgynous	2.
	syl	an+drog:y+nous
	pron	<@n1droJin*s>
	pos	adj.
	def	having male and female characteristics; hermaphrodite.
android	ety	C18: from Late Greek androeid*_es manlike; see #7andro -#7, -#7oid 
android	1.
	syl	an+droid
	pron	<1@ndrcid>
	pos	n.
	usage	in science fiction
	def	a robot resembling a human being.
android	2.
	syl	an+droid
	pron	<1@ndrcid>
	pos	adj.
	def	resembling a human being.
Andromache	0.
	syl	An:dro:ma:che
	pron	<@n1drom*ki>
	pos	n.
	qual	Greek myth.
	def	the wife of Hector.
Andromeda	H1.0.
	syl	An:drom:e:da
	pron	<@n1dromid*>
	pos	n.
	qual	Greek myth.
	def	the daughter of Cassiopeia and wife of Perseus, who saved her from a sea monster.
Andromedae	infl
	head	Andromeda
	syl	An+drom+e:dae
	pron	<@n1dromi2dE>
	pos	n.
	qual	Latin genitive
Andromeda	H2.0.
	syl	An+drom+e:da
	pron	<@n1dromid*>
	pos	n.
	def	a constellation in the N hemisphere lying between Cassiopeia and Pegasus, the three brightest stars being of the second magnitude. It contains the {Andromeda Galaxy}, a spiral galaxy 2.2 million light years away.
Andros	1.
	syl	An+dros
	pron	<1@ndr*s>
	pos	n.
	def	an island in the Aegean Sea, the northernmost of the Cyclades: long famous for wine. Capital: Andros. Pop.: 10457 (1971). Area: about 311 sq. km (120 sq. miles).
Andros	2.
	syl	An+dros
	pron	<1@ndr*s>
	pos	n.
	def	an island in the N West Indies, the largest of the Bahamas. Pop.: 8845 (1970). Area: 4144 sq. km (1600 sq. miles).
androsphinxes	infl
	head	androsphinx
	or	androsphinges
	syl	an+dro+sphinx:es
	pron	<-2sfinJEz>
	pos	n.
	mod	pl.
androsphinges	infl
	head	androsphinx
	or	androsphinxes
	syl	an+dro+sphin:ges
	pron	<-2sfinJEz>
	pos	n.
	mod	pl.
androsphinx	0.
	syl	an+dro+sphinx
	pron	<1@ndr*2sfiGks>
	pos	n.
	def	a sphinx having the head of a man.
androsterone	0.
	syl	an+dros+ter+one
	pron	<@n1drost*2r*un>
	pos	n.
	def	an androgenic steroid hormone produced in the testes. Formula: C\1\9H\3\0O\2.
-androus	ety	from New Latin -andrus, from Greek -andros, from an*_er man
-androus	0.
	syl	-an:drous
	pos	adj.
	usage	combining form.
	def	(in botany) indicating number or type of stamens.
	exam	1	diandrous.
-andry	ety	from Greek -andria, from an*_er man
-andry	0.
	syl	-an:dry
	pos	n.
	usage	combining form.
	def	indicating number of husbands.
	exam	1	polyandry.
Andvari	0.
	syl	And:va:ri
	pron	<@n1dwa:ri>
	pos	n.
	qual	Norse myth.
	def	a dwarf who possessed a treasure hoard, which was robbed by Loki.
ane	0.
	syl	ane
	pron	<An>
	usage	determiner, pron., n.
	def	a Scot. word for {one}.
-ane	ety	coined to replace -ene, -ine, and -one 
-ane	0.
	syl	-ane
	usage	suffix forming nouns.
	def	indicating an alkane hydrocarbon.
	exam	1	hexane.
	infl
	head	anear
	syl	~
	pos	prep.
	qual	Archaic.
anear	1.
	syl	a:near
	pron	<*1ni*>
	pos	prep.
	def	near.
anear	2.
	syl	a:near
	pron	<*1ni*>
	pos	adv.
	def	nearly.
anecdotage	1.
	syl	an+ec+dot+age
	pron	<1@nik2d*utiJ>
	pos	n.
	def	anecdotes collectively.
anecdotage	2.
	syl	an+ec+dot+age
	pron	<1@nik2d*utiJ>
	pos	n.
	qual	Humorous.
	def	talkative or garrulous old age.
anecdote	ety	C17: from Medieval Latin anecdota unpublished items, from Greek anekdotos unpublished, from #7an -#7+ ekdotos published, from ekdidonai, from ek- out+ didonai to give
anecdote	0.
	syl	an+ec+dote
	pron	<1@nik2d*ut>
	pos	n.
	def	a short usually amusing account of an incident, esp. a personal or biographical one.
anecdotal	sub
	head	anecdote
	or	anecdotic
	syl	an+ec+1do+tal
	pos	adj.
anecdotic	sub
	head	anecdote
	or	anecdotal
	syl	an+ec+1dot+ic
	pos	adj.
anechoic	0.
	syl	an+e:cho+ic
	pron	<2@ni1k*uik>
	pos	adj.
	def	having a low degree of reverbera?!tion.
	exam	1	an anechoic recording studio.
anelace	0.
	syl	an+e:lace
	pron	<1@n*2lAs>
	pos	n.
	def	a variant spelling of {anlace}.
anele	ety	C14 anelen, from an- (from Old English an- #7on) #7+ elen to anoint (from ele oil, from Latin oleum) 
anele	0.
	syl	a:nele
	pron	<*1nEl>
	pos	vb.
	mod	tr.
	qual	Archaic.
	def	to anoint, esp. to give extreme unction to.
anemia	ety	C19: from New Latin, from Greek anaimia lack of blood
anemia	0.
	syl	a:ne:mi:a
	pron	<*1nEmi*>
	pos	n.
	def	the usual U.S. spelling of {anaemia}.
anemic	0.
	syl	a:ne:mic
	pron	<*1nEmik>
	pos	adj.
	def	the usual U.S. spelling of {anaemic}.
anemo-	ety	from Greek anemos wind
anemo-	0.
	syl	a:ne:mo-
	usage	combining form.
	def	indicating wind.
	exam	1	anemometer;
	exam	2	anemophilous.
anemochore	0.
	syl	a:nem:o+chore
	pron	<*1nEm*u2kc:>
	pos	n.
	def	a plant in which the fruits or seeds are dispersed by wind.
anemograph	0.
	syl	a:nem:o+graph
	pron	<*1nem*u2gra:f>
	pos	n.
	def	a self-recording anemometer.
anemographic	sub
	head	anemograph
	syl	a:nem:o+graph+ic
	pron	<*2nem*u1gr@fik>
	pos	adj.
anemographically	sub
	head	anemograph
	syl	a:2nem:o+1graph:i+cal+ly
	pos	adv.
anemography	0.
	syl	an+e:mog+ra+phy
	pron	<2@ni1mogr*fi>
	pos	n.
	qual	Meteorol.
	def	the technique of recording wind measurements.
anemology	0.
	syl	an+e:mol+o:gy
	pron	<2@ni1mol*Ji>
	pos	n.
	def	the study of winds.
anemometer	1.
	syl	an+e:mom+e:ter
	pron	<2@ni1momit*>
	pos	n.
	def	Also called: {wind gauge}. an instrument for recording the speed and often the direction of winds.
anemometer	2.
	syl	an+e:mom+e:ter
	pron	<2@ni1momit*>
	pos	n.
	def	any instrument that measures the rate of movement of a fluid.
anemometric	sub
	head	anemometer
	syl	an+e:mo+met+ric
	pron	<2@nimo1metrik>
	pos	adj.
anemometrical	sub
	head	anemometer
	syl	an+e:mo+1met+ri+cal
	pos	adj.
anemometry	0.
	syl	an+e:mom+e:try
	pron	<2@ni1momitri>
	pos	n.
	qual	Meteorol.
	def	the technique of measuring wind speed and direction.
anemone	ety	C16: via Latin from Greek: wind-flower, from anemos wind
anemone	0.
	syl	a:nem:o+ne
	pron	<*1nem*ni>
	pos	n.
	def	any ranunculaceous woodland plant of the genus of N temperate regions, such as the white-flowered ({wood anemone} or {windflower}) . Some cultivated anemones have lilac or pale blue flowers. See also {pasque flower}. Compare {sea anemone} (an animal).
anemone fish	0.
	syl	a:nem:o+ne fish
	pos	n.
	def	any of various damselfishes of the genus such as (clown anemone fish), that usually live closely associated with sea anemones.
anemophilous	0.
	syl	an+e:moph:i+lous
	pron	<2@ni1mofil*s>
	pos	adj.
	usage	of flowering plants such as grasses
	def	pollinated by the wind. Compare {entomophilous}.
anemophily	sub
	head	anemophilous
	syl	an+e:1moph:i+ly
	pos	n.
anemoscope	0.
	syl	a:nem:o+scope
	pron	<*1nem*2sk*up>
	pos	n.
	qual	Meteorol.
	def	any device that shows the presence and direction of a wind.
anent	ety	Old English on efen, literally: on even (ground)
anent	0.
	syl	a:nent
	pron	<*1nent>
	pos	prep.
	qual	Archaic or Scot.
	def	concerning; about.
anergy	ety	from New Latin anergia, from #7an -#7+ Greek ergon work
anergy	1.
	syl	an+er+gy
	pron	<1@n*Ji>
	pos	n.
	def	lack of energy.
anergy	2.
	syl	an+er+gy
	pron	<1@n*Ji>
	pos	n.
	qual	Immunol.
	def	diminution or lack of immunity to an antigen.
anergic	sub
	head	anergy
	syl	a:ner+gic
	pron	<@1nR:Jik>
	pos	adj.
aneroid barometer	ety	C19 aneroid, from French, from #7an -#7+ Greek n*_eros wet+-#7oid 
aneroid barometer	0.
	syl	an+er+oid ba+rom+e:ter
	pron	<1@n*2rcid>
	pos	n.
	def	a device for measuring atmospheric pressure without the use of fluids. It consists of a partially evacuated metal chamber, the thin corrugated lid of which is displaced by variations in the external air pressure. This displacement is magnified by levers and made to operate a pointer.
anesthesia	0.
	syl	an+es+the:si:a
	pron	<2@nis1TEzi*>
	pos	n.
	def	the usual U.S. spelling of {anaesthesia}.
anaesthesiologist	alt
	head	anesthesiologist
	or	anesthesiologist
	syl	an+aes+the:si+ol:o+gist
	pron	<2@nis?!2TEzi1ol*Jist>
	pos	n.
anesthesiologist	0.
	or	anaesthesiologist
	syl	an+es+the:si+ol:o+gist
	pron	<2@nis?!2TEzi1ol*Jist>
	pos	n.
	def	the U.S. name for an {anaesthetist}; in the U.S., a qualified doctor specializing in the administration of anaesthesia. Compare {anesthetist}.
anesthetic	0.
	syl	an+es+thet+ic
	pron	<2@nis1Tetik>
	pos	n. adj.
	def	the usual U.S. spelling of {anaesthetic}.
anesthetist	0.
	syl	an+es+the+tist
	pron	<*1nEsT*tist>
	pos	n.
	usage	in the U.S.
	def	a person qualified to administer anaesthesia, often a nurse or someone other than a physician. Compare {anesthesiologist}.
anestrus	0.
	syl	an+es+trus
	pron	<@n1Estr*s>
	pos	n.
	def	a variant spelling (esp. U.S.) of {anoestrus}.
anestrous	sub
	head	anestrus
	syl	an+1es+trous
	pos	adj.
anethole	ety	C19: from Latin an*_ethum dill, anise, from Greek an*_ethon 
anethole	0.
	syl	an+e:thole
	pron	<1@ni2T*ul>
	pos	n.
	def	a white water-soluble crystalline substance with a liquorice-like odour, used as a flavouring and a sensitizer in the processing of colour photographs. Formula: CH\3CH:CHC\6H\4OCH\3.
Pico de	infl
	head	Aneto
	syl	Pi:co de
	pron	<1piko> <DA>
	pos	n.
Aneto	0.
	syl	A:ne:to
	pron	Spanish <a1nAto>
	pos	n.
	def	a mountain in N Spain, near the French border: the highest in the Pyrenees. Height: 3404 m (11168 ft.).
aneuploid	1.
	syl	an:eu+ploid
	pron	<1@nju2plcid>
	pos	adj.
	usage	of polyploid cells or organisms
	def	having a chromosome number that is not an exact multiple of the haploid number, caused by one chromosome set being incomplete.
aneuploid	2.
	syl	an:eu+ploid
	pron	<1@nju2plcid>
	pos	n.
	def	a cell or individual of this type.
aneuploid	xref
	syl	an:eu+ploid
	pron	<1@nju2plcid>
	pos	adj.
	def	Compare {euploid}.
aneurin	ety	C20: from #7a (#7nti -)+(#7poly) #7neur (#7itis) + (#7vitam) #7in 
aneurin	0.
	syl	an:eu+rin
	pron	<*1nju*rin>
	pos	n.
	def	a less common name for {thiamine}.
aneurysm	ety	C15: from Greek aneurusma, from aneurunein to dilate, from eurunein to widen
aneurism	alt
	head	aneurysm
	or	aneurysm
	syl	an:eu+rism
	pron	<1@nj*2riz*m>
	pos	n.
aneurysm	0.
	or	aneurism
	syl	an:eu+rysm
	pron	<1@nj*2riz*m>
	pos	n.
	def	a sac formed by abnormal dilation of the weakened wall of a blood vessel.
aneurysmal	sub
	head	aneurysm
	syl	an:eu+1rys+mal
	pos	adj.
aneurismal	sub
	head	aneurysm
	syl	an:eu+1ris+mal
	pos	adj.
aneurysmatic	sub
	head	aneurysm
	or	aneurismatic
	syl	an:eu+rys+1mat+ic
	pos	adj.
aneurismatic	sub
	head	aneurysm
	or	aneurysmatic
	syl	an:eu+ris+1mat+ic
	pos	adj.
aneurysmally	sub
	head	aneurysm
	syl	an:eu+1rys+mal+ly
	pos	adv.
aneurismally	sub
	head	aneurysm
	syl	an:eu+1ris+mal+ly
	pos	adv.
aneurysmatically	sub
	head	aneurysm
	or	aneurismatically
	syl	an:eu+rys+1mat:i+cal+ly
	pos	adv.
aneurismatically	sub
	head	aneurysm
	or	aneurysmatically
	syl	an:eu+ris+1mat:i+cal+ly
	pos	adv.
anew	ety	Old English of n*_iwe; see #7of, new 
anew	1.
	syl	a:new
	pron	<*1nju:>
	pos	adv.
	def	over again; once more.
anew	2.
	syl	a:new
	pron	<*1nju:>
	pos	adv.
	def	in a different way; afresh.
anfractuosity	1.
	syl	an+frac+tu+os+i:ty
	pron	<2@nfr@kCu1ositi>
	pos	n.
	def	the condition or quality of being anfractuous.
anfractuosity	2.
	syl	an+frac+tu+os+i:ty
	pron	<2@nfr@kCu1ositi>
	pos	n.
	def	a winding, circuitous, or intricate passage, surface, process, etc.
anfractuous	ety	C17: from Late Latin anfractu*_osus, from Latin anfractus a digression, literally: a bending
anfractuous	0.
	syl	an+frac+tu+ous
	pron	<@n1fr@kCu*s>
	pos	adj.
	def	characterized by twists and turns; convoluted.
Angara	0.
	syl	An+ga+ra
	pron	Russian <anga1ra>
	pos	n.
	def	a river in the S Soviet Union, in Siberia, flowing from Lake Baikal north and west to the Yenisei River: important for hydroelectric power. Length: about 2100 km (1300 miles).
Angarsk	0.
	syl	An+garsk
	pron	Russian <an1garsk>
	pos	n.
	def	an industrial city in the SE Soviet Union, in the southern RSFSR northwest of Irkutsk. Pop.: 228000 (1975 est.).
angary	ety	C19: from French angarie, from Late Latin angaria enforced service, from Greek angareia office of a courier, from angaros courier, of Persian origin
angary	0.
	syl	an+ga+ry
	pron	<1@Gg*ri>
	pos	n.
	qual	International law.
	def	the right of a belligerent state to use the property of a neutral state or to destroy it if necessary, subject to payment of full compensation to the owners.
angel	ety	Old English, from Late Latin angelus, from Greek angelos messenger
angel	1.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	qual	Theol.
	def	one of a class of spiritual beings attendant upon God. In medieval angelology they are divided by rank into nine orders: seraphim, cherubim, thrones, dominations (or dominions), virtues, powers, principalities (or prince?!doms), archangels, and angels.
angel	2.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	def	a divine messenger from God.
angel	3.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	def	a guardian spirit.
angel	4.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	def	a conventional representation of any of these beings, depicted in human form with wings.
angel	5.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	qual	Informal.
	def	a person, esp. a woman, who is kind, pure, or beautiful.
angel	6.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	qual	Informal.
	def	an investor in a venture, esp. a backer of a theatrical production.
angel	7.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	def	Also called: {angel-noble}. a former English gold coin with a representation of the archangel Michael on it, first minted in Edward IV's reign.
angel	8.
	syl	an+gel
	pron	<1AnJ*l>
	pos	n.
	qual	Informal.
	def	an unexplained signal on a radar screen.
Angelenos	infl
	head	Angeleno
	syl	An+ge+le:nos.
	pos	n.
	mod	pl.
Angeleno	0.
	syl	An+ge+le:no
	pron	<2@nJ*1lEn*u>
	pos	n.
	def	a native or inhabitant of Los Angeles.
Angel Falls	0.
	syl	An+gel Falls
	pos	n.
	def	a waterfall in SE Venezuela, on the Caroni River. Height (probably the highest in the world): 979 m (3211 ft.).
angelfish	infl
	or	angelfishes
	syl	an:gel+fish
	pos	n.
	mod	pl.
angelfishes	infl
	head	angelfish
	or	angelfish
	syl	an:gel+fish:es.
	pos	n.
	mod	pl.
angelfish	1.
	syl	an:gel+fish
	pron	<1AnJ*l2fiS>
	pos	n.
	def	any of various small tropical marine percoid fishes of the genus and related genera, which have a deep flattened brightly coloured body and brushlike teeth: family See also {butterfly fish}.
angelfish	2.
	syl	an:gel+fish
	pron	<1AnJ*l2fiS>
	pos	n.
	def	Also called: {scalare}. a South American cichlid, of the Amazon region, having a compressed body and large dorsal and anal fins: a popular aquarium fish.
angelfish	3.
	syl	an:gel+fish
	pron	<1AnJ*l2fiS>
	pos	n.
	def	another name for {angel shark}.
angelic	1.
	syl	an+gel+ic
	pron	<@n1Jelik>
	pos	adj.
	def	of or relating to angels.
angelic	2.
	syl	an+gel+ic
	pron	<@n1Jelik>
	pos	adj.
	qual	Informal.
	def	resembling an angel in beauty, purity, power, etc.
angelical	sub
	head	angelic
	syl	an+1gel:i+cal
	pos	adj.
angelically	sub
	head	angelic
	syl	an+1gel:i+cal+ly
	pos	adv.
angelica	ety	C16: from Medieval Latin (herba) angelica angelic herb
angelica	1.
	syl	an+gel+ic:a
	pron	<@n1Jelik*>
	pos	n.
	def	Also called: {archangel}. any tall umbelliferous plant of the genus having compound leaves and clusters of small white or greenish flowers, esp. the aromatic seeds, leaves, and stems of which are used in medicine and cookery.
angelica	2.
	syl	an+gel+ic:a
	pron	<@n1Jelik*>
	pos	n.
	def	the candied stems of this plant, used for decorating and flavouring sweet dishes.
Angelic Doctor	0.
	syl	An+gel+ic Doc+tor
	pos	n.
	def	an epithet of Saint Thomas Aquinas.
Fra	infl
	head	Angelico
	syl	Fra
	pos	n.
Angell	0.
	syl	An:gell
	pron	<1AnJ*l>
	pos	n.
	def	Sir {Nor@.man}. original name 1874-1967, English writer, pacifist, and economist, noted for his work on the economic futility of war, (1910): Nobel peace prize 1933.
angelology	0.
	syl	an+gel+ol+o:gy
	pron	<2AnJ*1lol*Ji>
	pos	n.
	def	a doctrine or theory treating of angels.
fish	alt
	head	angel shark
	or	angel shark
	syl	fish
	pos	n.
angel shark	0.
	or	fish
	syl	an+gel shark
	pos	n.
	def	any of several sharks constituting the family such as that have very large flattened pectoral fins and occur in the Atlantic and Pacific Oceans. Also called: {monkfish}.
angels-on-horseback	0.
	syl	an:gels-on-horse:back
	pos	n.
	qual	Brit.
	def	a savoury of oysters wrapped in bacon slices and served on toast.
angel's tears	0.
	syl	an+gel's tears
	pos	n.
	mod	functioning as; sing.
	def	another name for {{moonflower} (sense 2)}.
Angelus	ety	C17: Latin, from the phrase Angelus domini nuntiavit Mariae the angel of the Lord brought tidings to Mary
Angelus	1.
	syl	An+ge+lus
	pron	<1@nJil*s>
	pos	n.
	qual	R.C. Church.
	def	a series of prayers recited in the morning, at midday, and in the evening, commemorating the Annunciation and Incarnation.
Angelus	2.
	syl	An+ge+lus
	pron	<1@nJil*s>
	pos	n.
	qual	R.C. Church.
	def	the bell ({Angelus bell}) signalling the times of these prayers.
anger	ety	C12: from Old Norse angr grief; related to Old English enge, Old High German engi narrow, Latin angere to strangle
anger	1.
	syl	an+ger
	pron	<1@Gg*>
	pos	n.
	def	a feeling of great annoyance or antagonism as the result of some real or supposed grievance; rage; wrath.
anger	2.
	syl	an+ger
	pron	<1@Gg*>
	pos	vb.
	mod	tr.
	def	to make angry; enrage.
Angers	0.
	syl	An+gers
	pron	French <*~a1ZA>
	pos	n.
	def	a city in W France, on the River Maine. Pop.: 142966 (1975).
Angevin	1.
	syl	An+ge+vin
	pron	<1@nJivin>
	pos	n.
	def	a native or inhabitant of Anjou.
Angevin	2.
	syl	An+ge+vin
	pron	<1@nJivin>
	pos	n.
	qual	History.
	def	a member of the Plantagenet royal line descended from Geoffrey, Count of Anjou, esp. one of the kings of England from Henry II to Richard II (1154-1216).
Angevin	3.
	syl	An+ge+vin
	pron	<1@nJivin>
	pos	adj.
	def	of or relating to Anjou or its inhabitants.
Angevin	4.
	syl	An+ge+vin
	pron	<1@nJivin>
	pos	adj.
	def	of or relating to the Plantagenet kings of England between 1154 and 1216.
angina	ety	C16: from Latin: quinsy, from Greek ankhon*_e a strangling
angina	1.
	syl	an+gi+na
	pron	<@n1JIn*>
	pos	n.
	def	any disease marked by painful attacks of spasmodic choking, such as Vincent's angina and quinsy.
angina	2.
	syl	an+gi+na
	pron	<@n1JIn*>
	pos	n.
	def	short for {angina pectoris}.
anginal	sub
	head	angina
	syl	an+1gi+nal
	pos	adj.
anginose	sub
	head	angina
	or	anginous
	syl	an+gi+nose
	pron	<@n1JIn*us>, <-n*uz>
	pos	adj.
anginous	sub
	head	angina
	or	anginose
	syl	an+1gi+nous
	pos	adj.
angina pectoris	ety	C18: New Latin: angina of the chest
angina pectoris	0.
	syl	an+gi+na pec+to+ris
	pron	<1pAkt*ris>
	pos	n.
	def	a sudden intense pain in the chest, often accompanied by feelings of suffocation, caused by momentary lack of adequate blood supply to the heart muscle. Sometimes shortened to {angina}.
angio-	ety	from Greek angeion vessel
angiology	0.
	syl	an+gi+ol+o:gy
	pron	<2@nJi1ol*Ji>
	pos	n.
	def	the branch of medical science concerned with the blood vessels and the lymphatic system.
angiomas	infl
	head	angioma
	or	angiomata
	syl	an+gi:o+mas
	pron	<-m*t*>
	pos	n.
	mod	pl.
angiomata	infl
	head	angioma
	or	angiomas
	syl	an+gi:o+ma+ta
	pron	<-m*t*>
	pos	n.
	mod	pl.
angioma	0.
	syl	an+gi:o+ma
	pron	<2@nJi1*um*>
	pos	n.
	def	a tumour consisting of a mass of blood vessels ({haemangioma}) or a mass of lymphatic vessels ({lymphangioma}) .
angiomatous	sub
	head	angioma
	syl	an+gi+1om:a+tous
	pos	adj.
angiosperm	0.
	syl	an+gi:o+sperm
	pron	<1@nJi*2spR:m>
	pos	n.
	def	any seed-bearing plant of the division in which the ovules are enclosed in an ovary, which develops into the fruit after fertilization; any flowering plant. Compare {gymnosperm}.
angiospermous	sub
	head	angiosperm
	syl	an+gi:o+1sper+mous
	pos	adj.
Angkor	0.
	syl	Ang+kor
	pron	<1@Gkc:>
	pos	n.
	def	a large area of ruins in NW Cambodia, containing {Angkor Thom} (t@$$:m), the capital of the former Khmer Empire, and {Angkor Wat} (w$At), a three-storey temple, which were overgrown with dense jungle from the 14th to 19th centuries.
Angl	0.
	syl	Angl.
	qual	abbrev. for
	def	Anglican.
angle	ety	C14: from French, from Old Latin angulus corner
angle	H1.1.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	def	the space between two straight lines that diverge from a common point or between two planes that extend from a common line.
angle	H1.2.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	def	the shape formed by two such lines or planes.
angle	H1.3.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	def	the extent to which one such line or plane diverges from another, measured in degrees or radians.
angle	H1.4.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	def	an angular projection or recess; corner.
angle	H1.5.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	def	standpoint; point of view.
	exam	1	look at the question from another angle;
	exam	2	the angle of a newspaper article.
angle	H1.6.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	qual	Informal.
	def	a selfish or devious motive or purpose.
angle	H1.7.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	def	See {angle iron}.
angle	H1.8.
	syl	an+gle
	pron	<1@GgL>
	pos	vb.
	def	to move in or bend into angles or an angle.
angle	H1.9.
	syl	an+gle
	pron	<1@GgL>
	pos	vb.
	mod	tr.
	def	to produce (an article, statement, etc.) with a particular point of view.
angle	H1.10.
	syl	an+gle
	pron	<1@GgL>
	pos	vb.
	mod	tr.
	def	to present, direct, or place at an angle.
angle	H1.11.
	syl	an+gle
	pron	<1@GgL>
	pos	vb.
	mod	intr.
	def	to turn or bend in a different direction.
	exam	1	the path angled sharply to the left.
angle	ety	Old English angul fishhook; related to Old High German ango, Latin uncus, Greek onkos 
angle	H2.1.
	syl	an+gle
	pron	<1@GgL>
	pos	vb.
	mod	intr.
	def	to fish with a hook and line.
angle	H2.2.
	syl	an+gle
	pron	<1@GgL>
	pos	vb.
	mod	intr.
	usage	often foll. by for
	def	to attempt to get.
	exam	1	he angled for a compliment.
angle	H2.3.
	syl	an+gle
	pron	<1@GgL>
	pos	n.
	mod	intr.
	qual	Obsolete.
	def	any piece of fishing tackle, esp. a hook.
Angle	ety	from Latin Anglus, from Germanic (compare E#7nglish) , an inhabitant of Angul, a district in Schleswig (now Angeln) , a name identical with Old English angul hook, #7angle %2, referring to its shape
Angle	0.
	syl	An+gle
	pron	<1@GgL>
	pos	n.
	def	a member of a West Germanic people from N Germany who invaded and settled large parts of E and N England in the 5th and 6th centuries #7a.d.
angle bracket	0.
	syl	an+gle brack+et
	pos	n.
	def	either of a pair of brackets having the shapes ?<#800034 and ?>#800035 .
angle iron	1.
	syl	an+gle i:ron
	pos	n.
	def	Also called: {angle, angle bar}. an iron or a steel structural bar that has an L-shaped cross section.
angle iron	2.
	syl	an+gle i:ron
	pos	n.
	def	any piece of iron or steel forming an angle, esp. a right angle.
angle of attack	0.
	syl	an+gle of at+tack
	pos	n.
	def	the acute angle between the chord line of an aerofoil and the undisturbed relative airflow. Also called: {angle of incidence}.
angle of bank	0.
	syl	an+gle of bank
	pos	n.
	def	the angle between the lateral axis of an aircraft in flight and the horizontal.
angle of deviation	0.
	syl	an+gle of de+vi:a+tion
	pos	n.
	def	the angle between the direction of the refracted ray and the direction of the incident ray when a ray of light passes from one medium to another.
angle of dip	0.
	syl	an+gle of dip
	pos	n.
	def	the full name {for {dip} (sense 29)}.
angle of incidence	1.
	syl	an+gle of in+ci+dence
	pos	n.
	def	the angle that a line or beam of radiation makes with a line perpendicular to the surface at the point of incidence.
angle of incidence	2.
	syl	an+gle of in+ci+dence
	pos	n.
	def	another name for {angle of attack}.
angle of incidence	3.
	syl	an+gle of in+ci+dence
	pos	n.
	def	Also called: {rigging angle of incidence}. the angle between the chord line of an aircraft wing or tailplane and the aircraft's longitudinal axis.
angle of reflection	0.
	syl	an+gle of re+flec+tion
	pos	n.
	def	the angle that a beam of reflected radiation makes with the normal to a surface at the point of reflection.
angle of refraction	0.
	syl	an+gle of re+frac+tion
	pos	n.
	def	the angle that a refracted beam of radiation makes with the normal to the surface between two media at the point of refraction.
angle of repose	0.
	syl	an+gle of re+pose
	pos	n.
	def	the maximum angle to the horizontal at which rocks, soil, etc., will remain without sliding.
angle plate	0.
	syl	an+gle plate
	pos	n.
	def	a steel structural plate, esp. one in the shape of a right-angled triangle, used to connect structural members and stiffen frameworks.
angler	1.
	syl	an+gler
	pron	<1@Ggl*>
	pos	n.
	def	a person who fishes with a rod and line.
angler	2.
	syl	an+gler
	pron	<1@Ggl*>
	pos	n.
	qual	Informal.
	def	a person who schemes or uses devious methods to secure an advantage.
angler	3.
	syl	an+gler
	pron	<1@Ggl*>
	pos	n.
	def	Also called: {angler fish}. any spiny-finned fish of the order (or . They live at the bottom of the sea and typically have a long spiny movable dorsal fin with which they lure their prey.
Anglesey	0.
	syl	An+gle+sey
	pron	<1@GgLsi>
	pos	n.
	def	an island and, until 1974, a county of N Wales, now part of Gwynedd, separated from the mainland by the Menai Strait. Pop.: 59705 (1971). Area: 714 sq. km (276 sq. miles).
anglesite	ety	C19: from A#7nglesey, where it was first found
anglesite	0.
	syl	an+gle+site
	pron	<1@GgL2sIt>
	pos	n.
	def	a white or grey secondary mineral consisting of lead sulphate in orthorhombic crystalline form. It occurs in lead-ore deposits and is a source of lead. Formula: PbSO\4.
angleworm	0.
	syl	an:gle+worm
	pron	<1@GgL2wR:m>
	pos	n.
	def	an earthworm used as bait by anglers.
Anglia	0.
	syl	An+gli:a
	pron	<1@Ggli*>
	pos	n.
	def	a Latin name for {England}.
Anglian	1.
	syl	An+gli:an
	pron	<1@Ggli*n>
	pos	adj.
	def	of or relating to the Angles or to the Anglian dialects of Old English.
Anglian	2.
	syl	An+gli:an
	pron	<1@Ggli*n>
	pos	n.
	def	the group of Old and Middle English dialects spoken in the Midlands and the north of England, divided into Mercian and Northumbrian. See also {Kentish, West Saxon}.
Anglian	xref
	syl	An+gli:an
	pron	<1@Ggli*n>
	pos	adj.
	def	See also {East Anglia}.
Anglican	ety	C17: from Medieval Latin Anglic*_anus, from Anglicus English, from Latin Angl*_i the Angles
Anglican	1.
	syl	An+gli+can
	pron	<1@Gglik*n>
	pos	adj.
	def	denoting or relating to the Anglican communion.
Anglican	2.
	syl	An+gli+can
	pron	<1@Gglik*n>
	pos	n.
	def	a member of the Church of England or one of the Churches in full communion with it.
Anglican Church	0.
	syl	An+gli+can Church
	pos	n.
	def	any Church of the Anglican Communion or the Anglican Communion itself.
Anglican Communion	0.
	syl	An+gli+can Com+mun+ion
	pos	n.
	def	a group of Christian Churches including the Church of England, the Church of Ireland, the Episcopal Church in Scotland, the Church in Wales, the Episcopal Church in the U.S., and certain other Churches, all of which are in full communion with each other.
Anglicanism	0.
	syl	An+gli+can+ism
	pron	<1@Gglik*2niz*m>
	pos	n.
	def	the doctrine and practice of the Church of England and other Anglican Churches.
Anglice	ety	from Medieval Latin
Anglice	0.
	syl	An+gli+ce
	pron	<1@Gglisi>
	pos	adv.
	def	in English.
	exam	1	Roma, Anglice Rome.
Anglicism	1.
	syl	An+gli+cism
	pron	<1@Ggli2siz*m>
	pos	n.
	def	a word, phrase, or idiom peculiar to the English language, esp. as spoken in England.
Anglicism	2.
	syl	An+gli+cism
	pron	<1@Ggli2siz*m>
	pos	n.
	def	an English attitude, mannerism, custom, etc.
Anglicism	3.
	syl	An+gli+cism
	pron	<1@Ggli2siz*m>
	pos	n.
	def	the fact or quality of being English.
Anglist	alt
	head	Anglicist
	or	Anglicist
	syl	An+glist
	pos	n.
Anglicist	0.
	or	Anglist
	syl	An+gli+cist
	pron	<1@Gglisist>
	pos	n.
	qual	Rare.
	def	an expert in or student of English literature or language.
anglicise	infl
	head	anglicize
	or	anglify
	syl	an+gli+cise
	pron	<1@Ggli2sIz>
anglify	infl
	head	anglicize
	or	anglicise
	syl	an+gli+fy
	pron	<1@Ggli2fI>
anglicizes	infl
	head	anglicize
	syl	an+gli+ciz:es
	pos	vb.
anglicizing	infl
	head	anglicize
	syl	an+gli+ciz+ing
	pos	vb.
anglicized	infl
	head	anglicize
	syl	an+gli+cized
	pos	vb.
anglicises	infl
	head	anglicize
	or	fies
	syl	an+gli+cis:es
	pos	vb.
anglicising	infl
	head	anglicize
	or	fying
	syl	an+gli+cis+ing
	pos	vb.
anglicised	infl
	head	anglicize
	or	fied
	syl	an+gli+cised
	pos	vb.
fies	infl
	head	anglicize
	or	anglicises
	syl	+fies
	pos	vb.
fying	infl
	head	anglicize
	or	anglicising
	syl	+fy+ing
	pos	vb.
fied	infl
	head	anglicize
	or	anglicised
	syl	+fied.
	pos	vb.
anglicize	xref
	syl	an+gli+cize
	pron	<1@Ggli2sIz>
	pos	vb.
	usage	sometimes cap.
	def	to make or become English in outlook, attitude, form, etc.
anglicization	sub
	head	anglicize
	or	anglicisation
	syl	an+gli+ci+1za+tion
	pos	n.
anglicisation	sub
	head	anglicize
	or	anglicization
	syl	an+gli+ci+1sa+tion
	pos	n.
angling	0.a.
	syl	an+gling
	pron	<1@GgliG>
	pos	n.
	def	the art or sport of catching fish with a rod and line and a baited hook or other lure, such as a fly; fishing.
angling	0.b.
	syl	an+gling
	pron	<1@GgliG>
	pos	n.
	usage	as modifier
	exam	1	an angling contest.
Anglo-	ety	from Medieval Latin Angli*_i 
Anglo-	0.
	syl	An:glo-
	pron	<1@Ggl*u->
	usage	combining form.
	def	denoting English or England.
	exam	1	Anglo-Saxon.
Anglo-American	1.
	syl	An:glo-A:mer:i:can
	pos	adj.
	def	of or relating to relations between England and the United States or their peoples.
Anglo-American	2.
	syl	An:glo-A:mer:i:can
	pos	n.
	qual	Chiefly U.S.
	def	an inhabitant or citizen of the United States who was or whose ancestors were born in England.
Anglo-Catholic	1.
	syl	An:glo-Cath:o:lic
	pos	adj.
	def	of or relating to a group within the Church of England or the Anglican Communion that emphasizes the Catholic elements in its teaching and practice.
Anglo-Catholic	2.
	syl	An:glo-Cath:o:lic
	pos	n.
	def	a member of this group. &- {An@.glo-Ca@.thol@.i@.cism}
Anglo-French	1.
	syl	An:glo-French
	pos	adj.
	def	of or relating to England and France.
Anglo-French	2.
	syl	An:glo-French
	pos	adj.
	def	of or relating to Anglo-French.
Anglo-French	3.
	syl	An:glo-French
	pos	n.
	def	the Norman-French language of medieval England.
Anglo-Indian	1.
	syl	An:glo-In:di:an
	pos	adj.
	def	of or relating to England and India.
Anglo-Indian	2.
	syl	An:glo-In:di:an
	pos	adj.
	def	denoting or relating to Anglo-Indians.
Anglo-Indian	3.
	syl	An:glo-In:di:an
	pos	adj.
	usage	of a word
	def	introduced into English from an Indian language. {~}
Anglo-Indian	4.
	syl	An:glo-In:di:an
	pos	adj.
	def	a person of mixed British and Indian descent.
Anglo-Indian	5.
	syl	An:glo-In:di:an
	pos	adj.
	def	an Englishman who lives or has lived for a long time in India.
Anglo-Irish	1.
	syl	An:glo-I:rish
	pos	n.
	mod	preceded by the; functioning as; pl.
	def	the inhabitants of Ireland of English birth or descent.
Anglo-Irish	2.
	syl	An:glo-I:rish
	pos	n.
	def	the English language as spoken in Ireland.
Anglo-Irish	3.
	syl	An:glo-I:rish
	pos	adj.
	def	of or relating to the Anglo-Irish.
Anglo-Irish	4.
	syl	An:glo-I:rish
	pos	adj.
	def	of or relating to English and Irish.
Anglo-Irish	5.
	syl	An:glo-I:rish
	pos	adj.
	def	of or relating to the English language as spoken in Ireland.
Anglomania	0.
	syl	An+glo+ma+ni:a
	pron	<2@Ggl*u1mAni*>
	pos	n.
	def	excessive respect for English customs, etc.
Anglomaniac	sub
	head	Anglomania
	syl	An+glo+1ma+ni+ac
	pos	n.
Anglo-Norman	1.
	syl	An:glo-Nor:man
	pos	adj.
	qual	History.
	def	relating to the Norman conquerors of England, their society, or their language.
Anglo-Norman	2.
	syl	An:glo-Nor:man
	pos	n.
	qual	History.
	def	a Norman inhabitant of England after 1066.
Anglo-Norman	3.
	syl	An:glo-Nor:man
	pos	n.
	def	the Anglo-French language.
Anglophil	alt
	head	Anglophile
	or	Anglophile
	syl	An+glo+phil
	pos	n.
Anglophile	0.
	or	Anglophil
	syl	An+glo+phile
	pron	<1@Ggl*ufil>, <-2fIl>
	pos	n.
	def	a person having admiration for England or the English.
Anglophilia	sub
	head	Anglophile
	syl	An+glo+phil:i:a
	pron	<2@Ggl*u1fili*>
	pos	n.
Anglophiliac	sub
	head	Anglophile
	or	Anglophilic
	syl	An+glo+phil:i+ac
	pron	<2@Ggl*u1fili2@k>
	pos	adj.
Anglophilic	sub
	head	Anglophile
	or	Anglophiliac
	syl	An:glo+phil+ic
	pron	<2@Ggl*u1filik>
	pos	adj.
Anglophobe	0.
	syl	An+glo+phobe
	pron	<1@Ggl*u2f*ub>
	pos	n.
	def	a person who hates or fears England or its people.
Anglophobia	sub
	head	Anglophobe
	syl	An+glo+1pho+bi:a
	pos	n.
Anglophone	1.
	syl	An+glo+phone
	pron	<1@Ggl*2f*un>
	pos	n.
	def	a person who speaks English, esp. a native speaker.
Anglophone	2.
	syl	An+glo+phone
	pron	<1@Ggl*2f*un>
	pos	adj.
	def	speaking English.
Anglo-Saxon	1.
	syl	An:glo-Sax:on
	pos	n.
	def	a member of any of the West Germanic tribes (Angles, Saxons, and Jutes) that settled in Britain from the 5th century #7a.d. and were dominant until the Norman conquest.
Anglo-Saxon	2.
	syl	An:glo-Sax:on
	pos	n.
	def	the language of these tribes. See {Old English}.
Anglo-Saxon	3.
	syl	An:glo-Sax:on
	pos	n.
	def	any White person whose native language is English and whose cultural affiliations are those common to Britain and the U.S.
Anglo-Saxon	4.
	syl	An:glo-Sax:on
	pos	n.
	qual	Informal.
	def	plain blunt English, esp. English containing taboo words.
Anglo-Saxon	5.
	syl	An:glo-Sax:on
	pos	adj.
	def	forming part of the Germanic element in Modern English.
	exam	1	@6forget@9 is an Anglo-Saxon word.
Anglo-Saxon	6.
	syl	An:glo-Sax:on
	pos	adj.
	def	of or relating to the Anglo-Saxons or the Old English language.
Anglo-Saxon	7.
	syl	An:glo-Sax:on
	pos	adj.
	def	of or relating to the White Protestant culture of Britain and the U.S.
Anglo-Saxon	8.
	syl	An:glo-Sax:on
	pos	adj.
	usage	Informal. of English speech or writing
	def	plain and blunt.
Angola	0.
	syl	An+go+la
	pron	<@G1g*ul*>
	pos	n.
	def	a republic in SW Africa, on the Atlantic: includes the enclave of Cabinda, north of the River Congo; a Portuguese colony from 1575 until its independence in 1975. It consists of a narrow coastal plain with a large fertile plateau in the east. Currency: kwanza. Capital: Luanda. Pop.: 5673046 (1970). Area: 1246693 sq. km (481351 sq. miles).
Angolan	sub
	head	Angola
	syl	An+1go+lan
	pos	adj. n.
angora	1.a.
	syl	an+go+ra
	pron	<@G1gc:r*>
	pos	n.
	usage	sometimes cap.
	def	the long soft hair of the outer coat of the Angora goat or the fur of the Angora rabbit.
angora	1.b.
	syl	an+go+ra
	pron	<@G1gc:r*>
	pos	n.
	usage	sometimes cap.
	def	yarn, cloth, or clothing made from this hair.
angora	1.c.
	syl	an+go+ra
	pron	<@G1gc:r*>
	pos	n.
	usage	sometimes cap.
	def	a material made to resemble this yarn or cloth.
angora	1.d.
	syl	an+go+ra
	pron	<@G1gc:r*>
	pos	n.
	usage	sometimes cap.; as modifier; an angora sweater.
	def	See also {mohair}.
angora	2.
	syl	an+go+ra
	pron	<@G1gc:r*>
	pos	n.
	qual	Austral. slang.
	usage	sometimes cap.
	def	an idiot; fool.
Angora	1.
	syl	An+go+ra
	pron	<@G1gc:r*>, <1@Gg*r*>
	pos	n.
	def	the former name (until 1930) of {Ankara}.
Angora	2.
	syl	An+go+ra
	pron	<@G1gc:r*>
	pos	n.
	def	short for {Angora cat, Angora goat}, or {Angora rabbit}.
Angora cat	0.
	syl	An+go+ra cat
	pos	n.
	def	a former long-haired variety of cat, similar to the Persian.
Angora goat	0.
	syl	An+go+ra goat
	pos	n.
	def	a breed of domestic goat with long soft hair.
Angora rabbit	0.
	syl	An+go+ra rab+bit
	pos	n.
	def	a breed of rabbit with long usually white silky hair.
Angostura	0.
	syl	An+go+stu+ra
	pron	Spanish <2aGgo1stura>
	pos	n.
	def	the former name (1764-1846) for {Ciudad Bol*'ivar}.
angostura bark	0.
	syl	an+gos+tu+ra bark
	pron	<2@Gg*1stju*r*>
	pos	n.
	def	the bitter aromatic bark of certain South American rutaceous trees of the genus or used to make angostura bitters and formerly used medicinally to reduce fever.
angostura bitters	0.
	syl	an+gos+tu+ra bit+ters
	pos	n.
	mod	pl.
	qual	Trademark.
	usage	often cap.
	def	a bitter aromatic tonic, used as a flavouring in alcoholic drinks.
Angra do Hero'ismo	0.
	syl	An+gra do He+ro+*'is+mo
	pron	Portuguese <1*~*Ggr*> <Du> <i1rwiZmu>
	pos	n.
	def	a port in the Azores, on Terceira Island. Pop.: 40362 (1970).
angrier	infl
	head	angry
	syl	an+gri+er
	pos	adj.
angriest	infl
	head	angry
	syl	an+gri+est.
	pos	adj.
angry	1.
	syl	an+gry
	pron	<1@Ggri>
	pos	adj.
	def	feeling or expressing annoyance, animosity, or resentment; enraged.
angry	2.
	syl	an+gry
	pron	<1@Ggri>
	pos	adj.
	def	suggestive of anger.
	exam	1	angry clouds.
angry	3.
	syl	an+gry
	pron	<1@Ggri>
	pos	adj.
	def	severely inflamed.
	exam	1	an angry sore.
angrily	sub
	head	angry
	syl	an+gri+ly
	pos	adv.
angry young man	1.
	syl	an+gry young man
	pos	n.
	usage	often cap.
	def	one of several British novelists and playwrights of the 1950s who shared a hostility towards the established traditions and ruling elements of their country.
angry young man	2.
	syl	an+gry young man
	pos	n.
	def	any similarly rebellious person or group.
angst	ety	German
angst	0.
	syl	angst
	pron	<@Gst>, German <aGst>
	pos	n.
	def	an acute but nonspecific sense of anxiety or remorse.
angstrom	ety	C20: named after Anders J. *%A#7ngstr*"om 
angstrom	0.
	syl	ang+strom
	pron	<1@Gstr^m>, <-str*m>
	pos	n.
	def	a unit of length equal to 10%-%1%0 metre, used principally to express the wavelengths of electromagnetic radiations. It is equivalent to 0.1 nanometre. Symbol: *%A or A Also called: {angstrom unit}.
Anders Jonas	infl
	head	Angstrom
	syl	*%An:ders Jo:nas
	pron	<1and*rs> <1ju:nas>
	pos	n.
Angstrom	0.
	syl	*%Ang:str*"om
	pron	<1@Gstr*m>, Swedish <1cGstr@om>
	pos	n.
	def	1814-74, Swedish physicist, noted for his work on spectroscopy and solar physics.
Anguilla	0.
	syl	An+guil+la
	pron	<@G1gwil*>
	pos	n.
	def	an island in the West Indies, in the Leeward Islands: part of the British territory of St. Kitts-Nevis-Anguilla. Pop.: 5500 (1970 est.); area: 90 sq. km (35 sq. miles).
anguilliform	ety	C17: from Latin anguilla eel, diminutive of anguis snake
anguilliform	0.
	syl	an+guil+li+form
	pron	<@G1gwili2fc:m>
	pos	adj.
	def	having the shape or form of an eel.
anguine	ety	C17: from Latin angu*_inus, from anguis snake
anguine	0.
	syl	an+guine
	pron	<1@Ggwin>
	pos	adj.
	def	of, relating to, or similar to a snake.
anguish	ety	C13: from Old French angoisse a strangling, from Latin angustia narrowness, from angustus narrow
anguish	1.
	syl	an+guish
	pron	<1@GgwiS>
	pos	n.
	def	extreme pain or misery; mental or physical torture; agony.
anguish	2.
	syl	an+guish
	pron	<1@GgwiS>
	pos	vb.
	def	to afflict or be afflicted with anguish.
angular	ety	C15: from Latin angul*_aris, from angulus #7angle %1
angular	1.
	syl	an+gu+lar
	pron	<1@Ggjul*>
	pos	adj.
	def	lean or bony.
angular	2.
	syl	an+gu+lar
	pron	<1@Ggjul*>
	pos	adj.
	def	awkward or stiff in manner or movement.
angular	3.
	syl	an+gu+lar
	pron	<1@Ggjul*>
	pos	adj.
	def	having an angle or angles.
angular	4.
	syl	an+gu+lar
	pron	<1@Ggjul*>
	pos	adj.
	def	placed at an angle.
angular	5.
	syl	an+gu+lar
	pron	<1@Ggjul*>
	pos	adj.
	def	measured by an angle or by the rate at which an angle changes.
angularly	sub
	head	angular
	syl	an+gu+lar+ly
	pos	adv.
angularness	sub
	head	angular
	syl	an+gu+lar+ness
	pos	n.
angular acceleration	0.
	syl	an+gu+lar ac+cel+er:a+tion
	pos	n.
	def	the rate of change of angular velocity.
angularities	infl
	head	angularity
	syl	an+gu+lar+i:ties.
	pos	n.
	mod	pl.
angularity	1.
	syl	an+gu+lar+i:ty
	pron	<2@Ggju1l@riti>
	pos	n.
	def	the condition of being angular.
angularity	2.
	syl	an+gu+lar+i:ty
	pron	<2@Ggju1l@riti>
	pos	n.
	def	an angular form or shape.
angular momentum	0.
	syl	an+gu+lar mo+men+tum
	pos	n.
	def	the product of the momentum of a rotating body and its distance from the axis of rotation.
angular velocity	0.
	syl	an+gu+lar ve+loc+i:ty
	pos	n.
	def	the velocity of a body rotating about@T a@T fixed@T point@T measured@T as@T the@T rate@T of @T change@T of@T the@T angle subtended at that fixed point by the path of the body. Symbol: #Gw
angulate	ety	C18: from Late Latin angul*_are to make angled, from Latin angulus #7angle %1
angulate	1.
	syl	an+gu+late
	pron	<1@Ggjulit>, <-2lAt>
	pos	adj.
	def	having angles or an angular shape.
angulate	2.
	syl	an+gu+late
	pron	<1@Ggju2lAt>
	pos	vb.
	def	to make or become angular.
angulated	sub
	head	angulate
	syl	an+gu+2lat+ed
	pos	adj.
angulation	1.
	syl	an+gu+la+tion
	pron	<2@Ggju1lAS*n>
	pos	n.
	def	an angular formation.
angulation	2.
	syl	an+gu+la+tion
	pron	<2@Ggju1lAS*n>
	pos	n.
	def	the precise measurement of angles.
Angus	0.
	syl	An+gus
	pron	<1@Gg*s>
	pos	n.
	usage	until 1975
	def	a county of E Scotland, now part of Tayside region.
Angus Og	0.
	syl	An:gus Og
	pron	<*ug>
	pos	n.
	qual	Irish myth.
	def	the god of love and beauty.
angwantibo	ety	C19: from Efik
angwantibos	infl
	head	angwantibo
	syl	ang+wan+ti+bos.
	pos	n.
	mod	pl.
angwantibo	0.
	syl	ang+wan+ti+bo
	pron	<@G1gw@nti2b*u>
	pos	n.
	def	a rare gold-coloured prosimian primate, having digits that are specialized as a pair of pincers for climbing: family (lorises). Also called: {golden potto}.
Anhalt	0.
	syl	An+halt
	pron	German <1anhalt>
	pos	n.
	def	a former state of central Germany, now part of West Germany.
anhedral	0.
	syl	an+he+dral
	pron	<@n1hEdr*l>
	pos	n.
	def	the downward inclination of an aircraft wing in relation to the lateral axis. Compare {{dihedral} (sense 3)}.
anhinga	ety	C18: via Portuguese from Tupi
anhinga	0.
	syl	an+hin+ga
	pron	<@n1hiGg*>
	pos	n.
	def	another name for {darter} (the bird).
Anhwei	0.
	syl	An+hwei
	pron	<1@n1wA>
	pos	n.
	def	a province of E China, crossed by the Yangtze River. Capital: Hofei. Pop.: 35000000 (1967-71 est.). Area: 13986 sq. km (54000 sq. miles).
anhydride	ety	C19: from #7anhydr (#7ous) #7+ -#7ide 
anhydride	1.
	syl	an+hy+dride
	pron	<@n1hIdrId>, <-drid>
	pos	n.
	def	a compound that has been formed from another compound by dehydration.
anhydride	2.
	syl	an+hy+dride
	pron	<@n1hIdrId>, <-drid>
	pos	n.
	def	a compound that forms an acid or base when added to water.
anhydride	3.
	syl	an+hy+dride
	pron	<@n1hIdrId>, <-drid>
	pos	n.
	def	any organic compound containing the group -CO.O.CO- formed by removal of one water molecule from two carboxyl groups.
anhydrite	ety	C19: from #7anhydr (#7ous) #7+ -#7ite %1
anhydrite	0.
	syl	an+hy+drite
	pron	<@n1hIdrIt>
	pos	n.
	def	a glassy colourless to grey mineral consisting of anhydrous calcium sulphate in orthorhombic crystalline form, found in sedimentary rocks. Formula: CaSO\4.
anhydrous	ety	C19: from Greek anudros; see #7an -#7, hydro -
anhydrous	0.
	syl	an+hy+drous
	pron	<@n1hIdr*s>
	pos	adj.
	def	containing no water, esp. no water of crystallization.
ani	ety	Spanish an*'i, from Tupi
anis	infl
	head	ani
	syl	a:nis.
	pos	n.
	mod	pl.
ani	0.
	syl	a:ni
	pron	<1a:ni>
	pos	n.
	def	any of several gregarious tropical American birds of the genus family (cuckoos). They have a black plumage, long square-tipped tail, and heavily hooked bill.
Aniakchak	0.
	syl	An:i+ak+chak
	pron	<2@ni1@kC@k>
	pos	n.
	def	an active volcanic crater in SW Alaska, on the Alaska Peninsula: the largest explosion crater in the world. Height: 1347 m (4420 ft.). Diameter: 9 km (6 miles).
aniconic	ety	C19: from #7an -+#7iconic 
aniconic	0.
	syl	an+i:con+ic
	pron	<2@nI1konik>
	pos	adj.
	usage	of images of deities, symbols, etc.
	def	not portrayed in a human or animal form.
anil	ety	C16: from Portuguese, from Arabic an-*_nil, the indigo, from Sanskrit n*_ila dark blue
anil	0.
	syl	an:il
	pron	<1@nil>
	pos	n.
	def	a leguminous West Indian shrub, a source of indigo. Also called: {indigo}.
anile	ety	C17: from Latin an*_ilis, from anus old woman
anile	0.
	syl	an+ile
	pron	<1@nIl>, <1AnIl>
	pos	adj.
	def	of or like a feeble old woman.
anility	sub
	head	anile
	syl	a:nil+i:ty
	pron	<*1nil?!iti>
	pos	n.
aniline	0.
	syl	an:i+line
	pron	<1@nilin>, <-2lEn>
	pos	n.
	def	a colourless oily pungent poisonous liquid used in the manufacture of dyes, plastics, pharmaceuticals, and explosives. Formula: C\6H\5NH\2. Also called: {phenyl?!amine}.
aniline dye	0.
	syl	an:i+line dye
	pos	n.
	def	any synthetic dye originally made from raw materials, such as aniline, found in coal tar.
anilingus	ety	C20: from ani- #7anus+ -lingus, as in #7cunnilingus 
anilingus	0.
	syl	a:ni+lin+gus
	pron	<2Ani1liGg*s>
	pos	n.
	def	sexual stimulation involving oral contact with the anus.
anim	0.
	syl	anim.
	qual	abbrev. for
	def	animato.
anima	ety	Latin: air, breath, spirit, feminine of #7animus 
anima	0.a.
	syl	an:i+ma
	pron	<1@nim*>
	pos	n.
	usage	in Jungian psychology
	def	the inner personality, which is in communication with the unconscious.
anima	0.b.
	syl	an:i+ma
	pron	<1@nim*>
	pos	n.
	usage	in Jungian psychology
	def	the feminine principle as present in the male unconscious. See also {animus}.
animadversion	1.
	syl	an:i+mad+ver+sion
	pron	<2@nim@d1vR:S*n>
	pos	n.
	def	criticism or censure.
animadversion	2.
	syl	an:i+mad+ver+sion
	pron	<2@nim@d1vR:S*n>
	pos	n.
	def	a carefully considered observation.
animadvert	ety	C16: from Latin animadvertere to notice, pay attention, from animus mind+ advertere to turn to, from vertere to turn
animadvert	1.
	syl	an:i+mad+vert
	pron	<2@nim@d1vR:t>
	pos	vb.
	mod	intr.
	usage	usually foll. by on or upon
	def	to comment with strong criticism (upon); make censorious remarks (about).
animadvert	2.
	syl	an:i+mad+vert
	pron	<2@nim@d1vR:t>
	pos	vb.
	mod	intr.
	def	to make an observation or comment.
animal	ety	C14: from Latin animal (n.), from anim*_alis (adj.) living, breathing; see #7anima 
animal	1.
	syl	an:i+mal
	pron	<1@nim*l>
	pos	n.
	qual	Zoology.
	def	any living organism characterized by voluntary movement, the possession of cells with noncellulose cell walls and specialized sense organs enabling rapid response to stimuli, and the ingestion of complex organic substances such as plants and other animals.
animal	2.
	syl	an:i+mal
	pron	<1@nim*l>
	pos	n.
	def	any mammal, esp. any mammal except man.
animal	3.
	syl	an:i+mal
	pron	<1@nim*l>
	pos	n.
	def	a brutish person.
animal	4.
	syl	an:i+mal
	pron	<1@nim*l>
	pos	n.
	qual	Facetious.
	def	a person or thing (esp. in the phrase {no such animal) }.
animal	5.
	syl	an:i+mal
	pron	<1@nim*l>
	pos	adj.
	def	of or relating to animals.
	exam	1	animal products;
	exam	2	an animal characteristic.
animal	6.
	syl	an:i+mal
	pron	<1@nim*l>
	pos	adj.
	def	of or relating to the physical needs or desires; carnal; sensual.
animalcule	ety	C16: from New Latin animalculum a small #7animal 
animalculum	alt
	head	animalcule
	or	animalcule
	syl	an:i+mal+cu+lum
	pron	<2@ni?!1m@lkjul*m>
	pos	n.
animalcules	infl
	head	animalcule
	or	animalcula
	syl	an:i+mal+cules
	pron	<-kjul*>
	pos	n.
	mod	pl.
animalcula	infl
	head	animalcule
	or	animalcules
	syl	an:i+mal+cu+la
	pron	<-kjul*>
	pos	n.
	mod	pl.
animalcule	0.
	or	animalculum
	syl	an:i+mal+cule
	pron	<2@ni1m@lkju:l>
	pos	n.
	def	a microscopic animal such as an amoeba or rotifer.
animalcular	sub
	head	animalcule
	syl	an:i+1mal+cu+lar
	pos	adj.
animal husbandry	0.
	syl	an:i+mal hus+band+ry
	pos	n.
	def	the science of breeding, rearing, and caring for farm animals.
animalism	1.
	syl	an:i+mal+ism
	pron	<1@nim*2liz*m>
	pos	n.
	def	satisfaction of or preoccupation with physical matters; sensuality.
animalism	2.
	syl	an:i+mal+ism
	pron	<1@nim*2liz*m>
	pos	n.
	def	the doctrine or belief that man lacks a spiritual nature.
animalism	3.
	syl	an:i+mal+ism
	pron	<1@nim*2liz*m>
	pos	n.
	def	a trait or mode of behaviour typical of animals.
animalist	sub
	head	animalism
	syl	an:i+mal+ist
	pos	n.
animality	1.
	syl	an:i+mal+i:ty
	pron	<2@ni1m@liti>
	pos	n.
	def	the animal side of man, as opposed to the intellectual or spiritual.
animality	2.
	syl	an:i+mal+i:ty
	pron	<2@ni1m@liti>
	pos	n.
	def	the fact of being or having the characteristics of an animal.
animalise	alt
	head	animalize
	or	animalize
	syl	an:i+mal+ise
	pron	<1@nim*2lIz>
	pos	vb.
	mod	tr.
animalize	0.
	or	animalise
	syl	an:i+mal+ize
	pron	<1@nim*2lIz>
	pos	vb.
	mod	tr.
	def	to rouse to brutality or sensuality or make brutal or sensual.
animalization	sub
	head	animalize
	or	animalisation
	syl	an:i+mal:i+1za+tion
	pos	n.
animalisation	sub
	head	animalize
	or	animalization
	syl	an:i+mal:i+1sa+tion
	pos	n.
animal kingdom	0.
	syl	an:i+mal king+dom
	pos	n.
	def	a category of living organisms comprising all animals. Compare {plant kingdom, mineral kingdom}.
animal magnetism	1.
	syl	an:i+mal mag+net+ism
	pos	n.
	qual	Sometimes facetious.
	def	the quality of being attractive, esp. to members of the opposite sex.
animal magnetism	2.
	syl	an:i+mal mag+net+ism
	pos	n.
	qual	Obsolete.
	def	hypnotism.
animal starch	0.
	syl	an:i+mal starch
	pos	n.
	def	a less common name for {glycogen}.
animate	ety	C16: from Latin anim*_are to fill with breath, make alive, from anima breath, spirit &- #!an@.i+@!mat+ed+ly adv.
animate	1.
	syl	an:i+mate
	pron	<1@ni2mAt>
	pos	vb.
	mod	tr.
	def	to give life to or cause to come alive.
animate	2.
	syl	an:i+mate
	pron	<1@ni2mAt>
	pos	vb.
	mod	tr.
	def	to make gay or lively; enliven.
animate	3.
	syl	an:i+mate
	pron	<1@ni2mAt>
	pos	vb.
	mod	tr.
	def	to encourage or inspire.
animate	4.
	syl	an:i+mate
	pron	<1@ni2mAt>
	pos	vb.
	mod	tr.
	def	to impart motion to; move to action or work.
animate	5.
	syl	an:i+mate
	pron	<1@ni2mAt>
	pos	vb.
	mod	tr.
	def	to record on film so as to give movement to.
	exam	1	an animated cartoon.
animate	6.
	syl	an:i+mate
	pron	<1@nimit>
	pos	adj.
	mod	tr.
	def	being alive or having life.
animate	7.
	syl	an:i+mate
	pron	<1@nimit>
	pos	adj.
	mod	tr.
	def	gay, spirited, or lively.
animated cartoon	0.
	syl	an:i+mat+ed car+toon
	pos	n.
	def	a film produced by photographing a series of gradually changing drawings, etc., which give the illusion of movement when the series is projected rapidly.
animation	1.
	syl	an:i+ma+tion
	pron	<2@ni1mAS*n>
	pos	n.
	def	liveliness; vivacity.
animation	2.
	syl	an:i+ma+tion
	pron	<2@ni1mAS*n>
	pos	n.
	def	the condition of being alive.
animation	3.a.
	syl	an:i+ma+tion
	pron	<2@ni1mAS*n>
	pos	n.
	def	the techniques used in the production of animated cartoons.
animation	3.b.
	syl	an:i+ma+tion
	pron	<2@ni1mAS*n>
	pos	n.
	def	a variant of {animated cartoon}.
animatism	0.
	syl	an:i+ma+tism
	pron	<1@nim*2tiz*m>
	pos	n.
	def	the belief that inanimate objects have consciousness.
animato	ety	Italian
animato	0.
	syl	a:ni+ma+to
	pron	<2@ni1ma:t*u>
	pos	adj. adv.
	qual	Music.
	def	lively; animated.
animater	alt
	head	animator
	or	animator
	syl	an:i+mat+er
	pron	<1@ni2mAt*>
	pos	n.
animator	0.
	or	animater
	syl	an:i+ma+tor
	pron	<1@ni2mAt*>
	pos	n.
	def	an artist who produces animated cartoons.
anim'e	ety	French: of uncertain origin
anim'e	0.
	syl	an:i+m*'e
	pron	<1@ni2mA>, <-mi>
	pos	n.
	def	any of various resins, esp. that obtained from the tropical American leguminous tree
animism	ety	C19: from Latin anima vital breath, spirit
animism	1.
	syl	an:i+mism
	pron	<1@ni2miz*m>
	pos	n.
	def	the belief that natural objects, phenomena, and the universe itself possess souls.
animism	2.
	syl	an:i+mism
	pron	<1@ni2miz*m>
	pos	n.
	usage	in the philosophies of Plato and Pythagoras
	def	the hypothesis that there is an immaterial force that animates the universe.
animist	sub
	head	animism
	syl	an:i+mist
	pos	n.
animistic	sub
	head	animism
	syl	an:i+mis+tic
	pron	<2@ni1mistik>
	pos	adj.
animosity	ety	C15: from Late Latin anim*_osit*_as, from Latin anim*_osus spirited, from #7animus 
animosities	infl
	head	animosity
	syl	an:i+mos+i:ties.
	pos	n.
	mod	pl.
animosity	0.
	syl	an:i+mos+i:ty
	pron	<2@ni1mositi>
	pos	n.
	def	a powerful and active dislike or hostility; enmity.
animus	ety	C19: from Latin: mind, spirit
animus	1.
	syl	an:i+mus
	pron	<1@nim*s>
	pos	n.
	def	intense dislike; hatred; animosity.
animus	2.
	syl	an:i+mus
	pron	<1@nim*s>
	pos	n.
	def	motive, intention, or purpose.
animus	3.
	syl	an:i+mus
	pron	<1@nim*s>
	pos	n.
	usage	in Jungian psychology
	def	the masculine principle present in the female unconscious. See also {anima}.
anion	ety	C19: from #7ana -#7+#7ion  &- an@.i+on+ic (@!@ana$I#!$An$Ik) adj.
anion	0.
	syl	an+i:on
	pron	<1@n2I*n>
	pos	n.
	def	a negatively charged ion; an ion that is attracted to the anode during electrolysis. Compare {cation}.
anise	ety	C13: from Old French anis, via Latin from Greek anison 
anise	0.
	syl	an+ise
	pron	<1@nis>
	pos	n.
	def	a Mediterranean umbelliferous plant, having clusters of small yellowish-white flowers and liquorice-flavoured seeds (see {aniseed) }.
aniseed	0.
	syl	an:i+seed
	pron	<1@ni2sEd>
	pos	n.
	def	the liquorice-flavoured aromatic seeds of the anise plant, used medicinally for expelling intestinal gas and in cookery as a flavouring, esp. in cakes. Also called: {anise}.
aniseikonia	ety	C20: New Latin, from #7aniso -#7+ Greek eikon image
aniseikonia	0.
	syl	an+is:ei+ko+ni:a
	pron	<2@nIsI1k*uni*>
	pos	n.
	def	a visual defect in which the shape and size of an object seen by one eye differs from that seen by the other eye.
aniseikonic	sub
	head	aniseikonia
	syl	an+is:ei+1kon+ic
	pos	adj.
anisette	ety	C19: from French; see #7anise, -#7ette 
anisette	0.
	syl	an:i+sette
	pron	<2@ni1zet>, <-1set>
	pos	n.
	def	a liquorice-flavoured liqueur made from aniseed.
aniso-	ety	New Latin, from Greek anisos; see #7an -#7, iso -
anisodactyl	1.
	syl	an+i:so+dac+tyl
	pron	<@n2Is*u1d@ktil>, <2@nI->
	pos	adj.
	usage	also; of the feet of passerine birds
	def	having the first toe directed backwards and the other three toes directed forwards.
anisodactyl	2.
	syl	an+i:so+dac+tyl
	pron	<@n2Is*u1d@ktil>, <2@nI->
	pos	n.
	usage	also
	def	a bird having this type of feet.
anisogamy	0.
	syl	an:i+sog:a+my
	pron	<2@nI1sog*mi>
	pos	n.
	def	a type of sexual reproduction in which the gametes are dissimilar, either in size alone or in size and form.
anisogamous	sub
	head	anisogamy
	syl	an:i+1sog:a+mous
	pos	adj.
anisole	ety	C19: from #7anise+ -#7ole 
anisole	0.
	syl	an:i+sole
	pron	<1@ni2s*ul>
	pos	n.
	def	a colourless pleasant-smelling liquid used as a solvent and vermicide and in perfume and flavouring. Formula: C\6H\5OCH\3; relative density: 0.996; melting pt.: -37.5?%C; boiling pt.: 155?%C.
anisomerous	0.
	syl	an+i:som+er+ous
	pron	<2@ni1som*r*s>
	pos	adj.
	usage	of flowers
	def	having floral whorls that differ in the number of their parts. Compare {{isomerous} (sense 2)}.
anisometric	1.
	syl	an+i:so+met+ric
	pron	<@n2Is*u1metrik>
	pos	adj.
	def	not isometric; having unsymmetrical parts or unequal measurements.
anisometric	2.
	syl	an+i:so+met+ric
	pron	<@n2Is*u1metrik>
	pos	adj.
	usage	of a crystal
	def	having unequal axes.
anisometropia	0.
	syl	an+i:so+me:tro+pi:a
	pron	<@n2Is*um*1tr*upi*>, <2@nI->
	pos	n.
	def	an im?!balance in the power of the two eyes to refract light.
anisotropic	1.
	syl	an+i:so+trop+ic
	pron	<@n2Is*u1tropik>, <2@nI->
	pos	adj.
	def	not isotropic; having different physical properties in different directions.
	exam	1	anisotropic crystals.
anisotropic	2.
	syl	an+i:so+trop+ic
	pron	<@n2Is*u1tropik>, <2@nI->
	pos	adj.
	usage	of a plant
	def	responding unequally to an external stimulus in different parts of the plant. &- {an+@!i@.so+#!trop@.i+cal+ly}
anisotropy	sub
	head	anisotropic
	syl	an+i:sot+ro+py
	pron	<2@nI1sotr*pi>
	pos	n.
Anjou	0.
	syl	An+jou
	pron	French <*~a1Zu>
	pos	n.
	def	a former province of W France, in the Loire valley: a medieval countship from the 10th century, belonging to the English crown from 1154 until 1204; annexed by France in 1480.
Ankara	0.
	syl	An+ka+ra
	pron	<1@Gk*r*>
	pos	n.
	def	the capital of Turkey, an ancient city in the Anatolian highlands: first a capital in the 3rd century #7b.c., in the Celtic kingdom of Galatia. Pop.: 1701004 (1975). Ancient name: {Ancyra}. Former name (until 1930): {Angora}.
ankerite	ety	C19: named after M. J. Anker (died 1843), Austrian mineralogist
ankerite	0.
	syl	an+ker+ite
	pron	<1@Gk*2rIt>
	pos	n.
	def	a greyish to brown mineral that resembles dolomite and consists of a carbonate of calcium, magnesium, and iron. Formula: (Ca,Mg,Fe)CO\3.
ankh	ety	from Egyptian `nh life, soul
ankh	0.
	syl	ankh
	pron	<@Gk>
	pos	n.
	def	a tall cross with a loop on the top, symbolizing eternal life: often appearing in Egyptian personal names, such as Tutankhamen. Also called: {ansate cross, crux ansata}.
Anking	0.
	syl	An+king
	pron	<1a:n1kiG>
	pos	n.
	def	a city in E China, capital of Anhwei province, on the Yangtze River: famous seven-storeyed pagoda. Pop.: 105300 (1953).
ankle	ety	C14: from Old Norse; related to German, Dutch enkel, Latin angulus #7angle %1
ankle	1.
	syl	an+kle
	pron	<1@GkL>
	pos	n.
	def	the joint connecting the leg and the foot. See {talus%1}.
ankle	2.
	syl	an+kle
	pron	<1@GkL>
	pos	n.
	def	the part of the leg just above the foot.
anklebone	0.
	syl	an:kle+bone
	pron	<1@GkL2b*un>
	pos	n.
	def	the nontechnical name for {talus%1}.
ankle sock	0.
	syl	an+kle sock
	pos	n.
	mod	often; pl.
	qual	Brit.
	def	a short sock coming up to the ankle. U.S. term: {anklet}.
anklet	1.
	syl	an+klet
	pron	<1@Gklit>
	pos	n.
	def	an ornamental chain worn around the ankle.
anklet	2.
	syl	an+klet
	pron	<1@Gklit>
	pos	n.
	def	the U.S. word for {ankle sock}.
ankus	ety	from Hindi
ankus	infl
	or	ankuses
	syl	an+kus
	pos	n.
	mod	pl.
ankuses	infl
	head	ankus
	or	ankus
	syl	an+kus:es.
	pos	n.
	mod	pl.
ankus	0.
	syl	an+kus
	pron	<1@Gk*s>
	pos	n.
	def	a stick used, esp. in India, for goading elephants.
ankylosaur	ety	C20: from New Latin, from Greek ankulos crooked+ -#7saur 
ankylosaur	0.
	syl	an+ky+lo+saur
	pron	<1@Gkil*u2sc:>
	pos	n.
	def	any of various quadrupedal herbivorous ornithischian dinosaurs constituting the suborder which were most abundant in upper Cretaceous times and had a very heavily armoured tanklike body.
anchylose	alt
	head	ankylose
	or	ankylose
	syl	an+chy+lose
	pron	<1@Gki2l*us>, <-2l*uz>
	pos	vb.
ankylose	0.
	or	anchylose
	syl	an+ky+lose
	pron	<1@Gki2l*us>, <-2l*uz>
	pos	vb.
	usage	of bones in a joint, etc.
	def	to fuse or stiffen by ankylosis.
ankylosis	ety	C18: from New Latin, from Greek ankuloun to crook
anchylosis	alt
	head	ankylosis
	or	ankylosis
	syl	an+chy+lo+sis
	pron	<2@Gki1l*usis>
	pos	n.
ankylosis	0.
	or	anchylosis
	syl	an+ky+lo+sis
	pron	<2@Gki1l*usis>
	pos	n.
	def	abnormal adhesion or immobility of the bones in a joint, as by a direct joining of the bones, a fibrous growth of tissues within the joint, or surgery.
ankylotic	sub
	head	ankylosis
	or	anchylotic
	syl	an+ky+lot+ic
	pron	<2@Gki1lotik>
	pos	adj.
anchylotic	sub
	head	ankylosis
	or	ankylotic
	syl	an+chy+lot+ic
	pron	<2@Gki1lotik>
	pos	adj.
ankylostomiasis	0.
	syl	an+ky+los+to+mi:a+sis
	pron	<2@Gki2lost*1mI*sis>
	pos	n.
	def	a variant spelling of {ancylostomiasis}.
anlace	ety	C13: of unknown origin
anelace	alt
	head	anlace
	or	anlace
	syl	an+e:lace
	pron	<1@n*2lAs>
	pos	n.
anlace	0.
	or	anelace
	syl	an+lace
	pron	<1@nlis>
	pos	n.
	def	a medieval short dagger with a broad tapering blade.
anlage	ety	German: predisposition, layout
anlagen	infl
	head	anlage
	or	anlages
	syl	an+la+gen
	pron	<-g*n>
	pos	n.
	mod	pl.
anlages	infl
	head	anlage
	or	anlagen
	syl	an+la+ges.
	pos	n.
	mod	pl.
anlage	0.
	syl	an+la+ge
	pron	<1@n2la:g*>
	pos	n.
	def	another word for {primordium}.
ann	1.
	syl	ann.
	qual	abbrev. for:
	def	annals (periodical publications).
ann	2.
	syl	ann.
	qual	abbrev. for:
	def	an?!nual.
ann	3.
	syl	ann.
	qual	abbrev. for:
	def	annuity.
anna	ety	C18: from Hindi *_an*_a 
anna	0.
	syl	an:na
	pron	<1@n*>
	pos	n.
	def	a former Indian copper coin, worth one sixteenth of a rupee.
Annaba	0.
	syl	An+na+ba
	pron	<1@n*b*>
	pos	n.
	def	a port in NE Algeria: site of the Roman city of Hippo Regius. Pop.: 152006 (1966). Former name: {B*^one}.
annabergite	ety	C19: named after Annaberg in Saxony, where it was discovered; see -#7ite %1
annabergite	0.
	syl	an+na+berg+ite
	pron	<1@n*2bR:gIt>
	pos	n.
	def	a rare green secondary mineral consisting of hydrated nickel arsenate in monoclinic crystalline form. Formula: Ni\3(AsO\4)\2.8H\2O. Also called: {nickel bloom}.
annal	0.
	syl	an+nal
	pron	<1@nL>
	pos	n.
	def	the recorded events of one year. See also {annals}.
annals	ety	C16: from Latin (libr*_i) ann*_al*_es yearly (books), from annus year &- #!an+nal+ist n. &- @!an+nal+#!is+tic adj.
annals	1.
	syl	an+nals
	pron	<1@nLz>
	pos	n.
	mod	pl.
	def	yearly records of events, generally in chronological order.
annals	2.
	syl	an+nals
	pron	<1@nLz>
	pos	n.
	mod	pl.
	def	history or records of history in general.
annals	3.
	syl	an+nals
	pron	<1@nLz>
	pos	n.
	mod	pl.
	def	regular reports of the work of a society, learned body, etc.
Anam	alt
	head	Annam
	or	Annam
	syl	A:nam
	pron	<@1n@m>, <1@n@m>
	pos	n.
Annam	0.
	or	Anam
	syl	An+nam
	pron	<@1n@m>, <1@n@m>
	pos	n.
	def	a former kingdom (3rd cent.-1428), empire (1428-1884), and French protectorate (1884-1945) of E Indochina: now part of Vietnam.
Annamese	1.
	syl	An+na+mese
	pron	<2@n*1mEz>
	pos	adj.
	def	of or relating to Annam.
Annamese	2.
	syl	An+na+mese
	pron	<2@n*1mEz>
	pos	adj. n.
	def	a former word for {Vietnamese}.
Annapolis	0.
	syl	An+nap:o+lis
	pron	<*1n@p*lis>
	pos	n.
	def	the capital of Maryland, near the mouth of the Severn River on Chesapeake Bay: site of the U.S. Naval Academy. Pop.: 29592 (1970).
Annapolis Royal	0.
	syl	An+nap:o+lis Roy+al
	pos	n.
	def	a town in SE Canada in W Nova Scotia on an arm of the Bay of Fundy: the first settlement in Canada (1605). Pop.: 758 (1971). Former name (until 1710): {Park Royal}.
Anapurna	alt
	head	Annapurna
	or	Annapurna
	syl	A:na+pur+na
	pron	<2@n*1pu*n*>
	pos	n.
Annapurna	0.
	or	Anapurna
	syl	An+na+pur+na
	pron	<2@n*1pu*n*>
	pos	n.
	def	a massif of the Himalayas, in Nepal. Highest peak: 8078 m (26502 ft.).
Ann Arbor	0.
	syl	Ann Ar+bor
	pron	<@n> <1a:b*>
	pos	n.
	def	a city in SE Michigan: seat of the University of Michigan. Pop.: 104791 (1973 est.).
annates	ety	C16: plural of French annate, from Medieval Latin ann*_ata, from Latin annus year
annates	0.
	syl	an+nates
	pron	<1@nAts>, <-*ts>
	pos	n.
	mod	pl.
	qual	R.C. Church.
	def	the first year's revenue of a see, an abbacy, or a minor benefice, paid to the pope.
annatto	ety	from Carib
anatto	alt
	head	annatto
	or	annatto
	syl	a:nat+to
	pron	<*1n@t*u>
	pos	n.
annattos	infl
	head	annatto
	syl	an+nat+tos.
	pos	n.
	mod	pl.
annatto	1.
	or	anatto
	syl	an+nat+to
	pron	<*1n@t*u>
	pos	n.
	def	a small tropical American tree, having red or pinkish flowers and pulpy seeds that yield a dye: family
annatto	2.
	or	anatto
	syl	an+nat+to
	pron	<*1n@t*u>
	pos	n.
	def	the yellowish-red dye obtained from the pulpy outer layer of the coat of the seeds of this tree, used for colouring fabrics, butter, varnish, etc.
Princess	1.
	head	Anne
	syl	Princess.
	def	born 1950, daughter of Elizabeth II of England; noted also as a horsewoman.
Queen	2.
	head	Anne
	syl	Queen.
	def	1665-1714, queen of Great Britain and Ireland (1702-14), daughter of James II, and the last of the Stuart monarchs.
Saint	3.
	head	Anne
	syl	Saint.
	usage	in Christian tradition
	def	the mother of the Virgin Mary. Feast day: July 26.
anneal	ety	Old English on*_@alan, from #7on+ *_@alan to burn, from *_al fire
anneal	1.
	syl	an+neal
	pron	<*1nEl>
	pos	vb.
	def	to temper or toughen (something) by heat treatment.
anneal	2.
	syl	an+neal
	pron	<*1nEl>
	pos	vb.
	def	to subject to or undergo some physical treatment, esp. heating, that removes internal stress, crystal defects, and dislocations.
anneal	3.
	syl	an+neal
	pron	<*1nEl>
	pos	vb.
	mod	tr.
	def	to toughen or strengthen (the will, determination, etc.).
anneal	4.
	syl	an+neal
	pron	<*1nEl>
	pos	vb.
	qual	Physics.
	usage	often foll. by out
	def	to disappear or cause to disappear by a rearrangement of atoms.
	exam	1	defects anneal out at different temperatures.
anneal	5.
	syl	an+neal
	pron	<*1nEl>
	pos	vb.
	def	an act of annealing.
annealer	sub
	head	anneal
	syl	an+1neal+er
	pos	n.
Anne Boleyn	0.
	syl	Anne Bo:leyn
	pos	n.
	def	See (Anne) {Boleyn}.
Annecy	1.
	syl	Anne+cy
	pron	French <an1si>
	pos	n.
	def	a city and resort in E France, on Lake Annecy. Pop.: 54954 (1975).
Lake	2.
	head	Annecy
	syl	Lake.
	def	a lake in E France, in the Alps.
annelid	ety	C19: from New Latin Annelida, from French annel*'es, literally: the ringed ones, from Old French annel ring, from Latin *_anellus, from *_anulus ring
annelid	1.
	syl	an+ne:lid
	pron	<1@n*lid>
	pos	n.
	def	any worms of the phylum in which the body is divided into segments both externally and internally. The group includes the earthworms, lugworm, ragworm, and leeches.
annelid	2.
	syl	an+ne:lid
	pron	<1@n*lid>
	pos	adj.
	def	of, relating to, or belonging to the
annelidan	sub
	head	annelid
	syl	an+nel:i+dan
	pron	<*1neli?!d*n>
	pos	n. adj.
Anne of Austria	0.
	syl	Anne of Aus+tri:a
	pos	n.
	def	1601-66, wife of Louis XIII of France and daughter of Philip III of Spain: regent of France (1643-61) for her son Louis XIV.
Anne of Bohemia	0.
	syl	Anne of Bo+he+mi:a
	pos	n.
	def	1366-94, queen consort of Richard II of England.
Anne of Cleves	0.
	syl	Anne of Cleves
	pron	<klEvz>
	pos	n.
	def	1515-57, the fourth wife of Henry VIII of England, whose marriage (1540) was annulled after six months.
annex	ety	C14: from Medieval Latin annex*_are, from Latin annectere to attach to, from nectere to join
annex	1.
	syl	an+nex
	pron	<@1neks>
	pos	vb.
	mod	tr.
	def	to join or add, esp. to something larger; attach.
annex	2.
	syl	an+nex
	pron	<@1neks>
	pos	vb.
	mod	tr.
	def	to add territory by conquest or occupation.
annex	3.
	syl	an+nex
	pron	<@1neks>
	pos	vb.
	mod	tr.
	def	to add or append as a condition, warranty, etc.
annex	4.
	syl	an+nex
	pron	<@1neks>
	pos	vb.
	mod	tr.
	def	to appropriate without permission.
annex	5.
	syl	an+nex
	pron	<1@neks>
	pos	n.
	mod	tr.
	def	a variant spelling (esp. U.S.) of {annexe}.
annexable	sub
	head	annex
	syl	an+1nex+a:ble
	pos	adj.
annexation	1.
	syl	an+nex:a+tion
	pron	<2@nik1sAS*n>, <-ek->
	pos	n.
	def	the act of annexing, esp. territory, or the condition of being annexed.
annexation	2.
	syl	an+nex:a+tion
	pron	<2@nik1sAS*n>, <-ek->
	pos	n.
	def	something annexed.
annexational	sub
	head	annexation
	syl	an+nex:1a+tion+al
	pos	adj.
annexationism	sub
	head	annexation
	syl	an+nex:1a+tion+ism
	pos	n.
annexationist	sub
	head	annexation
	syl	an+nex:1a+tion+ist
	pos	n.
annexe	1.
	syl	an+nexe
	usage	esp. U.S.
	def	an extension to a main building.
annexe	2.
	syl	an+nexe
	usage	esp. U.S.
	def	something added or annexed, esp. a supplement to a document.
annihilate	ety	C16: from Late Latin annihil*_are to bring to nothing, from Latin nihil nothing
annihilate	1.
	syl	an+ni+hi+late
	pron	<*1nI*2lAt>
	pos	vb.
	mod	tr.
	def	to destroy completely; extinguish.
annihilate	2.
	syl	an+ni+hi+late
	pron	<*1nI*2lAt>
	pos	vb.
	mod	tr.
	qual	Informal.
	def	to defeat totally, as in debate or argument.
annihilable	sub
	head	annihilate
	syl	an+ni+hil+a:ble
	pron	<*1nI*l*bL>
	pos	adj.
annihilative	sub
	head	annihilate
	syl	an+1ni+hi+la+tive
	pos	adj.
annihilator	sub
	head	annihilate
	syl	an+1ni+hi+2la+tor
	pos	n.
annihilation	1.
	syl	an+ni+hi+la+tion
	pron	<*2nI*1lAS*n>
	pos	n.
	def	total destruction.
annihilation	2.
	syl	an+ni+hi+la+tion
	pron	<*2nI*1lAS*n>
	pos	n.
	def	the act of annihilating.
annihilation	3.
	syl	an+ni+hi+la+tion
	pron	<*2nI*1lAS*n>
	pos	n.
	def	the destruction of a particle and its antiparticle when they collide. The energy equivalent of the interacting masses is converted into one or more photons of {annihilation radiation}.
anniversary	ety	C13: from Latin annivers*_arius returning every year, from annus year+ vertere to turn
anniversaries	infl
	head	anniversary
	syl	an+ni+ver+sa+ries.
	pos	n.
	mod	pl.
anniversary	1.
	syl	an+ni+ver+sa+ry
	pron	<2@ni1vR:s*ri>
	pos	n.
	def	the date on which an event occurred in some previous year.
	exam	1	a wedding anniversary.
anniversary	2.
	syl	an+ni+ver+sa+ry
	pron	<2@ni1vR:s*ri>
	pos	n.
	def	the celebration of this.
anniversary	3.
	syl	an+ni+ver+sa+ry
	pron	<2@ni1vR:s*ri>
	pos	adj.
	def	of or relating to an anniversary.
anniversary	4.
	syl	an+ni+ver+sa+ry
	pron	<2@ni1vR:s*ri>
	pos	adj.
	def	recurring every year, esp. on the same date.
Anniversary Day	0.
	syl	An+ni+ver+sa+ry Day
	pos	n.
	def	another name for {Australia Day}.
anno Domini	ety	Latin: in the year of our Lord
anno Domini	0.
	syl	an:no Dom:i+ni
	pron	<1@n*u> <1domi2nI>, <-2nE>
	def	the full form of {A.D}.
anno regni	0.
	syl	an:no reg+ni
	pron	Latin. <1@n*u> <1regnI>
	def	in the year of the reign.
annotate	ety	C18: from Latin annot*_are, from nota mark &- #!an+no+@!tat+a@.ble adj. ?- #!an+no+@!ta+tive adj.
annotate	0.
	syl	an+no+tate
	pron	<1@n*u2tAt>, <1@n*->
	pos	vb.
	def	to supply (a written work, such as an ancient text) with critical or explanatory notes.
annotator	sub
	head	annotate
	syl	an+no+2ta+tor
	pos	n.
annotation	1.
	syl	an+no+ta+tion
	pron	<2@n*u1tAS*n>, <2@n*->
	pos	n.
	def	the act of annotat?!ing.
annotation	2.
	syl	an+no+ta+tion
	pron	<2@n*u1tAS*n>, <2@n*->
	pos	n.
	def	a note added in explanation, etc., esp. of some literary work.
announce	ety	C15: from Old French anoncer, from Latin annunit*_are, from nuntius messenger
announce	1.
	syl	an+nounce
	pron	<*1nauns>
	pos	vb.
	mod	tr.
	usage	may take a clause as object
	def	to make known publicly; proclaim.
announce	2.
	syl	an+nounce
	pron	<*1nauns>
	pos	vb.
	mod	tr.
	def	to declare the arrival of.
	exam	1	to announce a guest.
announce	3.
	syl	an+nounce
	pron	<*1nauns>
	pos	vb.
	mod	tr.
	usage	may take a clause as object
	def	to reveal to the mind or senses; presage.
	exam	1	the dark clouds an?!nounced rain.
announce	4.
	syl	an+nounce
	pron	<*1nauns>
	pos	vb.
	mod	intr.
	def	to work as an announcer, as on radio or television.
announce	5.
	syl	an+nounce
	pron	<*1nauns>
	pos	vb.
	qual	U.S.
	def	to make known (one's intention to run as a candidate).
	exam	1	to announce for the presidency.
announcement	1.
	syl	an+nounce+ment
	pron	<*1naunsm*nt>
	pos	n.
	def	a public statement.
announcement	2.
	syl	an+nounce+ment
	pron	<*1naunsm*nt>
	pos	n.
	def	a brief item or advertisement, as in a newspaper.
announcement	3.
	syl	an+nounce+ment
	pron	<*1naunsm*nt>
	pos	n.
	def	a formal printed or written invitation.
announcement	4.
	syl	an+nounce+ment
	pron	<*1naunsm*nt>
	pos	n.
	def	the act of announcing. ********************************************************************** ********************************************************************** the act of announcing. ********************************************************************** ********************************************************************** position.
announcement	5.
	syl	an+nounce+ment
	pron	<*1naunsm*nt>
	pos	n.
	usage	foll. by on
	def	to move (towards) in a threatening manner.
announcement	6.
	syl	an+nounce+ment
	pron	<*1naunsm*nt>
	pos	n.
	mod	tr.
	def	to present for consideration; suggest.
announcement	7.
	syl	an+nounce+ment
	pron	<*1naunsm*nt>
	pos	n.
	def	to bring or be brought to a further stage of
announcer	0.
	syl	an+nounc+er
	pron	<*1nauns*>
	pos	n.
	def	a person who announces, esp. one who reads the news, introduces programmes, etc., on radio or television.
anno urbis conditae	0.
	syl	an:no ur+bis con+di+tae
	pron	Latin. <1@n*u> <1R:bis> <1kondi2tE>
	def	the full form of {A.U.C}.
annoy	ety	C13: from Old French anoier, from Late Latin inodi*_are to make hateful, from Latin in odi*_o (esse) (to be) hated, from odium hatred
annoy	1.
	syl	an+noy
	pron	<*1nci>
	pos	vb.
	def	to irritate or displease.
annoy	2.
	syl	an+noy
	pron	<*1nci>
	pos	vb.
	def	to harass with repeated attacks.
annoyer	sub
	head	annoy
	syl	an+1noy+er
	pos	n.
annoyance	1.
	syl	an+noy+ance
	pron	<*1nci*ns>
	pos	n.
	def	the feeling of being annoyed.
annoyance	2.
	syl	an+noy+ance
	pron	<*1nci*ns>
	pos	n.
	def	the act of annoying.
annoyance	3.
	syl	an+noy+ance
	pron	<*1nci*ns>
	pos	n.
	def	a person or thing that annoys.
annual	ety	C14: from Late Latin annu*_alis, from Latin annuus yearly, from annus year
annual	1.
	syl	an+nu:al
	pron	<1@nju*l>
	pos	adj.
	def	occurring, done, etc., once a year or every year; yearly.
	exam	1	an annual income.
annual	2.
	syl	an+nu:al
	pron	<1@nju*l>
	pos	adj.
	def	lasting for a year.
	exam	1	an annual subscription.
annual	3.
	syl	an+nu:al
	pron	<1@nju*l>
	pos	n.
	def	a plant that completes its life cycle in one year. Compare { {perennial} (sense 3)}, { {biennial} (sense 3)}.
annual	4.
	syl	an+nu:al
	pron	<1@nju*l>
	pos	n.
	def	a book, magazine, etc., published once every year.
annually	sub
	head	annual
	syl	an+nu+al+ly
	pos	adv.
annual parallax	0.
	syl	an+nu:al par+al+lax
	pos	n.
	def	See under { {parallax} (sense 2)}.
annual ring	0.
	syl	an+nu:al ring
	pos	n.
	def	a ring of wood indicating one year's growth, seen in the transverse section of stems and roots of woody plants growing in temperate climates.
annuitant	0.
	syl	an+nu:i+tant
	pron	<*1nju:it*nt>
	pos	n.
	def	a person in receipt of or entitled to an annuity.
annuity	ety	C15: from French annuit*'e, from Medieval Latin annuit*_as, from Latin annuus #7annual 
annuities	infl
	head	annuity
	syl	an+nu+i:ties.
	pos	n.
	mod	pl.
annuity	1.
	syl	an+nu+i:ty
	pron	<*1nju:iti>
	pos	n.
	def	a fixed sum payable at specified intervals, esp. annually, over a period, such as the recipient's life, or in perpetuity, in return for a premium paid either in instalments or in a single payment.
annuity	2.
	syl	an+nu+i:ty
	pron	<*1nju:iti>
	pos	n.
	def	the right to receive or the duty to pay such a sum.
annul	ety	C14: from Old French annuller, from Late Latin adnull*_are to bring to nothing, from Latin nullus not any; see #7null 
annuls	infl
	head	annul
	syl	an+nuls
	pos	vb.
	mod	tr.
annulling	infl
	head	annul
	syl	an+nul+ling
	pos	vb.
	mod	tr.
annulled	infl
	head	annul
	syl	an+nulled.
	pos	vb.
	mod	tr.
annul	0.
	syl	an+nul
	pron	<*1n^l>
	pos	vb.
	mod	tr.
	def	to make (something, esp. a law or marriage) void; cancel the validity of; abolish.
annullable	sub
	head	annul
	syl	an+1nul+la:ble
	pos	adj.
annular	ety	C16: from Latin annul*_aris, from annulus, *_anulus ring
annular	0.
	syl	an+nu+lar
	pron	<1@njul*>
	pos	adj.
	def	ring-shaped; of or forming a ring.
annularity	sub
	head	annular
	syl	an+nu+lar+i:ty
	pron	<2@nju1l@riti>
	pos	n.
annularly	sub
	head	annular
	syl	an+nu+lar+ly
	pos	adv.
annular eclipse	0.
	syl	an+nu+lar e:clipse
	pos	n.
	def	an eclipse of the sun in which the moon does not cover the entire disc of the sun, so that a ring of sunlight surrounds the darkened moon. Compare {total eclipse, partial eclipse}.
annular ligament	0.
	syl	an+nu+lar lig:a+ment
	pos	n.
	qual	Anatomy.
	def	any of various ligaments that encircle a part, such as the wrist, ankle, or trachea.
annulate	ety	C19: from Latin *_anul*_atus, from *_anulus a ring
annulate	0.
	syl	an+nu+late
	pron	<1@njulit>, <-2lAt>
	pos	adj.
	def	having, composed of, or marked with rings.
annulated	sub
	head	annulate
	syl	an+nu+2lat+ed
	pos	adj.
annulation	1.
	syl	an+nu+la+tion
	pron	<2@nju1lAS*n>
	pos	n.
	def	the formation of rings.
annulation	2.
	syl	an+nu+la+tion
	pron	<2@nju1lAS*n>
	pos	n.
	def	a ringlike formation or part.
annulet	ety	C16: from Latin *_anulus ring+-#7et 
annulet	1.
	syl	an+nu+let
	pron	<1@nju2lit>
	pos	n.
	qual	Architect.
	def	a moulding in the form of a ring, as at the top of a column adjoining the capital.
annulet	2.
	syl	an+nu+let
	pron	<1@nju2lit>
	pos	n.
	qual	Heraldry.
	def	a ring-shaped device on a shield; hollow roundel.
annulet	3.
	syl	an+nu+let
	pron	<1@nju2lit>
	pos	n.
	def	a little ring.
annulment	1.
	syl	an+nul+ment
	pron	<*1n^lm*nt>
	pos	n.
	def	a formal invalidation, as of a marriage, judicial proceeding, etc.
annulment	2.
	syl	an+nul+ment
	pron	<*1n^lm*nt>
	pos	n.
	def	the act of annulling.
annulose	ety	C19: from New Latin annul*_osus; see #7annulus 
annulose	0.
	syl	an+nu+lose
	pron	<1@nju2l*us>, <-2l*uz>
	pos	adj.
	usage	of earthworms, crustaceans, and similar animals
	def	having a body formed of a series of rings; segmented.
annulus	ety	C16: from Latin, variant of *_anulus ring
annuli	infl
	head	annulus
	or	annuluses
	syl	an+nu+li
	pron	<-2lI>
	pos	n.
	mod	pl.
annuluses	infl
	head	annulus
	or	annuli
	syl	an+nu+lus:es.
	pos	n.
	mod	pl.
annulus	1.
	syl	an+nu+lus
	pron	<1@njul*s>
	pos	n.
	def	the area between two concentric circles.
annulus	2.
	syl	an+nu+lus
	pron	<1@njul*s>
	pos	n.
	def	a ring-shaped part, figure, or space.
annunciate	0.
	syl	an+nun+ci+ate
	pron	<*1n^nsi2At>, <-Si->
	pos	vb.
	mod	tr.
	def	a less common word for {announce}. &- {an+@!nun+ci@.#!a+tion} &- {an+nun+ci@.a+tive} ($$#!n^ns$I$$t$Iv, -#s$$t$Iv) {an+nun+ci@.a+to@.ry} ($$#!n^ns$I$$t$$r$I, -#s$$-)
Annunciathe	1.
	head	Annunciation
	syl	An+nun+ci:a+the.
	qual	New Testament.
	def	the announcement of the Incarnation by the angel Gabriel to the Virgin Mary (Luke 1:26-38).
Annunciation	2.
	syl	An+nun+ci:a+tion
	pron	<*2n^nsi1AS*n>
	pos	n.
	def	Also called: {Annunciation Day}. the festival commemorating this, held on March 25 (Lady Day).
annunciator	1.
	syl	an+nun+ci:a+tor
	pron	<*1n^nsi2At*>
	pos	n.
	def	a device that gives a visual indication as to which of a number of electric circuits has operated, such as an indicator in a hotel showing in which room a bell has been rung.
annunciator	2.
	syl	an+nun+ci:a+tor
	pron	<*1n^nsi2At*>
	pos	n.
	def	a device giving an audible signal indicating the position of a train.
annunciator	3.
	syl	an+nun+ci:a+tor
	pron	<*1n^nsi2At*>
	pos	n.
	def	a less common word for {announcer}.
anni mirabiles	infl
	head	annus mirabilis
	syl	an:ni mi+ra+bi+les
	pron	<1@nI> <mi1r@bilEz>
	pos	n.
	mod	pl.
annus mirabilis	0.
	syl	an+nus mi+ra+bi+lis
	pron	Latin. <1@nus> <mi1r@bilis>
	pos	n.
	def	a year of wonders, catastrophes, or other notable events.
anoa	ety	from a native name in Celebes
anoa	0.
	syl	a:no:a
	pron	<*1n*u*>
	pos	n.
	def	the smallest of the cattle tribe having small straight horns and inhabiting the island of Celebes in Indonesia. Compare {tamarau}.
anode	ety	C19: from Greek anodos a way up, from hodos a way; alluding to the movement of the current to or from the positive pole &- an+od+al (e$I#!n$$$ud%@l) or an+od+ic ($$#!n$Ad$Ik) adj.
anode	1.
	syl	an+ode
	pron	<1@n*ud>
	pos	n.
	def	the positive electrode in an electrolytic cell.
anode	2.
	syl	an+ode
	pron	<1@n*ud>
	pos	n.
	def	Also called (esp. U.S.): {plate}. the positively charged electrode in an electronic valve or tube.
anode	3.
	syl	an+ode
	pron	<1@n*ud>
	pos	n.
	def	the negative terminal of a primary cell. Compare {cathode}.
anodise	alt
	head	anodize
	or	anodize
	syl	an:o+dise
	pron	<1@n*2dIz>
	pos	vb.
anodize	0.
	or	anodise
	syl	an:o+dize
	pron	<1@n*2dIz>
	pos	vb.
	def	to coat (a metal, such as aluminium or magnesium) with a protective oxide film by electrodeposition.
anodyne	ety	C16: from Latin an*_odynus, from Greek an*_odunos painless, from #7an -#7+ odun*_e pain
anodyne	1.
	syl	an:o+dyne
	pron	<1@n*2dIn>
	pos	n.
	def	a drug that relieves pain; analgesic.
anodyne	2.
	syl	an:o+dyne
	pron	<1@n*2dIn>
	pos	n.
	def	anything that alleviates mental distress. {~}
anodyne	3.
	syl	an:o+dyne
	pron	<1@n*2dIn>
	pos	n.
	def	capable of relieving pain or distress.
anoestrus	ety	C20: New Latin; see #7an -#7, oestrus 
anestrus	alt
	head	anoestrus
	or	anoestrus
	syl	an+es+trus
	pron	<@n1Estr*s>
	pos	n.
	qual	U.S.
anoestrus	0.
	or	anestrus
	syl	an+oes+trus
	pron	<@n1Estr*s>
	pos	n.
	def	a period of sexual inactivity between two periods of oestrus in many mammals.
anoestrous	sub
	head	anoestrus
	or	anestrous
	syl	an+1oes+trous
	pos	adj.
anestrous	sub
	head	anoestrus
	or	anoestrous
	syl	an+1es+trous
	pos	adj.
	qual	U.S.
anoint	ety	C14: from Old French enoint, from enoindre, from Latin inunguere, from #7in -%2#7+ unguere to smear with oil
anoint	1.
	syl	a:noint
	pron	<*1ncint>
	pos	vb.
	mod	tr.
	def	to smear or rub over with oil or an oily liquid.
anoint	2.
	syl	a:noint
	pron	<*1ncint>
	pos	vb.
	mod	tr.
	def	to apply oil to as a sign of consecration or sanctification in a sacred rite.
anointer	sub
	head	anoint
	syl	a:1noint+er
	pos	n.
anointment	sub
	head	anoint
	syl	a:1noint+ment
	pos	n.
anole	ety	C18 annolis, from French anolis, from Carib anoli 
anole	0.
	syl	a:nole
	pron	<*1n*ul>
	pos	n.
	def	any small arboreal tropical American insecti?!vorous lizards of the genus such as ({green anole}) : family (iguanas). They are able to change the colour of their skin. Also called: {American chameleon}.
anomalistic month	0.
	syl	a:nom:a+lis+tic month
	pos	n.
	def	the interval between two successive passages of the moon through perigee; 27.55455 days.
anomalistic year	0.
	syl	a:nom:a+lis+tic year
	pos	n.
	def	the interval between two successive passages of the earth through perihelion; 365.25964 mean solar days.
anomalous	ety	C17: from Late Latin an*_omalus, from Greek an*_omalos uneven, inconsistent, from #7an -#7+ homalos even, from homos one and the same
anomalous	0.
	syl	a:nom:a+lous
	pron	<*1nom*l*s>
	pos	adj.
	def	deviating from the normal or usual order, type, etc.; irregular, abnormal, or incongruous.
anomalously	sub
	head	anomalous
	syl	a:1nom:a+lous+ly
	pos	adv.
anomalies	infl
	head	anomaly
	syl	a:nom:a+lies.
	pos	n.
	mod	pl.
anomaly	1.
	syl	a:nom:a+ly
	pron	<*1nom*li>
	pos	n.
	def	something anomalous.
anomaly	2.
	syl	a:nom:a+ly
	pron	<*1nom*li>
	pos	n.
	def	deviation from the normal or usual order, type, etc.; irregu?!larity.
anomaly	3.
	syl	a:nom:a+ly
	pron	<*1nom*li>
	pos	n.
	qual	Astronomy.
	def	the angle between a planet, the sun, and the previous perihelion of the planet.
anomalistic	sub
	head	anomaly
	syl	a:2nom:a+1lis+tic
	pos	adj.
anomalistically	sub
	head	anomaly
	syl	a:2nom:a+1lis+ti+cal+ly
	pos	adv.
anomie	ety	from Greek anomia lawlessness, from #7a -%1#7+ nomos law
anomy	alt
	head	anomie
	or	anomie
	syl	an+o:my
	pron	<1@n*umi>
	pos	n.
anomie	0.
	or	anomy
	syl	an+o:mie
	pron	<1@n*umi>
	pos	n.
	qual	Sociol.
	def	lack of social or moral standards in an individual or society.
anomic	sub
	head	anomie
	syl	a:nom+ic
	pron	<*1nomik>
	pos	adj.
anon	ety	Old English on *_ane, literally: in one, that is, immediately
anon	1.
	syl	a:non
	pron	<*1non>
	pos	adv.
	qual	Archaic or literary.
	def	in a short time; soon.
ever and anon	2.
	head	anon
	syl	ever and anon.
	qual	Archaic or literary.
	def	now and then.
anon	0.
	syl	anon.
	qual	abbrev. for
	def	anonymous.
anonym	1.
	syl	an:o+nym
	pron	<1@n*nim>
	pos	n.
	def	a less common word for {pseudo?!nym}.
anonym	2.
	syl	an:o+nym
	pron	<1@n*nim>
	pos	n.
	def	an anonymous person or publication.
anonymous	ety	C17: via Late Latin from Greek an*_onumos, from #7an -#7+ onoma name
anonymous	1.
	syl	a:non:y+mous
	pron	<*1nonim*s>
	pos	adj.
	def	from or by a person, author, etc., whose name is unknown or withheld.
	exam	1	an anonymous letter.
anonymous	2.
	syl	a:non:y+mous
	pron	<*1nonim*s>
	pos	adj.
	def	having no known name.
anonymous	3.
	syl	a:non:y+mous
	pron	<*1nonim*s>
	pos	adj.
	def	lacking individual characteristics; unexceptional.
anonymity	sub
	head	anonymous
	syl	an:o+nym+i:ty
	pron	<2@n*?!1nimiti>
	pos	n.
anonymously	sub
	head	anonymous
	syl	a:1non:y+mous+ly
	pos	adv.
anopheles	ety	C19: via New Latin from Greek an*_ophel*_es useless, from #7an -#7+ *_ophelein to help, from ophelos help
anopheles	infl
	syl	a:noph:e+les.
	pos	n.
	mod	pl.
anopheles	0.
	syl	a:noph:e+les
	pron	<*1nofi2lEz>
	pos	n.
	def	any of various mosquitoes constituting the genus some species of which transmit the malaria parasite to man.
anorak	ety	from Eskimo *'anor*^aq 
anorak	0.
	syl	a:no+rak
	pron	<1@n*2r@k>
	pos	n.
	def	a warm waterproof hip-length jacket usually with a hood, originally worn in polar regions, but now worn for any outdoor activity.
anorexia	ety	C17: via New Latin from Greek, from #7an -#7+ orexis appetite
anorexia	0.
	syl	an:o+rex:i:a
	pron	<2@no1reksi*>
	pos	n.
	def	loss of appetite.
anorexia nervosa	0.
	syl	an:o+rex:i:a ner+vo+sa
	pron	<nR:1v*us*>
	pos	n.
	qual	Psychiatry.
	def	a psychological disorder characterized by fear of becoming fat and refusal of food, leading to debility and even death.
anorthic	ety	C19: from #7an -#7+ortho -#7+ -#7ic 
anorthic	0.
	syl	an+or+thic
	pron	<@n1c:Tik>
	pos	adj.
	def	another word for {triclinic}.
anorthite	ety	C19: from #7an -#7+ortho -#7+ -#7ite %1
anorthite	0.
	syl	an+or+thite
	pron	<@n1c:TIt>
	pos	n.
	def	a rare feldspar mineral of the plagioclase series that consists of an aluminium silicate of calcium and occurs in volcanic regions, esp. in Italy and Japan. Formula: CaAl\2Si\2O\8.
anorthitic	sub
	head	anorthite
	syl	an+or+thit+ic
	pron	<2@nc:1Titik>
	pos	adj.
anorthosite	ety	C19: from French anorthose (see #7an -#7, ortho -)#7+ -#7ite %1
anorthosite	0.
	syl	an+or+tho+site
	pron	<@n1c:T*2sIt>
	pos	n.
	def	a coarse-grained plutonic igneous rock consisting almost entirely of plagioclase feldspar.
anosmia	ety	C19: from New Latin, from #7an -#7+ Greek osm*_e smell, from ozein to smell
anosmia	0.
	syl	an+os+mi:a
	pron	<@n1ozmi*>, <-1os->
	pos	n.
	qual	Pathol.
	def	loss of the sense of smell, usually as the result of a lesion of the olfactory nerve, disease in another organ or part, or obstruction of the nasal passages.
anosmatic	sub
	head	anosmia
	or	anosmic
	syl	an+os+mat+ic
	pron	<2@noz1m@tik>
	pos	adj.
anosmic	sub
	head	anosmia
	or	anosmatic
	syl	an+1os+mic
	pos	adj.
another	1.a.
	syl	an+oth+er
	pron	<*1n^D*>
	pos	determiner.
	def	one more; an added.
	exam	1	another chance.
another	1.b.
	syl	an+oth+er
	pron	<*1n^D*>
	pos	determiner.
	usage	as pronoun
	exam	1	help yourself to another.
another	2.a.
	syl	an+oth+er
	pron	<*1n^D*>
	pos	determiner.
	def	a different; alternative.
	exam	1	another era from ours.
another	2.b.
	syl	an+oth+er
	pron	<*1n^D*>
	pos	determiner.
	usage	as pronoun
	exam	1	to try one path, then another.
another	3.a.
	syl	an+oth+er
	pron	<*1n^D*>
	pos	determiner.
	def	a different example of the same sort.
	exam	1	another Beethoven.
another	3.b.
	syl	an+oth+er
	pron	<*1n^D*>
	pos	determiner.
	usage	as pronoun
	exam	1	we got rid of one loafer, but I think this new man's another.
another place	4.
	head	another
	syl	another place.
	def	the other House of Parliament (used in the House of Commons to refer to the House of Lords and vice versa).
AN Other	0.
	syl	A.N. Oth+er
	pos	n.
	qual	Brit.
	def	an unnamed person: used in team lists, etc., to indicate a place that remains to be filled.
Jean	infl
	head	Anouilh
	syl	Jean
	pron	<Z?~a>
	pos	n.
Anouilh	0.
	syl	A:nouilh
	pron	French <a1nuj>
	pos	n.
	def	born 1910, French dramatist, noted for his reinterpretations of Greek myths: his works include (1942), (1944), and (1959).
anoxaemia	ety	C19: from New Latin, from #7an -#7+ox (#7ygen) #7+ -#7aemia  &- @!an+ox+#!ae@.mic or U.S. @!an+ox+#!e@.mic adj.
anoxemia	alt
	head	anoxaemia
	or	anoxaemia
	syl	an+ox+e:mi:a
	pron	<2@nok1sEmi*>
	pos	n.
	qual	U.S.
anoxaemia	0.
	or	anoxemia
	syl	an+ox+ae:mi:a
	pron	<2@nok1sEmi*>
	pos	n.
	def	a deficiency in the amount of oxygen in the arterial blood.
anoxia	ety	C20: from #7an -#7+ox (#7ygen) +-#7ia 
anoxia	1.
	syl	an+ox:i:a
	pron	<@n1oksi*>
	pos	n.
	def	lack or absence of oxygen.
anoxia	2.
	syl	an+ox:i:a
	pron	<@n1oksi*>
	pos	n.
	def	a deficiency of oxygen in tissues and organs. Compare {hypoxia}.
anoxic	sub
	head	anoxia
	syl	an+1ox+ic
	pos	adj.
ansate	ety	C19: from Latin ans*_atus, from ansa handle
ansate	0.
	syl	an+sate
	pron	<1@nsAt>
	pos	adj.
	def	having a handle or handle-like part.
Anschluss	ety	German: from anschliessen to join
Anschluss	0.
	syl	An+schluss
	pron	<1@nSlus>
	pos	n.
	def	a political or economic union, esp. the annexation of Austria by Nazi Germany (1938).
Saint	infl
	head	Anselm
	syl	Saint.
	pos	n.
Anselm	0.
	syl	An:selm
	pron	<1@nselm>
	pos	n.
	def	1033-1109, Italian Benedictine monk; archbishop of Canterbury (1093-1109): one of the found?!ers of scholasticism; author of . Feast day: Aug. 21.
anserine	ety	C19: from Latin anser*_inus, from anser goose
anserous	alt
	head	anserine
	or	anserine
	syl	an+ser+ous
	pron	<1@ns*r*s>
	pos	adj.
anserine	1.
	or	anserous
	syl	an+ser+ine
	pron	<1@ns*2rIn>, <-rin>
	pos	adj.
	def	of or resembling a goose.
anserine	2.
	or	anserous
	syl	an+ser+ine
	pron	<1@ns*2rIn>, <-rin>
	pos	adj.
	def	of, relating to, or belonging to the subfamily which includes geese, swans, and certain ducks: family order
anserine	3.
	or	anserous
	syl	an+ser+ine
	pron	<1@ns*2rIn>, <-rin>
	pos	adj.
	def	silly; foolish.
Ernest	infl
	head	Ansermet
	syl	Er:nest
	pron	<er1nest>
	pos	n.
Ansermet	0.
	syl	An:ser:met
	pron	French <?~aser1me>
	pos	n.
	def	1883-1969, Swiss orchestral conductor; principal conductor of Diaghilev's Ballet Russe.
Anshan	1.
	syl	An+shan
	pron	<2@n1S@n>
	pos	n.
	def	a city in NE China, in Liaoning province. Pop.: 1050000 (1970 est.).
Anshan	2.
	syl	An+shan
	pron	<2@n1S@n>
	pos	n.
	def	an ancient city and region in Persia, associated with Elam.
answer	ety	Old English andswaru an answer; related to Old Frisian ondser, Old Norse andsvar; see #7swear 
answer	1.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	def	a reply, either spoken or written, as to a question, request, letter, or article.
answer	2.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	def	a reaction or response in the form of an action.
	exam	1	drunkenness was his answer to disappointment.
answer	3.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	def	a solution, esp. of a mathematical problem.
answer	4.a.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	def	a party's written reply to his opponent's interrogatories.
answer	4.b.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	usage	in divorce law
	def	the respondent's written reply to the petition.
answer	5.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	def	a musical phrase that follows the subject of a fugue, reproducing it a fifth higher or a fourth lower. {~}
answer	6.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	mod	when; tr.
	usage	may take a clause as object
	def	to reply or respond (to) by word or act.
	exam	1	to answer a question;
	exam	2	he answered;
	exam	3	to answer the door;
	exam	4	he answered that he would come.
answer	7.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	mod	tr.
	def	to reply correctly to; solve or attempt to solve.
	exam	1	I could answer only three questions.
answer	8.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	mod	intr.
	usage	usually foll. by to
	def	to respond or react (to a stimulus, command, etc.).
	exam	1	the steering answers to the slightest touch.
answer	9.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	mod	tr.
	def	to pay off (a debt, obligation, etc.); discharge.
answer	10.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	mod	when; intr.
	usage	often foll. by for
	def	to meet the requirements (of); be satisfactory (for); serve the purpose (of).
	exam	1	this will answer his needs;
	exam	2	this will answer for a chisel.
answer	11.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	mod	when; intr.
	usage	foll. by to
	def	to match or correspond (esp. in the phrase {answer} (or {answer to) the description) }.
answer	12.
	syl	an+swer
	pron	<1a:ns*>
	pos	n.
	mod	tr.
	def	to give a defence or refutation of (a charge) or in (an argument).
answerable	1.
	syl	an+swer+a:ble
	pron	<1a:ns*r*bL>
	pos	adj.
	usage	postpositive; foll. by for or to
	def	responsible or accountable.
	exam	1	answerable for someone's safety;
	exam	2	answerable to one's boss.
answerable	2.
	syl	an+swer+a:ble
	pron	<1a:ns*r*bL>
	pos	adj.
	def	able to be answered.
answerability	sub
	head	answerable
	or	answerableness
	syl	an+swer+a:1bil+i:ty
	pos	n.
answerableness	sub
	head	answerable
	or	answerability
	syl	an+swer+a:ble+ness
	pos	n.
answerably	sub
	head	answerable
	syl	an+swer+a:bly
	pos	adv.
answer back	0.
	syl	an+swer back
	pos	vb. adv.
	def	to reply rudely to (a person, esp. someone in authority) when one is expected to remain silent.
answer for	1.
	syl	an+swer for
	pos	vb. prep.
	mod	intr.
	def	to be liable or responsible for (a person's actions, behaviour, etc.).
answer for	2.
	syl	an+swer for
	pos	vb. prep.
	mod	intr.
	def	to vouch for or speak on behalf of (a person).
answer for	3.
	syl	an+swer for
	pos	vb. prep.
	mod	intr.
	def	to suffer or atone for (one's wrongdoing).
ant	ety	Old English *_@amette; related to Old High German *_ameiza, Old Norse meita; see #7emmet 
ant	1.
	syl	ant
	pron	<@nt>
	pos	n.
	def	any small social insect of the widely distributed hymenopterous family typically living in highly organized colonies of winged males, wingless sterile females (workers), and fertile females (queens), which are winged until after mating. See also {army ant, fire ant, slave ant, wood ant}. Related adj.: {formic}.
white ant	2.
	head	ant
	syl	white ant.
	def	another name for a {termite}.
have ants in one's pants	3.
	head	ant
	syl	have ants in one's pants.
	qual	Slang.
	def	to be restless or impatient.
antlike	sub
	head	ant
	syl	ant+like
	pos	adj.
ant	0.
	syl	ant.
	qual	abbrev. for
	def	antonym.
an't	1.
	syl	an't
	pron	<a:nt>
	qual	Chiefly Brit.
	def	a rare variant spelling of {aren't}.
an't	2.
	syl	an't
	pron	<Ant>
	qual	Chiefly Brit.; Dialect.
	def	a variant spelling of {ain't}.
ant-	0.
	syl	ant-
	pos	prefix.
	def	variant of {anti-}.
	exam	1	antacid.
-ant	ety	from Latin -ant, ending of present participles of the first conjugation
-ant	0.
	syl	-ant
	usage	suffix forming adjectives and nouns.
	def	causing or perform?!ing an action or existing in a certain condition; the agent that performs an action.
	exam	1	pleasant;
	exam	2	claimant;
	exam	3	deodorant;
	exam	4	protestant;
	exam	5	servant.
antae	infl
	head	anta
	syl	an:tae
	pron	<1@ntE>
	pos	n.
	mod	pl.
anta	0.
	syl	an:ta
	pron	<1@nt*>
	pos	n.
	qual	Architect.
	def	a pilaster attached to the end of a side wall or sometimes to the side of a doorway.
Antabuse	0.
	syl	An+ta+buse
	pron	<1@nt*2bju:s>
	pos	n.
	qual	Trademark.
	def	a drug used in the treatment of alcoholism that acts by inducing nausea following ingestion of alcohol; tetraethylthiuram disulphide.
antacid	1.
	syl	ant+ac:id
	pron	<@nt1@sid>
	pos	n.
	def	a substance used to treat acidity, esp. in the stomach.
antacid	2.
	syl	ant+ac:id
	pron	<@nt1@sid>
	pos	adj.
	def	having the properties of this substance.
Antaeus	0.
	syl	An:tae:us
	pron	<@n1tE*s>
	pos	n.
	qual	Greek myth.
	def	an African giant who was invincible as long as he touched the ground, but was lifted into the air by Hercules and crushed to death.
antagonism	1.
	syl	an+tag:o+nism
	pron	<@n1t@g*2niz*m>
	pos	n.
	def	openly expressed and usually mutual opposition.
antagonism	2.
	syl	an+tag:o+nism
	pron	<@n1t@g*2niz*m>
	pos	n.
	def	the inhibiting or nullifying action of one substance or organism on another.
antagonism	3.
	syl	an+tag:o+nism
	pron	<@n1t@g*2niz*m>
	pos	n.
	qual	Physiol.
	def	the normal opposition between certain muscles.
antagonist	1.
	syl	an+tag:o+nist
	pron	<@n1t@g*nist>
	pos	n.
	def	an opponent or adversary, as in a contest, drama, sporting event, etc.
antagonist	2.
	syl	an+tag:o+nist
	pron	<@n1t@g*nist>
	pos	n.
	def	any muscle that opposes the action of another. Compare {agonist}.
antagonist	3.
	syl	an+tag:o+nist
	pron	<@n1t@g*nist>
	pos	n.
	def	a drug that neutralizes or counteracts the effects of another drug. Compare { {synergist} (sense 1)}.
antagonistic	1.
	syl	an+tag:o+nis+tic
	pron	<@n2t@g*1nistik>
	pos	adj.
	def	in active opposition.
antagonistic	2.
	syl	an+tag:o+nis+tic
	pron	<@n2t@g*1nistik>
	pos	adj.
	def	mutually opposed.
antagonistically	sub
	head	antagonistic
	syl	an+2tag:o+1nis+ti+cal+ly
	pos	adv.
antagonize	ety	C17: from Greek antag*_onizesthai, from #7anti -#7+ ag*_onizesthai to strive, from ag*_on contest
antagonise	alt
	head	antagonize
	or	antagonize
	syl	an+tag:o+nise
	pron	<@n1t@g*2nIz>
	pos	vb.
	mod	tr.
antagonize	1.
	or	antagonise
	syl	an+tag:o+nize
	pron	<@n1t@g*2nIz>
	pos	vb.
	mod	tr.
	def	to make hostile; annoy or irritate.
antagonize	2.
	or	antagonise
	syl	an+tag:o+nize
	pron	<@n1t@g*2nIz>
	pos	vb.
	mod	tr.
	def	to act in opposition to or counteract.
antagonizable	sub
	head	antagonize
	or	antagonisable
	syl	an+1tag:o+2niz+a:ble
	pos	adj.
antagonisable	sub
	head	antagonize
	or	antagonizable
	syl	an+1tag:o+2nis+a:ble
	pos	adj.
antagonization	sub
	head	antagonize
	or	antagonisation
	syl	an+2tag:o+ni+1za+tion
	pos	n.
antagonisation	sub
	head	antagonize
	or	antagonization
	syl	an+2tag:o+ni+1sa+tion
	pos	n.
Antakiya	0.
	syl	An+ta+ki+ya
	pron	<2@nta:1kEj*>
	pos	n.
	def	the Arabic name for {Antioch}.
Antakya	0.
	syl	An+ta+kya
	pron	<an1takja>
	pos	n.
	def	the Turkish name for {Antioch}.
antalkalis	infl
	head	antalkali
	or	antalkalies
	syl	ant+al+ka+lis
	pos	n.
	mod	pl.
antalkalies	infl
	head	antalkali
	or	antalkalis
	syl	ant+al+ka+lies.
	pos	n.
	mod	pl.
antalkali	0.
	syl	ant+al+ka+li
	pron	<@nt1@lk*2lI>
	pos	n.
	def	a substance that neutralizes alkalis, esp. one used to treat alkalosis.
antalkaline	sub
	head	antalkali
	syl	ant+al+ka+line
	pron	<@nt1@lk*2lIn>, <-lin>
	pos	adj. n.
Antalya	0.
	syl	An+tal+ya
	pron	Turkish <an1talja>
	pos	n.
	def	a port in SW Turkey, on the {Gulf of Antalya}. Pop.: 130774 (1975).
Antananarivo	0.
	syl	An+ta+na+na+ri+vo
	pron	<2@nt*2n@n*1rEv*u>
	pos	n.
	def	another name for {Tananarive}.
Antarctic	ety	C14: via Latin from Greek antarktikos; see #7anti -#7, arctic 
the	1.
	head	Antarctic
	syl	the.
	def	Also called: {Antarctic Zone}. Antarctica and the surrounding waters.
Antarctic	2.
	syl	Ant+arc+tic
	pron	<@nt1a:ktik>
	pos	adj.
	def	of or relating to the south polar regions.
Antarctica	0.
	syl	Ant+arc+ti+ca
	pron	<@nt1a:ktik*>
	pos	n.
	def	a continent around the South Pole: consists of an ice-covered plateau, 1800-3000 m (6000 ft. to 10000 ft.) above sea level, and mountain ranges rising to 4500 m (15000 ft.) with some volcanic peaks; average temperatures all below freezing and human settlement is confined to research stations.
Antarctic Archipelago	0.
	syl	Ant+arc+tic Ar+chi+pel:a+go
	pos	n.
	def	the former name of the {Palmer Archipelago}.
Antarctic Circle	0.
	syl	Ant+arc+tic Cir+cle
	pos	n.
	def	the imaginary circle around the earth, parallel to the equator, at latitude 66?% 32@' S.
Antarctic Ocean	0.
	syl	Ant+arc+tic O:cean
	pos	n.
	def	the sea surrounding Antarctica, consist?!ing of the most southerly parts of the Pacific, Atlantic, and Indian Oceans.
Antarctic Peninsula	0.
	syl	Ant+arc+tic Pen+in+su+la
	pos	n.
	def	the largest peninsula of Antarctica, between the Weddell Sea and the Pacific: consists of Graham Land in the north and the Palmer Peninsula in the south. Former name (until 1964): {Palmer Peninsula}.
Antares	ety	from Greek Antar*_es, literally: simulating Mars (in colour), from #7anti -#7+ Ar*_es Mars
Antares	0.
	syl	An+tar+es
	pron	<@n1te*rEz>
	pos	n.
	def	the brightest star in the constellation Scorpius. It is a variable binary star whose main component, a red supergiant, is associated with a fainter green component. Visual magnitude: 1.2 (red), 6.8 (green); spectral type: MO (red); distance: 250 light years.
ant bear	0.
	syl	ant bear
	pos	n.
	def	another name for {aardvark} or {giant anteater}. See { {anteater} (sense 1)}.
ant bird	0.
	syl	ant bird
	pos	n.
	def	any of various dull-coloured South American passerine birds of the family such as (spotted ant bird), that typically feed on ants. Also called: {bush-shrike, ant thrush}.
ant cow	0.
	syl	ant cow
	pos	n.
	def	an insect, esp. an aphid, that excretes a sweet honey-like substance that is collected and eaten by ants.
ante	1.
	syl	an:te
	pron	<1@nti>
	pos	n.
	def	the gaming stake put up before the deal in poker by the players.
ante	2.
	syl	an:te
	pron	<1@nti>
	pos	n.
	qual	Informal, chiefly U.S.
	def	a sum of money representing a person's share, as in a syndicate.
antes	infl
	head	ante
	syl	an:tes
	pos	vb.
anteing ted	infl
	head	ante
	or	anteed
	syl	an:te+ing; +ted
	pos	vb.
anteed	infl
	head	ante
	or	anteing ted
	syl	an:teed.
	pos	vb.
ante	3.
	syl	an:te
	pron	<1@nti>
	pos	vb.
	def	to place (one's stake) in poker.
ante	4.
	syl	an:te
	pron	<1@nti>
	pos	vb.
	qual	Informal, chiefly U.S.
	usage	usually foll. by up
	def	to pay.
ante-	ety	from Latin
ante-	0.
	syl	an:te-
	pos	prefix.
	def	before in time or position; previous to; in front of.
	exam	1	antedate;
	exam	2	antechamber.
anteater	1.
	syl	ant+eat:er
	pron	<1@nt2Et*>
	pos	n.
	def	any toothless edentate mammal of the family of Central and South America, esp. (or ({giant anteater} or {ant bear}) , having a long tubular snout used for eating termites. See also {tamandua}.
scaly anteater	2.
	head	anteater
	syl	scaly anteater.
	def	another name for {pangolin}.
spiny anteater	3.
	head	anteater
	syl	spiny anteater.
	def	another name for {echidna}.
banded anteater	4.
	head	anteater
	syl	banded anteater.
	def	another name for {numbat}.
antebellum	ety	Latin ante bellum, literally: before the war
antebellum	0.
	syl	an:te+bel+lum
	pron	<2@nti1bel*m>
	pos	adj.
	def	of or during the period before a war, esp. the American Civil War.
	exam	1	the antebellum South.
antecede	ety	C17: from Latin antec*_edere, from c*_edere to go
antecede	0.
	syl	an:te+cede
	pron	<2@nti1sEd>
	pos	vb.
	mod	tr.
	def	to go before, as in time, order, etc.; precede.
antecedence	1.
	syl	an:te+ced+ence
	pron	<2@nti1sEdNs>
	pos	n.
	def	precedence; priority.
antecedence	2.
	syl	an:te+ced+ence
	pron	<2@nti1sEdNs>
	pos	n.
	qual	Astronomy.
	def	retrograde motion.
antecedent	1.
	syl	an:te+ced+ent
	pron	<2@nti1sEdNt>
	pos	n.
	def	an event, circumstance, etc., that happens before another.
antecedent	2.
	syl	an:te+ced+ent
	pron	<2@nti1sEdNt>
	pos	n.
	qual	Grammar.
	def	a word or phrase to which a pronoun refers. In the sentence @6People who live in glass houses shouldn't throw stones,@9 is the antecedent of
antecedent	3.
	syl	an:te+ced+ent
	pron	<2@nti1sEdNt>
	pos	n.
	qual	Logic.
	def	the first proposition in a conditional, such as in
antecedent	4.
	syl	an:te+ced+ent
	pron	<2@nti1sEdNt>
	pos	n.
	qual	Maths.
	def	an obsolescent name for {numerator} (sense 1).
antecedent	5.
	syl	an:te+ced+ent
	pron	<2@nti1sEdNt>
	pos	adj.
	def	preceding in time or order; prior.
antecedents	1.
	syl	an:te+ced+ents
	pron	<2@nti1si:dNts>
	pos	n.
	mod	pl.
	def	ancestry.
antecedents	2.
	syl	an:te+ced+ents
	pron	<2@nti1si:dNts>
	pos	n.
	mod	pl.
	def	a person's past history.
antechamber	ety	C17: from Old French, from Italian anticamera; see #7ante -#7, chamber 
antechamber	0.
	syl	an:te+cham+ber
	pron	<1@nti2CAmb*>
	pos	n.
	def	another name for {anteroom}.
antechoir	0.
	syl	an:te+choir
	pron	<1@nti2kwI*>
	pos	n.
	def	the part of a church in front of the choir, usually enclosed by screens, tombs, etc.
antedate	1.
	syl	an:te+date
	pron	<1@nti2dAt>, <2@nti1dAt>
	pos	vb.
	mod	tr.
	def	to be or occur at an earlier date than.
antedate	2.
	syl	an:te+date
	pron	<1@nti2dAt>, <2@nti1dAt>
	pos	vb.
	mod	tr.
	def	to affix a date to (a document, etc.) that is earlier than the actual date.
antedate	3.
	syl	an:te+date
	pron	<1@nti2dAt>, <2@nti1dAt>
	pos	vb.
	mod	tr.
	def	to assign a date to (an event, etc.) that is earlier than its previously assigned date.
antedate	4.
	syl	an:te+date
	pron	<1@nti2dAt>, <2@nti1dAt>
	pos	vb.
	mod	tr.
	def	to cause to occur sooner. {~} (#!@ant$I@!de$It)
antedate	5.
	syl	an:te+date
	pron	<1@nti2dAt>, <2@nti1dAt>
	pos	vb.
	mod	tr.
	def	an earlier date.
antediluvian	ety	C17: from #7ante -#7+ Latin d*_iluvium flood
antediluvian	1.
	syl	an:te+di+lu+vi:an
	pron	<2@ntidi1lu:vi*n>, <-dI->
	pos	adj.
	def	belonging to the ages before the biblical Flood (Genesis 7, 8).
antediluvian	2.
	syl	an:te+di+lu+vi:an
	pron	<2@ntidi1lu:vi*n>, <-dI->
	pos	adj.
	def	old-fashioned or antiquated.
antediluvian	3.
	syl	an:te+di+lu+vi:an
	pron	<2@ntidi1lu:vi*n>, <-dI->
	pos	n.
	def	an antediluvian person or thing.
antefix	ety	C19: from Latin antefixa (things) fastened in front, from f*_igere to #7fix 
antefixes	infl
	head	antefix
	or	antefixa
	syl	an:te+fix:es
	pron	<-2fiks*>
	pos	n.
	mod	pl.
antefixa	infl
	head	antefix
	or	antefixes
	syl	an:te+fix:a
	pron	<-2fiks*>
	pos	n.
	mod	pl.
antefix	0.
	syl	an:te+fix
	pron	<1@nti2fiks>
	pos	n.
	def	a carved ornament at the eaves of a roof to hide the joint between the tiles.
antefixal	sub
	head	antefix
	syl	an:te+fix+al
	pron	<2@nti1fiks*l>
	pos	adj.
antelope	ety	C15: from Old French antelop, from Medieval Latin antalopus, from Late Greek antholops a legendary beast
antelopes	infl
	head	antelope
	or	antelope
	syl	an:te+lopes
	pos	n.
	mod	pl.
antelope	infl
	or	antelopes
	syl	an:te+lope.
	pos	n.
	mod	pl.
antelope	1.
	syl	an:te+lope
	pron	<1@nti2l*up>
	pos	n.
	def	any bovid mammal of the subfamily of Africa and Asia. They are typically graceful, having long legs and horns, and include the gazelles, springbok, impala, gerenuk, blackbuck, and dik-diks.
antelope	2.
	syl	an:te+lope
	pron	<1@nti2l*up>
	pos	n.
	def	any of various similar bovids of Africa and Asia.
American antelope	3.
	head	antelope
	syl	American antelope.
	def	another name for {pronghorn}.
antemeridian	ety	C17: from Latin antemer*_idi*_anus; see #7ante -#7, meridian 
antemeridian	0.
	syl	an:te+me+rid+i:an
	pron	<2@ntim*1ridi*n>
	pos	adj.
	def	before noon; in the morning.
ante meridiem	ety	Latin, from #7ante -#7+ mer*_idi*_es midday
ante meridiem	0.
	syl	an:te me+rid:i+em
	pron	<1@nti> <m*1ridi*m>
	def	the full form of {a.m}.
ante-mortem	ety	Latin
ante-mortem	0.
	syl	an:te-mor:tem
	pos	adj. adv.
	usage	esp. in legal or medical contexts
	def	before death.
antenatal	1.
	syl	an:te+na+tal
	pron	<2@nti1nAtL>
	pos	adj.
	def	occurring or present before birth; during pregnancy.
antenatal	2.
	syl	an:te+na+tal
	pron	<2@nti1nAtL>
	pos	n.
	def	Also called: {prenatal}. an examination during pregnancy.
antenatally	sub
	head	antenatal
	syl	an:te+1na+tal+ly
	pos	adv.
antenna	ety	C17: from Latin: sail yard, of obscure origin &- an+#!ten+nal or an+#!ten+na@.ry adj.
antennae	infl
	head	antenna
	syl	an+ten+nae
	pron	<-nE)). onA of a pair of mobilA ap?!pAndagAs on thA hAads of insActs, crustacAans, Atc., that arA oftAn whiplikA and rAspond to touch and tastA but may bA spAcializAd for swimming or attachmAnt>
	pos	n.
	mod	pl.
antennas	infl
	head	antenna
	syl	an+ten+nas
	pos	n.
	mod	pl.
antenna	2.
	syl	an+ten+na
	pron	<@n1ten*>
	pos	n.
	def	another name for { {aerial} (sense 7)}.
antennule	ety	C19: from French, diminutive of #7antenna 
antennule	0.
	syl	an+ten+nule
	pron	<@n1tenju:l>
	pos	n.
	def	one of a pair of small mobile appendages on the heads of crustaceans in front of the antennae, usually having a sensory function.
antependium	ety	C17: from Medieval Latin, from Latin #7ante -#7+ pend*_ere to hang
antependia	infl
	head	antependium
	syl	an:te+pen+di:a
	pron	<-di*>
	pos	n.
	mod	pl.
antependium	0.
	syl	an:te+pen+di:um
	pron	<2@nti1pendi*m>
	pos	n.
	def	a covering hung over the front of an altar.
antepenult	ety	C16: shortened from Latin (syllaba) antepaenultima; see #7ante -, #7penult 
antepenult	0.
	syl	an:te+pe:nult
	pron	<2@ntipi1n^lt>
	pos	n.
	def	the third last syllable in a word.
antepenultimate	1.
	syl	an:te+pe:nul+ti+mate
	pron	<2@ntipi1n^ltimit>
	pos	adj.
	def	third from last.
antepenultimate	2.
	syl	an:te+pe:nul+ti+mate
	pron	<2@ntipi1n^ltimit>
	pos	n.
	def	anything that is third from last.
anterior	ety	C17: from Latin, comparative of ante before &- an+te@.ri+or+i@.ty (@an@!t$I$$r$I?!#!$Ar$It$I) n.
anterior	1.
	syl	an:te+ri+or
	pron	<@n1ti*ri*>
	pos	adj.
	def	situated at or towards the front.
anterior	2.
	syl	an:te+ri+or
	pron	<@n1ti*ri*>
	pos	adj.
	def	earlier in time.
anterior	3.
	syl	an:te+ri+or
	pron	<@n1ti*ri*>
	pos	adj.
	qual	Zoology.
	def	of or near the head end.
anterior	4.
	syl	an:te+ri+or
	pron	<@n1ti*ri*>
	pos	adj.
	usage	Botany. of part of a flower or leaf
	def	situated farthest away from the main stem.
anterior	xref
	syl	an:te+ri+or
	pron	<@n1ti*ri*>
	pos	adj.
	def	Compare {posterior}.
anteroom	0.
	syl	an:te+room
	pron	<1@nti2ru:m>, <-2rum>
	pos	n.
	def	a room giving entrance to a larger room, often used as a waiting room.
antetype	0.
	syl	an:te+type
	pron	<1@nti2tIp>
	pos	n.
	def	an earlier form; prototype.
anteversion	0.
	syl	an:te+ver+sion
	pron	<2@nti1vR:S*n>
	pos	n.
	def	abnormal forward tilting of a bodily organ, esp. the uterus.
antevert	ety	C17: from Latin antevertere to go in front, from vertere to turn
antevert	0.
	syl	an:te+vert
	pron	<2@nti1vR:t>
	pos	vb.
	mod	tr.
	def	to displace (an organ or part) by tilting forward.
anthelion	ety	C17: from Late Greek, from anth*_elios opposite the sun, from #7ante -#7+ h*_elios sun
anthelia	infl
	head	anthelion
	syl	ant+he+li:a
	pron	<-li*>
	pos	n.
	mod	pl.
anthelion	1.
	syl	ant+he+li+on
	pron	<@nt1hEli*n>, <@n1TE->
	pos	n.
	def	a faint halo sometimes seen in polar or high altitude regions around the shadow of an object cast onto a thick cloud bank or fog.
anthelion	2.
	syl	ant+he+li+on
	pron	<@nt1hEli*n>, <@n1TE->
	pos	n.
	def	a white spot occasionally appearing on the parhelic circle at the same height as and opposite to the sun.
antihelix	alt
	head	anthelix
	or	anthelix
	syl	an:ti+he+lix
	pron	<-1hElisEz>
	pos	n.
anthelices	infl
	head	anthelix
	or	anthelixes
	syl	ant+hel:i+ces
	pron	<-1hElisEz>
	pos	n.
	mod	pl.
anthelixes	infl
	head	anthelix
	or	anthelices
	syl	ant+he+lix:es.
	pos	n.
	mod	pl.
anthelix	0.
	or	antihelix
	syl	ant+he+lix
	pron	<@nt1hEliks>, <@n1Ti:->
	pos	n.
	qual	Anatomy.
	def	a prominent curved fold of cartilage just inside the outer rim of the external ear.
anthelminthic	alt
	head	anthelmintic
	or	anthelmintic
	syl	an+thel+min+thic
	pron	<2@nTel?!1minTik>
	pos	n.
anthelmintic	0.
	or	anthelminthic
	syl	an+thel+min+tic
	pron	<2@nTel1mintik>
	pos	n.
	qual	Med.
	def	another name for {vermifuge}.
anthem	ety	Old English antemne, from Late Latin antiph*_ona #7antiphon 
anthem	1.
	syl	an+them
	pron	<1@nT*m>
	pos	n.
	def	a song of loyalty or devotion, as to a nation or college.
	exam	1	a national anthem.
anthem	2.
	syl	an+them
	pron	<1@nT*m>
	pos	n.
	def	a musical composition for choir, usually set to words from the Bible, sung as part of a church service.
anthem	3.
	syl	an+them
	pron	<1@nT*m>
	pos	n.
	def	a religious chant sung antiphonally.
anthemion	ety	from Greek: a little flower, from anthos flower
anthemia	infl
	head	anthemion
	syl	an+the:mi:a
	pron	<-mi*>
	pos	n.
	mod	pl.
anthemion	0.
	syl	an+the:mi+on
	pron	<@n1TEmi*n>
	pos	n.
	def	a floral design, used esp. in ancient Greek and Roman architecture and decoration, usually consisting of honeysuckle, lotus, or palmette leaf motifs.
anther	ety	C18: from New Latin anth*_era, from Latin: a remedy prepared from flowers, from Greek, from anth*_eros flowery, from anthos flower &- #!an+ther+al adj.
anther	0.
	syl	an+ther
	pron	<1@nT*>
	pos	n.
	def	the terminal part of a stamen consisting of two lobes each containing two sacs in which the pollen matures.
antheridium	ety	C19: from New Latin, diminutive of anth*_era #7anther 
antheridiia	infl
	head	antheridium
	syl	an+ther+id+i:i:a
	pron	<-i*>
	pos	n.
	mod	pl.
antheridium	0.
	syl	an+ther+id+i:um
	pron	<2@nT*1ridi*m>
	pos	n.
	def	the male sex organ of algae, fungi, mosses, and ferns, which produces antherozoids.
antheridial	sub
	head	antheridium
	syl	an+ther+1id+i:al
	pos	adj.
antherozoid	ety	C19: see #7anther, zo (#7o) #7id 
antherozoid	0.
	syl	an+ther:o+zo+id
	pron	<2@nT*r*1z*uid>, <-1zcid>
	pos	n.
	def	one of many small male gametes produced in an antheridium.
anthesis	ety	C19: via New Latin from Greek: full bloom, from anthein to bloom, from anthos flower
anthesis	0.
	syl	an+the:sis
	pron	<@n1TEsis>
	pos	n.
	def	the process of flowering in plants.
ant hill	0.
	syl	ant hill
	pos	n.
	def	a mound of soil, leaves, etc., near the entrance of an ants' nest, carried and deposited there by the ants while constructing the nest.
antho-	ety	from Greek anthos 
antho-	0.
	syl	an:tho-
	usage	combining form.
	def	denoting a flower.
	exam	1	anthophore;
	exam	2	anthotaxy;
	exam	3	anthozoan.
anthocyanin	ety	C19: from #7antho -#7+ -cyanin, from Greek kuanos dark blue
anthocyan	alt
	head	anthocyanin
	or	anthocyanin
	syl	an+tho+cy+an
	pron	<2@nT*u?!1sI*n>
	pos	n.
anthocyanin	0.
	or	anthocyan
	syl	an+tho+cy:a+nin
	pron	<2@nT*u1sI*nin>
	pos	n.
	def	any of a class of water-soluble glycosidic pigments, esp. those responsible for the red and blue colours in flowers. They are closely related to vitamins E and P.
anthodium	ety	C19: from New Latin, from Greek anth*_od*_es flower-like, from anthos flower+ -*_od*_es -#7oid 
anthodia	infl
	head	anthodium
	syl	an+tho+di:a
	pron	<-di*>
	pos	n.
	mod	pl.
anthodium	0.
	syl	an+tho+di:um
	pron	<@n1T*udi*m>
	pos	n.
	qual	Botany.
	def	another name for { {capitulum} (sense 1)}.
anthologise	alt
	head	anthologize
	or	anthologize
	syl	an+thol:o+gise
	pron	<@n1Tol*2JIz>
	pos	vb.
	mod	tr.
anthologize	0.
	or	anthologise
	syl	an+thol:o+gize
	pron	<@n1Tol*2JIz>
	pos	vb.
	mod	tr.
	def	to compile or put into an anthology.
anthology	ety	C17: from Medieval Latin anthologia, from Greek, literally: a flower gathering, from anthos flower+ legein to collect
anthologies	infl
	head	anthology
	syl	an+thol+o:gies.
	pos	n.
	mod	pl.
anthology	1.
	syl	an+thol+o:gy
	pron	<@n1Tol*Ji>
	pos	n.
	def	a collection of literary passages or works, esp. poems, by various authors.
anthology	2.
	syl	an+thol+o:gy
	pron	<@n1Tol*Ji>
	pos	n.
	def	any printed collection of literary pieces, songs, works of art, etc.
anthological	sub
	head	anthology
	syl	an+tho+log:i+cal
	pron	<2@nT*1loJikL>
	pos	adj.
anthologist	sub
	head	anthology
	syl	an+1thol:o+gist
	pos	n.
Saint	infl
	head	Anthony
	syl	Saint.
	pos	n.
Anthony	0.
	syl	An:tho:ny
	pron	<1@nt*ni>
	pos	n.
	def	??251-??356 #7a.d., Egyptian hermit, commonly regarded as the founder of Christian monasticism. Feast day: Jan. 17.
Saint	infl
	head	Anthony of Padua
	syl	Saint.
	pos	n.
Anthony of Padua	0.
	syl	An:tho:ny of Pad:u:a
	pos	n.
	def	1195-1231, Franciscan friar, who preached in France and Italy. Feast day: June 13.
anthophore	0.
	syl	an+tho+phore
	pron	<1@nT*u2fc:>, <-T*->
	pos	n.
	def	an elongation of the receptacle of a flower between the calyx and corolla.
anthotaxy	0.
	syl	an+tho+tax:y
	pron	<1@nT*2t@ksi>
	pos	n.
	def	the arrangement of flowers on a stem or parts on a flower.
anthozoan	1.
	syl	an+tho+zo+an
	pron	<2@nT*1z*u*n>
	pos	n.
	def	any of the solitary or colonial sessile marine coelenterates of the class including the corals, sea anemones, and sea pens, in which the body is in the form of a polyp. {~}
anthozoan	2.
	syl	an+tho+zo+an
	pron	<2@nT*1z*u*n>
	pos	n.
	def	Also: {actinozoan}. of or relating to the class
anthracene	ety	C19: from #7anthrax+ -#7ene 
anthracene	0.
	syl	an+thra+cene
	pron	<1@nTr*2sEn>
	pos	n.
	def	a colourless tricyclic crystalline solid having a slight blue fluorescence, used in the manufacture of chemicals, esp. diphenylamine and alizarin, and as crystals in scintillation counters. Formula: C\6H\4(CH)\2C\6H\4.
anthracite	ety	C19: from Latin anthrac*_ites type of bloodstone, from Greek anthra?!kit*_es coal-like, from anthrax coal, #7anthrax 
anthracite	0.
	syl	an+thra+cite
	pron	<1@nTr*2sIt>
	pos	n.
	def	a hard jet-black coal that burns slowly with a nonluminous flame giving out intense heat. Fixed carbon content: 86-98 per cent; calorific value: 3.14#Ml0%7-3.63#M10%7 J/kg. Also called: {hard coal}.
anthracitic	sub
	head	anthracite
	syl	an+thra+cit+ic
	pron	<2@nTr*1sitik>
	pos	adj.
anthracnose	ety	C19: from French, from Greek anthrax coal, carbuncle+ nosos disease
anthracnose	0.
	syl	an+thrac+nose
	pron	<@n1Tr@kn*us>
	pos	n.
	def	any of several fungus diseases of plants, such as vines and beans, characterized by oval dark depressed spots on the fruit and elsewhere.
anthracoid	1.
	syl	an+thra+coid
	pron	<1@nTr*2kcid>
	pos	adj.
	def	resembling anthrax.
anthracoid	2.
	syl	an+thra+coid
	pron	<1@nTr*2kcid>
	pos	adj.
	def	resembling carbon, coal, or charcoal.
anthraquinone	ety	C19: #7anthra (#7cene) #7+quinone 
anthraquinone	0.
	syl	an+thra+qui+none
	pron	<2@nTr*kwi1n*un>, <-1kwin*un>
	pos	n.
	def	a yellow crystalline solid used in the manufacture of dyes, esp. {anthraquinone dyes}, which have excellent colour properties. Formula: C\6H\4(CO)\2C\6H\4.
anthrax	ety	C19: from Late Latin, from Greek: carbuncle
anthraces	infl
	head	anthrax
	syl	an+thra+ces
	pron	<-Tr*2sEz>
	pos	n.
	mod	pl.
anthrax	1.
	syl	an+thrax
	pron	<1@nTr@ks>
	pos	n.
	def	a highly infectious disease of animals, esp. cattle and sheep, characterized by fever, enlarged spleen and swelling of the throat. It is caused by the bacterium and can be transmitted to man.
anthrax	2.
	syl	an+thrax
	pron	<1@nTr@ks>
	pos	n.
	def	a pustule or other lesion caused by this disease.
anthrop	1.
	syl	anthrop.
	qual	abbrev. for:
	def	anthropological.
anthrop	2.
	syl	anthrop.
	qual	abbrev. for:
	def	anthropology.
anthropo-	ety	from Greek anthr*_opos 
anthropo-	0.
	syl	an:thro:po-
	usage	combining form.
	def	indicating man or human.
	exam	1	anthropology;
	exam	2	anthropomorphism.
anthropocentric	0.
	syl	an+thro+po+cen+tric
	pron	<2@nTr*p*u1sentrik>
	pos	adj.
	def	regarding man as the most important and central factor in the universe.
anthropocentrism	sub
	head	anthropocentric
	syl	an+thro+po+1cen+trism
	pos	n.
anthropogeny	alt
	head	anthropogenesis
	or	anthropogenesis
	syl	an+thro+po+gen:y
	pron	<2@nTr*1poJini>
	pos	n.
anthropogenesis	0.
	or	anthropogeny
	syl	an+thro+po+gen+e:sis
	pron	<2@nTr*p*u1Jenisis>
	pos	n.
	def	the study of the origins of man.
anthropogenetic	sub
	head	anthropogenesis
	or	anthropogenic
	syl	an+thro+po+ge:1net+ic
	pos	adj.
anthropogenic	sub
	head	anthropogenesis
	or	anthropogenetic
	syl	an+thro+po+1gen+ic
	pos	adj.
anthropoid	1.
	syl	an+thro+poid
	pron	<1@nTr*2pcid>
	pos	adj.
	def	resembling man.
anthropoid	2.
	syl	an+thro+poid
	pron	<1@nTr*2pcid>
	pos	adj.
	def	resembling an ape; apelike.
anthropoid	3.
	syl	an+thro+poid
	pron	<1@nTr*2pcid>
	pos	adj.
	def	of or relating to the suborder
anthropoid	4.
	syl	an+thro+poid
	pron	<1@nTr*2pcid>
	pos	n.
	def	any primate of the suborder including monkeys, apes, and man. Compare {prosimian}.
anthropoidal	sub
	head	anthropoid
	syl	an+thro+1poi+dal
	pos	adj.
anthropoid ape	0.
	syl	an+thro+poid ape
	pos	n.
	def	any primate of the family having no tail, elongated arms, and a highly developed brain. The group includes gibbons, orang-utans, chimpanzees, and gorillas.
anthropol	0.
	syl	anthropol.
	qual	abbrev. for
	def	anthropology.
anthropology	0.
	syl	an+thro+pol+o:gy
	pron	<2@nTr*1pol*Ji>
	pos	n.
	def	the study of man, his origins, physical characteristics, institutions, religious beliefs, social relationships, etc. See also {cultural anthropology, eth?!nology, physical anthropology, social anthropology}.
anthropological	sub
	head	anthropology
	syl	an+thro+po+log:i+cal
	pron	<2@nTr*p*1loJikL>
	pos	adj.
anthropologically	sub
	head	anthropology
	syl	an+thro+po+1log:i+cal+ly
	pos	adv.
anthropologist	sub
	head	anthropology
	syl	an+thro+1pol:o+gist
	pos	n.
anthropometry	0.
	syl	an+thro+pom+e:try
	pron	<2@nTr*1pomitri>
	pos	n.
	def	the comparative study of sizes and proportions of the human body.
anthropometric	sub
	head	anthropometry
	or	anthropometrical
	syl	an+thro+po+met+ric
	pron	<2@nTr*p*1metrik>
	pos	adj.
anthropometrical	sub
	head	anthropometry
	or	anthropometric
	syl	an+thro+po+1met+ri+cal
	pos	adj.
anthropometrically	sub
	head	anthropometry
	syl	an+thro+po+1met+ri+cal+ly
	pos	adv.
anthropometrist	sub
	head	anthropometry
	syl	an+thro+1pom+e:trist
	pos	n.
anthropomorphic	1.
	syl	an+thro+po+mor+phic
	pron	<2@nTr*p*1mc:fik>
	pos	adj.
	def	of or relating to anthropomorphism.
anthropomorphic	2.
	syl	an+thro+po+mor+phic
	pron	<2@nTr*p*1mc:fik>
	pos	adj.
	def	resembling the human form.
anthropomorphism	0.
	syl	an+thro+po+mor+phism
	pron	<2@nTr*p*1mc:fiz*m>
	pos	n.
	def	the attribution of human form or behaviour to a deity, animal, etc.
anthropomorphist	sub
	head	anthropomorphism
	syl	an+thro+po+1mor+phist
	pos	n.
anthropomorphise	alt
	head	anthropomorphize
	or	anthropomorphize
	syl	an+thro+po+mor+phise
	pron	<2@nTr*p*?!1mc:fIz>
	pos	vb.
anthropomorphize	0.
	or	anthropomorphise
	syl	an+thro+po+mor+phize
	pron	<2@nTr*p*?!1mc:fIz>
	pos	vb.
	def	to attribute or ascribe human form or behaviour to (a god, animal, object, etc.).
anthropomorphosis	0.
	syl	an+thro+po+mor+pho+sis
	pron	<2@nTr*p*1mc:f*sis>
	pos	n.
	def	transforma?!tion into human form.
anthropomorphous	1.
	syl	an+thro+po+mor+phous
	pron	<2@nTr*p*1mc:f*s>
	pos	adj.
	def	shaped like a human being.
anthropomorphous	2.
	syl	an+thro+po+mor+phous
	pron	<2@nTr*p*1mc:f*s>
	pos	adj.
	def	another word for {anthropomorphic}.
anthropomorphously	sub
	head	anthropomorphous
	syl	an+thro+po+1mor+phous+ly
	pos	adv.
anthropopathism	alt
	head	anthropopathy
	or	anthropopathy
	syl	an+thro+pop:a+thism
	pos	n.
anthropopathy	0.
	or	anthropopathism
	syl	an+thro+pop:a+thy
	pron	<2@nTr*1pop*Ti>
	pos	n.
	def	the attribution of human passions, etc., to a deity, object, etc.
anthropopathic	sub
	head	anthropopathy
	syl	an+thro+po+path+ic
	pron	<2@nTr*p*1p@Tik>
	pos	adj.
anthropophagi	ety	C16: from Latin, from Greek anthr*_opophagos; see #7anthropo -#7, -#7phagous 
anthropophagus	infl
	head	anthropophagi
	syl	an+thro+poph:a+gus
	pron	<-g*s>
	pos	n.
	mod	sing.
anthropophagi	0.
	syl	an+thro+poph:a+gi
	pron	<2@nTr*1pof*2gI>
	pos	n.
	mod	pl.
	def	cannibals.
anthropophagite	0.
	syl	an+thro+poph:a+gite
	pron	<2@nTr*1pof*2gIt>
	pos	n.
	def	a rare word for {cannibal}.
anthropophagy	sub
	head	anthropophagite
	syl	an+thro+poph:a+gy
	pron	<2@nTr*1pof*Ji>
	pos	n.
anthropophagic	sub
	head	anthropophagite
	syl	an+thro+po+phag+ic
	pron	<2@nTr*p*1f@Jik>
	pos	adj.
anthropophagous	sub
	head	anthropophagite
	syl	an+thro+1poph:a+gous
	pos	adj.
anthroposophy	0.
	syl	an+thro+pos:o+phy
	pron	<2@nTr*1pos*fi>
	pos	n.
	def	the spiritual and mystical teachings of Rudolph Steiner. &- {an+thro+po+soph+ic} (@!@an#Ggr$$p$$$u#!s$Af$Ik) &- {@!an+thro+#!pos@.o+phist}
anthurium	ety	C19: New Latin, from #7antho -#7+ Greek oura a tail
anthurium	0.
	syl	an+thu+ri:um
	pron	<@n1Tju*ri*m>
	pos	n.
	def	any of various tropical American aroid plants constituting the genus many of which are cultivated as house plants for their showy foliage and their flowers, which have a long-stalked spike surrounded by a flaring heart-shaped white or red bract.
anti	1.
	syl	an:ti
	pron	<1@nti>
	pos	adj.
	qual	Informal.
	def	opposed to a party, policy, attitude, etc..
	exam	1	he won't join because he is rather anti.
anti	2.
	syl	an:ti
	pron	<1@nti>
	pos	n.
	qual	Informal.
	def	an opponent of a party, policy, etc.
anti-	ety	from Greek anti 
anti-	1.
	syl	an:ti-
	pos	prefix.
	def	against; opposing.
	exam	1	anticlerical;
	exam	2	antisocial.
anti-	2.
	syl	an:ti-
	pos	prefix.
	def	opposite to.
	exam	1	anticlimax;
	exam	2	antimere.
anti-	3.
	syl	an:ti-
	pos	prefix.
	def	rival; false.
	exam	1	antipope.
anti-	4.
	syl	an:ti-
	pos	prefix.
	def	counteracting, inhibiting, or neutralizing.
	exam	1	antifreeze;
	exam	2	anti?!histamine.
anti-aircraft	0.
	syl	an:ti-air:craft
	pron	<2@nti1e*kra:ft>
	pos	n.
	usage	modifier
	def	of or relating to defence against aircraft attack.
	exam	1	anti-aircraft batteries.
antiar	ety	from Javanese
antiar	0.
	syl	an+ti+ar
	pron	<1@nti2a:>
	pos	n.
	def	another name for { {upas} (senses 1, 2)}.
antibaryon	0.
	syl	an:ti+bar:y+on
	pron	<2@nti1b@ri*n>
	pos	n.
	qual	Physics.
	def	the antiparticle of any of the baryons.
Antibes	0.
	syl	An+tibes
	pron	French <?~a1tib>
	pos	n.
	def	a port and resort in SE France, on the Mediterranean: an important Roman town. Pop.: 56309 (1975).
antibiosis	0.
	syl	an:ti+bi:o+sis
	pron	<2@ntibI1*usis>
	pos	n.
	def	an association between two organisms, esp. microorganisms, that is harmful to one of them.
antibiotic	1.
	syl	an:ti+bi+ot+ic
	pron	<2@ntibI1otik>
	pos	n.
	def	any of various chemical substances, such as penicillin, streptomycin, neomycin, and tetracycline, produced by various microorganisms, esp. fungi, or made synthetically and capable of destroying or inhibiting the growth of microorganisms, esp. bacteria. {~}
antibiotic	2.
	syl	an:ti+bi+ot+ic
	pron	<2@ntibI1otik>
	pos	n.
	def	of or relating to antibiotics.
antibodies	infl
	head	antibody
	syl	an:ti+bod:ies.
	pos	n.
	mod	pl.
antibody	0.
	syl	an:ti+bod:y
	pron	<1@nti2bodi>
	pos	n.
	def	any of various proteins produced in the blood in response to the presence of an antigen. It combines with the antigen, usually a toxin produced by a bacterium, rendering it harmless. See also {immuno?!globulin}.
antic	ety	C16: from Italian antico something ancient, or grotesque (from its application to fantastic carvings found in ruins of ancient Rome); see #7antique 
antic	1.
	syl	an+tic
	pron	<1@ntik>
	pos	n.
	qual	Archaic.
	def	an actor in a ludicrous or grotesque part; clown; buffoon. {~}
antic	2.
	syl	an+tic
	pron	<1@ntik>
	pos	n.
	qual	Archaic.
	def	fantastic; grotesque.
anticatalyst	1.
	syl	an:ti+cat:a+lyst
	pron	<2@nti1k@t*list>
	pos	n.
	def	a substance that destroys or diminishes the activity of a catalyst.
anticatalyst	2.
	syl	an:ti+cat:a+lyst
	pron	<2@nti1k@t*list>
	pos	n.
	def	another name for { {inhibitor} (sense 1)}.
anticathode	0.
	syl	an:ti+cath+ode
	pron	<2@nti1k@T*ud>
	pos	n.
	def	the target electrode for the stream of electrons in a vacuum tube, esp. an x-ray tube.
antichlor	ety	C19: from #7anti -#7+ chlor (#7ine) 
antichlor	0.
	syl	an:ti+chlor
	pron	<1@nti2klc:>
	pos	n.
	def	a substance used to remove chlorine from a material after bleaching.
antichloristic	sub
	head	antichlor
	syl	an:ti+chlo+1ris+tic
	pos	adj.
anticholinergic	1.
	syl	an:ti+cho+lin+er+gic
	pron	<2@nti2koli1nR:Jik>
	pos	adj.
	qual	Physiol.
	def	blocking nerve impulses through the parasympathetic nerves.
anticholinergic	2.
	syl	an:ti+cho+lin+er+gic
	pron	<2@nti2koli1nR:Jik>
	pos	n.
	qual	Med.
	def	a drug or agent that blocks these nerve impulses, used esp. to control intestinal spasm.
anticholinesterase	0.
	syl	an:ti+cho+lin+es+ter+ase
	pron	<2@nti2kol*1nest*2rAz>
	pos	n.
	def	any of a group of substances that inhibit the action of cholinesterase.
Antichrist	1.
	syl	An:ti+christ
	pron	<1@nti2krIst>
	pos	n.
	qual	New Testament.
	def	the antago?!nist of Christ, expected by early Christians to appear and reign over the world until overthrown at Christ's Second Coming.
Antichrist	2.
	syl	An:ti+christ
	pron	<1@nti2krIst>
	pos	n.
	usage	sometimes not cap.
	def	an enemy of Christ or Christianity.
Antichristian	sub
	head	Antichrist
	syl	An:ti+1chris+tian
	pos	adj.
anticipant	1.
	syl	an+tic:i+pant
	pron	<@n1tisip*nt>
	pos	adj.
	def	operating in advance; expectant.
anticipant	2.
	syl	an+tic:i+pant
	pron	<@n1tisip*nt>
	pos	n.
	def	a person who anticipates.
anticipate	ety	C16: from Latin anticip*_are to take before, realize beforehand, from anti- #7ante -#7+ capere to take &- an+#!tic@.i+@!pa+tor n.
anticipate	1.
	syl	an+tic:i+pate
	pron	<@n1tisi2pAt>
	pos	vb.
	mod	mainly; tr.
	usage	may take a clause as object
	def	to regard as likely; expect; foresee.
	exam	1	he antici?!pated that it would happen.
anticipate	2.
	syl	an+tic:i+pate
	pron	<@n1tisi2pAt>
	pos	vb.
	mod	mainly; tr.
	usage	may take a clause as object
	def	to foresee and act in advance of.
	exam	1	he anticipated the fall in value by selling early.
anticipate	3.
	syl	an+tic:i+pate
	pron	<@n1tisi2pAt>
	pos	vb.
	mod	mainly; tr.
	def	to thwart by acting in advance of; forestall.
	exam	1	I anticipated his punch by moving out of reach.
anticipate	4.
	syl	an+tic:i+pate
	pron	<@n1tisi2pAt>
	pos	vb.
	mod	also; intr.
	def	to mention (something) before its proper time.
	exam	1	don't anticipate the climax of the story.
anticipate	5.
	syl	an+tic:i+pate
	pron	<@n1tisi2pAt>
	pos	vb.
	mod	mainly; tr.
	def	to make use of in advance of possession.
	exam	1	he anticipated his salary in buying a house.
anticipate	6.
	syl	an+tic:i+pate
	pron	<@n1tisi2pAt>
	pos	vb.
	mod	mainly; tr.
	def	to pay (a bill, etc.) before it falls due.
anticipate	7.
	syl	an+tic:i+pate
	pron	<@n1tisi2pAt>
	pos	vb.
	mod	mainly; tr.
	def	to cause to happen sooner.
	exam	1	the spread of nationalism anticipated the decline of the Empire.
anticipatory	sub
	head	anticipate
	or	anticipative
	syl	an+1tic:i+2pa+to:ry
	pos	adj.
anticipative	sub
	head	anticipate
	or	anticipatory
	syl	an+1tic:i+pa+tive
	pos	adj.
anticipation	1.
	syl	an+tic:i+pa+tion
	pron	<@n2tisi1pAS*n>
	pos	n.
	def	the act of anticipating; expectation, premonition, or foresight.
anticipation	2.
	syl	an+tic:i+pa+tion
	pron	<@n2tisi1pAS*n>
	pos	n.
	def	the act of taking or dealing with funds before they are legally available or due.
anticipation	3.
	syl	an+tic:i+pa+tion
	pron	<@n2tisi1pAS*n>
	pos	n.
	qual	Music.
	def	an unstressed, usually short note introduced before a downbeat and harmonically related to the chord immediately following it. Compare { {suspension} (sense 11)}.
anticlastic	0.
	syl	an:ti+clas+tic
	pron	<2@nti1kl@stik>
	pos	adj.
	usage	Maths. of a surface
	def	having a curvature, at a given point and in a particular direction, that is of the opposite sign to the curvature at that point in a perpendicular direction. Compare {synclastic}.
anticlerical	1.
	syl	an:ti+cler:i+cal
	pron	<2@nti1klerikL>
	pos	adj.
	def	opposed to the power and influence of the clergy, esp. in politics.
anticlerical	2.
	syl	an:ti+cler:i+cal
	pron	<2@nti1klerikL>
	pos	n.
	def	a supporter of an anticlerical party.
anticlericalism	sub
	head	anticlerical
	syl	an:ti+1cler:i+cal+ism
	pos	n.
anticlimax	1.
	syl	an:ti+cli+max
	pron	<2@nti1klIm@ks>
	pos	n.
	def	a disappointing or ineffective conclusion to a series of events, etc.
anticlimax	2.
	syl	an:ti+cli+max
	pron	<2@nti1klIm@ks>
	pos	n.
	def	a sudden change from a serious subject to one that is disappointing or ludicrous.
anticlimax	3.
	syl	an:ti+cli+max
	pron	<2@nti1klIm@ks>
	pos	n.
	qual	Rhetoric.
	def	a descent in discourse from the significant or important to the trivial, inconsequential, etc.
anticlimactic	sub
	head	anticlimax
	syl	an:ti+cli+mac+tic
	pron	<2@ntiklI1m@ktik>
	pos	adj.
anticlimactically	sub
	head	anticlimax
	syl	an:ti+cli+1mac+ti+cal+ly
	pos	adv.
anticlinal	1.
	syl	an:ti+cli+nal
	pron	<2@nti1klInL>
	pos	adj.
	def	of, relating to, or resembling an anticline.
anticlinal	2.
	syl	an:ti+cli+nal
	pron	<2@nti1klInL>
	pos	adj.
	qual	Botany.
	def	of or relating to the plane at right angles to the surface of an organ.
anticline	0.
	syl	an:ti+cline
	pron	<1@nti2klIn>
	pos	n.
	def	a formation of stratified rock raised up, by folding, into a broad arch so that the strata slope down on both sides from a common crest. Compare {syncline}.
anticlinoria	infl
	head	anticlinorium
	syl	an:ti+cli+no+ri:a
	pron	<-1nc:ri*>
	pos	n.
	mod	pl.
anticlinorium	0.
	syl	an:ti+cli+no+ri:um
	pron	<2@ntiklI1nc:ri*m>
	pos	n.
	def	a vast elongated anticline with its strata further folded into anticlines and synclines.
anticlockwise	0.
	syl	an:ti+clock+wise
	pron	<2@nti1klok2wIz>
	pos	adv. adj.
	def	in the opposite direction to the rotation of the hands of a clock. U.S. equivalent: {counterclockwise}.
anticoagulant	1.
	syl	an:ti+co+ag:u+lant
	pron	<2@ntik*u1@gjul*nt>
	pos	adj.
	def	acting to prevent or retard coagulation, esp. of blood.
anticoagulant	2.
	syl	an:ti+co+ag:u+lant
	pron	<2@ntik*u1@gjul*nt>
	pos	n.
	def	an agent that prevents or retards coagulation.
anticoincidence	0.
	syl	an:ti+co+in+ci+dence
	pron	<2@ntik*u1insid*ns>
	pos	n.
	usage	modifier
	def	of or relating to an electronic circuit that produces an output pulse if one but not both of its input terminals receives a pulse within a specified interval of time. Compare { {coincidence} (sense 3)}.
anticonvulsant	1.
	syl	an:ti+con+vul+sant
	pron	<2@ntik*n1v^ls*nt>
	pos	n.
	def	any of a class of drugs used to relieve convulsions. {~}
anticonvulsant	2.
	syl	an:ti+con+vul+sant
	pron	<2@ntik*n1v^ls*nt>
	pos	n.
	def	of or relating to this class of drugs.
Anti-Corn Law League	0.
	syl	An:ti-Corn Law League
	pos	n.
	def	an organization founded in 1839 by Richard Cobden and John Bright to oppose the Corn Laws, which were repealed in 1846.
Anticosti	0.
	syl	An+ti+cos+ti
	pron	<2@nti1kosti>
	pos	n.
	def	an island of E Canada in the Gulf of St. Lawrence; part of Quebec. Area: 7881 sq. km (3043 sq. miles).
antics	0.
	syl	an+tics
	pron	<1@ntiks>
	pos	n.
	mod	pl.
	def	absurd or grotesque acts or postures.
anticyclone	0.
	syl	an:ti+cy+clone
	pron	<2@nti1sIkl*un>
	pos	n.
	qual	Meteorol.
	def	a body of moving air of higher pressure than the surrounding air, in which the pressure decreases away from the centre. Winds circulate around the centre in a clockwise direction in the N hemisphere and anticlockwise in the S hemisphere. Also called: {high}.
anticyclonic	sub
	head	anticyclone
	syl	an:ti+cy+clon+ic
	pron	<2@ntisI1klonik>
	pos	adj.
antidepressant	1.
	syl	an:ti+de+pres+sant
	pron	<2@ntidi1presNt>
	pos	n.
	def	any of a class of drugs used to alleviate depression. {~}
antidepressant	2.
	syl	an:ti+de+pres+sant
	pron	<2@ntidi1presNt>
	pos	n.
	def	of or relating to this class of drugs.
antidote	ety	C15: from Latin antidotum, from Greek antidoton something given as a countermeasure, from #7anti -#7+ didonai to give &- @!an@.ti+#!dot+al adj.
antidote	1.
	syl	an:ti+dote
	pron	<1@nti2d*ut>
	pos	n.
	qual	Med.
	def	a drug or agent that counter?!acts or neutralizes the effects of a poison.
antidote	2.
	syl	an:ti+dote
	pron	<1@nti2d*ut>
	pos	n.
	def	anything that counteracts or relieves a harmful or unwanted condition; remedy.
antidromic	1.
	syl	an:ti+drom+ic
	pron	<2@nti1dromik>
	pos	adj.
	usage	of nerve fibres
	def	conduct?!ing nerve impulses in a direction opposite to normal.
antidromic	2.
	syl	an:ti+drom+ic
	pron	<2@nti1dromik>
	pos	adj.
	usage	of plants
	def	showing twining to the left and right in members of the same species.
Antietam	0.
	syl	An+tie+tam
	pron	<@n1tEt*m>
	pos	n.
	def	a creek in NW Maryland, flowing into the Potomac: scene of a Civil War battle (1862), in which the Confederate forces of General Robert E. Lee were defeated.
antifebrile	1.
	syl	an:ti+fe:brile
	pron	<2@nti1fEbrIl>
	pos	adj.
	def	reducing fever; antipyretic. {~}
antifebrile	2.
	syl	an:ti+fe:brile
	pron	<2@nti1fEbrIl>
	pos	adj.
	def	an antifebrile agent or drug.
Antifederalist	1.
	syl	An:ti+fed+er+al+ist
	pron	<2@nti1fed*r*list>, <-1fedr*->
	pos	n.
	qual	U.S. history.
	def	a person who opposed the ratification of the Constitution in 1789 and thereafter allied with Thomas Jefferson's Antifederal Party, which opposed extension of the powers of the federal Government.
Antifederalist	2.
	syl	An:ti+fed+er+al+ist
	pron	<2@nti1fed*r*list>, <-1fedr*->
	pos	n.
	usage	often not cap.
	def	any person who opposes federalism.
antiferromagnetism	0.
	syl	an:ti+fer+ro+mag+ne+tism
	pron	<2@nti2fer*u1m@gni2tiz*m>
	pos	n.
	qual	Phys?!ics.
	def	the phenomenon exhibited by substances that resemble paramagnetic substances in the value of their relative permeability but that behave like ferromagnetic substances when their temperature is varied. See also {ferrimagnetism}.
antifouling	1.
	syl	an:ti+foul+ing
	pron	<2@nti1fauliG>
	pos	adj.
	usage	of a paint or other coating
	def	inhibiting the growth of barnacles and other marine organisms on a ship's bottom.
antifouling	2.
	syl	an:ti+foul+ing
	pron	<2@nti1fauliG>
	pos	n.
	def	an antifouling paint or other coating.
antifreeze	0.
	syl	an:ti+freeze
	pron	<1@nti2frEz>
	pos	n.
	def	a liquid, usually ethylene glycol (ethanediol), added to cooling water to lower its freezing point, esp. for use in an internal-combustion engine.
antigen	ety	C20: from #7anti (#7body) #7+ -#7gen 
antigen	0.
	syl	an:ti+gen
	pron	<1@ntiJ*n>, <-2Jen>
	pos	n.
	def	a substance that stimulates the production of antibodies.
antigenic	sub
	head	antigen
	syl	an:ti+1gen+ic
	pos	adj.
antigenically	sub
	head	antigen
	syl	an:ti+1gen:i+cal+ly
	pos	adv.
Antigone	0.
	syl	An:tig:o:ne
	pron	<@n1tig*ni>
	pos	n.
	qual	Greek myth.
	def	daughter of Oedipus and Jocasta, who was condemned to death for cremating the body of her brother Polynices in defiance of an edict of her uncle, King Creon of Thebes.
Antigonus I	0.
	syl	An:tig:o:nus I
	pron	<@n1tig*n*s>
	pos	n.
	def	called 382-301 #7b.c., Macedonian general under Alexander the Great; king of Macedon (306-301).
anti-G suit	0.
	syl	an:ti-G suit
	pos	n.
	def	another name for {G-suit}.
Antigua	0.
	syl	An+ti+gua
	pron	<@n1tEg*>
	pos	n.
	def	an island of the West Indies, one of the Leeward Islands: a British colony until 1967, now a British Associated State. Capital: St. John's. Pop.: 66000 (1972 est.). Area: 279 sq. km (108 sq. miles). &- {An+#!ti+guan}
antihalation	0.a.
	syl	an:ti+ha+la+tion
	pron	<2antih*1lAS*n>
	pos	n.
	qual	Photog.
	def	a process by which light, passing through the emulsion on a film or plate, is not reflected back into it but is absorbed by a layer of dye or pigment, usually on the back of the film, thus preventing halation.
antihalation	0.b.
	syl	an:ti+ha+la+tion
	pron	<2antih*1lAS*n>
	pos	n.
	qual	Photog.
	usage	as modifier
	exam	1	antihalation backing.
antihelices	infl
	head	antihelix
	or	antihelixes
	syl	an:ti+hel:i+ces
	pron	<-1hElisEz>
	pos	n.
	mod	pl.
antihelixes	infl
	head	antihelix
	or	antihelices
	syl	an:ti+he+lix:es.
	pos	n.
	mod	pl.
antihelix	0.
	syl	an:ti+he+lix
	pron	<2@nti1hEliks>
	pos	n.
	def	a variant spelling of {anthelix}.
antiheroes	infl
	head	antihero
	syl	an:ti+he+roes.
	pos	n.
	mod	pl.
antihero	0.
	syl	an:ti+he+ro
	pron	<1@nti2hi*r*u>
	pos	n.
	def	a central character in a novel, play, etc., who lacks the traditional heroic virtues.
antihistamine	0.
	syl	an:ti+his+ta+mine
	pron	<2@nti1hist*2mEn>, <-min>
	pos	n.
	def	any drug that neutralizes the effects of histamine, used esp. in the treatment of allergies.
anti-icer	0.
	syl	an:ti-ic:er
	pos	n.
	def	a device fitted to an aircraft to prevent the formation of ice. Compare {de-icer}.
antiknock	0.
	syl	an:ti+knock
	pron	<2@nti1nok>
	pos	n.
	def	a compound, such as lead tetraethyl, added to petrol to reduce knocking in the engine.
Anti-Lebanon	0.
	syl	An:ti-Leb:a+non
	pos	n.
	def	a mountain range running north and south between Syria and Lebanon, east of the Lebanon Mountains. Highest peak: Mount Hermon, 279 m (9232 ft.).
antilepton	0.
	syl	an:ti+lep+ton
	pron	<2@nti1lept*n>
	pos	n.
	qual	Physics.
	def	the antiparticle of any of the leptons.
Anthe	infl
	head	Antilles
	syl	An+the.
	pos	n.
Antilles	0.
	syl	An+til+les
	pron	<@n1tilEz>
	pos	n.
	mod	pl.
	def	a group of islands in the West Indies consisting of the {Greater Antilles} and the {Lesser Antilles}.
antilog	0.
	syl	an:ti+log
	pron	<1@nti2log>
	pos	n.
	def	short for {antilogarithm}.
antilogarithm	0.
	syl	an:ti+log:a+rithm
	pron	<2@nti1log*2riD*m>
	pos	n.
	def	a number whose logarithm is the given number.
	exam	1	100 is the antilogarithm of 2.
antilogarithmic	sub
	head	antilogarithm
	syl	an:ti+2log:a+1rith+mic
	pos	adj.
antilogism	ety	C20: from #7anti -#7+ (#7syl) #7logism 
antilogism	0.
	syl	an+til:o+gism
	pron	<@n1til*2Jiz*m>
	pos	n.
	def	a triad of propositions consist?!ing of the two premisses of a syllogism and the negation of its conclusion.
antilogy	ety	C17: from Greek antilogia 
antilogies	infl
	head	antilogy
	syl	an+til+o:gies.
	pos	n.
	mod	pl.
antilogy	0.
	syl	an+til+o:gy
	pron	<@n1til*Ji>
	pos	n.
	def	a contradiction in terms.
antimacassar	ety	C19: from #7anti -#7+ M#7acassar (#7oil) 
antimacassar	0.
	syl	an:ti+ma+cas+sar
	pron	<2@ntim*1k@s*>
	pos	n.
	def	a cloth covering the back and arms of chairs, etc., to prevent soiling or as decoration.
antimagnetic	0.
	syl	an:ti+mag+net+ic
	pron	<2@ntim@g1netik>
	pos	adj.
	def	of or constructed of a material that does not acquire permanent magnetism when exposed to a magnetic field.
	exam	1	an antimagnetic watch.
antimalarial	1.
	syl	an:ti+ma+lar+i:al
	pron	<2@ntim*1le*ri*l>
	pos	adj.
	def	effective in the treatment of malaria. {~}
antimalarial	2.
	syl	an:ti+ma+lar+i:al
	pron	<2@ntim*1le*ri*l>
	pos	adj.
	def	an antimalarial drug or agent.
antimasque	0.
	syl	an:ti+masque
	pron	<1@nti2ma:sk>
	pos	n.
	def	a comic or grotesque dance, presented between the acts of a masque.
antimatter	0.
	syl	an:ti+mat+ter
	pron	<1@nti2m@t*>
	pos	n.
	def	a hypothetical form of matter composed of antiparticles.
antimere	0.
	syl	an:ti+mere
	pron	<1@nti2mi*>
	pos	n.
	def	a part or organ of a bilaterally or radially symmetrical organism that corresponds to a similar structure on the other side of the axis, such as the right or left limb of a four-legged animal. Also called: {actinomere}.
antimeric	sub
	head	antimere
	syl	an:ti+mer+ic
	pron	<2@nti1merik>
	pos	adj.
antimerism	sub
	head	antimere
	syl	an+tim+er+ism
	pron	<@n1tim*2riz*m>
	pos	n.
antimissile	1.
	syl	an:ti+mis+sile
	pron	<2@nti1misIl>
	pos	adj.
	def	relating to defensive measures against missile attack.
	exam	1	an antimissile system.
antimissile	2.
	syl	an:ti+mis+sile
	pron	<2@nti1misIl>
	pos	n.
	def	a defensive missile used to intercept and destroy attacking missiles.
antimonial	1.
	syl	an:ti+mo+ni:al
	pron	<2@nti1m*uni*l>
	pos	adj.
	def	of or containing antimony.
antimonial	2.
	syl	an:ti+mo+ni:al
	pron	<2@nti1m*uni*l>
	pos	n.
	def	a drug or agent containing antimony.
antimonic	0.
	syl	an:ti+mo+nic
	pron	<2@nti1monik>
	pos	adj.
	def	of or containing antimony in the pentavalent state.
antimonous	0.
	syl	an:ti+mo+nous
	pron	<1@ntim*n*s>
	pos	adj.
	def	of or containing antimony in the trivalent state.
antimony	ety	C15: from Medieval Latin antim*_onium, of uncertain origin
antimony	0.
	syl	an:ti+mo+ny
	pron	<1@ntim*ni>
	pos	n.
	def	a toxic metallic element that exists in two allotropic forms and occurs principally in stibnite. The stable form is a brittle silvery-white crystalline metal that is added to alloys to increase their strength and hardness and is used in semiconductors. Symbol: Sb; atomic no.: 51; atomic wt.: 121.75; valency: 3 or 5; relative density: 6.684; melting pt.: 630.5?%C; boiling pt.: 1640?%C.
antimonyl	0.
	syl	an:ti+mo+nyl
	pron	<1@ntim*nil>, <@n1tim->
	pos	n.
	usage	modifier
	def	of, consisting of, or containing the monovalent group SbO-.
	exam	1	an antimonyl group or radical.
antimony potassium tartrate	0.
	syl	an:ti+mo+ny po+tas+si:um tar+trate
	pos	n.
	def	a colourless odourless poisonous crystalline salt used as a mordant for textiles and leather, as an insecticide, and as an anthelmintic. Formula: K(SbO)C\4H\4O\6. Also called: {tartar emetic}.
antineutrinos	infl
	head	antineutrino
	syl	an:ti+neu+tri+nos.
	pos	n.
	mod	pl.
antineutrino	0.
	syl	an:ti+neu+tri+no
	pron	<2@ntinju:1trEn*u>
	pos	n.
	def	the antiparticle of a neutrino; a particle having the opposite spin to a neutrino.
antineutron	0.
	syl	an:ti+neu+tron
	pron	<2@nti1nju:tron>
	pos	n.
	def	the antiparticle of a neutron; a particle having the same mass as the neutron but a magnetic moment of opposite sign.
anting	0.
	syl	ant+ing
	pron	<1@ntiG>
	pos	n.
	def	the placing or rubbing of ants by birds on their feathers. The body fluids of the ants are thought to repel parasites.
antinode	0.
	syl	an:ti+node
	pron	<1@nti2n*ud>
	pos	n.
	def	a point of maximum displacement between two adjacent nodes in a standing wave.
antinodal	sub
	head	antinode
	syl	an:ti+1nod+al
	pos	adj.
antinomian	1.
	syl	an:ti+no+mi:an
	pron	<2@nti1n*umi*n>
	pos	adj.
	def	relating to the doctrine that by faith and the dispensation of grace a Christian is released from the obligation of adhering to any moral law.
antinomian	2.
	syl	an:ti+no+mi:an
	pron	<2@nti1n*umi*n>
	pos	n.
	def	a member of a Christian sect holding such a doctrine.
antinomianism	sub
	head	antinomian
	syl	an:ti+1no+mi+an+ism
	pos	n.
antinomy	ety	C16: from Latin antinomia, from Greek: conflict between laws, from #7anti -#7+ nomos law
antinomies	infl
	head	antinomy
	syl	an+tin:o+mies.
	pos	n.
	mod	pl.
antinomy	1.
	syl	an+tin:o+my
	pron	<@n1tin*mi>
	pos	n.
	def	opposition of one law, principle, or rule to another; contradiction within a law.
antinomy	2.
	syl	an+tin:o+my
	pron	<@n1tin*mi>
	pos	n.
	qual	Philosophy.
	def	contradiction existing between two apparently indubitable propositions; paradox.
antinomic	sub
	head	antinomy
	syl	an:ti+nom+ic
	pron	<2@nti1nomik>
	pos	adj.
antinomically	sub
	head	antinomy
	syl	an:ti+1nom:i+cal+ly
	pos	adv.
antinovel	0.
	syl	an:ti+nov+el
	pron	<1@nti2novL>
	pos	n.
	def	a type of prose fiction in which conventional or traditional novelistic elements are rejected. Also called: {anti-roman, nouveau roman}.
antinucleon	0.
	syl	an:ti+nu+cle:on
	pron	<2@nti1nju:kli2on>
	pos	n.
	def	an antiproton or an antineutron.
Antioch	0.
	syl	An+ti+och
	pron	<1@nti2ok>
	pos	n.
	def	a city in S Turkey, on the Orantes River: ancient commercial centre and capital of Syria (300-64 #7b.c.) ; early centre of Christianity. Pop.: 57900 (1965). Arabic name: {Antakiya}. Turkish name: {Antakya}.
Antiochus III	0.
	syl	An:ti:o:chus III
	pron	<@n1tI*k*s>
	pos	n.
	def	called 242-187 #7b.c., king of Syria (223-187), who greatly extended the Seleucid empire but was forced (190) to surrender most of Asia Minor to the Romans.
Antiochus IV	0.
	syl	An:ti:o:chus IV
	pos	n.
	def	??215-164 #7b.c., Seleucid king of Syria (175-164), who attacked the Jews and provoked the revolt of the Maccabees.
antioxidant	0.
	syl	an:ti+ox:i+dant
	pron	<2@nti1oksid*nt>
	pos	n.
	def	any substance that retards deterioration by oxidation, esp. of fats, oils, foods, petroleum products, or rubber.
antiparallel	1.
	syl	an:ti+par+al+lel
	pron	<2@nti1p@r*2lel>
	pos	adj.
	qual	Physics.
	def	parallel but pointing or rotating in opposite directions.
antiparallel	2.
	syl	an:ti+par+al+lel
	pron	<2@nti1p@r*2lel>
	pos	adj.
	usage	Maths. of two lines
	def	cutting two given lines so that in the quadrilateral formed the interior opposite angles are supplementary.
antiparticle	0.
	syl	an:ti+par+ti+cle
	pron	<1@nti2pa:tikL>
	pos	n.
	def	any of a group of elementary particles that have the same mass as their corresponding particle but have a charge, baryon number, strangeness, and isospin quantum number, I\3, of equal magnitude but opposite sign. When a particle collides with its antiparticle mutual annihilation occurs.
antipasto	ety	Italian: before food
antipastos	infl
	head	antipasto
	syl	an:ti+pas+tos.
	pos	n.
	mod	pl.
antipasto	0.
	syl	an:ti+pas+to
	pron	<2@nti1pa:st*u>, <-1p@s->
	pos	n.
	def	a course of hors d'oeuvres in an Italian meal.
Antipater	0.
	syl	An:tip:a:ter
	pron	<@n1tip*t*>
	pos	n.
	def	??398-319 #7b.c., Macedonian general under Alexander the Great: regent of Macedon (334-323).
antipathetical	alt
	head	antipathetic
	or	antipathetic
	syl	an:ti+pa+thet+ic:al
	pos	adj.
antipathetic	0.
	or	antipathetical
	syl	an:ti+pa+thet+ic
	pron	<@n2tip*1Tetik>, <2@ntip*->
	pos	adj.
	usage	often foll. by to
	def	having or arousing a strong aversion.
antipathetically	sub
	head	antipathetic
	syl	an:ti+pa+1thet:i+cal+ly
	pos	adv.
antipathy	ety	C17: from Latin antipathia, from Greek antipatheia, from #7anti -#7+ patheia feeling
antipathies	infl
	head	antipathy
	syl	an+tip:a+thies.
	pos	n.
	mod	pl.
antipathy	1.
	syl	an+tip:a+thy
	pron	<@n1tip*Ti>
	pos	n.
	def	a feeling of intense aversion, dislike, or hostility.
antipathy	2.
	syl	an+tip:a+thy
	pron	<@n1tip*Ti>
	pos	n.
	def	the object of such a feeling.
antiperiodic	1.
	syl	an:ti+pe:ri+od+ic
	pron	<2@nti2pi*ri1odik>
	pos	adj.
	qual	Med.
	def	efficacious against recurring attacks of a disease. {~}
antiperiodic	2.
	syl	an:ti+pe:ri+od+ic
	pron	<2@nti2pi*ri1odik>
	pos	adj.
	qual	Med.
	def	an antiperiodic drug or agent.
antiperistalsis	0.
	syl	an:ti+per:i+stal+sis
	pron	<2@nti2peri1st@lsis>
	pos	n.
	qual	Physiol.
	def	contractions of the intestine that force the contents in the opposite direction to the normal.
antipersonnel	0.
	syl	an:ti+per+son+nel
	pron	<2@nti2pR:s*1nel>
	pos	adj.
	usage	of weapons, etc.
	def	designed to cause casualties to personnel rather than to destroy equipment or defences.
antiperspirant	1.
	syl	an:ti+per+spi+rant
	pron	<2@nti1pR:sp*r*nt>
	pos	n.
	def	an astringent substance applied to the skin to reduce or prevent perspiration.
antiperspirant	2.
	syl	an:ti+per+spi+rant
	pron	<2@nti1pR:sp*r*nt>
	pos	adj.
	def	reducing or preventing perspiration.
antiphlogistic	1.
	syl	an:ti+phlo+gis+tic
	pron	<2@ntifl*1Jistik>
	pos	adj.
	def	of or relating to the prevention or alleviation of inflammation.
antiphlogistic	2.
	syl	an:ti+phlo+gis+tic
	pron	<2@ntifl*1Jistik>
	pos	n.
	def	an antiphlogistic agent or drug.
antiphon	ety	C15: from Late Latin antiph*_ona sung responses, from Late Greek, plural of antiph*_onon (something) responsive, from antiph*_onos, from #7anti -#7+ ph*_on*_e sound
antiphon	1.
	syl	an:ti+phon
	pron	<1@ntif*n>
	pos	n.
	def	a short passage, usually from the Bible, recited or sung as a response after certain parts of a liturgical service.
antiphon	2.
	syl	an:ti+phon
	pron	<1@ntif*n>
	pos	n.
	def	a psalm, hymn, etc., chanted or sung in alternate parts.
antiphon	3.
	syl	an:ti+phon
	pron	<1@ntif*n>
	pos	n.
	def	any response or answer.
antiphonal	1.
	syl	an+tiph:o+nal
	pron	<@n1tif*n*l>
	pos	adj.
	def	sung or recited in alternation.
antiphonal	2.
	syl	an+tiph:o+nal
	pron	<@n1tif*n*l>
	pos	n.
	def	another word for {antiphonary}.
antiphonally	sub
	head	antiphonal
	syl	an+1tiph:o+nal+ly
	pos	adv.
antiphonaries	infl
	head	antiphonary
	syl	an+tiph:o+nar:ies.
	pos	n.
	mod	pl.
antiphonary	1.
	syl	an+tiph:o+nar:y
	pron	<@n1tif*n*ri>
	pos	n.
	def	a bound collection of antiphons, esp. for use in the divine office.
antiphonary	2.
	syl	an+tiph:o+nar:y
	pron	<@n1tif*n*ri>
	pos	adj.
	def	of or relating to such a book.
antiphonies	infl
	head	antiphony
	syl	an+tiph:o+nies.
	pos	n.
	mod	pl.
antiphony	1.
	syl	an+tiph:o+ny
	pron	<@n1tif*ni>
	pos	n.
	def	the antiphonal singing of a musical composition by two choirs.
antiphony	2.
	syl	an+tiph:o+ny
	pron	<@n1tif*ni>
	pos	n.
	def	any musical or other sound effect that answers or echoes another.
antiphrasis	ety	C16: via Late Latin from Greek, from #7anti -#7+ phrasis, from phrazein to speak
antiphrasis	0.
	syl	an+tiph+ra+sis
	pron	<@n1tifr*sis>
	pos	n.
	qual	Rhetoric.
	def	the use of a word in a sense opposite to its normal one, esp. for ironic effect.
antipodal	1.
	syl	an+tip:o+dal
	pron	<@n1tip*dL>
	pos	adj.
	def	of or relating to diametrically opposite points on the earth's surface.
antipodal	2.
	syl	an+tip:o+dal
	pron	<@n1tip*dL>
	pos	adj.
	def	exactly or diametrically opposite.
antipode	0.
	syl	an:ti+pode
	pron	<1@ntip*ud>
	pos	n.
	def	the exact or direct opposite.
antipodes	ety	C16: via Late Latin from Greek, plural of antipous having the feet opposite, from #7anti -#7+ pous foot &- an+tip@.o+de@.an (@an@!t$Ip$$#!di$:$$n) adj.
antipodes	1.
	syl	an+tip:o+des
	pron	<@n1tip*2dEz>
	pos	n.
	mod	pl.
	def	either or both of two points, places, or regions that are situated diametrically opposite to one another on the earth's surface, esp. the country or region opposite one's own.
antipodes	2.
	syl	an+tip:o+des
	pron	<@n1tip*2dEz>
	pos	n.
	mod	pl.
	def	the people who live there.
anthe	infl
	head	antipodes
	syl	an+the.
	pos	n.
antipodes	3.
	syl	an+tip:o+des
	pron	<@n1tip*2dEz>
	pos	n.
	mod	pl.
	def	Australia and New Zealand.
antipodes	4.
	syl	an+tip:o+des
	pron	<@n1tip*2dEz>
	pos	n.
	mod	sometimes functioning as; sing.
	def	the exact or direct opposite.
Anthe	infl
	head	Antipodes
	syl	An+the.
	pos	n.
Antipodes	0.
	syl	An+tip:o+des
	pron	<@n1tip*2dEz>
	pos	n.
	mod	pl.
	def	a group of small un?!inhabited islands in the South Pacific, southeast of and belonging to New Zealand. Area: 62 sq. km (24 sq. miles).
antipope	0.
	syl	an:ti+pope
	pron	<1@nti2p*up>
	pos	n.
	def	a rival pope elected in opposition to one who has been canonically chosen.
antiproton	0.
	syl	an:ti+pro+ton
	pron	<1@nti2pr*uton>
	pos	n.
	def	the antiparticle of the proton; a particle having the same mass as the proton but an equal and opposite charge.
antipsychiatry	0.
	syl	an:ti+psy+chi:a+try
	pron	<2@ntisI1kI*tri>
	pos	n.
	def	an approach to mental disorders that makes use of concepts derived from existentialism, psychoanalysis, and sociological theory.
antipyretic	1.
	syl	an:ti+py+ret+ic
	pron	<2@ntipI1retik>
	pos	adj.
	def	preventing or alleviating fever. {~}
antipyretic	2.
	syl	an:ti+py+ret+ic
	pron	<2@ntipI1retik>
	pos	adj.
	def	an antipyretic remedy or drug.
antipyresis	sub
	head	antipyretic
	syl	an:ti+py+re:sis
	pron	<2@ntipI1rEsis>
	pos	n.
antipyrine	0.
	syl	an:ti+py+rine
	pron	<2@nti1pIrin>, <-rEn>
	pos	n.
	def	a white powder used medicinally to reduce pain and fever. Formula: C\1\1H\1\2N\2O.
antiq	1.
	syl	antiq.
	qual	abbrev. for:
	def	antiquarian.
antiq	2.
	syl	antiq.
	qual	abbrev. for:
	def	antiquity.
antiquarian	1.
	syl	an:ti+quar+i:an
	pron	<2@nti1kwe*ri*n>
	pos	adj.
	def	concerned with the study of antiquities or antiques.
antiquarian	2.
	syl	an:ti+quar+i:an
	pron	<2@nti1kwe*ri*n>
	pos	n.
	def	the largest size of handmade drawing paper, 53#M31 inches.
antiquarian	3.
	syl	an:ti+quar+i:an
	pron	<2@nti1kwe*ri*n>
	pos	n.
	def	a less common name for {antiquary}.
antiquarianism	sub
	head	antiquarian
	syl	an:ti+1quar:i+an+ism
	pos	n.
antiquaries	infl
	head	antiquary
	syl	an:ti+quar:ies.
	pos	n.
	mod	pl.
antiquary	0.
	syl	an:ti+quar:y
	pron	<1@nti2kweri>
	pos	n.
	def	a person who collects, deals in, or studies antiques, ancient works of art, or ancient times. Also called: {antiquarian}.
antiquate	ety	C15: from Latin ant*_iqu*_are to make old, from ant*_iquus ancient
antiquate	1.
	syl	an:ti+quate
	pron	<1@nti2kwAt>
	pos	vb.
	mod	tr.
	def	to make obsolete or old-fashioned.
antiquate	2.
	syl	an:ti+quate
	pron	<1@nti2kwAt>
	pos	vb.
	mod	tr.
	def	to give an old or antique appearance to.
antiquated	1.
	syl	an:ti+quat+ed
	pron	<1@nti2kwAtid>
	pos	adj.
	def	outmoded; obsolete.
antiquated	2.
	syl	an:ti+quat+ed
	pron	<1@nti2kwAtid>
	pos	adj.
	def	aged; ancient.
antiquatedness	sub
	head	antiquated
	syl	an:ti+2quat+ed+ness
	pos	n.
antique	ety	C16: from Latin ant*_iquus ancient, from ante before
antique	1.a.
	syl	an+tique
	pron	<@n1tEk>
	pos	n.
	def	a decorative object, piece of furniture, or other work of art created in an earlier period, that is collected and valued for its beauty, workmanship, and age.
antique	1.b.
	syl	an+tique
	pron	<@n1tEk>
	pos	n.
	usage	as modifier
	exam	1	an antique shop.
antique	2.
	syl	an+tique
	pron	<@n1tEk>
	pos	n.
	def	any object made in an earlier period.
anthe	3.
	head	antique
	syl	an+the.
	def	the style of ancient art, esp. Greek or Roman art, or an example of it.
antique	4.
	syl	an+tique
	pron	<@n1tEk>
	pos	n.
	qual	Printing.
	def	a family of typefaces having all lines of nearly equal thickness.
antique	5.
	syl	an+tique
	pron	<@n1tEk>
	pos	adj.
	def	made in or in the style of an earlier period.
antique	6.
	syl	an+tique
	pron	<@n1tEk>
	pos	adj.
	def	of or belonging to the distant past, esp. of or in the style of ancient Greece or Rome.
antique	7.
	syl	an+tique
	pron	<@n1tEk>
	pos	adj.
	qual	Informal.
	def	old-fashioned; out-of-date.
antique	8.
	syl	an+tique
	pron	<@n1tEk>
	pos	adj.
	qual	Archaic.
	def	aged or venerable.
antique	9.
	syl	an+tique
	pron	<@n1tEk>
	pos	adj.
	usage	of paper
	def	not calendered or coated; having a rough surface.
antique	10.
	syl	an+tique
	pron	<@n1tEk>
	pos	vb.
	mod	tr.
	def	to give an antique appearance to.
antiquities	0.
	syl	an+tiq+ui:ties
	pron	<@n1tikwitiz>
	pos	n.
	mod	pl.
	def	remains or relics, such as statues, buildings, or coins, that date from ancient times.
antiquities	infl
	head	antiquity
	syl	an+tiq+ui:ties.
	pos	n.
	mod	pl.
antiquity	1.
	syl	an+tiq+ui:ty
	pron	<@n1tikwiti>
	pos	n.
	def	the quality of being ancient or very old.
	exam	1	a vase of great antiquity.
antiquity	2.
	syl	an+tiq+ui:ty
	pron	<@n1tikwiti>
	pos	n.
	def	the far distant past, esp. the time preceding the Middle Ages in Europe.
antiquity	3.
	syl	an+tiq+ui:ty
	pron	<@n1tikwiti>
	pos	n.
	def	the people of ancient times collectively; the ancients.
antirachitic	1.
	syl	an:ti+ra+chit+ic
	pron	<2@ntir*1kitik>
	pos	adj.
	def	preventing or curing rickets. {~}
antirachitic	2.
	syl	an:ti+ra+chit+ic
	pron	<2@ntir*1kitik>
	pos	adj.
	def	an antirachitic remedy or agent.
Antiremonstrant	0.
	syl	An:ti+re:mon+strant
	pron	<2@ntiri1monstr*nt>
	pos	n.
	qual	Dutch Reformed Church.
	def	the party that opposed the Remonstrants.
antirrhinum	ety	C16: via Latin from Greek antirrhinon, from #7anti - (imitating)#7+ rhis nose; so called from a fancied likeness to an animal's snout
antirrhinum	0.
	syl	an+tir+rhi+num
	pron	<2@nti1rIn*m>
	pos	n.
	def	any scrophulariaceous plant of the genus esp. the snapdragon, which have two-lipped flowers of various colours.
Antisana	0.
	syl	An+ti+sa+na
	pron	Spanish <2anti1sana>
	pos	n.
	def	a volcano in N central Ecuador, in the Andes. Height: 5756 m (18885 ft.).
antiscorbutic	1.
	syl	an:ti+scor+bu+tic
	pron	<2@ntiskc:1bju:tik>
	pos	adj.
	def	preventing or curing scurvy.
antiscorbutic	2.
	syl	an:ti+scor+bu+tic
	pron	<2@ntiskc:1bju:tik>
	pos	n.
	def	an antiscorbutic remedy or agent.
anti-Semite	0.
	syl	an:ti-Sem:ite
	pos	n.
	def	a person who persecutes or discriminates against Jews.
anti-Semitic	sub
	head	anti-Semite
	syl	an:ti-Se:1mit:ic
	pos	adj.
anti-Semitically	sub
	head	anti-Semite
	syl	an:ti-Se:1mit:i+cal+ly
	pos	adv.
anti-Semitism	sub
	head	anti-Semite
	syl	an:ti-1Sem:i:tism
	pos	n.
antisepsis	1.
	syl	an:ti+sep+sis
	pron	<2@nti1sepsis>
	pos	n.
	def	destruction of undesirable microorganisms, such as those that cause disease or putrefaction. Compare {asepsis}.
antisepsis	2.
	syl	an:ti+sep+sis
	pron	<2@nti1sepsis>
	pos	n.
	def	the state or condition of being free from such microorganisms.
antiseptic	1.
	syl	an:ti+sep+tic
	pron	<2@nti1septik>
	pos	adj.
	def	of, relating to, or affecting antisepsis.
antiseptic	2.
	syl	an:ti+sep+tic
	pron	<2@nti1septik>
	pos	adj.
	def	entirely free from contamination.
antiseptic	3.
	syl	an:ti+sep+tic
	pron	<2@nti1septik>
	pos	adj.
	qual	Informal.
	def	lacking spirit or excitement; clinical.
antiseptic	4.
	syl	an:ti+sep+tic
	pron	<2@nti1septik>
	pos	n.
	def	an antiseptic agent or substance.
antiseptically	sub
	head	antiseptic
	syl	an:ti+1sep+ti+cal+ly
	pos	adv.
antiserums	infl
	head	antiserum
	or	antisera
	syl	an:ti+se:rums
	pron	<-r*>
	pos	n.
	mod	pl.
antisera	infl
	head	antiserum
	or	antiserums
	syl	an:ti+se:ra
	pron	<-r*>
	pos	n.
	mod	pl.
antiserum	0.
	syl	an:ti+se:rum
	pron	<2@nti1si*r*m>
	pos	n.
	def	blood serum containing antibodies against a specific antigen, used to treat or provide immunity to a disease.
antislavery	0.
	syl	an:ti+slav+er:y
	pron	<2@nti1slAv*ri>
	pos	adj.
	def	opposed to slavery, esp. Negro slavery.
antisocial	1.
	syl	an:ti+so+cial
	pron	<2@nti1s*uS*l>
	pos	adj.
	def	avoiding the company of other people; unsociable.
antisocial	2.
	syl	an:ti+so+cial
	pron	<2@nti1s*uS*l>
	pos	adj.
	def	contrary or injurious to the interests of society in general.
antisocially	sub
	head	antisocial
	syl	an:ti+1so+cial+ly
	pos	adv.
antispasmodic	1.
	syl	an:ti+spas+mod+ic
	pron	<2@ntisp@z1modik>
	pos	adj.
	def	preventing or arresting spasms.
antispasmodic	2.
	syl	an:ti+spas+mod+ic
	pron	<2@ntisp@z1modik>
	pos	n.
	def	an antispasmodic drug.
antistatic	0.
	syl	an:ti+stat+ic
	pron	<2@nti1st@tik>
	pos	adj.
	usage	of a substance, textile, etc.
	def	retaining sufficient moisture to provide a conducting path, thus avoiding the effects of static electricity.
Antisthenes	0.
	syl	An:tis:the:nes
	pron	<@n1tisT*2nEz>
	pos	n.
	def	??445-365 #7b.c., Greek philosopher, founder of the Cynic school, who taught that the only good was virtue, won by self-control and independence from worldly needs.
antistrophe	ety	C17: via Late Latin from Greek antistroph*_e an answering turn, from #7anti -#7+ stroph*_e a turning
antistrophe	1.a.
	syl	an+tis+tro+phe
	pron	<@n1tistr*fi>
	pos	n.
	def	the second of two movements made by a chorus during the performance of a choral ode.
antistrophe	1.b.
	syl	an+tis+tro+phe
	pron	<@n1tistr*fi>
	pos	n.
	def	the second part of a choral ode sung during this movement.
antistrophe	2.
	syl	an+tis+tro+phe
	pron	<@n1tistr*fi>
	pos	n.
	usage	in classical prosody
	def	the second of two metrical systems used alternately within a poem. {~} See {strophe}.
antistrophic	sub
	head	antistrophe
	syl	an:ti+stroph+ic
	pron	<2@nti1strofik>
	pos	adj.
antistrophically	sub
	head	antistrophe
	syl	an:ti+1stroph:i+cal+ly
	pos	adv.
antitank	0.
	syl	an:ti+tank
	pron	<2@nti1t@Gk>
	pos	adj.
	def	designed to immobilize or destroy armoured vehicles.
	exam	1	antitank weapons.
antithesis	ety	C15: via Latin from Greek: a setting against, from #7anti -#7+ tithenai to place
antitheses	infl
	head	antithesis
	syl	an+tith+e:ses
	pron	<-2sEz>
	pos	n.
	mod	pl.
antithesis	1.
	syl	an+tith+e:sis
	pron	<@n1tiTisis>
	pos	n.
	def	the exact opposite.
antithesis	2.
	syl	an+tith+e:sis
	pron	<@n1tiTisis>
	pos	n.
	def	contrast or opposition.
antithesis	3.
	syl	an+tith+e:sis
	pron	<@n1tiTisis>
	pos	n.
	qual	Rhetoric.
	def	the juxtaposition of contrasting ideas, phrases, or words so as to produce an effect of balance, such as
antithesis	4.
	syl	an+tith+e:sis
	pron	<@n1tiTisis>
	pos	n.
	qual	Philosophy.
	def	the second stage in the {Hegelian dialectic}.
antithetic	alt
	head	antithetical
	or	antithetical
	syl	an:ti+thet+ic
	pos	adj.
antithetical	1.
	or	antithetic
	syl	an:ti+thet:i+cal
	pron	<2@nti1TetikL>
	pos	adj.
	def	of the nature of antithesis.
antithetical	2.
	or	antithetic
	syl	an:ti+thet:i+cal
	pron	<2@nti1TetikL>
	pos	adj.
	def	directly contrasted.
antitoxin	1.
	syl	an:ti+tox+in
	pron	<2@nti1toksin>
	pos	n.
	def	an antibody that neutralizes a toxin.
antitoxin	2.
	syl	an:ti+tox+in
	pron	<2@nti1toksin>
	pos	n.
	def	blood serum that contains a specific antibody. &- {@!an@.ti+#!tox+ic}
antitrades	0.
	syl	an:ti+trades
	pron	<1@nti2trAdz>
	pos	n.
	mod	pl.
	def	winds in the upper atmosphere blowing in the opposite direction from and above the trade winds.
antitragus	ety	C19: from New Latin, from Greek antitragos; see #7anti -, #7tragus 
antitragi	infl
	head	antitragus
	syl	an+tit+ra+gi
	pron	<-2JI>
	pos	n.
	mod	pl.
antitragus	0.
	syl	an+tit+ra+gus
	pron	<@n1titr*g*s>
	pos	n.
	def	a cartilaginous projection of the external ear opposite the tragus.
antitrust	0.
	syl	an:ti+trust
	pron	<2@nti1tr^st>
	pos	n.
	qual	Chiefly U.S.
	usage	modifier
	def	regulating or opposing trusts, monopolies, cartels, or similar organizations, esp. in order to prevent unfair competition.
antitussive	1.
	syl	an:ti+tus+sive
	pron	<2@nti1t^siv>
	pos	adj.
	def	alleviating or suppressing coughing. {~}
antitussive	2.
	syl	an:ti+tus+sive
	pron	<2@nti1t^siv>
	pos	adj.
	def	an antitussive drug.
antitype	1.
	syl	an:ti+type
	pron	<1@nti2tIp>
	pos	n.
	def	a person or thing that is foreshadowed or represented by a type or symbol, esp. a character or event in the New Testament prefigured in the Old Testament.
antitype	2.
	syl	an:ti+type
	pron	<1@nti2tIp>
	pos	n.
	def	an opposite type.
antitypic	sub
	head	antitype
	or	antitypical
	syl	an:ti+typ+ic
	pron	<2@nti1tipik>
	pos	adj.
antitypical	sub
	head	antitype
	or	antitypic
	syl	an:ti+1typ:i+cal
	pos	adj.
antitypically	sub
	head	antitype
	syl	an:ti+1typ:i+cal+ly
	pos	adv.
antivenin	ety	C19: from #7anti -#7+ ven (#7om) #7+ -#7in 
antivenin	0.
	syl	an:ti+ven+in
	pron	<2@nti1venin>
	pos	n.
	def	an antitoxin that counteracts a specific venom, esp. snake venom.
antiworld	0.
	syl	an:ti+world
	pron	<1@nti2wR:ld>
	pos	n.
	def	a hypothetical or supposed world or universe composed of antimatter.
antler	ety	C14: from Old French antoillier, from Vulgar Latin anteoculare (unattested) (something) in front of the eye
antler	0.
	syl	ant+ler
	pron	<1@ntl*>
	pos	n.
	def	one of a pair of bony outgrowths on the heads of male deer and some related species of either sex. The antlers are shed each year and grow more branches as the animal ages.
antler moth	0.
	syl	ant+ler moth
	pos	n.
	def	a European noctuid moth, (or that has white antler-like markings on the forewings and produces larvae that periodically cause great damage to pastures and grasslands.
Antlia	ety	C19: from Latin, from Greek: bucket
Antliae	infl
	head	Antlia
	syl	Ant+li:ae
	pron	<1@ntli2E>
	pos	n.
	qual	Latin genitive
Antlia	0.
	syl	Ant+li:a
	pron	<1@ntli*>
	pos	n.
	def	a faint constellation in the S hemisphere close to Hydra and Vela.
antlion	1.
	syl	ant+li+on
	pron	<1@nt2lI*n>
	pos	n.
	def	Also called: {antlion fly}. any of various neuropterous insects of the family which typically resemble dragonflies and are most common in tropical regions.
antlion	2.
	syl	ant+li+on
	pron	<1@nt2lI*n>
	pos	n.
	def	Also called (U.S.): {doodlebug}. the larva of this insect, which has very large jaws and buries itself in the sand to await its prey.
Antofagasta	0.
	syl	An+to+fa+gas+ta
	pron	<2@nt*f*1g@st*>, Spanish <2antofa1$Gasta>
	pos	n.
	def	a port in N Chile. Pop.: 149720 (1975 est.).
Antoinette	0.
	syl	An:toi:nette
	pron	French <?~atwa1net>
	pos	n.
	def	See {Marie Antoinette}.
Antoninus	0.
	syl	An:to:ni:nus
	pron	<2@nt*1nIn*s>
	pos	n.
	def	See {Marcus Aurelius Antoninus}.
Antoninus Pius	0.
	syl	An:to:ni:nus Pi:us
	pos	n.
	def	86-161 #7a.d., emperor of Rome (138-161); adopted son and successor of Hadrian.
Michelangelo	infl
	head	Antonioni
	syl	Mi:chel:an:ge:lo
	pron	<mikA1lanJA?!lo>
	pos	n.
Antonioni	0.
	syl	An:to:ni:o:ni
	pron	<2@nt*uni1*uni>
	pos	n.
	def	born 1912, Italian film director; his films include (1959), (1961), (1966), and (1970).
Marcus	infl
	head	Antonius
	syl	Mar:cus
	pron	<1ma:k*s>
	pos	n.
Antonius	0.
	syl	An:to:ni:us
	pron	<@n1t*uni*s>
	pos	n.
	def	Latin name of (Mark) {Antony}.
antonomasia	ety	C16: via Latin from Greek, from antonoma?!zein to name differently, from onoma name
antonomasia	1.
	syl	an+to+no+ma+si:a
	pron	<2@nt*n*1mAzi*>
	pos	n.
	qual	Rhetoric.
	def	the substitution of a title or epithet for a proper name, such as
antonomasia	2.
	syl	an+to+no+ma+si:a
	pron	<2@nt*n*1mAzi*>
	pos	n.
	qual	Rhetoric.
	def	the use of a proper name for an idea.
	exam	1	he is a Daniel come to judgment.
antonomastic	sub
	head	antonomasia
	syl	an+to+no+mas+tic
	pron	<2@nt*n*1m@stik>
	pos	adj.
antonomastically	sub
	head	antonomasia
	syl	an+to+no+1mas+ti+cal+ly
	pos	adv.
Mark	infl
	head	Antony
	syl	Mark.
	pos	n.
Antony	0.
	syl	An:to:ny
	pron	<1@nt*ni>
	pos	n.
	def	Latin name ??83-30 #7b.c., Roman general who served under Julius Caesar in the Gallic wars and became a member of the second triumvirate (43). He defeated Brutus and Cassius at Philippi (42) but having repudiated his wife for Cleopatra, queen of Egypt, he was defeated by his brother-in-law Octavian (Augustus) at Actium (31).
antonym	ety	C19: from Greek ant*_onumia, from #7anti -#7+ onoma name
antonym	0.
	syl	an+to+nym
	pron	<1@nt*nim>
	pos	n.
	def	a word that means the opposite of another word: @6 @9 @6 @9.
antonymous	sub
	head	antonym
	syl	an+ton:y+mous
	pron	<@n1tonim*s>
	pos	adj.
antre	ety	C17: from French, from Latin antrum, from Greek antron 
antre	0.
	syl	an+tre
	pron	<1@nt*>
	pos	n.
	qual	Rare.
	def	a cavern or cave.
Antrim	0.
	syl	An+trim
	pron	<1@ntrim>
	pos	n.
	def	a county of NE Northern Ireland: famous for the Giant's Causeway on the N coast. County town: Belfast. Pop.: 352549 (1971). Area: 2843 sq. km (1098 sq. miles).
antrorse	ety	C19: from New Latin antrorsus, from antero- front+ -orsus, as in Latin introrsus; see #7introrse 
antrorse	0.
	syl	an+trorse
	pron	<@n1trc:s>
	pos	adj.
	qual	Biology.
	def	directed or pointing upwards or forwards.
antrorsely	sub
	head	antrorse
	syl	an+1trorse+ly
	pos	adv.
antrum	ety	C14: from Latin: cave, from Greek antron  &- #!an+tral adj.
antra	infl
	head	antrum
	syl	an+tra
	pron	<-tr*>
	pos	n.
	mod	pl.
antrum	0.
	syl	an+trum
	pron	<1@ntr*m>
	pos	n.
	qual	Anatomy.
	def	a natural cavity, hollow, or sinus, esp. in a bone.
Antung	0.
	syl	An+tung
	pron	<1@n1tuG>
	pos	n.
	def	a port in E China, in Liaoning province at the mouth of the Yalu River. Pop.: 360000 (1953).
Antwerp	1.
	syl	Ant+werp
	pron	<1@ntwR:p>
	pos	n.
	def	a province of N Belgium. Pop.: 1559269 (1975 est.). Area: 2859 sq. km (1104 sq. miles).
Antwerp	2.
	syl	Ant+werp
	pron	<1@ntwR:p>
	pos	n.
	def	a port in N Belgium, capital of Antwerp province, on the River Scheldt: a major European port. Pop.: 224543 (1970). Flemish name: {Ant+werp+en} (#!$antw$erp$$). French name: {Anvers}.
ANU	0.
	syl	A.N.U.
	qual	abbrev. for
	def	Australian National University.
Anu	0.
	syl	A:nu
	pron	<1a:nu:>
	pos	n.
	qual	Babylonian myth.
	def	the sky god.
Anubis	0.
	syl	A:nu:bis
	pron	<*1nju:bis>
	pos	n.
	qual	Egyptian myth.
	def	a deity, a son of Osiris, who conducted the dead to judgment. He is represented as having a jackal's head and was identified by the Greeks with Hermes.
Anuradhapura	0.
	syl	A:nu+ra+dha+pu+ra
	pron	<*1nu*r*d*2pu*r*>, <2^nu1ra:d*->
	pos	n.
	def	a town in Sri Lanka: ancient capital of Ceylon; site of the sacred bo tree and place of pilgrimage for Buddhists. Pop.: 35000 (1971).
anuran	ety	C20: from New Latin Anura, from #7an -#7+ Greek oura tail
anuran	1.
	syl	a:nu+ran
	pron	<*1nju*r*n>
	pos	n.
	def	any of the vertebrates of the order (or characterized by absence of a tail and very long hind legs specialized for hopping: class (amphibians). The group includes the frogs and toads.
anuran	2.
	syl	a:nu+ran
	pron	<*1nju*r*n>
	pos	adj.
	def	of, relating to, or belonging to the order
anuran	xref
	syl	a:nu+ran
	pron	<*1nju*r*n>
	pos	n.
	def	Also: {salientian}.
anuresis	ety	C20: New Latin, from #7an -#7+ Greek ouresis urination, from ouron urine
anuresis	0.
	syl	an:u+re:sis
	pron	<2@nju1rEsis>
	pos	n.
	qual	Pathol.
	def	inability to urinate even though urine is formed by the kidneys and retained in the urinary bladder. Compare {anuria}.
anuria	ety	C19: from New Latin, from #7an -#7+ Greek ouron urine
anuria	0.
	syl	an:u+ri:a
	pron	<*1nju*ri*>
	pos	n.
	qual	Pathol.
	def	complete suppression of urine formation, often as the result of a kidney disorder. Compare {anuresis, oliguria}.
anurous	ety	C19: from #7an -#7+ Greek oura tail
anurous	0.
	syl	a:nu+rous
	pron	<@1nju*r*s>
	pos	adj.
	qual	Zoology.
	def	lacking a tail; tailless; acaudate.
anus	ety	C16: from Latin
anus	0.
	syl	a:nus
	pron	<1An*s>
	pos	n.
	def	the excretory opening at the end of the alimentary canal.
Anvers	0.
	syl	An+vers
	pron	<?~a1ver>
	pos	n.
	def	the French name for {Antwerp}.
anvil	ety	Old English anfealt; related to Old High German anafalz, Middle Dutch anvilte; see #7on, felt %2
anvil	1.
	syl	an+vil
	pron	<1@nvil>
	pos	n.
	def	a heavy iron or steel block on which metals are hammered during forging.
anvil	2.
	syl	an+vil
	pron	<1@nvil>
	pos	n.
	def	any part having a similar shape or function, such as the lower part of a telegraph key.
anvil	3.
	syl	an+vil
	pron	<1@nvil>
	pos	n.
	def	the fixed jaw of a measurement device against which the piece to be measured is held.
anvil	4.
	syl	an+vil
	pron	<1@nvil>
	pos	n.
	qual	Anatomy.
	def	the nontechnical name for {incus}.
anxiety	ety	C16: from Latin anxietas; see #7anxious 
anxieties	infl
	head	anxiety
	syl	anx:i+e:ties.
	pos	n.
	mod	pl.
anxiety	1.
	syl	anx:i+e:ty
	pron	<@G1zIiti>
	pos	n.
	def	a state of uneasiness or tension caused by apprehension of possible future misfortune, danger, etc.; worry.
anxiety	2.
	syl	anx:i+e:ty
	pron	<@G1zIiti>
	pos	n.
	def	intense desire; eagerness.
anxiety	3.
	syl	anx:i+e:ty
	pron	<@G1zIiti>
	pos	n.
	qual	Psychol.
	def	an intense state of apprehension or worry occurring in a variety of nervous and mental disorders. See also {angst}.
anxious	ety	C17: from Latin anxius; related to Latin angere to torment; see #7anger, anguish 
anxious	1.
	syl	anx+ious
	pron	<1@GkS*s>, <1@GS*s>
	pos	adj.
	def	worried and tense because of possible misfortune, danger, etc.; uneasy.
anxious	2.
	syl	anx+ious
	pron	<1@GkS*s>, <1@GS*s>
	pos	adj.
	def	fraught with or causing anxiety; worrying; distressing.
	exam	1	an anxious time.
anxious	3.
	syl	anx+ious
	pron	<1@GkS*s>, <1@GS*s>
	pos	adj.
	def	intensely desirous; eager.
	exam	1	anxious for promotion.
anxiously	sub
	head	anxious
	syl	anx+ious+ly
	pos	adv.
anxiousness	sub
	head	anxious
	syl	anx+ious+ness
	pos	n.
any	ety	Old English *_@anig; related to Old Frisian *_enig, Old High German einag, Old Norse einigr anyone, Latin *_unicus unique; see #7an %1#7, one 
any	1.a.
	syl	an:y
	pron	<1eni>
	pos	determiner.
	def	one, some, or several, as specified, no matter how much or many, what kind or quality, etc..
	exam	1	any cheese in the cupboard is yours;
	exam	2	you may take any clothes you like.
any	1.b.
	syl	an:y
	pron	<1eni>
	pos	determiner.
	mod	as pronoun; functioning as; sing. pl.
	exam	1	take any you like.
any	2.a.
	syl	an:y
	pron	<1eni>
	pos	determiner.
	def	even the smallest amount or even one.
	exam	1	I can't stand any noise.
any	2.b.
	syl	an:y
	pron	<1eni>
	pos	determiner.
	mod	as pronoun; functioning as; sing. pl.
	exam	1	don't give her any.
any	3.
	syl	an:y
	pron	<1eni>
	pos	determiner.
	def	whatever or whichever; no matter what or which.
	exam	1	any dictionary will do;
	exam	2	any time of day.
any	4.
	syl	an:y
	pron	<1eni>
	pos	determiner.
	def	an indefinite or unlimited (esp. in the phrases {any amount} or {number) }.
	exam	1	any number of friends.
any	5.a.
	syl	an:y
	pron	<1eni>
	pos	adv.
	usage	foll. by a comparative adj.
	def	to even the smallest extent.
	exam	1	it isn't any worse now.
any	5.b.
	syl	an:y
	pron	<1eni>
	pos	adv.
	qual	Not standard.
	def	at all.
	exam	1	he doesn't care any.
Anyang	0.
	syl	An+yang
	pron	<1a:n1ja:G>
	pos	n.
	def	a town in E China: archaeological site and capital of the Shang dynasty. Pop.: 124900 (1953).
anybody	1.
	syl	an:y+bod:y
	pron	<1eni2bodi>, <-b*di>
	pos	pron.
	def	any person; anyone.
anybody	2.
	syl	an:y+bod:y
	pron	<1eni2bodi>, <-b*di>
	pos	pron.
	usage	a question
	def	a person of any importance.
	exam	1	he isn't anybody in this town.
anybodies	infl
	head	anybody
	syl	an:y+bod:ies.
	pos	n.
	mod	pl.
anybody	3.
	syl	an:y+bod:y
	pron	<1eni2bodi>, <-b*di>
	pos	n.
	usage	often preceded by just
	def	any person at random; no matter who.
anyhow	1.
	syl	an:y+how
	pron	<1eni2hau>
	pos	adv.
	def	in any case; at any rate.
anyhow	2.
	syl	an:y+how
	pron	<1eni2hau>
	pos	adv.
	def	in any manner or by any means whatever.
anyhow	3.
	syl	an:y+how
	pron	<1eni2hau>
	pos	adv.
	def	in a haphazard manner; carelessly.
anyone	1.
	syl	an:y+one
	pron	<1eni2w^n>, <-w*n>
	pos	pron.
	def	any person; anybody.
anyone	2.
	syl	an:y+one
	pron	<1eni2w^n>, <-w*n>
	pos	pron.
	usage	a question
	def	a person of any impor?!tance.
	exam	1	is he anyone in this town??
anyone	3.
	syl	an:y+one
	pron	<1eni2w^n>, <-w*n>
	pos	pron.
	usage	often preceded by just
	def	any person at random; no matter who.
anyplace	0.
	syl	an:y+place
	pron	<1eni2plAs>
	pos	adv.
	qual	U.S. informal.
	def	in, at, or to any unspecified place.
anything	1.
	syl	an:y+thing
	pron	<1eni2TiG>
	pos	pron.
	def	any object, event, action, etc., whatever.
	exam	1	anything might happen.
anything	2.
	syl	an:y+thing
	pron	<1eni2TiG>
	pos	n.
	def	a thing of any kind.
	exam	1	have you anything to declare??
anything	3.
	syl	an:y+thing
	pron	<1eni2TiG>
	pos	adv.
	def	in any way.
	exam	1	he wasn't anything like his father.
anything but	4.
	head	anything
	syl	anything but.
	def	by no means; not in the least.
	exam	1	she was anything but happy.
anyway	1.
	syl	an:y+way
	pron	<1eni2wA>
	pos	adv.
	def	in any case; at any rate; nevertheless; anyhow.
anyway	2.
	syl	an:y+way
	pron	<1eni2wA>
	pos	adv.
	def	in a careless or haphazard manner.
anyway	3.
	syl	an:y+way
	pron	<1eni2wA>
	pos	adv.
	def	Usually {any way}. in any manner; by any means.
anyways	0.
	syl	an:y+ways
	pron	<1eni2wAz>
	pos	adv.
	qual	U.S.
	def	a nonstandard word for {anyway}.
anywhere	1.
	syl	an:y+where
	pron	<1eni2we*>
	pos	adv.
	def	in, at, or to any place.
get anywhere	2.
	head	anywhere
	syl	get anywhere.
	def	to be successful.
	exam	1	it took three years before he got anywhere.
anywhere from	3.
	head	anywhere
	syl	anywhere from.
	def	any quantity, time, degree, etc., above a specified limit.
	exam	1	he could be anywhere from 40 to 50 years old.
anywheres	0.
	syl	an:y+wheres
	pron	<1eni2we*z>
	pos	adv.
	qual	U.S.
	def	a nonstandard word for {anywhere}.
anywise	0.
	syl	an:y+wise
	pron	<1eni2wIz>
	pos	adv.
	qual	Chiefly U.S.
	def	in any way or manner; at all.
Anzac	1.
	syl	An+zac
	pron	<1@nz@k>
	pos	n.
	usage	in World War I
	def	a soldier serving with the Australian and New Zealand Army Corps.
Anzac	2.
	syl	An+zac
	pron	<1@nz@k>
	pos	n.
	usage	now
	def	any Australian or New Zealand soldier.
Anzac	3.
	syl	An+zac
	pron	<1@nz@k>
	pos	n.
	def	the Anzac landing at Gallipoli in 1915.
Anzac Day	0.
	syl	An+zac Day
	pos	n.
	def	25 April, a public holiday in Australia and New Zealand commemorating the Anzac landing at Gallipoli in 1915.
Anzio	0.
	syl	An+zi:o
	pron	<1@nzi2*u>, Italian <1antsjo>
	pos	n.
	def	a port and resort on the W coast of Italy: site of Allied landings in World War II. Pop.: 22927 (1971).
ANZUS	0.
	syl	ANZUS
	pron	<1@nz*s>
	pos	n.
	usage	acronym for
	def	Australia, New Zealand, and the United States, with reference to the security alliance between them.
ao	alt
	head	AO
	or	AO
	syl	a/o
AO	0.
	or	ao
	syl	A/O
	qual	abbrev. for
	usage	accounting, etc.
	def	account of.
AOB	alt
	head	aob
	or	aob
	syl	A.O.B.
aob	0.
	or	AOB
	syl	a.o.b.
	qual	abbrev. for
	def	any other business.
A-OK	ety	C20: from a(ll systems) OK 
A-okay	alt
	head	A-OK
	or	A-OK
	syl	A-o:kay
	pos	adj.
A-OK	0.
	or	A-okay
	syl	A-OK
	pos	adj.
	qual	Informal, chiefly U.S.
	def	in perfect working order; excellent.
Aorangi	0.
	syl	A:o:ran+gi
	pron	<2A*u1r@Ggi>
	pos	n.
	def	another name for Mount {Cook}.
aorist	ety	C16: from Greek aoristos not limited, from #7a -%1#7+ horistos restricted, from horizein to define
aorist	0.
	syl	a:o:rist
	pron	<1A*rist>, <1e*rist>
	pos	n.
	qual	Grammar.
	def	a tense of the verb in classical Greek and in certain other inflected languages, indicating past action without reference to whether the action involved was momentary or continuous. Compare { {perfect} (sense 8)}, { {imperfect} (sense 4)}.
aoristic	sub
	head	aorist
	syl	a:o:1ris+tic
	pos	adj.
aoristically	sub
	head	aorist
	syl	a:o:1ris+ti+cal+ly
	pos	adv.
aorta	ety	C16: from New Latin, from Greek aort*_e, literally: something lifted, from aeirein to raise
aortas	infl
	head	aorta
	or	aortae
	syl	a:or+tas
	pron	<-tE>
	pos	n.
	mod	pl.
aortae	infl
	head	aorta
	or	aortas
	syl	a:or+tae
	pron	<-tE>
	pos	n.
	mod	pl.
aorta	0.
	syl	a:or+ta
	pron	<A1c:t*>
	pos	n.
	def	the main vessel in the arterial network, which conveys oxygen-rich blood from the heart to all parts of the body except the lungs.
aortic	sub
	head	aorta
	or	aortal
	syl	a:1or+tic
	pos	adj.
aortal	sub
	head	aorta
	or	aortic
	syl	a:1or+tal
	pos	adj.
Aosta	0.
	syl	A:o:sta
	pron	Italian <a1csta>
	pos	n.
	def	a town in NW Italy, in Piedmont: Roman remains. Pop.: 36906 (1971).
aoudad	ety	from French, from Berber audad 
aoudad	0.
	syl	a:ou+dad
	pron	<1a:u2d@d>
	pos	n.
	def	a wild mountain sheep, of N Africa, having horns curved in a semicircle and long hair covering the neck and forelegs. Also called: {Barbary sheep}.
ap-	0.
	syl	ap-
	pos	prefix.
	def	variant of {apo-}.
	exam	1	aphelion.
ap	ety	Latin: before a meal
ap	1.
	syl	a.p.
	qual	abbrev. for:
	def	additional premium.
ap	2.
	syl	a.p.
	qual	abbrev. for:
	usage	in prescriptions, etc.
	def	ante prandium.
AP	1.
	syl	A.P.
	qual	abbrev. for:
	def	Air Police.
AP	2.
	syl	A.P.
	qual	abbrev. for:
	def	Associated Press.
apace	ety	C14: probably from Old French *`a pas, at a (good) pace
apace	0.
	syl	a:pace
	pron	<*1pAs>
	pos	adv.
	def	quickly; rapidly.
apache	ety	from French: A#7pache 
apache	0.
	syl	a:pache
	pron	<*1pa:S>, <-1p@S>, French <a1paS>
	pos	n.
	def	a Parisian gangster or ruffian.
Apache	ety	from Mexican Spanish, probably from Zu?~ni Apachu, literally: enemy
Apache	1.
	or	Apaches
	syl	A:pach:e
	pron	<*1p@Ci>
	pos	n.
	mod	pl.
	def	a member of a North American Indian people, formerly nomadic and warlike, inhabiting the southwestern U.S. and N Mexico.
Apache	2.
	syl	A:pach:e
	pron	<*1p@Ci>
	pos	n.
	def	the language of this people, belonging to the Athapascan group of the Na-Dene phylum.
apache dance	0.
	syl	a:pache dance
	pos	n.
	def	a fast violent dance in French vaudeville, supposedly between a Parisian gangster and his girl.
apagoge	ety	C18: from Greek apag*_og*_e a taking away, from agein to lead
apagoge	0.
	syl	ap:a+go+ge
	pron	<2@p*1g*uJi>
	pos	n.
	def	an indirect proof of a proposition, hypothesis, etc., by showing that its contrary is false, impossible, or absurd.
apagogic	sub
	head	apagoge
	or	apagogical
	syl	ap:a+gog+ic
	pron	<2@p*1goJik>
	pos	adj.
apagogical	sub
	head	apagoge
	or	apagogic
	syl	ap:a+1gog:i+cal
	pos	adj.
apagogically	sub
	head	apagoge
	syl	ap:a+1gog:i+cal+ly
	pos	adv.
apanage	0.
	syl	ap:a+nage
	pron	<1@p*niJ>
	pos	n.
	def	a variant spelling of {appanage}.
aparejo	ety	American Spanish: equipment, from aparejar to make ready; see #7apparel 
aparejos	infl
	head	aparejo
	syl	a:pa+re:jos
	pos	n.
	mod	pl.
Aparri	0.
	syl	A:par+ri
	pron	<@1pa:ri>
	pos	n.
	def	a port in the Philippines, on the N coast of Luzon. Pop.: 40307 (1970).
apart	ety	C14: from Old French a part at (the) side
apart	1.
	syl	a:part
	pron	<*1pa:t>
	pos	adj. postpositive; adv.
	def	to pieces or in pieces.
	exam	1	he had the television apart on the floor.
apart	2.
	syl	a:part
	pron	<*1pa:t>
	pos	adj. postpositive; adv.
	def	placed or kept separately or to one side for a particular purpose, reason, etc.; aside (esp. in the phrases {set} {put apart) }.
apart	3.
	syl	a:part
	pron	<*1pa:t>
	pos	adj. postpositive; adv.
	def	separate in time, place, or position; at a distance.
	exam	1	he stood apart from the group;
	exam	2	two points three feet apart.
apart	4.
	syl	a:part
	pron	<*1pa:t>
	pos	adj. postpositive; adv.
	def	not being taken into account; aside.
	exam	1	these difficulties apart, the project ran smoothly.
apart	5.
	syl	a:part
	pron	<*1pa:t>
	pos	adj. postpositive; adv.
	def	individual; distinct; separate.
	exam	1	a race apart.
apart	6.
	syl	a:part
	pron	<*1pa:t>
	pos	adj. postpositive; adv.
	def	separately or independently in use, thought, or function.
	exam	1	considered apart, his reasoning was faulty.
apart from	7.
	head	apart
	syl	apart from.
	pos	prep.
	def	besides; other than.
apart	xref
	syl	a:part
	pron	<*1pa:t>
	pos	adj. postpositive; adv.
	def	See also {take apart, tell apart}.
apartheid	ety	C20: Afrikaans, from apart #7apart+ -heid -#7hood 
apartheid	0.
	syl	a:part+heid
	pron	<*1pa:thIt>, <-hAt>
	pos	n.
	usage	in South Africa
	def	the official government policy of racial segregation.
apartment	ety	C17: from French appartement, from Italian appartamento, from appartare to set on one side, separate
apartment	1.
	syl	a:part+ment
	pron	<*1pa:tm*nt>
	pos	n.
	mod	often; pl.
	def	any room in a building, usually one of several forming a suite, esp. one that is spacious and well furnished and used as living accommodation, offices, etc.
apartment	2.a.
	syl	a:part+ment
	pron	<*1pa:tm*nt>
	pos	n.
	def	another name (esp. U.S.) for { {flat} %2 (sense 1)}.
apartment	2.b.
	syl	a:part+ment
	pron	<*1pa:tm*nt>
	pos	n.
	usage	as modifier
	exam	1	apartment building;
	exam	2	apartment house.
apatetic	ety	C19: from Greek apat*_etikos deceitful, from apateuein to deceive
apatetic	0.
	syl	ap:a+tet+ic
	pron	<2@p*1tetik>
	pos	adj.
	def	of or relating to coloration that disguises and protects an animal.
apathetic	ety	C18: from #7apathy+pathetic 
apathetic	0.
	syl	ap:a+thet+ic
	pron	<2@p*1Tetik>
	pos	adj.
	def	having or showing little or no emotion; indifferent.
apathetically	sub
	head	apathetic
	syl	ap:a+1thet:i+cal+ly
	pos	adv.
apathy	ety	C17: from Latin, from Greek apatheia, from apath*_es without feeling, from #7a -%1#7+ pathos feeling
apathy	1.
	syl	ap:a+thy
	pron	<1@p*Ti>
	pos	n.
	def	absence of interest in or enthusiasm for things generally considered interesting or moving.
apathy	2.
	syl	ap:a+thy
	pron	<1@p*Ti>
	pos	n.
	def	absence of emotion.
apatite	ety	C19: from German Apatit, from Greek apat*_e deceit; from its misleading similarity to other minerals
apatite	0.
	syl	ap:a+tite
	pron	<1@p*2tIt>
	pos	n.
	def	a common naturally occurring mineral consisting basically of calcium fluorophosphate or calcium chlorophosphate in hexagonal crystalline form. It is a source of phosphorus and is used in the manufacture of fertilizers. Formula: Ca\5(F,Cl,OH,@2CO\3)(PO\4)\3.
APC	0.
	syl	APC
	pos	n.
	def	acetylsalicylic acid, phenacetin, and caffeine; the mixture formerly used in headache and cold tablets.
ape	ety	Old English apa; related to Old Saxon ape, Old Norse api, Old High German affo 
ape	1.
	syl	ape
	pron	<Ap>
	pos	n.
	def	any of various primates, esp. those of the family (see {anthropoid ape) }, in which the tail is very short or absent.
ape	2.
	syl	ape
	pron	<Ap>
	pos	n.
	usage	not in technical use
	def	any monkey.
ape	3.
	syl	ape
	pron	<Ap>
	pos	n.
	def	an imitator; mimic.
ape	4.
	syl	ape
	pron	<Ap>
	pos	n.
	qual	U.S. informal.
	def	a coarse, clumsy, or rude person.
ape	5.
	syl	ape
	pron	<Ap>
	pos	vb.
	mod	tr.
	def	to imitate.
apelike	sub
	head	ape
	syl	ape+2like
	pos	adj.
apeak	0.
	syl	a:peak
	pron	<*1pEk>
	pos	adv. adj.
	qual	Nautical.
	def	in a vertical or almost vertical position.
	exam	1	with the oars apeak.
Apeldoorn	0.
	syl	A:pel+doorn
	pron	<1@pL2dc:n>, Dutch <1a:p*ldo:rn>
	pos	n.
	def	a town in the Netherlands, in central Gelderland province: nearby is the summer residence of the Dutch royal family. Pop.: 131768 (1974 est.).
Apelles	0.
	syl	A:pel:les
	pron	<*1pelEz>
	pos	n.
	def	4th century #7b.c., Greek painter of mythological subjects, none of whose work survives, his fame resting on the testimony of Pliny and other writers.
apemen	infl
	head	apeman
	syl	ape+men.
	pos	n.
	mod	pl.
apeman	0.
	syl	ape+man
	pron	<1Ap2m@n>
	pos	n.
	def	any of various extinct apelike primates thought to have been the forerunners, or closely related to the forerunners, of modern man.
Apennines	1.
	syl	Ap+en+nines
	pron	<1@p*2nInz>
	pos	n.
	mod	pl.
	def	a mountain range in Italy, extending over 1250 km (800 miles) from the northwest to the southernmost tip of the peninsula. Highest peak: Monte Corno, 2912 m (9554 ft.).
Apennines	2.
	syl	Ap+en+nines
	pron	<1@p*2nInz>
	pos	n.
	mod	pl.
	def	a mountain range lying in the N quadrants of the moon, extending over 950 km along the SE border of the Mare Imbrium and rising to 6200 m.
apercu	ety	from apercevoir to #7perceive 
apercu	1.
	syl	a:per+*,cu
	pron	French. <aper1sy>
	pos	n.
	def	an outline; summary.
apercu	2.
	syl	a:per+*,cu
	pron	French. <aper1sy>
	pos	n.
	def	an insight.
aperient	ety	C17: from Latin aper*_ire to open
	infl
	head	aperient
	syl	~
	pos	adj.
	qual	Med.
aperient	1.
	syl	a:per:i+ent
	pron	<*1pi*ri*nt>
	pos	adj.
	def	laxative.
aperient	2.
	syl	a:per:i+ent
	pron	<*1pi*ri*nt>
	pos	n.
	def	a mild